59 Commits

Author SHA1 Message Date
Jake Stanger
3b04642148 chore(release): v0.7.0 2022-11-05 17:33:36 +00:00
Jake Stanger
0a331f3138 docs(readme): remove warning about outdated cargo package 2022-11-05 17:33:02 +00:00
Jake Stanger
bc625b929b refactor: clippy & fmt 2022-11-05 17:32:42 +00:00
Jake Stanger
ad77dc4e4c feat: improved logging & error handling 2022-11-05 17:32:29 +00:00
Jake Stanger
3a83bd31ab fix: able to insert duplicate keys into collection
This replaces the custom `Collection` implementation with `IndexMap` from the crate of the same name.

Fixes #28.
2022-11-05 17:32:01 +00:00
Jake Stanger
5ebc84c7b9 refactor(logging): consts for default log levels 2022-11-05 17:29:17 +00:00
Jake Stanger
51d1cd4a16 build: update deps 2022-11-01 22:56:47 +00:00
Jake Stanger
b7792a415e feat: env var to set custom css location
Set `IRONBAR_CSS` to load CSS from that path instead of regular path.
2022-11-01 13:25:46 +00:00
Jake Stanger
9f82ba58cd chore: cleanup println 2022-10-23 17:18:49 +01:00
Jake Stanger
a93700e8fd Merge pull request #27 from JakeStanger/feat/custom-widget
feat: new custom module
2022-10-23 17:11:17 +01:00
Jake Stanger
2a3fe33446 build: remove no longer required patch, reduce build times 2022-10-23 17:01:35 +01:00
Jake Stanger
3750124d8c feat: new custom module
Allows basic modules to be created from a config object, including popup content.
2022-10-23 17:01:35 +01:00
Jake Stanger
e693c1c166 fix(mpd): volume slider causing mpd server errors 2022-10-16 22:23:40 +01:00
Jake Stanger
cbd0c49e25 fix: css watcher not working 2022-10-16 22:21:51 +01:00
Jake Stanger
e23e691bc6 build: use latest release version of stray 2022-10-16 16:44:51 +01:00
Jake Stanger
be0f4c6366 chore: run fmt 2022-10-16 16:44:32 +01:00
Jake Stanger
493df6bb49 feat(mpd): add volume slider to popup 2022-10-16 16:00:18 +01:00
Jake Stanger
b4ac1c9850 Merge pull request #26 from JakeStanger/feat/sysinfo-tokens
Add loads more tokens & interval options to `sysinfo`, optimise info refreshing
2022-10-16 14:04:11 +01:00
Jake Stanger
27f6abad67 chore: format and fix clippy warnings 2022-10-16 13:54:48 +01:00
Jake Stanger
ec1d59677b feat(logging): IRONBAR_LOG and IRONBAR_FILE_LOG env vars 2022-10-16 13:42:59 +01:00
Jake Stanger
70e1b526a9 fix(logging): file log not capturing panics 2022-10-16 13:42:35 +01:00
Jake Stanger
3c43c20c6a fix: weird behaviour when config does not exist 2022-10-16 12:58:11 +01:00
Jake Stanger
b66bd788b2 fix: logging for creating bar incorrect still 2022-10-16 12:57:37 +01:00
Jake Stanger
f17ae7a415 fix(script): not parsing pango markup 2022-10-16 12:56:39 +01:00
Jake Stanger
a06c4bccca docs(examples): add full system info config 2022-10-16 01:03:36 +01:00
Jake Stanger
e4e72d8008 style(sys-info): fix clippy warnings & run fmt 2022-10-16 01:03:20 +01:00
Jake Stanger
9e6dbbd131 fix(sys-info): tokens not replaced if more than one in string 2022-10-16 01:00:43 +01:00
Jake Stanger
91c57edc73 feat(sys-info): pango markup support 2022-10-16 01:00:14 +01:00
Jake Stanger
dec402edd9 feat(sys-info): config options for refresh intervals 2022-10-16 00:59:28 +01:00
Jake Stanger
fad90fdad6 feat(sys-info): add loads more formatting tokens 2022-10-16 00:58:47 +01:00
Jake Stanger
35ce3b4d45 chore: use cargo patch block 2022-10-16 00:56:47 +01:00
Jake Stanger
27d04795af docs(readme): add warning about crate being outdated 2022-10-15 18:51:45 +01:00
JakeStanger
9d9c275313 docs: update CHANGELOG.md for v0.6.0 [skip ci] 2022-10-15 17:27:37 +00:00
Jake Stanger
0669504519 chore(release): v0.6.0 2022-10-15 18:26:51 +01:00
Jake Stanger
eb5170ff6a style: run fmt 2022-10-15 18:08:56 +01:00
Jake Stanger
b7b64886e3 fix: sometimes panicking on startup 2022-10-15 18:01:09 +01:00
Jake Stanger
75339f07ed fix: vertical bars ignoring height config option 2022-10-15 16:35:31 +01:00
Jake Stanger
06cfad62e2 feat: more positioning options (#23)
* feat: more positioning options

Can now display the bar on the left/right, and avoid anchoring to edges to centre the bar.

BREAKING CHANGE: The `left` and `right` config options have been renamed to `start` and `end`
2022-10-15 16:27:25 +01:00
Jake Stanger
1b853bcb71 refactor: fix clippy warning 2022-10-15 16:19:21 +01:00
Jake Stanger
bd5bdf5af5 fix: logging for creating bar incorrect 2022-10-15 15:36:23 +01:00
Jake Stanger
8536ad719a fix(mpd): incorrectly checking for unix sockets 2022-10-15 00:17:40 +01:00
Jake Stanger
006c242f49 style: run fmt 2022-10-15 00:09:38 +01:00
Jake Stanger
2cd59ef5ff build: fix compilation errors caused by package update 2022-10-15 00:07:10 +01:00
Jake Stanger
f411b7c451 chore: update lockfile 2022-10-14 23:53:13 +01:00
Jake Stanger
1dd0a9e52f feat(launcher): add popup css selectors 2022-10-14 23:49:11 +01:00
Jake Stanger
5523e9af46 fix(popup): often opening in wrong place
Fixes #16.
2022-10-14 23:48:28 +01:00
Jake Stanger
9e31107251 chore: update lockfile 2022-10-14 23:46:56 +01:00
Jake Stanger
668fe4a308 Merge pull request #24 from JakeStanger/feat/wayland-protocols
Implement Wayland protocol support
2022-10-14 22:24:57 +01:00
Jake Stanger
994d0f580b docs(readme): update references to sway 2022-10-14 22:14:04 +01:00
Jake Stanger
5ce50b0987 refactor: tidy and format 2022-10-10 21:59:44 +01:00
Jake Stanger
b1c66b9117 feat: wlroots-agnostic support for launcher module 2022-10-10 20:15:24 +01:00
Jake Stanger
bb4fe7f7f5 docs(readme): credit smithay client toolkit
Could not have got the Wayland stuff working without.
2022-10-04 23:26:26 +01:00
Jake Stanger
324f00cdf9 feat: wlroots-agnostic support for focused module 2022-10-04 23:26:07 +01:00
Jake Stanger
b188bc7146 feat: initial support for running outside sway
Progress is being tracked in #18. Currently the workspaces, focused and launcher modules are not supported.
2022-09-27 20:24:16 +01:00
Jake Stanger
d22d954e83 ci: alter changelog categories 2022-09-25 22:50:17 +01:00
Jake Stanger
45e44d7913 chore(intellij): update run configs 2022-09-25 22:50:05 +01:00
Jake Stanger
b352181b3d docs: update json example 2022-09-25 22:49:54 +01:00
Jake Stanger
720ba7bfb0 Major module refactor (#19)
* refactor: major module restructuring

Modules now implement a "controller", which allows for separation of logic from UI code and enforces a tighter structure around how modules should be written. The introduction of this change required major refactoring or even rewriting of all modules.

This also better integrates the popup into modules, making it easier for data to be passed around without fetching the same thing twice

The refactor also improves some client code, switching from `ksway` to the much more stable `swayipc-async`. Partial multi-monitor for the tray module has been added.

BREAKING CHANGE: The `mpd` module config has changed, moving the icons to their own object.
2022-09-25 22:49:00 +01:00
JakeStanger
daafa0943e docs: update CHANGELOG.md for v0.5.2 [skip ci] 2022-09-07 21:49:04 +00:00
47 changed files with 4665 additions and 2585 deletions

View File

@@ -26,6 +26,7 @@ jobs:
with: with:
token: ${{ github.token }} token: ${{ github.token }}
tag: ${{ github.ref_name }} tag: ${{ github.ref_name }}
excludeTypes: 'build,chore,style'
- name: Create release - name: Create release
uses: ncipollo/release-action@v1 uses: ncipollo/release-action@v1

View File

@@ -12,7 +12,7 @@
<envs> <envs>
<env name="IRONBAR_CONFIG" value="examples/config.json" /> <env name="IRONBAR_CONFIG" value="examples/config.json" />
<env name="PATH" value="/usr/local/bin:/usr/bin:$USER_HOME$/.local/share/npm/bin" /> <env name="PATH" value="/usr/local/bin:/usr/bin:$USER_HOME$/.local/share/npm/bin" />
<env name="RUST_LOG" value="trace" /> <env name="RUST_LOG" value="debug" />
</envs> </envs>
<option name="isRedirectInput" value="false" /> <option name="isRedirectInput" value="false" />
<option name="redirectInputPath" value="" /> <option name="redirectInputPath" value="" />

View File

@@ -12,6 +12,8 @@
<envs> <envs>
<env name="GTK_DEBUG" value="interactive" /> <env name="GTK_DEBUG" value="interactive" />
<env name="IRONBAR_CONFIG" value="examples/config.json" /> <env name="IRONBAR_CONFIG" value="examples/config.json" />
<env name="RUST_LOG" value="debug" />
<env name="PATH" value="/usr/local/bin:/usr/bin:$USER_HOME$/.local/share/npm/bin" />
</envs> </envs>
<option name="isRedirectInput" value="false" /> <option name="isRedirectInput" value="false" />
<option name="redirectInputPath" value="" /> <option name="redirectInputPath" value="" />

View File

@@ -11,7 +11,7 @@
<option name="backtrace" value="SHORT" /> <option name="backtrace" value="SHORT" />
<envs> <envs>
<env name="PATH" value="/usr/local/bin:/usr/bin:$USER_HOME$/.local/share/npm/bin" /> <env name="PATH" value="/usr/local/bin:/usr/bin:$USER_HOME$/.local/share/npm/bin" />
<env name="RUST_LOG" value="trace" /> <env name="RUST_LOG" value="debug" />
</envs> </envs>
<option name="isRedirectInput" value="false" /> <option name="isRedirectInput" value="false" />
<option name="redirectInputPath" value="" /> <option name="redirectInputPath" value="" />

View File

@@ -4,6 +4,42 @@ All notable changes to this project will be documented in this file.
The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/), The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/),
and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html). and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
## [v0.6.0] - 2022-10-15
### :sparkles: New Features
- [`b188bc7`](https://github.com/JakeStanger/ironbar/commit/b188bc714614406935d8bb88a719adab2dfce32f) - initial support for running outside sway *(commit by [@JakeStanger](https://github.com/JakeStanger))*
- [`324f00c`](https://github.com/JakeStanger/ironbar/commit/324f00cdf9200e3e3ecedfa68ab4c99b170242e2) - wlroots-agnostic support for `focused` module *(commit by [@JakeStanger](https://github.com/JakeStanger))*
- [`b1c66b9`](https://github.com/JakeStanger/ironbar/commit/b1c66b9117cf8a10350cdb857a5267a1a72ad914) - wlroots-agnostic support for `launcher` module *(commit by [@JakeStanger](https://github.com/JakeStanger))*
- [`1dd0a9e`](https://github.com/JakeStanger/ironbar/commit/1dd0a9e52f69e672d9ac313c1da0e201c911e6c2) - **launcher**: add popup css selectors *(commit by [@JakeStanger](https://github.com/JakeStanger))*
- [`06cfad6`](https://github.com/JakeStanger/ironbar/commit/06cfad62e228f7fc63938f2280206450005cb064) - more positioning options *(PR [#23](https://github.com/JakeStanger/ironbar/pull/23) by [@JakeStanger](https://github.com/JakeStanger))*
### :bug: Bug Fixes
- [`5523e9a`](https://github.com/JakeStanger/ironbar/commit/5523e9af46e457f9d45902debaaacf26b586e457) - **popup**: often opening in wrong place *(commit by [@JakeStanger](https://github.com/JakeStanger))*
- [`8536ad7`](https://github.com/JakeStanger/ironbar/commit/8536ad719a92aec4166e35b75cb029075ad3ae34) - **mpd**: incorrectly checking for unix sockets *(commit by [@JakeStanger](https://github.com/JakeStanger))*
- [`bd5bdf5`](https://github.com/JakeStanger/ironbar/commit/bd5bdf5af548304958663d593fccb454afa6c8ff) - logging for creating bar incorrect *(commit by [@JakeStanger](https://github.com/JakeStanger))*
- [`75339f0`](https://github.com/JakeStanger/ironbar/commit/75339f07ed164fa94838036a604a1dcb6d53564c) - vertical bars ignoring height config option *(commit by [@JakeStanger](https://github.com/JakeStanger))*
- [`b7b6488`](https://github.com/JakeStanger/ironbar/commit/b7b64886e3c48ace3faffbb1e277275aeeac3adf) - sometimes panicking on startup *(commit by [@JakeStanger](https://github.com/JakeStanger))*
### :recycle: Refactors
- [`5ce50b0`](https://github.com/JakeStanger/ironbar/commit/5ce50b0987812a1ade2d1262e8d7df6916cfc39a) - tidy and format *(commit by [@JakeStanger](https://github.com/JakeStanger))*
- [`1b853bc`](https://github.com/JakeStanger/ironbar/commit/1b853bcb71197a4bf3ca75725cc010b1d404c2b3) - fix clippy warning *(commit by [@JakeStanger](https://github.com/JakeStanger))*
### :memo: Documentation Changes
- [`daafa09`](https://github.com/JakeStanger/ironbar/commit/daafa0943e5b9886b09fd18d6fff04558fb02335) - update CHANGELOG.md for v0.5.2 [skip ci] *(commit by [@JakeStanger](https://github.com/JakeStanger))*
- [`b352181`](https://github.com/JakeStanger/ironbar/commit/b352181b3d232ccc79ffc1d9e22a633729d01a47) - update json example *(commit by [@JakeStanger](https://github.com/JakeStanger))*
- [`bb4fe7f`](https://github.com/JakeStanger/ironbar/commit/bb4fe7f7f58fa2a6d0a2259bd9442700d2c884f7) - **readme**: credit smithay client toolkit *(commit by [@JakeStanger](https://github.com/JakeStanger))*
- [`994d0f5`](https://github.com/JakeStanger/ironbar/commit/994d0f580b4d1b6ff750839652a7f06149743172) - **readme**: update references to sway *(commit by [@JakeStanger](https://github.com/JakeStanger))*
### :boom: BREAKING CHANGES
- due to [`06cfad6`](https://github.com/JakeStanger/ironbar/commit/06cfad62e228f7fc63938f2280206450005cb064) - more positioning options *(PR [#23](https://github.com/JakeStanger/ironbar/pull/23) by [@JakeStanger](https://github.com/JakeStanger))*:
The `left` and `right` config options have been renamed to `start` and `end`
## [v0.5.2] - 2022-09-07
### :wrench: Chores
- [`b801751`](https://github.com/JakeStanger/ironbar/commit/b801751bdabd8416084f46e6b6d803ea28a259ec) - **release**: v0.5.2 *(commit by [@JakeStanger](https://github.com/JakeStanger))*
## [v0.5.1] - 2022-09-06 ## [v0.5.1] - 2022-09-06
### :bug: Bug Fixes ### :bug: Bug Fixes
- [`b81927e`](https://github.com/JakeStanger/ironbar/commit/b81927e3a57808188e31419695a36aa4ea3f2830) - **launcher**: opening new instances when focused/urgent *(commit by [@JakeStanger](https://github.com/JakeStanger))* - [`b81927e`](https://github.com/JakeStanger/ironbar/commit/b81927e3a57808188e31419695a36aa4ea3f2830) - **launcher**: opening new instances when focused/urgent *(commit by [@JakeStanger](https://github.com/JakeStanger))*
@@ -39,4 +75,6 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
[v0.4.0]: https://github.com/JakeStanger/ironbar/compare/v0.3.0...v0.4.0 [v0.4.0]: https://github.com/JakeStanger/ironbar/compare/v0.3.0...v0.4.0
[v0.5.0]: https://github.com/JakeStanger/ironbar/compare/v0.4.0...v0.5.0 [v0.5.0]: https://github.com/JakeStanger/ironbar/compare/v0.4.0...v0.5.0
[v0.5.1]: https://github.com/JakeStanger/ironbar/compare/v0.5.0...v0.5.1 [v0.5.1]: https://github.com/JakeStanger/ironbar/compare/v0.5.0...v0.5.1
[v0.5.2]: https://github.com/JakeStanger/ironbar/compare/v0.5.1...v0.5.2
[v0.6.0]: https://github.com/JakeStanger/ironbar/compare/v0.5.2...v0.6.0

View File

@@ -14,3 +14,4 @@ I welcome contributions of any kind with open arms. That said, please do stick t
- For issues: - For issues:
- Please provide as much information as you can - share your config, any logs, steps to reproduce... - Please provide as much information as you can - share your config, any logs, steps to reproduce...
- If reporting an error, please ensure you use `IRONBAR_LOG` or `IRONBAR_FILE_LOG` set to `debug`.

1402
Cargo.lock generated

File diff suppressed because it is too large Load Diff

View File

@@ -1,38 +1,40 @@
[package] [package]
name = "ironbar" name = "ironbar"
version = "0.5.2" version = "0.7.0"
edition = "2021" edition = "2021"
license = "MIT" license = "MIT"
description = "Customisable wlroots/sway bar" description = "Customisable GTK Layer Shell wlroots/sway bar"
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
[dependencies] [dependencies]
gtk = "0.15.5" derive_builder = "0.11.2"
gtk-layer-shell = "0.4.1" gtk = "0.16.0"
glib = "0.15.12" gtk-layer-shell = "0.5.0"
tokio = { version = "1.20.1", features = ["macros", "rt-multi-thread", "time"] } glib = "0.16.2"
tracing = "0.1.36" tokio = { version = "1.21.2", features = ["macros", "rt-multi-thread", "time"] }
tracing-subscriber = { version = "0.3.15", features = ["env-filter"] } tracing = "0.1.37"
tracing-subscriber = { version = "0.3.16", features = ["env-filter"] }
tracing-error = "0.2.0" tracing-error = "0.2.0"
tracing-appender = "0.2.2" tracing-appender = "0.2.2"
strip-ansi-escapes = "0.1.1" strip-ansi-escapes = "0.1.1"
color-eyre = "0.6.2" color-eyre = "0.6.2"
futures-util = "0.3.21"
chrono = "0.4.19"
serde = { version = "1.0.141", features = ["derive"] } serde = { version = "1.0.141", features = ["derive"] }
serde_json = "1.0.82" serde_json = "1.0.82"
serde_yaml = "0.9.4" serde_yaml = "0.9.4"
toml = "0.5.9" toml = "0.5.9"
cornfig = "0.3.0" libcorn = "0.4.0"
lazy_static = "1.4.0" lazy_static = "1.4.0"
regex = "1.6.0" async_once = "0.2.6"
stray = "0.1.1" indexmap = "1.9.1"
futures-util = "0.3.21"
chrono = "0.4.19"
regex = { version = "1.6.0", default-features = false, features = ["std"] }
stray = { version = "0.1.2" }
dirs = "4.0.0" dirs = "4.0.0"
walkdir = "2.3.2" walkdir = "2.3.2"
notify = "5.0.0" notify = { version = "5.0.0", default-features = false }
mpd_client = "1.0.0" mpd_client = "1.0.0"
ksway = "0.1.0" swayipc-async = { version = "2.0.1" }
sysinfo = "0.26.2" sysinfo = "0.26.4"
# required for wrapping ksway wayland-client = "0.29.5"
crossbeam-channel = "0.5.6" wayland-protocols = { version = "0.29.5", features = ["unstable_protocols", "client"] }
smithay-client-toolkit = { version = "0.16.0", default-features = false, features=["calloop"] }

View File

@@ -1,16 +1,15 @@
# Ironbar # Ironbar
Ironbar is a customisable and feature-rich bar targeting the Sway compositor, written in Rust. Ironbar is a customisable and feature-rich bar for wlroots compositors, written in Rust.
It uses GTK3 and gtk-layer-shell. It uses GTK3 and gtk-layer-shell.
The bar can be styled to your liking using CSS and hot-loads style changes. The bar can be styled to your liking using CSS and hot-loads style changes.
For information and examples on styling please see the [wiki](https://github.com/JakeStanger/ironbar/wiki). For information and examples on styling please see the [wiki](https://github.com/JakeStanger/ironbar/wiki).
![Screenshot of fully configured bar with MPD widget open](https://user-images.githubusercontent.com/5057870/184539623-92d56a44-a659-49a9-91f9-5cdc453e5dfb.png) ![Screenshot of fully configured bar with MPD widget open](https://user-images.githubusercontent.com/5057870/184539623-92d56a44-a659-49a9-91f9-5cdc453e5dfb.png)
## Installation
Run using `ironbar`. ## Installation
### Cargo ### Cargo
@@ -40,31 +39,41 @@ install target/release/ironbar ~/.local/bin/ironbar
[repo](https://github.com/jakestanger/ironbar) [repo](https://github.com/jakestanger/ironbar)
## Running
All of the above installation methods provide a binary called `ironbar`.
You can set the `IRONBAR_LOG` or `IRONBAR_FILE_LOG` environment variables to
`error`, `warn`, `info`, `debug` or `trace` to configure the log output level.
These default to `IRONBAR_LOG=info` and `IRONBAR_FILE_LOG=error`.
File output can be found at `~/.local/share/ironbar/error.log`.
## Configuration ## Configuration
Ironbar gives a lot of flexibility when configuring, including multiple file formats Ironbar gives a lot of flexibility when configuring, including multiple file formats
and options for scaling complexity: you can use a single config across all monitors, and options for scaling complexity: you can use a single config across all monitors,
or configure different/multiple bars per monitor. or configure different/multiple bars per monitor.
A full configuration guide can be found [here](https://github.com/JakeStanger/ironbar/wiki/configuration-guide). A full configuration guide can be found [here](https://github.com/JakeStanger/ironbar/wiki/configuration-guide).
## Styling ## Styling
To get started, create a stylesheet at `.config/ironbar/style.css`. Changes will be hot-reloaded every time you save the file. To get started, create a stylesheet at `.config/ironbar/style.css`. Changes will be hot-reloaded every time you save the
file.
A full styling guide can be found [here](https://github.com/JakeStanger/ironbar/wiki/styling-guide). A full styling guide can be found [here](https://github.com/JakeStanger/ironbar/wiki/styling-guide).
## Project Status ## Project Status
This project is in alpha, but should be usable. This project is in alpha, but should be usable.
Everything that is implemented works and should be documented. Everything that is implemented works and should be documented.
Proper error handling is in place so things should either fail gracefully with detail, or not fail at all. Proper error handling is in place so things should either fail gracefully with detail, or not fail at all.
There is currently room for lots more modules, and lots more configuration options for the existing modules. There is currently room for lots more modules, and lots more configuration options for the existing modules.
The current configuration schema is not set in stone and breaking changes could come along at any point; The current configuration schema is not set in stone and breaking changes could come along at any point;
until the project matures I am more interested in ease of use than backwards compatibility. until the project matures I am more interested in ease of use than backwards compatibility.
A few bugs do exist, and I am sure there are plenty more to be found. A few bugs do exist, and I am sure there are plenty more to be found.
The project will be *actively developed* as I am using it on my daily driver. The project will be *actively developed* as I am using it on my daily driver.
Bugs will be fixed, features will be added, code will be refactored. Bugs will be fixed, features will be added, code will be refactored.
@@ -77,3 +86,4 @@ Please check [here](https://github.com/JakeStanger/ironbar/blob/master/CONTRIBUT
- [Waybar](https://github.com/Alexays/Waybar) - A lot of the initial inspiration, and a pretty great bar. - [Waybar](https://github.com/Alexays/Waybar) - A lot of the initial inspiration, and a pretty great bar.
- [Rustbar](https://github.com/zeroeightysix/rustbar) - Served as a good demo for writing a basic GTK bar in Rust - [Rustbar](https://github.com/zeroeightysix/rustbar) - Served as a good demo for writing a basic GTK bar in Rust
- [Smithay Client Toolkit](https://github.com/Smithay/client-toolkit) - Essential in being able to communicate to Wayland

View File

@@ -39,5 +39,7 @@ let {
$right = [ $mpd_local $mpd_server $phone_battery $sys_info $clock ] $right = [ $mpd_local $mpd_server $phone_battery $sys_info $clock ]
} }
in { in {
left = $left right = $right anchor_to_edges = true
position = "top"
start = $left end = $right
} }

View File

@@ -1,18 +1,43 @@
{ {
"monitors": { "start": [
"DP-1": [ {
{ "type": "workspaces"
"left": [{"type": "clock"}] },
}, {
{ "type": "launcher",
"position": "top", "icon_theme": "Paper",
"left": [] "favorites": [
} "firefox",
], "discord",
"DP-2": { "Steam"
"position": "bottom", ],
"height": 30, "show_names": false
"left": []
} }
} ],
"end": [
{
"type": "mpd"
},
{
"type": "mpd",
"host": "chloe:6600"
},
{
"path": "/home/jake/bin/phone-battery",
"type": "script"
},
{
"format": [
"{cpu-percent}% ",
"{memory-percent}% "
],
"type": "sys-info"
},
{
"type": "tray"
},
{
"type": "clock"
}
]
} }

25
examples/custom.corn Normal file
View File

@@ -0,0 +1,25 @@
let {
$power_menu = {
type = "custom"
class = "power-menu"
bar = [ { type = "button" name="power-btn" label = "" exec = "popup:toggle" } ]
popup = [ {
type = "box"
orientation = "vertical"
widgets = [
{ type = "label" name = "header" label = "Power menu" }
{
type = "box"
widgets = [
{ type = "button" class="power-btn" label = "<span font-size='40pt'></span>" exec = "!shutdown now" }
{ type = "button" class="power-btn" label = "<span font-size='40pt'></span>" exec = "!reboot" }
]
}
]
} ]
}
} in {
end = [ { type = "clock" } $power_menu ]
}

23
examples/sys-info.corn Normal file
View File

@@ -0,0 +1,23 @@
{
end = [
{
type = "sys-info"
interval.memory = 30
interval.cpu = 1
interval.temps = 5
interval.disks = 300
interval.networks = 3
format = [
" {cpu-percent}% | {temp-c:k10temp-Tccd1}°C"
" {memory-used} / {memory-total} GB ({memory-percent}%)"
"| {swap-used} / {swap-total} GB ({swap-percent}%)"
" {disk-used:/} / {disk-total:/} GB ({disk-percent:/}%)"
"李 {net-down:enp39s0} / {net-up:enp39s0} Mbps"
"猪 {load-average:1} | {load-average:5} | {load-average:15}"
" {uptime}"
]
}
]
}

View File

@@ -1,10 +1,22 @@
use crate::bridge_channel::BridgeChannel;
use crate::config::{BarPosition, ModuleConfig}; use crate::config::{BarPosition, ModuleConfig};
use crate::modules::{Module, ModuleInfo, ModuleLocation}; use crate::modules::custom::ExecEvent;
use crate::modules::launcher::{ItemEvent, LauncherUpdate};
use crate::modules::mpd::{PlayerCommand, SongUpdate};
use crate::modules::workspaces::WorkspaceUpdate;
use crate::modules::{Module, ModuleInfoBuilder, ModuleLocation, ModuleUpdateEvent, WidgetContext};
use crate::popup::Popup;
use crate::Config; use crate::Config;
use chrono::{DateTime, Local};
use color_eyre::Result; use color_eyre::Result;
use gtk::gdk::Monitor; use gtk::gdk::Monitor;
use gtk::prelude::*; use gtk::prelude::*;
use gtk::{Application, ApplicationWindow, Orientation}; use gtk::{Application, ApplicationWindow, Orientation};
use std::collections::HashMap;
use std::sync::{Arc, RwLock};
use stray::message::NotifierItemCommand;
use stray::NotifierItemMessage;
use tokio::sync::mpsc;
use tracing::{debug, info}; use tracing::{debug, info};
/// Creates a new window for a bar, /// Creates a new window for a bar,
@@ -17,30 +29,49 @@ pub fn create_bar(
) -> Result<()> { ) -> Result<()> {
let win = ApplicationWindow::builder().application(app).build(); let win = ApplicationWindow::builder().application(app).build();
setup_layer_shell(&win, monitor, &config.position); setup_layer_shell(&win, monitor, config.position, config.anchor_to_edges);
let orientation = config.position.get_orientation();
let content = gtk::Box::builder() let content = gtk::Box::builder()
.orientation(Orientation::Horizontal) .orientation(orientation)
.spacing(0) .spacing(0)
.hexpand(false) .hexpand(false)
.height_request(config.height) .name("bar");
.name("bar")
let content = if orientation == Orientation::Horizontal {
content.height_request(config.height)
} else {
content.width_request(config.height)
}
.build();
let start = gtk::Box::builder()
.orientation(orientation)
.spacing(0)
.name("start")
.build();
let center = gtk::Box::builder()
.orientation(orientation)
.spacing(0)
.name("center")
.build();
let end = gtk::Box::builder()
.orientation(orientation)
.spacing(0)
.name("end")
.build(); .build();
let left = gtk::Box::builder().spacing(0).name("left").build();
let center = gtk::Box::builder().spacing(0).name("center").build();
let right = gtk::Box::builder().spacing(0).name("right").build();
content.style_context().add_class("container"); content.style_context().add_class("container");
left.style_context().add_class("container"); start.style_context().add_class("container");
center.style_context().add_class("container"); center.style_context().add_class("container");
right.style_context().add_class("container"); end.style_context().add_class("container");
content.add(&left); content.add(&start);
content.set_center_widget(Some(&center)); content.set_center_widget(Some(&center));
content.pack_end(&right, false, false, 0); content.pack_end(&end, false, false, 0);
load_modules(&left, &center, &right, app, config, monitor, monitor_name)?; load_modules(&start, &center, &end, app, config, monitor, monitor_name)?;
win.add(&content); win.add(&content);
win.connect_destroy_event(|_, _| { win.connect_destroy_event(|_, _| {
@@ -65,40 +96,29 @@ fn load_modules(
monitor: &Monitor, monitor: &Monitor,
output_name: &str, output_name: &str,
) -> Result<()> { ) -> Result<()> {
if let Some(modules) = config.left { let mut info_builder = ModuleInfoBuilder::default();
let info = ModuleInfo { let info_builder = info_builder
app, .app(app)
location: ModuleLocation::Left, .bar_position(config.position)
bar_position: &config.position, .monitor(monitor)
monitor, .output_name(output_name);
output_name,
};
add_modules(left, modules, &info)?; if let Some(modules) = config.start {
let info_builder = info_builder.location(ModuleLocation::Left);
add_modules(left, modules, info_builder)?;
} }
if let Some(modules) = config.center { if let Some(modules) = config.center {
let info = ModuleInfo { let info_builder = info_builder.location(ModuleLocation::Center);
app,
location: ModuleLocation::Center,
bar_position: &config.position,
monitor,
output_name,
};
add_modules(center, modules, &info)?; add_modules(center, modules, info_builder)?;
} }
if let Some(modules) = config.right { if let Some(modules) = config.end {
let info = ModuleInfo { let info_builder = info_builder.location(ModuleLocation::Right);
app,
location: ModuleLocation::Right,
bar_position: &config.position,
monitor,
output_name,
};
add_modules(right, modules, &info)?; add_modules(right, modules, info_builder)?;
} }
Ok(()) Ok(())
@@ -106,34 +126,133 @@ fn load_modules(
/// Adds modules into a provided GTK box, /// Adds modules into a provided GTK box,
/// which should be one of its left, center or right containers. /// which should be one of its left, center or right containers.
fn add_modules(content: &gtk::Box, modules: Vec<ModuleConfig>, info: &ModuleInfo) -> Result<()> { fn add_modules(
content: &gtk::Box,
modules: Vec<ModuleConfig>,
info_builder: &mut ModuleInfoBuilder,
) -> Result<()> {
let base_popup_info = info_builder.module_name("").build()?;
let popup = Popup::new(&base_popup_info);
let popup = Arc::new(RwLock::new(popup));
macro_rules! add_module { macro_rules! add_module {
($module:expr, $name:literal) => {{ ($module:expr, $id:expr, $name:literal, $send_message:ty, $receive_message:ty) => {
let widget = $module.into_widget(&info)?; let info = info_builder.module_name($name).build()?;
widget.set_widget_name($name);
content.add(&widget); let (w_tx, w_rx) = glib::MainContext::channel::<$send_message>(glib::PRIORITY_DEFAULT);
debug!("Added module of type {}", $name); let (p_tx, p_rx) = glib::MainContext::channel::<$send_message>(glib::PRIORITY_DEFAULT);
}};
let channel = BridgeChannel::<ModuleUpdateEvent<$send_message>>::new();
let (ui_tx, ui_rx) = mpsc::channel::<$receive_message>(16);
$module.spawn_controller(&info, channel.create_sender(), ui_rx)?;
let context = WidgetContext {
id: $id,
widget_rx: w_rx,
popup_rx: p_rx,
tx: channel.create_sender(),
controller_tx: ui_tx,
};
let widget = $module.into_widget(context, &info)?;
content.add(&widget.widget);
widget.widget.set_widget_name(info.module_name);
let has_popup = widget.popup.is_some();
if let Some(popup_content) = widget.popup {
popup
.write()
.expect("Failed to get write lock on popup")
.register_content($id, popup_content);
}
let popup2 = Arc::clone(&popup);
channel.recv(move |ev| {
let popup = popup2.clone();
match ev {
ModuleUpdateEvent::Update(update) => {
if has_popup {
p_tx.send(update.clone())
.expect("Failed to send update to popup");
}
w_tx.send(update).expect("Failed to send update to module");
}
ModuleUpdateEvent::TogglePopup(geometry) => {
debug!("Toggling popup for {} [#{}]", $name, $id);
let popup = popup.read().expect("Failed to get read lock on popup");
if popup.is_visible() {
popup.hide()
} else {
popup.show_content($id);
popup.show(geometry);
}
}
ModuleUpdateEvent::OpenPopup(geometry) => {
debug!("Opening popup for {} [#{}]", $name, $id);
let popup = popup.read().expect("Failed to get read lock on popup");
popup.hide();
popup.show_content($id);
popup.show(geometry);
}
ModuleUpdateEvent::ClosePopup => {
debug!("Closing popup for {} [#{}]", $name, $id);
let popup = popup.read().expect("Failed to get read lock on popup");
popup.hide();
}
}
Continue(true)
});
};
} }
for config in modules { for (id, config) in modules.into_iter().enumerate() {
match config { match config {
ModuleConfig::Clock(module) => add_module!(module, "clock"), ModuleConfig::Clock(module) => {
ModuleConfig::Mpd(module) => add_module!(module, "mpd"), add_module!(module, id, "clock", DateTime<Local>, ());
ModuleConfig::Tray(module) => add_module!(module, "tray"), }
ModuleConfig::Workspaces(module) => add_module!(module, "workspaces"), ModuleConfig::Script(module) => {
ModuleConfig::SysInfo(module) => add_module!(module, "sysinfo"), add_module!(module, id, "script", String, ());
ModuleConfig::Launcher(module) => add_module!(module, "launcher"), }
ModuleConfig::Script(module) => add_module!(module, "script"), ModuleConfig::SysInfo(module) => {
ModuleConfig::Focused(module) => add_module!(module, "focused"), add_module!(module, id, "sysinfo", HashMap<String, String>, ());
}
ModuleConfig::Focused(module) => {
add_module!(module, id, "focused", (String, String), ());
}
ModuleConfig::Workspaces(module) => {
add_module!(module, id, "workspaces", WorkspaceUpdate, String);
}
ModuleConfig::Tray(module) => {
add_module!(module, id, "tray", NotifierItemMessage, NotifierItemCommand);
}
ModuleConfig::Mpd(module) => {
add_module!(module, id, "mpd", Option<SongUpdate>, PlayerCommand);
}
ModuleConfig::Launcher(module) => {
add_module!(module, id, "launcher", LauncherUpdate, ItemEvent);
}
ModuleConfig::Custom(module) => {
add_module!(module, id, "custom", (), ExecEvent);
}
} }
} }
Ok(()) Ok(())
} }
/// Sets up GTK layer shell for a provided aplication window. /// Sets up GTK layer shell for a provided application window.
fn setup_layer_shell(win: &ApplicationWindow, monitor: &Monitor, position: &BarPosition) { fn setup_layer_shell(
win: &ApplicationWindow,
monitor: &Monitor,
position: BarPosition,
anchor_to_edges: bool,
) {
gtk_layer_shell::init_for_window(win); gtk_layer_shell::init_for_window(win);
gtk_layer_shell::set_monitor(win, monitor); gtk_layer_shell::set_monitor(win, monitor);
gtk_layer_shell::set_layer(win, gtk_layer_shell::Layer::Top); gtk_layer_shell::set_layer(win, gtk_layer_shell::Layer::Top);
@@ -144,16 +263,30 @@ fn setup_layer_shell(win: &ApplicationWindow, monitor: &Monitor, position: &BarP
gtk_layer_shell::set_margin(win, gtk_layer_shell::Edge::Left, 0); gtk_layer_shell::set_margin(win, gtk_layer_shell::Edge::Left, 0);
gtk_layer_shell::set_margin(win, gtk_layer_shell::Edge::Right, 0); gtk_layer_shell::set_margin(win, gtk_layer_shell::Edge::Right, 0);
let bar_orientation = position.get_orientation();
gtk_layer_shell::set_anchor( gtk_layer_shell::set_anchor(
win, win,
gtk_layer_shell::Edge::Top, gtk_layer_shell::Edge::Top,
position == &BarPosition::Top, position == BarPosition::Top
|| (bar_orientation == Orientation::Vertical && anchor_to_edges),
); );
gtk_layer_shell::set_anchor( gtk_layer_shell::set_anchor(
win, win,
gtk_layer_shell::Edge::Bottom, gtk_layer_shell::Edge::Bottom,
position == &BarPosition::Bottom, position == BarPosition::Bottom
|| (bar_orientation == Orientation::Vertical && anchor_to_edges),
);
gtk_layer_shell::set_anchor(
win,
gtk_layer_shell::Edge::Left,
position == BarPosition::Left
|| (bar_orientation == Orientation::Horizontal && anchor_to_edges),
);
gtk_layer_shell::set_anchor(
win,
gtk_layer_shell::Edge::Right,
position == BarPosition::Right
|| (bar_orientation == Orientation::Horizontal && anchor_to_edges),
); );
gtk_layer_shell::set_anchor(win, gtk_layer_shell::Edge::Left, true);
gtk_layer_shell::set_anchor(win, gtk_layer_shell::Edge::Right, true);
} }

43
src/bridge_channel.rs Normal file
View File

@@ -0,0 +1,43 @@
use tokio::spawn;
use tokio::sync::mpsc;
/// MPSC async -> sync channel.
/// The sender uses `tokio::sync::mpsc`
/// while the receiver uses `glib::MainContext::channel`.
///
/// This makes it possible to send events asynchronously
/// and receive them on the main thread,
/// allowing UI updates to be handled on the receiving end.
pub struct BridgeChannel<T> {
async_tx: mpsc::Sender<T>,
sync_rx: glib::Receiver<T>,
}
impl<T: Send + 'static> BridgeChannel<T> {
/// Creates a new channel
pub fn new() -> Self {
let (async_tx, mut async_rx) = mpsc::channel(32);
let (sync_tx, sync_rx) = glib::MainContext::channel(glib::PRIORITY_DEFAULT);
spawn(async move {
while let Some(val) = async_rx.recv().await {
sync_tx.send(val).expect("Failed to send message");
}
});
Self { async_tx, sync_rx }
}
/// Gets a clone of the sender.
pub fn create_sender(&self) -> mpsc::Sender<T> {
self.async_tx.clone()
}
/// Attaches a callback to the receiver.
pub fn recv<F>(self, f: F) -> glib::SourceId
where
F: FnMut(T) -> glib::Continue + 'static,
{
self.sync_rx.attach(None, f)
}
}

View File

@@ -1,146 +0,0 @@
use serde::Serialize;
use std::slice::{Iter, IterMut};
/// An ordered map.
/// Internally this is just two vectors -
/// one for keys and one for values.
#[derive(Debug, Clone, Serialize)]
pub struct Collection<TKey, TData> {
keys: Vec<TKey>,
values: Vec<TData>,
}
impl<TKey: PartialEq, TData> Collection<TKey, TData> {
/// Creates a new empty collection.
pub const fn new() -> Self {
Self {
keys: vec![],
values: vec![],
}
}
/// Inserts a new key/value pair at the end of the collection.
pub fn insert(&mut self, key: TKey, value: TData) {
self.keys.push(key);
self.values.push(value);
assert_eq!(self.keys.len(), self.values.len());
}
/// Gets a reference of the value for the specified key
/// if it exists in the collection.
pub fn get(&self, key: &TKey) -> Option<&TData> {
let index = self.keys.iter().position(|k| k == key);
match index {
Some(index) => self.values.get(index),
None => None,
}
}
/// Gets a mutable reference for the value with the specified key
/// if it exists in the collection.
pub fn get_mut(&mut self, key: &TKey) -> Option<&mut TData> {
let index = self.keys.iter().position(|k| k == key);
match index {
Some(index) => self.values.get_mut(index),
None => None,
}
}
/// Removes the key/value from the collection
/// if it exists
/// and returns the removed value.
pub fn remove(&mut self, key: &TKey) -> Option<TData> {
assert_eq!(self.keys.len(), self.values.len());
let index = self.keys.iter().position(|k| k == key);
if let Some(index) = index {
self.keys.remove(index);
Some(self.values.remove(index))
} else {
None
}
}
/// Gets the length of the collection.
pub fn len(&self) -> usize {
self.keys.len()
}
/// Gets a reference to the first value in the collection.
pub fn first(&self) -> Option<&TData> {
self.values.first()
}
/// Gets the values as a slice.
pub fn as_slice(&self) -> &[TData] {
self.values.as_slice()
}
/// Checks whether the collection is empty.
pub fn is_empty(&self) -> bool {
self.keys.is_empty()
}
/// Gets an iterator for the collection.
pub fn iter(&self) -> Iter<'_, TData> {
self.values.iter()
}
/// Gets a mutable iterator for the collection
pub fn iter_mut(&mut self) -> IterMut<'_, TData> {
self.values.iter_mut()
}
}
impl<TKey: PartialEq, TData> From<(TKey, TData)> for Collection<TKey, TData> {
fn from((key, value): (TKey, TData)) -> Self {
let mut collection = Self::new();
collection.insert(key, value);
collection
}
}
impl<TKey: PartialEq, TData> FromIterator<(TKey, TData)> for Collection<TKey, TData> {
fn from_iter<T: IntoIterator<Item = (TKey, TData)>>(iter: T) -> Self {
let mut collection = Self::new();
for (key, value) in iter {
collection.insert(key, value);
}
collection
}
}
impl<'a, TKey: PartialEq, TData> IntoIterator for &'a Collection<TKey, TData> {
type Item = &'a TData;
type IntoIter = CollectionIntoIterator<'a, TKey, TData>;
fn into_iter(self) -> Self::IntoIter {
CollectionIntoIterator {
collection: self,
index: 0,
}
}
}
pub struct CollectionIntoIterator<'a, TKey, TData> {
collection: &'a Collection<TKey, TData>,
index: usize,
}
impl<'a, TKey: PartialEq, TData> Iterator for CollectionIntoIterator<'a, TKey, TData> {
type Item = &'a TData;
fn next(&mut self) -> Option<Self::Item> {
let res = self.collection.values.get(self.index);
self.index += 1;
res
}
}
impl<TKey: PartialEq, TData> Default for Collection<TKey, TData> {
fn default() -> Self {
Self::new()
}
}

View File

@@ -1,4 +1,5 @@
use crate::modules::clock::ClockModule; use crate::modules::clock::ClockModule;
use crate::modules::custom::CustomModule;
use crate::modules::focused::FocusedModule; use crate::modules::focused::FocusedModule;
use crate::modules::launcher::LauncherModule; use crate::modules::launcher::LauncherModule;
use crate::modules::mpd::MpdModule; use crate::modules::mpd::MpdModule;
@@ -10,10 +11,12 @@ use color_eyre::eyre::{Context, ContextCompat};
use color_eyre::{eyre, Help, Report}; use color_eyre::{eyre, Help, Report};
use dirs::config_dir; use dirs::config_dir;
use eyre::Result; use eyre::Result;
use gtk::Orientation;
use serde::Deserialize; use serde::Deserialize;
use std::collections::HashMap; use std::collections::HashMap;
use std::path::{Path, PathBuf}; use std::path::{Path, PathBuf};
use std::{env, fs}; use std::{env, fs};
use tracing::instrument;
#[derive(Debug, Deserialize, Clone)] #[derive(Debug, Deserialize, Clone)]
#[serde(tag = "type", rename_all = "kebab-case")] #[serde(tag = "type", rename_all = "kebab-case")]
@@ -26,6 +29,7 @@ pub enum ModuleConfig {
Launcher(LauncherModule), Launcher(LauncherModule),
Script(ScriptModule), Script(ScriptModule),
Focused(FocusedModule), Focused(FocusedModule),
Custom(CustomModule),
} }
#[derive(Debug, Deserialize, Clone)] #[derive(Debug, Deserialize, Clone)]
@@ -35,11 +39,13 @@ pub enum MonitorConfig {
Multiple(Vec<Config>), Multiple(Vec<Config>),
} }
#[derive(Debug, Deserialize, Clone, PartialEq, Eq)] #[derive(Debug, Deserialize, Copy, Clone, PartialEq, Eq)]
#[serde(rename_all = "kebab-case")] #[serde(rename_all = "kebab-case")]
pub enum BarPosition { pub enum BarPosition {
Top, Top,
Bottom, Bottom,
Left,
Right,
} }
impl Default for BarPosition { impl Default for BarPosition {
@@ -48,16 +54,36 @@ impl Default for BarPosition {
} }
} }
#[derive(Debug, Deserialize, Clone, Default)] impl BarPosition {
pub fn get_orientation(self) -> Orientation {
if self == Self::Top || self == Self::Bottom {
Orientation::Horizontal
} else {
Orientation::Vertical
}
}
pub const fn get_angle(self) -> f64 {
match self {
Self::Top | Self::Bottom => 0.0,
Self::Left => 90.0,
Self::Right => 270.0,
}
}
}
#[derive(Debug, Deserialize, Clone)]
pub struct Config { pub struct Config {
#[serde(default = "default_bar_position")] #[serde(default = "default_bar_position")]
pub position: BarPosition, pub position: BarPosition,
#[serde(default = "default_true")]
pub anchor_to_edges: bool,
#[serde(default = "default_bar_height")] #[serde(default = "default_bar_height")]
pub height: i32, pub height: i32,
pub left: Option<Vec<ModuleConfig>>, pub start: Option<Vec<ModuleConfig>>,
pub center: Option<Vec<ModuleConfig>>, pub center: Option<Vec<ModuleConfig>>,
pub right: Option<Vec<ModuleConfig>>, pub end: Option<Vec<ModuleConfig>>,
pub monitors: Option<HashMap<String, MonitorConfig>>, pub monitors: Option<HashMap<String, MonitorConfig>>,
} }
@@ -73,14 +99,18 @@ const fn default_bar_height() -> i32 {
impl Config { impl Config {
/// Attempts to load the config file from file, /// Attempts to load the config file from file,
/// parse it and return a new instance of `Self`. /// parse it and return a new instance of `Self`.
#[instrument]
pub fn load() -> Result<Self> { pub fn load() -> Result<Self> {
let config_path = if let Ok(config_path) = env::var("IRONBAR_CONFIG") { let config_path = if let Ok(config_path) = env::var("IRONBAR_CONFIG") {
let path = PathBuf::from(config_path); let path = PathBuf::from(config_path);
if path.exists() { if path.exists() {
Ok(path) Ok(path)
} else { } else {
Err(Report::msg("Specified config file does not exist") Err(Report::msg(format!(
.note("Config file was specified using `IRONBAR_CONFIG` environment variable")) "Specified config file does not exist: {}",
path.display()
))
.note("Config file was specified using `IRONBAR_CONFIG` environment variable"))
} }
} else { } else {
Self::try_find_config() Self::try_find_config()
@@ -93,6 +123,7 @@ impl Config {
/// by checking each valid format's extension. /// by checking each valid format's extension.
/// ///
/// Returns the path of the first valid match, if any. /// Returns the path of the first valid match, if any.
#[instrument]
fn try_find_config() -> Result<PathBuf> { fn try_find_config() -> Result<PathBuf> {
let config_dir = config_dir().wrap_err("Failed to locate user config dir")?; let config_dir = config_dir().wrap_err("Failed to locate user config dir")?;
@@ -112,7 +143,10 @@ impl Config {
match file { match file {
Some(file) => Ok(file), Some(file) => Ok(file),
None => Err(Report::msg("Could not find config file")), None => Err(Report::msg("Could not find config file")
.suggestion("Ironbar does not include a configuration out of the box")
.suggestion("A guide on writing a config can be found on the wiki:")
.suggestion("https://github.com/JakeStanger/ironbar/wiki/configuration-guide")),
} }
} }
@@ -135,7 +169,7 @@ impl Config {
// so serialize the interpreted result then deserialize that // so serialize the interpreted result then deserialize that
let file = let file =
String::from_utf8(file).wrap_err("Config file contains invalid UTF-8")?; String::from_utf8(file).wrap_err("Config file contains invalid UTF-8")?;
let config = cornfig::parse(&file).wrap_err("Invalid corn config")?.value; let config = libcorn::parse(&file).wrap_err("Invalid corn config")?.value;
Ok(serde_json::from_str(&serde_json::to_string(&config)?)?) Ok(serde_json::from_str(&serde_json::to_string(&config)?)?)
} }
_ => unreachable!(), _ => unreachable!(),

View File

@@ -31,10 +31,15 @@ impl<'a> MakeWriter<'a> for MakeFileWriter {
/// The returned `WorkerGuard` must remain in scope /// The returned `WorkerGuard` must remain in scope
/// for the lifetime of the application for logging to file to work. /// for the lifetime of the application for logging to file to work.
pub fn install_tracing() -> Result<WorkerGuard> { pub fn install_tracing() -> Result<WorkerGuard> {
const DEFAULT_LOG: &str = "info";
const DEFAULT_FILE_LOG: &str = "warn";
let fmt_layer = fmt::layer().with_target(true); let fmt_layer = fmt::layer().with_target(true);
let filter_layer = EnvFilter::try_from_default_env().or_else(|_| EnvFilter::try_new("info"))?; let filter_layer =
let file_filter_layer = EnvFilter::try_from_env("IRONBAR_LOG").or_else(|_| EnvFilter::try_new(DEFAULT_LOG))?;
EnvFilter::try_from_default_env().or_else(|_| EnvFilter::try_new("warn"))?;
let file_filter_layer = EnvFilter::try_from_env("IRONBAR_FILE_LOG")
.or_else(|_| EnvFilter::try_new(DEFAULT_FILE_LOG))?;
let log_path = data_dir().unwrap_or(env::current_dir()?).join("ironbar"); let log_path = data_dir().unwrap_or(env::current_dir()?).join("ironbar");

View File

@@ -1,32 +1,44 @@
mod bar; mod bar;
mod collection; mod bridge_channel;
mod config; mod config;
mod icon; mod icon;
mod logging; mod logging;
mod modules; mod modules;
mod popup; mod popup;
mod script;
mod style; mod style;
mod sway; mod sway;
mod wayland;
use crate::bar::create_bar; use crate::bar::create_bar;
use crate::config::{Config, MonitorConfig}; use crate::config::{Config, MonitorConfig};
use crate::style::load_css; use crate::style::load_css;
use crate::sway::{get_client, SwayOutput};
use color_eyre::eyre::Result; use color_eyre::eyre::Result;
use color_eyre::Report; use color_eyre::Report;
use dirs::config_dir; use dirs::config_dir;
use gtk::gdk::Display; use gtk::gdk::Display;
use gtk::prelude::*; use gtk::prelude::*;
use gtk::Application; use gtk::Application;
use ksway::IpcCommand; use std::future::Future;
use std::env; use std::path::PathBuf;
use std::process::exit; use std::process::exit;
use std::{env, panic};
use tokio::runtime::Handle;
use tokio::task::block_in_place;
use crate::logging::install_tracing; use crate::logging::install_tracing;
use tracing::{debug, error, info}; use tracing::{debug, error, info};
use wayland::WaylandClient;
const VERSION: &str = env!("CARGO_PKG_VERSION"); const VERSION: &str = env!("CARGO_PKG_VERSION");
#[repr(i32)]
enum ErrorCode {
GtkDisplay = 1,
CreateBars = 2,
Config = 3,
}
#[tokio::main] #[tokio::main]
async fn main() -> Result<()> { async fn main() -> Result<()> {
// Disable backtraces by default // Disable backtraces by default
@@ -38,53 +50,67 @@ async fn main() -> Result<()> {
// otherwise file logging drops // otherwise file logging drops
let _guard = install_tracing()?; let _guard = install_tracing()?;
color_eyre::install()?; let hook_builder = color_eyre::config::HookBuilder::default();
let (panic_hook, eyre_hook) = hook_builder.into_hooks();
eyre_hook.install()?;
// custom hook allows tracing_appender to capture panics
panic::set_hook(Box::new(move |panic_info| {
error!("{}", panic_hook.panic_report(panic_info));
}));
info!("Ironbar version {}", VERSION); info!("Ironbar version {}", VERSION);
info!("Starting application"); info!("Starting application");
let wayland_client = wayland::get_client().await;
let app = Application::builder() let app = Application::builder()
.application_id("dev.jstanger.ironbar") .application_id("dev.jstanger.ironbar")
.build(); .build();
app.connect_activate(move |app| { app.connect_activate(move |app| {
let display = match Display::default() { let display = Display::default().map_or_else(
Some(display) => display, || {
None => {
let report = Report::msg("Failed to get default GTK display"); let report = Report::msg("Failed to get default GTK display");
error!("{:?}", report); error!("{:?}", report);
exit(1) exit(ErrorCode::GtkDisplay as i32)
} },
}; |display| display,
);
let config = match Config::load() { let config = match Config::load() {
Ok(config) => config, Ok(config) => config,
Err(err) => { Err(err) => {
error!("{:?}", err); error!("{:?}", err);
Config::default() exit(ErrorCode::Config as i32)
} }
}; };
debug!("Loaded config file"); debug!("Loaded config file");
if let Err(err) = create_bars(app, &display, &config) { if let Err(err) = create_bars(app, &display, wayland_client, &config) {
error!("{:?}", err); error!("{:?}", err);
exit(2); exit(ErrorCode::CreateBars as i32);
} }
debug!("Created bars"); debug!("Created bars");
let style_path = match config_dir() { let style_path = env::var("IRONBAR_CSS").ok().map_or_else(
Some(dir) => dir.join("ironbar").join("style.css"), || {
None => { config_dir().map_or_else(
let report = Report::msg("Failed to locate user config dir"); || {
error!("{:?}", report); let report = Report::msg("Failed to locate user config dir");
exit(3); error!("{:?}", report);
} exit(ErrorCode::CreateBars as i32);
}; },
|dir| dir.join("ironbar").join("style.css"),
)
},
PathBuf::from,
);
if style_path.exists() { if style_path.exists() {
load_css(style_path); load_css(style_path);
debug!("Loaded CSS watcher file");
} }
}); });
@@ -96,42 +122,40 @@ async fn main() -> Result<()> {
} }
/// Creates each of the bars across each of the (configured) outputs. /// Creates each of the bars across each of the (configured) outputs.
fn create_bars(app: &Application, display: &Display, config: &Config) -> Result<()> { fn create_bars(
let outputs = { app: &Application,
let sway = get_client(); display: &Display,
let mut sway = sway.lock().expect("Failed to get lock on Sway IPC client"); wl: &WaylandClient,
config: &Config,
) -> Result<()> {
let outputs = wl.outputs.as_slice();
let outputs = sway.ipc(IpcCommand::GetOutputs); debug!("Received {} outputs from Wayland", outputs.len());
debug!("Outputs: {:?}", outputs);
match outputs {
Ok(outputs) => Ok(outputs),
Err(err) => Err(err),
}
}?;
let outputs = serde_json::from_slice::<Vec<SwayOutput>>(&outputs)?;
debug!("Received {} outputs from Sway IPC", outputs.len());
let num_monitors = display.n_monitors(); let num_monitors = display.n_monitors();
for i in 0..num_monitors { for i in 0..num_monitors {
let monitor = display.monitor(i).ok_or_else(|| Report::msg("GTK and Sway are reporting a different number of outputs - this is a severe bug and should never happen"))?; let monitor = display.monitor(i).ok_or_else(|| Report::msg("GTK and Sway are reporting a different set of outputs - this is a severe bug and should never happen"))?;
let monitor_name = &outputs.get(i as usize).ok_or_else(|| Report::msg("GTK and Sway are reporting a different set of outputs - this is a severe bug and should never happen"))?.name; let output = outputs.get(i as usize).ok_or_else(|| Report::msg("GTK and Sway are reporting a different set of outputs - this is a severe bug and should never happen"))?;
let monitor_name = &output.name;
info!("Creating bar on '{}'", monitor_name); // TODO: Could we use an Arc<Config> or `Cow<Config>` here to avoid cloning?
// TODO: Could we use an Arc<Config> here to avoid cloning?
config.monitors.as_ref().map_or_else( config.monitors.as_ref().map_or_else(
|| create_bar(app, &monitor, monitor_name, config.clone()), || {
info!("Creating bar on '{}'", monitor_name);
create_bar(app, &monitor, monitor_name, config.clone())
},
|config| { |config| {
let config = config.get(monitor_name); let config = config.get(monitor_name);
match &config { match &config {
Some(MonitorConfig::Single(config)) => { Some(MonitorConfig::Single(config)) => {
info!("Creating bar on '{}'", monitor_name);
create_bar(app, &monitor, monitor_name, config.clone()) create_bar(app, &monitor, monitor_name, config.clone())
} }
Some(MonitorConfig::Multiple(configs)) => { Some(MonitorConfig::Multiple(configs)) => {
for config in configs { for config in configs {
info!("Creating bar on '{}'", monitor_name);
create_bar(app, &monitor, monitor_name, config.clone())?; create_bar(app, &monitor, monitor_name, config.clone())?;
} }
@@ -145,3 +169,15 @@ fn create_bars(app: &Application, display: &Display, config: &Config) -> Result<
Ok(()) Ok(())
} }
/// Blocks on a `Future` until it resolves.
///
/// This is not an `async` operation
/// so can be used outside of an async function.
///
/// Do note it must be called from within a Tokio runtime still.
///
/// Use sparingly! Prefer async functions wherever possible.
pub fn await_sync<F: Future>(f: F) -> F::Output {
block_in_place(|| Handle::current().block_on(f))
}

120
src/modules/clock.rs Normal file
View File

@@ -0,0 +1,120 @@
use crate::modules::{Module, ModuleInfo, ModuleUpdateEvent, ModuleWidget, WidgetContext};
use crate::popup::Popup;
use chrono::{DateTime, Local};
use color_eyre::Result;
use glib::Continue;
use gtk::prelude::*;
use gtk::{Align, Button, Calendar, Label, Orientation};
use serde::Deserialize;
use tokio::spawn;
use tokio::sync::mpsc;
use tokio::time::sleep;
#[derive(Debug, Deserialize, Clone)]
pub struct ClockModule {
/// Date/time format string.
/// Default: `%d/%m/%Y %H:%M`
///
/// Detail on available tokens can be found here:
/// <https://docs.rs/chrono/latest/chrono/format/strftime/index.html>
#[serde(default = "default_format")]
pub(crate) format: String,
}
fn default_format() -> String {
String::from("%d/%m/%Y %H:%M")
}
impl Module<Button> for ClockModule {
type SendMessage = DateTime<Local>;
type ReceiveMessage = ();
fn spawn_controller(
&self,
_info: &ModuleInfo,
tx: mpsc::Sender<ModuleUpdateEvent<Self::SendMessage>>,
_rx: mpsc::Receiver<Self::ReceiveMessage>,
) -> Result<()> {
spawn(async move {
loop {
let date = Local::now();
tx.send(ModuleUpdateEvent::Update(date))
.await
.expect("Failed to send date");
sleep(tokio::time::Duration::from_millis(500)).await;
}
});
Ok(())
}
fn into_widget(
self,
context: WidgetContext<Self::SendMessage, Self::ReceiveMessage>,
info: &ModuleInfo,
) -> Result<ModuleWidget<Button>> {
let button = Button::new();
let label = Label::new(None);
label.set_angle(info.bar_position.get_angle());
button.add(&label);
let orientation = info.bar_position.get_orientation();
button.connect_clicked(move |button| {
context
.tx
.try_send(ModuleUpdateEvent::TogglePopup(Popup::button_pos(
button,
orientation,
)))
.expect("Failed to toggle popup");
});
let format = self.format.clone();
{
context.widget_rx.attach(None, move |date| {
let date_string = format!("{}", date.format(&format));
label.set_label(&date_string);
Continue(true)
});
}
let popup = self.into_popup(context.controller_tx, context.popup_rx);
Ok(ModuleWidget {
widget: button,
popup,
})
}
fn into_popup(
self,
_tx: mpsc::Sender<Self::ReceiveMessage>,
rx: glib::Receiver<Self::SendMessage>,
) -> Option<gtk::Box> {
let container = gtk::Box::builder()
.orientation(Orientation::Vertical)
.name("popup-clock")
.build();
let clock = Label::builder()
.name("calendar-clock")
.halign(Align::Center)
.build();
let format = "%H:%M:%S";
container.add(&clock);
let calendar = Calendar::builder().name("calendar").build();
container.add(&calendar);
{
rx.attach(None, move |date| {
let date_string = format!("{}", date.format(format));
clock.set_label(&date_string);
Continue(true)
});
}
Some(container)
}
}

View File

@@ -1,71 +0,0 @@
mod popup;
use self::popup::Popup;
use crate::modules::{Module, ModuleInfo};
use chrono::Local;
use color_eyre::Result;
use glib::Continue;
use gtk::prelude::*;
use gtk::{Button, Orientation};
use serde::Deserialize;
use tokio::spawn;
use tokio::time::sleep;
#[derive(Debug, Deserialize, Clone)]
pub struct ClockModule {
/// Date/time format string.
/// Default: `%d/%m/%Y %H:%M`
///
/// Detail on available tokens can be found here:
/// <https://docs.rs/chrono/latest/chrono/format/strftime/index.html>
#[serde(default = "default_format")]
pub(crate) format: String,
}
fn default_format() -> String {
String::from("%d/%m/%Y %H:%M")
}
impl Module<Button> for ClockModule {
fn into_widget(self, info: &ModuleInfo) -> Result<Button> {
let button = Button::new();
let popup = Popup::new(
"popup-clock",
info.app,
info.monitor,
Orientation::Vertical,
info.bar_position,
);
popup.add_clock_widgets();
button.show_all();
button.connect_clicked(move |button| {
popup.show(button);
});
let (tx, rx) = glib::MainContext::channel(glib::PRIORITY_DEFAULT);
spawn(async move {
let format = self.format.as_str();
loop {
let date = Local::now();
let date_string = format!("{}", date.format(format));
tx.send(date_string).expect("Failed to send date string");
sleep(tokio::time::Duration::from_millis(500)).await;
}
});
{
let button = button.clone();
rx.attach(None, move |s| {
button.set_label(s.as_str());
Continue(true)
});
}
Ok(button)
}
}

View File

@@ -1,40 +0,0 @@
pub use crate::popup::Popup;
use chrono::Local;
use gtk::prelude::*;
use gtk::{Align, Calendar, Label};
use tokio::spawn;
use tokio::time::sleep;
impl Popup {
pub fn add_clock_widgets(&self) {
let clock = Label::builder()
.name("calendar-clock")
.halign(Align::Center)
.build();
let format = "%H:%M:%S";
self.container.add(&clock);
let calendar = Calendar::builder().name("calendar").build();
self.container.add(&calendar);
let (tx, rx) = glib::MainContext::channel(glib::PRIORITY_DEFAULT);
spawn(async move {
loop {
let date = Local::now();
let date_string = format!("{}", date.format(format));
tx.send(date_string).expect("Failed to send date string");
sleep(tokio::time::Duration::from_millis(500)).await;
}
});
{
rx.attach(None, move |s| {
clock.set_label(s.as_str());
Continue(true)
});
}
}
}

240
src/modules/custom.rs Normal file
View File

@@ -0,0 +1,240 @@
use crate::modules::{Module, ModuleInfo, ModuleUpdateEvent, ModuleWidget, WidgetContext};
use crate::popup::{ButtonGeometry, Popup};
use crate::script::exec_command;
use color_eyre::{Report, Result};
use gtk::prelude::*;
use gtk::{Button, Label, Orientation};
use serde::Deserialize;
use tokio::spawn;
use tokio::sync::mpsc::{Receiver, Sender};
use tracing::{debug, error};
#[derive(Debug, Deserialize, Clone)]
pub struct CustomModule {
/// Container class name
class: Option<String>,
/// Widgets to add to the bar container
bar: Vec<Widget>,
/// Widgets to add to the popup container
popup: Option<Vec<Widget>>,
}
/// Attempts to parse an `Orientation` from `String`
fn try_get_orientation(orientation: &str) -> Result<Orientation> {
match orientation.to_lowercase().as_str() {
"horizontal" | "h" => Ok(Orientation::Horizontal),
"vertical" | "v" => Ok(Orientation::Vertical),
_ => Err(Report::msg("Invalid orientation string in config")),
}
}
/// Widget attributes
#[derive(Debug, Deserialize, Clone)]
pub struct Widget {
/// Type of GTK widget to add
#[serde(rename = "type")]
widget_type: WidgetType,
widgets: Option<Vec<Widget>>,
label: Option<String>,
name: Option<String>,
class: Option<String>,
exec: Option<String>,
orientation: Option<String>,
}
/// Supported GTK widget types
#[derive(Debug, Deserialize, Clone)]
#[serde(rename_all = "kebab-case")]
pub enum WidgetType {
Box,
Label,
Button,
}
impl Widget {
/// Creates this widget and adds it to the parent container
fn add_to(self, parent: &gtk::Box, tx: Sender<ExecEvent>, bar_orientation: Orientation) {
match self.widget_type {
WidgetType::Box => parent.add(&self.into_box(&tx, bar_orientation)),
WidgetType::Label => parent.add(&self.into_label()),
WidgetType::Button => parent.add(&self.into_button(tx, bar_orientation)),
}
}
/// Creates a `gtk::Box` from this widget
fn into_box(self, tx: &Sender<ExecEvent>, bar_orientation: Orientation) -> gtk::Box {
let mut builder = gtk::Box::builder();
if let Some(name) = self.name {
builder = builder.name(&name);
}
if let Some(orientation) = self.orientation {
builder = builder
.orientation(try_get_orientation(&orientation).unwrap_or(Orientation::Horizontal));
}
let container = builder.build();
if let Some(class) = self.class {
container.style_context().add_class(&class);
}
if let Some(widgets) = self.widgets {
widgets
.into_iter()
.for_each(|widget| widget.add_to(&container, tx.clone(), bar_orientation));
}
container
}
/// Creates a `gtk::Label` from this widget
fn into_label(self) -> Label {
let mut builder = Label::builder().use_markup(true);
if let Some(name) = self.name {
builder = builder.name(&name);
}
let label = builder.build();
if let Some(text) = self.label {
label.set_markup(&text);
}
if let Some(class) = self.class {
label.style_context().add_class(&class);
}
label
}
/// Creates a `gtk::Button` from this widget
fn into_button(self, tx: Sender<ExecEvent>, bar_orientation: Orientation) -> Button {
let mut builder = Button::builder();
if let Some(name) = self.name {
builder = builder.name(&name);
}
let button = builder.build();
if let Some(text) = self.label {
let label = Label::new(None);
label.set_use_markup(true);
label.set_markup(&text);
button.add(&label);
}
if let Some(class) = self.class {
button.style_context().add_class(&class);
}
if let Some(exec) = self.exec {
button.connect_clicked(move |button| {
tx.try_send(ExecEvent {
cmd: exec.clone(),
geometry: Popup::button_pos(button, bar_orientation),
})
.expect("Failed to send exec message");
});
}
button
}
}
#[derive(Debug)]
pub struct ExecEvent {
cmd: String,
geometry: ButtonGeometry,
}
impl Module<gtk::Box> for CustomModule {
type SendMessage = ();
type ReceiveMessage = ExecEvent;
fn spawn_controller(
&self,
_info: &ModuleInfo,
tx: Sender<ModuleUpdateEvent<Self::SendMessage>>,
mut rx: Receiver<Self::ReceiveMessage>,
) -> Result<()> {
spawn(async move {
while let Some(event) = rx.recv().await {
if event.cmd.starts_with('!') {
debug!("executing command: '{}'", &event.cmd[1..]);
if let Err(err) = exec_command(&event.cmd[1..]) {
error!("{err:?}");
}
} else if event.cmd == "popup:toggle" {
tx.send(ModuleUpdateEvent::TogglePopup(event.geometry))
.await
.expect("Failed to send open popup event");
} else if event.cmd == "popup:open" {
tx.send(ModuleUpdateEvent::OpenPopup(event.geometry))
.await
.expect("Failed to send open popup event");
} else if event.cmd == "popup:close" {
tx.send(ModuleUpdateEvent::ClosePopup)
.await
.expect("Failed to send open popup event");
} else {
error!("Received invalid command: '{}'", event.cmd);
}
}
});
Ok(())
}
fn into_widget(
self,
context: WidgetContext<Self::SendMessage, Self::ReceiveMessage>,
info: &ModuleInfo,
) -> Result<ModuleWidget<gtk::Box>> {
let orientation = info.bar_position.get_orientation();
let container = gtk::Box::builder().orientation(orientation).build();
if let Some(ref class) = self.class {
container.style_context().add_class(class);
}
self.bar.clone().into_iter().for_each(|widget| {
widget.add_to(&container, context.controller_tx.clone(), orientation);
});
let popup = self.into_popup(context.controller_tx, context.popup_rx);
Ok(ModuleWidget {
widget: container,
popup,
})
}
fn into_popup(
self,
tx: Sender<Self::ReceiveMessage>,
_rx: glib::Receiver<Self::SendMessage>,
) -> Option<gtk::Box>
where
Self: Sized,
{
let container = gtk::Box::builder().name("popup-custom").build();
if let Some(class) = self.class {
container
.style_context()
.add_class(format!("popup-{class}").as_str());
}
if let Some(popup) = self.popup {
popup
.into_iter()
.for_each(|widget| widget.add_to(&container, tx.clone(), Orientation::Horizontal));
}
Some(container)
}
}

View File

@@ -1,12 +1,13 @@
use crate::icon; use crate::modules::{Module, ModuleInfo, ModuleUpdateEvent, ModuleWidget, WidgetContext};
use crate::modules::{Module, ModuleInfo}; use crate::wayland::ToplevelChange;
use crate::sway::get_client; use crate::{await_sync, icon, wayland};
use color_eyre::Result; use color_eyre::Result;
use glib::Continue; use glib::Continue;
use gtk::prelude::*; use gtk::prelude::*;
use gtk::{IconTheme, Image, Label, Orientation}; use gtk::{IconTheme, Image, Label};
use serde::Deserialize; use serde::Deserialize;
use tokio::task::spawn_blocking; use tokio::spawn;
use tokio::sync::mpsc::{Receiver, Sender};
#[derive(Debug, Deserialize, Clone)] #[derive(Debug, Deserialize, Clone)]
pub struct FocusedModule { pub struct FocusedModule {
@@ -29,14 +30,69 @@ const fn default_icon_size() -> i32 {
} }
impl Module<gtk::Box> for FocusedModule { impl Module<gtk::Box> for FocusedModule {
fn into_widget(self, _info: &ModuleInfo) -> Result<gtk::Box> { type SendMessage = (String, String);
type ReceiveMessage = ();
fn spawn_controller(
&self,
_info: &ModuleInfo,
tx: Sender<ModuleUpdateEvent<Self::SendMessage>>,
_rx: Receiver<Self::ReceiveMessage>,
) -> Result<()> {
let focused = await_sync(async {
let wl = wayland::get_client().await;
let toplevels = wl
.toplevels
.read()
.expect("Failed to get read lock on toplevels")
.clone();
toplevels.into_iter().find(|(_, (top, _))| top.active)
});
if let Some((_, (top, _))) = focused {
tx.try_send(ModuleUpdateEvent::Update((top.title.clone(), top.app_id)))?;
}
spawn(async move {
let mut wlrx = {
let wl = wayland::get_client().await;
wl.subscribe_toplevels()
};
while let Ok(event) = wlrx.recv().await {
let update = match event.change {
ToplevelChange::Focus(focus) => focus,
ToplevelChange::Title(_) => event.toplevel.active,
_ => false,
};
if update {
tx.send(ModuleUpdateEvent::Update((
event.toplevel.title,
event.toplevel.app_id,
)))
.await
.expect("Failed to send focus update");
}
}
});
Ok(())
}
fn into_widget(
self,
context: WidgetContext<Self::SendMessage, Self::ReceiveMessage>,
info: &ModuleInfo,
) -> Result<ModuleWidget<gtk::Box>> {
let icon_theme = IconTheme::new(); let icon_theme = IconTheme::new();
if let Some(theme) = self.icon_theme { if let Some(theme) = self.icon_theme {
icon_theme.set_custom_theme(Some(&theme)); icon_theme.set_custom_theme(Some(&theme));
} }
let container = gtk::Box::new(Orientation::Horizontal, 5); let container = gtk::Box::new(info.bar_position.get_orientation(), 5);
let icon = Image::builder().name("icon").build(); let icon = Image::builder().name("icon").build();
let label = Label::builder().name("label").build(); let label = Label::builder().name("label").build();
@@ -44,59 +100,25 @@ impl Module<gtk::Box> for FocusedModule {
container.add(&icon); container.add(&icon);
container.add(&label); container.add(&label);
let (tx, rx) = glib::MainContext::channel(glib::PRIORITY_DEFAULT);
let focused = {
let sway = get_client();
let mut sway = sway.lock().expect("Failed to get lock on Sway IPC client");
sway.get_open_windows()?
.into_iter()
.find(|node| node.focused)
};
if let Some(focused) = focused {
tx.send(focused)?;
}
spawn_blocking(move || {
let srx = {
let sway = get_client();
let mut sway = sway.lock().expect("Failed to get lock on Sway IPC client");
sway.subscribe_window()
};
while let Ok(payload) = srx.recv() {
let update = match payload.change.as_str() {
"focus" => true,
"title" => payload.container.focused,
_ => false,
};
if update {
tx.send(payload.container)
.expect("Failed to sendf focus update");
}
}
});
{ {
rx.attach(None, move |node| { context.widget_rx.attach(None, move |(name, id)| {
let value = node.name.as_deref().unwrap_or_else(|| node.get_id()); let pixbuf = icon::get_icon(&icon_theme, &id, self.icon_size);
let pixbuf = icon::get_icon(&icon_theme, node.get_id(), self.icon_size);
if self.show_icon { if self.show_icon {
icon.set_pixbuf(pixbuf.as_ref()); icon.set_pixbuf(pixbuf.as_ref());
} }
if self.show_title { if self.show_title {
label.set_label(value); label.set_label(&name);
} }
Continue(true) Continue(true)
}); });
} }
Ok(container) Ok(ModuleWidget {
widget: container,
popup: None,
})
} }
} }

View File

@@ -1,292 +1,258 @@
use crate::collection::Collection; use super::open_state::OpenState;
use crate::icon::{find_desktop_file, get_icon}; use crate::icon::get_icon;
use crate::modules::launcher::open_state::OpenState; use crate::modules::launcher::{ItemEvent, LauncherUpdate};
use crate::modules::launcher::popup::Popup; use crate::modules::ModuleUpdateEvent;
use crate::modules::launcher::FocusEvent; use crate::popup::Popup;
use crate::sway::SwayNode; use crate::wayland::ToplevelInfo;
use crate::Report;
use color_eyre::Help;
use gtk::prelude::*; use gtk::prelude::*;
use gtk::{Button, IconTheme, Image}; use gtk::{Button, IconTheme, Image, Orientation};
use std::process::{Command, Stdio}; use indexmap::IndexMap;
use std::rc::Rc; use std::rc::Rc;
use std::sync::{Arc, RwLock}; use std::sync::RwLock;
use tokio::spawn; use tokio::sync::mpsc::Sender;
use tokio::sync::mpsc;
use tracing::error;
#[derive(Debug, Clone)] #[derive(Debug, Clone)]
pub struct LauncherItem { pub struct Item {
pub app_id: String, pub app_id: String,
pub favorite: bool, pub favorite: bool,
pub windows: Rc<RwLock<Collection<i32, LauncherWindow>>>,
pub state: Arc<RwLock<State>>,
pub button: Button,
}
#[derive(Debug, Clone)]
pub struct LauncherWindow {
pub con_id: i32,
pub name: Option<String>,
pub open_state: OpenState, pub open_state: OpenState,
pub windows: IndexMap<usize, Window>,
pub name: String,
} }
#[derive(Debug, Clone)] impl Item {
pub struct State { pub fn new(app_id: String, open_state: OpenState, favorite: bool) -> Self {
pub is_xwayland: bool, Self {
pub open_state: OpenState,
}
#[derive(Debug, Clone)]
pub struct ButtonConfig {
pub icon_theme: IconTheme,
pub show_names: bool,
pub show_icons: bool,
pub popup: Popup,
pub tx: mpsc::Sender<FocusEvent>,
}
impl LauncherItem {
pub fn new(app_id: String, favorite: bool, config: &ButtonConfig) -> Self {
let button = Button::new();
button.style_context().add_class("item");
let state = State {
open_state: OpenState::Closed,
is_xwayland: false,
};
let item = Self {
app_id, app_id,
favorite, favorite,
windows: Rc::new(RwLock::new(Collection::new())), open_state,
state: Arc::new(RwLock::new(state)), windows: IndexMap::new(),
button, name: String::new(),
}; }
item.configure_button(config);
item
} }
pub fn from_node(node: &SwayNode, config: &ButtonConfig) -> Self { /// Merges the provided node into this launcher item
let button = Button::new(); pub fn merge_toplevel(&mut self, node: ToplevelInfo) -> Window {
button.style_context().add_class("item"); let id = node.id;
let windows = Collection::from(( if self.windows.is_empty() {
node.id, self.name = node.title.clone();
LauncherWindow { }
con_id: node.id,
name: node.name.clone(),
open_state: OpenState::from_node(node),
},
));
let state = State { let window: Window = node.into();
open_state: OpenState::from_node(node), self.windows.insert(id, window.clone());
is_xwayland: node.is_xwayland(),
};
let item = Self { self.recalculate_open_state();
app_id: node.get_id().to_string(),
favorite: false,
windows: Rc::new(RwLock::new(windows)),
state: Arc::new(RwLock::new(state)),
button,
};
item.configure_button(config); window
item
} }
fn configure_button(&self, config: &ButtonConfig) { pub fn unmerge_toplevel(&mut self, node: &ToplevelInfo) {
let button = &self.button; self.windows.remove(&node.id);
self.recalculate_open_state();
}
let windows = self pub fn set_window_name(&mut self, window_id: usize, name: String) {
.windows if let Some(window) = self.windows.get_mut(&window_id) {
.read() if let OpenState::Open { focused: true, .. } = window.open_state {
.expect("Failed to get read lock on windows"); self.name = name.clone();
let name = if windows.len() == 1 {
windows
.first()
.expect("Failed to get first window")
.name
.as_ref()
} else {
Some(&self.app_id)
};
if let Some(name) = name {
self.set_title(name, config);
}
if config.show_icons {
let icon = get_icon(&config.icon_theme, &self.app_id, 32);
if icon.is_some() {
let image = Image::from_pixbuf(icon.as_ref());
button.set_image(Some(&image));
button.set_always_show_image(true);
}
}
let app_id = self.app_id.clone();
let state = Arc::clone(&self.state);
let tx_click = config.tx.clone();
let (focus_tx, mut focus_rx) = mpsc::channel(32);
button.connect_clicked(move |_| {
let state = state.read().expect("Failed to get read lock on state");
if state.open_state.is_open() {
focus_tx.try_send(()).expect("Failed to send focus event");
} else {
// attempt to find desktop file and launch
match find_desktop_file(&app_id) {
Some(file) => {
if let Err(err) = Command::new("gtk-launch")
.arg(
file.file_name()
.expect("File segment missing from path to desktop file"),
)
.stdout(Stdio::null())
.stderr(Stdio::null())
.spawn()
{
error!(
"{:?}",
Report::new(err)
.wrap_err("Failed to run gtk-launch command.")
.suggestion("Perhaps the desktop file is invalid?")
);
}
}
None => error!("Could not find desktop file for {}", app_id),
}
}
});
let app_id = self.app_id.clone();
let state = Arc::clone(&self.state);
spawn(async move {
while focus_rx.recv().await == Some(()) {
let state = state.read().expect("Failed to get read lock on state");
if state.is_xwayland {
tx_click
.try_send(FocusEvent::Class(app_id.clone()))
.expect("Failed to send focus event");
} else {
tx_click
.try_send(FocusEvent::AppId(app_id.clone()))
.expect("Failed to send focus event");
}
}
});
let popup = config.popup.clone();
let popup2 = config.popup.clone();
let windows = Rc::clone(&self.windows);
let tx_hover = config.tx.clone();
button.connect_enter_notify_event(move |button, _| {
let windows = windows.read().expect("Failed to get read lock on windows");
if windows.len() > 1 {
popup.set_windows(windows.as_slice(), &tx_hover);
popup.show(button);
} }
Inhibit(false) window.name = name;
});
{}
button.connect_leave_notify_event(move |_, e| {
let (_, y) = e.position();
// hover boundary
if y > 2.0 {
popup2.hide();
}
Inhibit(false)
});
let style = button.style_context();
style.add_class("launcher-item");
self.update_button_classes(&self.state.read().expect("Failed to get read lock on state"));
button.show_all();
}
pub fn set_title(&self, title: &str, config: &ButtonConfig) {
if config.show_names {
self.button.set_label(title);
} else {
self.button.set_tooltip_text(Some(title));
};
}
/// Updates the classnames on the GTK button
/// based on its current state.
///
/// State must be passed as an arg here rather than
/// using `self.state` to avoid a weird `RwLock` issue.
pub fn update_button_classes(&self, state: &State) {
let style = self.button.style_context();
if self.favorite {
style.add_class("favorite");
} else {
style.remove_class("favorite");
}
if state.open_state.is_open() {
style.add_class("open");
} else {
style.remove_class("open");
}
if state.open_state.is_focused() {
style.add_class("focused");
} else {
style.remove_class("focused");
}
if state.open_state.is_urgent() {
style.add_class("urgent");
} else {
style.remove_class("urgent");
} }
} }
/// Sets the open state for a specific window on the item pub fn set_window_focused(&mut self, window_id: usize, focused: bool) {
/// and updates the item state based on all its windows. if let Some(window) = self.windows.get_mut(&window_id) {
pub fn set_window_open_state(&self, window_id: i32, new_state: OpenState, state: &mut State) { window.open_state =
let mut windows = self OpenState::merge_states(&[&window.open_state, &OpenState::focused(focused)]);
.windows
.write()
.expect("Failed to get write lock on windows");
let window = windows.iter_mut().find(|w| w.con_id == window_id); self.recalculate_open_state();
if let Some(window) = window {
window.open_state = new_state;
state.open_state =
OpenState::merge_states(windows.iter().map(|w| &w.open_state).collect());
} }
} }
/// Sets the open state on the item and all its windows. /// Sets this item's open state
/// This overrides the existing open states. /// to the merged result of its windows' open states
pub fn set_open_state(&self, new_state: OpenState, state: &mut State) { fn recalculate_open_state(&mut self) {
state.open_state = new_state; let new_state = OpenState::merge_states(
let mut windows = self &self
.windows .windows
.write() .iter()
.expect("Failed to get write lock on windows"); .map(|(_, win)| &win.open_state)
.collect::<Vec<_>>(),
windows );
.iter_mut() self.open_state = new_state;
.for_each(|window| window.open_state = new_state); }
}
impl From<ToplevelInfo> for Item {
fn from(toplevel: ToplevelInfo) -> Self {
let open_state = OpenState::from_toplevel(&toplevel);
let name = toplevel.title.clone();
let app_id = toplevel.app_id.clone();
let mut windows = IndexMap::new();
windows.insert(toplevel.id, toplevel.into());
Self {
app_id,
favorite: false,
open_state,
windows,
name,
}
}
}
#[derive(Clone, Debug)]
pub struct Window {
pub id: usize,
pub name: String,
pub open_state: OpenState,
}
impl From<ToplevelInfo> for Window {
fn from(node: ToplevelInfo) -> Self {
let open_state = OpenState::from_toplevel(&node);
Self {
id: node.id,
name: node.title,
open_state,
}
}
}
pub struct MenuState {
pub num_windows: usize,
}
pub struct ItemButton {
pub button: Button,
pub persistent: bool,
pub show_names: bool,
pub menu_state: Rc<RwLock<MenuState>>,
}
impl ItemButton {
pub fn new(
item: &Item,
show_names: bool,
show_icons: bool,
orientation: Orientation,
icon_theme: &IconTheme,
tx: &Sender<ModuleUpdateEvent<LauncherUpdate>>,
controller_tx: &Sender<ItemEvent>,
) -> Self {
let mut button = Button::builder();
if show_names {
button = button.label(&item.name);
}
if show_icons {
let icon = get_icon(icon_theme, &item.app_id, 32);
if icon.is_some() {
let image = Image::from_pixbuf(icon.as_ref());
button = button.image(&image).always_show_image(true);
}
}
let button = button.build();
let style_context = button.style_context();
style_context.add_class("item");
if item.favorite {
style_context.add_class("favorite");
}
if item.open_state.is_open() {
style_context.add_class("open");
}
if item.open_state.is_focused() {
style_context.add_class("focused");
}
{
let app_id = item.app_id.clone();
let tx = controller_tx.clone();
button.connect_clicked(move |button| {
// lazy check :|
let style_context = button.style_context();
if style_context.has_class("open") {
tx.try_send(ItemEvent::FocusItem(app_id.clone()))
.expect("Failed to send item focus event");
} else {
tx.try_send(ItemEvent::OpenItem(app_id.clone()))
.expect("Failed to send item open event");
}
});
}
let menu_state = Rc::new(RwLock::new(MenuState {
num_windows: item.windows.len(),
}));
{
let app_id = item.app_id.clone();
let tx = tx.clone();
let menu_state = menu_state.clone();
button.connect_enter_notify_event(move |button, _| {
let menu_state = menu_state
.read()
.expect("Failed to get read lock on item menu state");
if menu_state.num_windows > 1 {
tx.try_send(ModuleUpdateEvent::Update(LauncherUpdate::Hover(
app_id.clone(),
)))
.expect("Failed to send item open popup event");
tx.try_send(ModuleUpdateEvent::OpenPopup(Popup::button_pos(
button,
orientation,
)))
.expect("Failed to send item open popup event");
} else {
tx.try_send(ModuleUpdateEvent::ClosePopup)
.expect("Failed to send item close popup event");
}
Inhibit(false)
});
}
button.show_all();
Self {
button,
persistent: item.favorite,
show_names,
menu_state,
}
}
pub fn set_open(&self, open: bool) {
self.update_class("open", open);
if !open {
self.set_focused(false);
}
}
pub fn set_focused(&self, focused: bool) {
self.update_class("focused", focused);
}
/// Adds or removes a class to the button based on `toggle`.
fn update_class(&self, class: &str, toggle: bool) {
let style_context = self.button.style_context();
if toggle {
style_context.add_class(class);
} else {
style_context.remove_class(class);
}
} }
} }

View File

@@ -1,26 +1,28 @@
mod item; mod item;
mod open_state; mod open_state;
mod popup;
use crate::collection::Collection; use self::item::{Item, ItemButton, Window};
use crate::modules::launcher::item::{ButtonConfig, LauncherItem, LauncherWindow}; use self::open_state::OpenState;
use crate::modules::launcher::open_state::OpenState; use crate::icon::find_desktop_file;
use crate::modules::launcher::popup::Popup; use crate::modules::{Module, ModuleInfo, ModuleUpdateEvent, ModuleWidget, WidgetContext};
use crate::modules::{Module, ModuleInfo}; use crate::wayland;
use crate::sway::{get_client, SwayNode}; use crate::wayland::ToplevelChange;
use color_eyre::{Report, Result}; use color_eyre::{Help, Report};
use glib::Continue;
use gtk::prelude::*; use gtk::prelude::*;
use gtk::{IconTheme, Orientation}; use gtk::{Button, IconTheme, Orientation};
use indexmap::IndexMap;
use serde::Deserialize; use serde::Deserialize;
use std::rc::Rc; use std::process::{Command, Stdio};
use std::sync::{Arc, Mutex};
use tokio::spawn; use tokio::spawn;
use tokio::sync::mpsc; use tokio::sync::mpsc;
use tokio::task::spawn_blocking; use tokio::sync::mpsc::{Receiver, Sender};
use tracing::debug; use tracing::{debug, error, trace};
#[derive(Debug, Deserialize, Clone)] #[derive(Debug, Deserialize, Clone)]
pub struct LauncherModule { pub struct LauncherModule {
/// List of app IDs (or classes) to always show regardles of open state, /// List of app IDs (or classes) to always show regardless of open state,
/// in the order specified. /// in the order specified.
favorites: Option<Vec<String>>, favorites: Option<Vec<String>>,
/// Whether to show application names on the bar. /// Whether to show application names on the bar.
@@ -34,277 +36,501 @@ pub struct LauncherModule {
icon_theme: Option<String>, icon_theme: Option<String>,
} }
#[derive(Debug, Clone)]
pub enum LauncherUpdate {
/// Adds item
AddItem(Item),
/// Adds window to item with `app_id`
AddWindow(String, Window),
/// Removes item with `app_id`
RemoveItem(String),
/// Removes window from item with `app_id`.
RemoveWindow(String, usize),
/// Sets title for `app_id`
Title(String, usize, String),
/// Marks the item with `app_id` as focused or not focused
Focus(String, bool),
/// Declares the item with `app_id` has been hovered over
Hover(String),
}
#[derive(Debug)] #[derive(Debug)]
pub enum FocusEvent { pub enum ItemEvent {
AppId(String), FocusItem(String),
Class(String), FocusWindow(usize),
ConId(i32), OpenItem(String),
} }
type AppId = String; enum ItemOrWindow {
Item(Item),
struct Launcher { Window(Window),
items: Collection<AppId, LauncherItem>,
container: gtk::Box,
button_config: ButtonConfig,
} }
impl Launcher { enum ItemOrWindowId {
fn new(favorites: Vec<String>, container: gtk::Box, button_config: ButtonConfig) -> Self { Item,
let items = favorites Window,
.into_iter()
.map(|app_id| {
(
app_id.clone(),
LauncherItem::new(app_id, true, &button_config),
)
})
.collect::<Collection<_, _>>();
for item in &items {
container.add(&item.button);
}
Self {
items,
container,
button_config,
}
}
/// Adds a new window to the launcher.
/// This gets added to an existing group
/// if an instance of the program is already open.
fn add_window(&mut self, node: SwayNode) {
let id = node.get_id().to_string();
debug!("Adding window with ID {}", id);
if let Some(item) = self.items.get_mut(&id) {
let mut state = item
.state
.write()
.expect("Failed to get write lock on state");
let new_open_state = OpenState::from_node(&node);
state.open_state = OpenState::merge_states(vec![&state.open_state, &new_open_state]);
state.is_xwayland = node.is_xwayland();
item.update_button_classes(&state);
let mut windows = item
.windows
.write()
.expect("Failed to get write lock on windows");
windows.insert(
node.id,
LauncherWindow {
con_id: node.id,
name: node.name,
open_state: new_open_state,
},
);
} else {
let item = LauncherItem::from_node(&node, &self.button_config);
self.container.add(&item.button);
self.items.insert(id, item);
}
}
/// Removes a window from the launcher.
/// This removes it from the group if multiple instances were open.
/// The button will remain on the launcher if it is favourited.
fn remove_window(&mut self, window: &SwayNode) {
let id = window.get_id().to_string();
debug!("Removing window with ID {}", id);
let item = self.items.get_mut(&id);
let remove = if let Some(item) = item {
let windows = Rc::clone(&item.windows);
let mut windows = windows
.write()
.expect("Failed to get write lock on windows");
windows.remove(&window.id);
if windows.is_empty() {
let mut state = item.state.write().expect("Failed to get lock on windows");
state.open_state = OpenState::Closed;
item.update_button_classes(&state);
if item.favorite {
false
} else {
self.container.remove(&item.button);
true
}
} else {
false
}
} else {
false
};
if remove {
self.items.remove(&id);
}
}
/// Unfocuses the currently focused window
/// and focuses the newly focused one.
fn set_window_focused(&mut self, node: &SwayNode) {
let id = node.get_id().to_string();
debug!("Setting window with ID {} focused", id);
let prev_focused = self.items.iter_mut().find(|item| {
item.state
.read()
.expect("Failed to get read lock on state")
.open_state
.is_focused()
});
if let Some(prev_focused) = prev_focused {
let mut state = prev_focused
.state
.write()
.expect("Failed to get write lock on state");
// if a window from the same item took focus,
// we don't need to unfocus the item.
if prev_focused.app_id != id {
prev_focused.set_open_state(OpenState::open(), &mut state);
prev_focused.update_button_classes(&state);
}
}
let item = self.items.get_mut(&id);
if let Some(item) = item {
let mut state = item
.state
.write()
.expect("Failed to get write lock on state");
item.set_window_open_state(node.id, OpenState::focused(), &mut state);
item.update_button_classes(&state);
}
}
/// Updates the window title for the given node.
fn set_window_title(&mut self, window: SwayNode) {
let id = window.get_id().to_string();
let item = self.items.get_mut(&id);
debug!("Updating title for window with ID {}", id);
if let (Some(item), Some(name)) = (item, window.name) {
let mut windows = item
.windows
.write()
.expect("Failed to get write lock on windows");
if windows.len() == 1 {
item.set_title(&name, &self.button_config);
} else if let Some(window) = windows.get_mut(&window.id) {
window.name = Some(name);
} else {
// This should never happen
// But makes more sense to wipe title than keep old one in case of error
item.set_title("", &self.button_config);
}
}
}
/// Updates the window urgency based on the given node.
fn set_window_urgent(&mut self, node: &SwayNode) {
let id = node.get_id().to_string();
let item = self.items.get_mut(&id);
debug!(
"Setting urgency to {} for window with ID {}",
node.urgent, id
);
if let Some(item) = item {
let mut state = item
.state
.write()
.expect("Failed to get write lock on state");
item.set_window_open_state(node.id, OpenState::urgent(node.urgent), &mut state);
item.update_button_classes(&state);
}
}
} }
impl Module<gtk::Box> for LauncherModule { impl Module<gtk::Box> for LauncherModule {
fn into_widget(self, info: &ModuleInfo) -> Result<gtk::Box> { type SendMessage = LauncherUpdate;
let icon_theme = IconTheme::new(); type ReceiveMessage = ItemEvent;
if let Some(theme) = self.icon_theme { fn spawn_controller(
icon_theme.set_custom_theme(Some(&theme)); &self,
} _info: &ModuleInfo,
tx: Sender<ModuleUpdateEvent<Self::SendMessage>>,
let popup = Popup::new( mut rx: Receiver<Self::ReceiveMessage>,
"popup-launcher", ) -> crate::Result<()> {
info.app, let items = match &self.favorites {
info.monitor, Some(favorites) => favorites
Orientation::Vertical, .iter()
info.bar_position, .map(|app_id| {
); (
let container = gtk::Box::new(Orientation::Horizontal, 0); app_id.to_string(),
Item::new(app_id.to_string(), OpenState::Closed, true),
let (ui_tx, mut ui_rx) = mpsc::channel(32); )
})
let button_config = ButtonConfig { .collect::<IndexMap<_, _>>(),
icon_theme, None => IndexMap::new(),
show_names: self.show_names,
show_icons: self.show_icons,
popup,
tx: ui_tx,
}; };
let mut launcher = Launcher::new( let items = Arc::new(Mutex::new(items));
self.favorites.unwrap_or_default(),
container.clone(),
button_config,
);
let open_windows = {
let sway = get_client();
let mut sway = sway.lock().expect("Failed to get lock on Sway IPC client");
sway.get_open_windows()
}?;
for window in open_windows {
launcher.add_window(window);
}
let (tx, rx) = glib::MainContext::channel(glib::PRIORITY_DEFAULT);
spawn_blocking(move || {
let srx = {
let sway = get_client();
let mut sway = sway.lock().expect("Failed to get lock on Sway IPC client");
sway.subscribe_window()
};
while let Ok(payload) = srx.recv() {
tx.send(payload)
.expect("Failed to send window event payload");
}
});
{ {
let items = Arc::clone(&items);
let tx = tx.clone();
spawn(async move {
let wl = wayland::get_client().await;
let open_windows = wl
.toplevels
.read()
.expect("Failed to get read lock on toplevels");
let mut items = items.lock().expect("Failed to get lock on items");
for (_, (window, _)) in open_windows.clone() {
let item = items.get_mut(&window.app_id);
match item {
Some(item) => {
item.merge_toplevel(window);
}
None => {
items.insert(window.app_id.clone(), window.into());
}
}
}
let items = items.iter();
for (_, item) in items {
tx.try_send(ModuleUpdateEvent::Update(LauncherUpdate::AddItem(
item.clone(),
)))?;
}
Ok::<(), Report>(())
});
}
let items2 = Arc::clone(&items);
spawn(async move {
let items = items2;
let mut wlrx = {
let wl = wayland::get_client().await;
wl.subscribe_toplevels()
};
let send_update = |update: LauncherUpdate| tx.send(ModuleUpdateEvent::Update(update));
while let Ok(event) = wlrx.recv().await {
trace!("event: {:?}", event);
let window = event.toplevel;
let app_id = window.app_id.clone();
let items = || items.lock().expect("Failed to get lock on items");
match event.change {
ToplevelChange::New => {
let new_item = {
let mut items = items();
let item = items.get_mut(&app_id);
match item {
None => {
let item: Item = window.into();
items.insert(app_id.clone(), item.clone());
ItemOrWindow::Item(item)
}
Some(item) => {
let window = item.merge_toplevel(window);
ItemOrWindow::Window(window)
}
}
};
match new_item {
ItemOrWindow::Item(item) => {
send_update(LauncherUpdate::AddItem(item)).await
}
ItemOrWindow::Window(window) => {
send_update(LauncherUpdate::AddWindow(app_id, window)).await
}
}?;
}
ToplevelChange::Close => {
let remove_item = {
let mut items = items();
let item = items.get_mut(&app_id);
match item {
Some(item) => {
item.unmerge_toplevel(&window);
if item.windows.is_empty() {
items.remove(&app_id);
Some(ItemOrWindowId::Item)
} else {
Some(ItemOrWindowId::Window)
}
}
None => None,
}
};
match remove_item {
Some(ItemOrWindowId::Item) => {
send_update(LauncherUpdate::RemoveItem(app_id)).await?;
}
Some(ItemOrWindowId::Window) => {
send_update(LauncherUpdate::RemoveWindow(app_id, window.id))
.await?;
}
None => {}
};
}
ToplevelChange::Focus(focused) => {
let update_title = if focused {
if let Some(item) = items().get_mut(&app_id) {
item.set_window_focused(window.id, true);
// might be switching focus between windows of same app
if item.windows.len() > 1 {
item.set_window_name(window.id, window.title.clone());
true
} else {
false
}
} else {
false
}
} else {
false
};
send_update(LauncherUpdate::Focus(app_id.clone(), focused)).await?;
if update_title {
send_update(LauncherUpdate::Title(app_id, window.id, window.title))
.await?;
}
}
ToplevelChange::Title(title) => {
if let Some(item) = items().get_mut(&app_id) {
item.set_window_name(window.id, title.clone());
}
send_update(LauncherUpdate::Title(app_id, window.id, title)).await?;
}
ToplevelChange::Fullscreen(_) => {}
}
}
Ok::<(), mpsc::error::SendError<ModuleUpdateEvent<LauncherUpdate>>>(())
});
// listen to ui events
spawn(async move {
while let Some(event) = rx.recv().await {
trace!("{:?}", event);
if let ItemEvent::OpenItem(app_id) = event {
find_desktop_file(&app_id).map_or_else(
|| error!("Could not find desktop file for {}", app_id),
|file| {
if let Err(err) = Command::new("gtk-launch")
.arg(
file.file_name()
.expect("File segment missing from path to desktop file"),
)
.stdout(Stdio::null())
.stderr(Stdio::null())
.spawn()
{
error!(
"{:?}",
Report::new(err)
.wrap_err("Failed to run gtk-launch command.")
.suggestion("Perhaps the desktop file is invalid?")
);
}
},
);
} else {
let wl = wayland::get_client().await;
let items = items.lock().expect("Failed to get lock on items");
let id = match event {
ItemEvent::FocusItem(app_id) => items
.get(&app_id)
.and_then(|item| item.windows.first().map(|(_, win)| win.id)),
ItemEvent::FocusWindow(id) => Some(id),
ItemEvent::OpenItem(_) => unreachable!(),
};
if let Some(id) = id {
let toplevels = wl
.toplevels
.read()
.expect("Failed to get read lock on toplevels");
let seat = wl.seats.first().expect("Failed to get Wayland seat");
if let Some((_top, handle)) = toplevels.get(&id) {
handle.activate(seat);
};
}
}
}
Ok::<(), swayipc_async::Error>(())
});
Ok(())
}
fn into_widget(
self,
context: WidgetContext<Self::SendMessage, Self::ReceiveMessage>,
info: &ModuleInfo,
) -> crate::Result<ModuleWidget<gtk::Box>> {
let icon_theme = IconTheme::new();
if let Some(ref theme) = self.icon_theme {
icon_theme.set_custom_theme(Some(theme));
}
let container = gtk::Box::new(info.bar_position.get_orientation(), 0);
{
let container = container.clone();
let show_names = self.show_names;
let show_icons = self.show_icons;
let orientation = info.bar_position.get_orientation();
let mut buttons = IndexMap::<String, ItemButton>::new();
let controller_tx2 = context.controller_tx.clone();
context.widget_rx.attach(None, move |event| {
match event {
LauncherUpdate::AddItem(item) => {
debug!("Adding item with id {}", item.app_id);
if let Some(button) = buttons.get(&item.app_id) {
button.set_open(true);
} else {
let button = ItemButton::new(
&item,
show_names,
show_icons,
orientation,
&icon_theme,
&context.tx,
&controller_tx2,
);
container.add(&button.button);
buttons.insert(item.app_id, button);
}
}
LauncherUpdate::AddWindow(app_id, _) => {
if let Some(button) = buttons.get(&app_id) {
button.set_open(true);
let mut menu_state = button
.menu_state
.write()
.expect("Failed to get write lock on item menu state");
menu_state.num_windows += 1;
}
}
LauncherUpdate::RemoveItem(app_id) => {
debug!("Removing item with id {}", app_id);
if let Some(button) = buttons.get(&app_id) {
if button.persistent {
button.set_open(false);
if button.show_names {
button.button.set_label(&app_id);
}
} else {
container.remove(&button.button);
buttons.remove(&app_id);
}
}
}
LauncherUpdate::RemoveWindow(app_id, _) => {
if let Some(button) = buttons.get(&app_id) {
let mut menu_state = button
.menu_state
.write()
.expect("Failed to get write lock on item menu state");
menu_state.num_windows -= 1;
}
}
LauncherUpdate::Focus(app_id, focus) => {
debug!("Changing focus to {} on item with id {}", focus, app_id);
if let Some(button) = buttons.get(&app_id) {
button.set_focused(focus);
}
}
LauncherUpdate::Title(app_id, _, name) => {
debug!("Updating title for item with id {}: {:?}", app_id, name);
if show_names {
if let Some(button) = buttons.get(&app_id) {
button.button.set_label(&name);
}
}
}
LauncherUpdate::Hover(_) => {}
};
Continue(true)
});
}
let popup = self.into_popup(context.controller_tx, context.popup_rx);
Ok(ModuleWidget {
widget: container,
popup,
})
}
fn into_popup(
self,
controller_tx: Sender<Self::ReceiveMessage>,
rx: glib::Receiver<Self::SendMessage>,
) -> Option<gtk::Box> {
const MAX_WIDTH: i32 = 250;
let container = gtk::Box::builder()
.orientation(Orientation::Vertical)
.name("popup-launcher")
.build();
// we need some content to force the container to have a size
let placeholder = Button::with_label("PLACEHOLDER");
placeholder.set_width_request(MAX_WIDTH);
container.add(&placeholder);
let mut buttons = IndexMap::<String, IndexMap<usize, Button>>::new();
{
let container = container.clone();
rx.attach(None, move |event| { rx.attach(None, move |event| {
match event.change.as_str() { match event {
"new" => launcher.add_window(event.container), LauncherUpdate::AddItem(item) => {
"close" => launcher.remove_window(&event.container), let app_id = item.app_id.clone();
"focus" => launcher.set_window_focused(&event.container), trace!("Adding item with id '{app_id}' to the popup: {item:?}");
"title" => launcher.set_window_title(event.container),
"urgent" => launcher.set_window_urgent(&event.container), let window_buttons = item
.windows
.into_iter()
.map(|(_, win)| {
let button = Button::builder()
.label(&clamp(&win.name))
.height_request(40)
.build();
{
let tx = controller_tx.clone();
button.connect_clicked(move |button| {
tx.try_send(ItemEvent::FocusWindow(win.id))
.expect("Failed to send window click event");
if let Some(win) = button.window() {
win.hide();
}
});
}
(win.id, button)
})
.collect();
buttons.insert(app_id, window_buttons);
}
LauncherUpdate::AddWindow(app_id, win) => {
debug!(
"Adding new window to popup for '{app_id}': '{}' ({})",
win.name, win.id
);
if let Some(buttons) = buttons.get_mut(&app_id) {
let button = Button::builder()
.height_request(40)
.label(&clamp(&win.name))
.build();
{
let tx = controller_tx.clone();
button.connect_clicked(move |button| {
tx.try_send(ItemEvent::FocusWindow(win.id))
.expect("Failed to send window click event");
if let Some(win) = button.window() {
win.hide();
}
});
}
buttons.insert(win.id, button);
}
}
LauncherUpdate::RemoveWindow(app_id, win_id) => {
debug!("Removing window from popup for '{app_id}': {win_id}");
if let Some(buttons) = buttons.get_mut(&app_id) {
buttons.remove(&win_id);
}
}
LauncherUpdate::Title(app_id, win_id, title) => {
debug!(
"Updating window title on popup for '{app_id}'/{win_id} to '{title}'"
);
if let Some(buttons) = buttons.get_mut(&app_id) {
if let Some(button) = buttons.get(&win_id) {
button.set_label(&title);
}
}
}
LauncherUpdate::Hover(app_id) => {
// empty current buttons
for child in container.children() {
container.remove(&child);
}
// add app's buttons
if let Some(buttons) = buttons.get(&app_id) {
for (_, button) in buttons {
button.style_context().add_class("popup-item");
container.add(button);
}
container.show_all();
container.set_width_request(MAX_WIDTH);
}
}
_ => {} _ => {}
} }
@@ -312,22 +538,21 @@ impl Module<gtk::Box> for LauncherModule {
}); });
} }
spawn(async move { Some(container)
let sway = get_client(); }
}
while let Some(event) = ui_rx.recv().await {
let selector = match event { /// Clamps a string at 24 characters.
FocusEvent::AppId(app_id) => format!("[app_id={}]", app_id), ///
FocusEvent::Class(class) => format!("[class={}]", class), /// This is a hacky number derived from
FocusEvent::ConId(id) => format!("[con_id={}]", id), /// "what fits inside the 250px popup"
}; /// and probably won't hold up with wide fonts.
let mut sway = sway.lock().expect("Failed to get lock on Sway IPC client"); fn clamp(str: &str) -> String {
sway.run(format!("{} focus", selector))?; const MAX_CHARS: usize = 24;
}
if str.len() > MAX_CHARS {
Ok::<(), Report>(()) str.chars().take(MAX_CHARS - 3).collect::<String>() + "..."
}); } else {
str.to_string()
Ok(container)
} }
} }

View File

@@ -1,43 +1,23 @@
use crate::sway::SwayNode; use crate::wayland::ToplevelInfo;
/// Open state for a launcher item, or item window. /// Open state for a launcher item, or item window.
#[derive(Debug, Clone, Eq, PartialEq, Copy)] #[derive(Debug, Clone, Eq, PartialEq, Copy)]
pub enum OpenState { pub enum OpenState {
Closed, Closed,
Open { focused: bool, urgent: bool }, Open { focused: bool },
} }
impl OpenState { impl OpenState {
/// Creates from `SwayNode` /// Creates from `SwayNode`
pub const fn from_node(node: &SwayNode) -> Self { pub const fn from_toplevel(toplevel: &ToplevelInfo) -> Self {
Self::Open { Self::Open {
focused: node.focused, focused: toplevel.active,
urgent: node.urgent,
}
}
/// Creates open without focused/urgent
pub const fn open() -> Self {
Self::Open {
focused: false,
urgent: false,
} }
} }
/// Creates open with focused /// Creates open with focused
pub const fn focused() -> Self { pub const fn focused(focused: bool) -> Self {
Self::Open { Self::Open { focused }
focused: true,
urgent: false,
}
}
/// Creates open with urgent
pub const fn urgent(urgent: bool) -> Self {
Self::Open {
focused: false,
urgent,
}
} }
/// Checks if open /// Checks if open
@@ -47,24 +27,18 @@ impl OpenState {
/// Checks if open with focus /// Checks if open with focus
pub const fn is_focused(self) -> bool { pub const fn is_focused(self) -> bool {
matches!(self, Self::Open { focused: true, .. }) matches!(self, Self::Open { focused: true })
}
/// check if open with urgent
pub const fn is_urgent(self) -> bool {
matches!(self, Self::Open { urgent: true, .. })
} }
/// Merges states together to produce a single state. /// Merges states together to produce a single state.
/// This is effectively an OR operation, /// This is effectively an OR operation,
/// so sets state to open and flags to true if any state is open /// so sets state to open and flags to true if any state is open
/// or any instance of the flag is true. /// or any instance of the flag is true.
pub fn merge_states(states: Vec<&Self>) -> Self { pub fn merge_states(states: &[&Self]) -> Self {
states.iter().fold(Self::Closed, |merged, current| { states.iter().fold(Self::Closed, |merged, current| {
if merged.is_open() || current.is_open() { if merged.is_open() || current.is_open() {
Self::Open { Self::Open {
focused: merged.is_focused() || current.is_focused(), focused: merged.is_focused() || current.is_focused(),
urgent: merged.is_urgent() || current.is_urgent(),
} }
} else { } else {
Self::Closed Self::Closed

View File

@@ -1,36 +0,0 @@
use crate::modules::launcher::item::LauncherWindow;
use crate::modules::launcher::FocusEvent;
pub use crate::popup::Popup;
use gtk::prelude::*;
use gtk::Button;
use tokio::sync::mpsc;
impl Popup {
pub fn set_windows(&self, windows: &[LauncherWindow], tx: &mpsc::Sender<FocusEvent>) {
// clear
for child in self.container.children() {
self.container.remove(&child);
}
for window in windows {
let mut button_builder = Button::builder().height_request(40);
if let Some(name) = &window.name {
button_builder = button_builder.label(name);
}
let button = button_builder.build();
let con_id = window.con_id;
let window = self.window.clone();
let tx = tx.clone();
button.connect_clicked(move |_| {
tx.try_send(FocusEvent::ConId(con_id))
.expect("Failed to send focus event");
window.hide();
});
self.container.add(&button);
}
}
}

View File

@@ -5,6 +5,7 @@
/// Clicking the widget opens a popup containing the current time /// Clicking the widget opens a popup containing the current time
/// with second-level precision and a calendar. /// with second-level precision and a calendar.
pub mod clock; pub mod clock;
pub mod custom;
pub mod focused; pub mod focused;
pub mod launcher; pub mod launcher;
pub mod mpd; pub mod mpd;
@@ -14,12 +15,13 @@ pub mod tray;
pub mod workspaces; pub mod workspaces;
use crate::config::BarPosition; use crate::config::BarPosition;
use crate::popup::ButtonGeometry;
use color_eyre::Result; use color_eyre::Result;
/// Shamelessly stolen from here: use derive_builder::Builder;
/// <https://github.com/zeroeightysix/rustbar/blob/master/src/modules/module.rs>
use glib::IsA; use glib::IsA;
use gtk::gdk::Monitor; use gtk::gdk::Monitor;
use gtk::{Application, Widget}; use gtk::{Application, Widget};
use tokio::sync::mpsc;
#[derive(Clone)] #[derive(Clone)]
pub enum ModuleLocation { pub enum ModuleLocation {
@@ -28,19 +30,70 @@ pub enum ModuleLocation {
Right, Right,
} }
#[derive(Builder)]
pub struct ModuleInfo<'a> { pub struct ModuleInfo<'a> {
pub app: &'a Application, pub app: &'a Application,
pub location: ModuleLocation, pub location: ModuleLocation,
pub bar_position: &'a BarPosition, pub bar_position: BarPosition,
pub monitor: &'a Monitor, pub monitor: &'a Monitor,
pub output_name: &'a str, pub output_name: &'a str,
pub module_name: &'a str,
}
#[derive(Debug)]
pub enum ModuleUpdateEvent<T> {
/// Sends an update to the module UI
Update(T),
/// Toggles the open state of the popup.
TogglePopup(ButtonGeometry),
/// Force sets the popup open.
/// Takes the button X position and width.
OpenPopup(ButtonGeometry),
/// Force sets the popup closed.
ClosePopup,
}
pub struct WidgetContext<TSend, TReceive> {
pub id: usize,
pub tx: mpsc::Sender<ModuleUpdateEvent<TSend>>,
pub controller_tx: mpsc::Sender<TReceive>,
pub widget_rx: glib::Receiver<TSend>,
pub popup_rx: glib::Receiver<TSend>,
}
pub struct ModuleWidget<W: IsA<Widget>> {
pub widget: W,
pub popup: Option<gtk::Box>,
} }
pub trait Module<W> pub trait Module<W>
where where
W: IsA<Widget>, W: IsA<Widget>,
{ {
/// Consumes the module config type SendMessage;
/// and produces a GTK widget of type `W` type ReceiveMessage;
fn into_widget(self, info: &ModuleInfo) -> Result<W>;
fn spawn_controller(
&self,
info: &ModuleInfo,
tx: mpsc::Sender<ModuleUpdateEvent<Self::SendMessage>>,
rx: mpsc::Receiver<Self::ReceiveMessage>,
) -> Result<()>;
fn into_widget(
self,
context: WidgetContext<Self::SendMessage, Self::ReceiveMessage>,
info: &ModuleInfo,
) -> Result<ModuleWidget<W>>;
fn into_popup(
self,
_tx: mpsc::Sender<Self::ReceiveMessage>,
_rx: glib::Receiver<Self::SendMessage>,
) -> Option<gtk::Box>
where
Self: Sized,
{
None
}
} }

View File

@@ -1,53 +1,128 @@
use lazy_static::lazy_static; use lazy_static::lazy_static;
use mpd_client::client::Connection; use mpd_client::client::{CommandError, Connection, ConnectionEvent, Subsystem};
use mpd_client::commands::Command;
use mpd_client::protocol::MpdProtocolError; use mpd_client::protocol::MpdProtocolError;
use mpd_client::responses::Status; use mpd_client::responses::Status;
use mpd_client::Client; use mpd_client::Client;
use std::collections::HashMap; use std::collections::HashMap;
use std::fmt::{Display, Formatter};
use std::os::unix::fs::FileTypeExt;
use std::path::PathBuf; use std::path::PathBuf;
use std::sync::Arc; use std::sync::Arc;
use std::time::Duration; use std::time::Duration;
use tokio::net::{TcpStream, UnixStream}; use tokio::net::{TcpStream, UnixStream};
use tokio::spawn;
use tokio::sync::broadcast::{channel, error::SendError, Receiver, Sender};
use tokio::sync::Mutex; use tokio::sync::Mutex;
use tokio::time::sleep; use tokio::time::sleep;
use tracing::debug;
lazy_static! { lazy_static! {
static ref CLIENTS: Arc<Mutex<HashMap<String, Arc<Client>>>> = static ref CONNECTIONS: Arc<Mutex<HashMap<String, Arc<MpdClient>>>> =
Arc::new(Mutex::new(HashMap::new())); Arc::new(Mutex::new(HashMap::new()));
} }
pub async fn get_connection(host: &str) -> Option<Arc<Client>> { pub struct MpdClient {
let mut clients = CLIENTS.lock().await; client: Client,
tx: Sender<()>,
_rx: Receiver<()>,
}
match clients.get(host) { #[derive(Debug)]
Some(client) => Some(Arc::clone(client)), pub enum MpdConnectionError {
None => { MaxRetries,
let client = wait_for_connection(host, Duration::from_secs(5), None).await?; ProtocolError(MpdProtocolError),
let client = Arc::new(client); }
clients.insert(host.to_string(), Arc::clone(&client));
Some(client) impl Display for MpdConnectionError {
fn fmt(&self, f: &mut Formatter<'_>) -> std::fmt::Result {
match self {
Self::MaxRetries => write!(f, "Reached max retries"),
Self::ProtocolError(e) => write!(f, "{:?}", e),
} }
} }
} }
impl std::error::Error for MpdConnectionError {}
impl MpdClient {
async fn new(host: &str) -> Result<Self, MpdConnectionError> {
debug!("Creating new MPD connection to {}", host);
let (client, mut state_changes) =
wait_for_connection(host, Duration::from_secs(5), None).await?;
let (tx, rx) = channel(16);
let tx2 = tx.clone();
spawn(async move {
while let Some(change) = state_changes.next().await {
debug!("Received state change: {:?}", change);
if let ConnectionEvent::SubsystemChange(
Subsystem::Player | Subsystem::Queue | Subsystem::Mixer,
) = change
{
tx2.send(())?;
}
}
Ok::<(), SendError<()>>(())
});
Ok(Self {
client,
tx,
_rx: rx,
})
}
pub fn subscribe(&self) -> Receiver<()> {
self.tx.subscribe()
}
pub async fn command<C: Command>(&self, command: C) -> Result<C::Response, CommandError> {
self.client.command(command).await
}
}
pub async fn get_client(host: &str) -> Result<Arc<MpdClient>, MpdConnectionError> {
let mut connections = CONNECTIONS.lock().await;
match connections.get(host) {
None => {
let client = MpdClient::new(host).await?;
let client = Arc::new(client);
connections.insert(host.to_string(), Arc::clone(&client));
Ok(client)
}
Some(client) => Ok(Arc::clone(client)),
}
}
async fn wait_for_connection( async fn wait_for_connection(
host: &str, host: &str,
interval: Duration, interval: Duration,
max_retries: Option<usize>, max_retries: Option<usize>,
) -> Option<Client> { ) -> Result<Connection, MpdConnectionError> {
let mut retries = 0; let mut retries = 0;
let max_retries = max_retries.unwrap_or(usize::MAX); let max_retries = max_retries.unwrap_or(usize::MAX);
loop { loop {
if retries == max_retries { if retries == max_retries {
break None; break Err(MpdConnectionError::MaxRetries);
}
if let Some(conn) = try_get_mpd_conn(host).await {
break Some(conn.0);
} }
retries += 1; retries += 1;
match try_get_mpd_conn(host).await {
Ok(conn) => break Ok(conn),
Err(err) => {
if retries == max_retries {
break Err(MpdConnectionError::ProtocolError(err));
}
}
}
sleep(interval).await; sleep(interval).await;
} }
} }
@@ -55,18 +130,21 @@ async fn wait_for_connection(
/// Cycles through each MPD host and /// Cycles through each MPD host and
/// returns the first one which connects, /// returns the first one which connects,
/// or none if there are none /// or none if there are none
async fn try_get_mpd_conn(host: &str) -> Option<Connection> { async fn try_get_mpd_conn(host: &str) -> Result<Connection, MpdProtocolError> {
let connection = if is_unix_socket(host) { if is_unix_socket(host) {
connect_unix(host).await connect_unix(host).await
} else { } else {
connect_tcp(host).await connect_tcp(host).await
}; }
connection.ok()
} }
fn is_unix_socket(host: &str) -> bool { fn is_unix_socket(host: &str) -> bool {
PathBuf::from(host).is_file() let path = PathBuf::from(host);
path.exists()
&& match path.metadata() {
Ok(metadata) => metadata.file_type().is_socket(),
Err(_) => false,
}
} }
async fn connect_unix(host: &str) -> Result<Connection, MpdProtocolError> { async fn connect_unix(host: &str) -> Result<Connection, MpdProtocolError> {

View File

@@ -1,27 +1,57 @@
mod client; mod client;
mod popup;
use self::popup::Popup; use crate::modules::mpd::client::MpdConnectionError;
use crate::modules::mpd::client::{get_connection, get_duration, get_elapsed}; use crate::modules::mpd::client::{get_client, get_duration, get_elapsed};
use crate::modules::mpd::popup::{MpdPopup, PopupEvent}; use crate::modules::{Module, ModuleInfo, ModuleUpdateEvent, ModuleWidget, WidgetContext};
use crate::modules::{Module, ModuleInfo}; use crate::popup::Popup;
use color_eyre::Result; use color_eyre::Result;
use dirs::{audio_dir, home_dir}; use dirs::{audio_dir, home_dir};
use glib::Continue; use glib::Continue;
use gtk::gdk_pixbuf::Pixbuf;
use gtk::prelude::*; use gtk::prelude::*;
use gtk::{Button, Orientation}; use gtk::{Button, Image, Label, Orientation, Scale};
use mpd_client::commands; use mpd_client::commands;
use mpd_client::responses::{PlayState, Song, Status}; use mpd_client::responses::{PlayState, Song, Status};
use mpd_client::tag::Tag; use mpd_client::tag::Tag;
use regex::Regex; use regex::Regex;
use serde::Deserialize; use serde::Deserialize;
use std::path::PathBuf; use std::path::PathBuf;
use std::time::Duration;
use tokio::spawn; use tokio::spawn;
use tokio::sync::mpsc; use tokio::sync::mpsc;
use tokio::time::sleep; use tokio::sync::mpsc::{Receiver, Sender};
use tracing::error; use tracing::error;
#[derive(Debug)]
pub enum PlayerCommand {
Previous,
Toggle,
Next,
Volume(u8),
}
#[derive(Debug, Deserialize, Clone)]
pub struct Icons {
/// Icon to display when playing.
#[serde(default = "default_icon_play")]
play: String,
/// Icon to display when paused.
#[serde(default = "default_icon_pause")]
pause: String,
/// Icon to display under volume slider
#[serde(default = "default_icon_volume")]
volume: String,
}
impl Default for Icons {
fn default() -> Self {
Self {
pause: default_icon_pause(),
play: default_icon_play(),
volume: default_icon_volume(),
}
}
}
#[derive(Debug, Deserialize, Clone)] #[derive(Debug, Deserialize, Clone)]
pub struct MpdModule { pub struct MpdModule {
/// TCP or Unix socket address. /// TCP or Unix socket address.
@@ -30,12 +60,10 @@ pub struct MpdModule {
/// Format of current song info to display on the bar. /// Format of current song info to display on the bar.
#[serde(default = "default_format")] #[serde(default = "default_format")]
format: String, format: String,
/// Icon to display when playing.
#[serde(default = "default_icon_play")] /// Player state icons
icon_play: Option<String>, #[serde(default)]
/// Icon to display when paused. icons: Icons,
#[serde(default = "default_icon_pause")]
icon_pause: Option<String>,
/// Path to root of music directory. /// Path to root of music directory.
#[serde(default = "default_music_dir")] #[serde(default = "default_music_dir")]
@@ -50,14 +78,16 @@ fn default_format() -> String {
String::from("{icon} {title} / {artist}") String::from("{icon} {title} / {artist}")
} }
#[allow(clippy::unnecessary_wraps)] fn default_icon_play() -> String {
fn default_icon_play() -> Option<String> { String::from("")
Some(String::from(""))
} }
#[allow(clippy::unnecessary_wraps)] fn default_icon_pause() -> String {
fn default_icon_pause() -> Option<String> { String::from("")
Some(String::from("")) }
fn default_icon_volume() -> String {
String::from("")
} }
fn default_music_dir() -> PathBuf { fn default_music_dir() -> PathBuf {
@@ -89,76 +119,72 @@ fn get_tokens(re: &Regex, format_string: &str) -> Vec<String> {
.collect::<Vec<_>>() .collect::<Vec<_>>()
} }
enum Event { #[derive(Clone, Debug)]
Open, pub struct SongUpdate {
Update(Box<Option<(Song, Status, String)>>), song: Song,
status: Status,
display_string: String,
} }
impl Module<Button> for MpdModule { impl Module<Button> for MpdModule {
fn into_widget(self, info: &ModuleInfo) -> Result<Button> { type SendMessage = Option<SongUpdate>;
type ReceiveMessage = PlayerCommand;
fn spawn_controller(
&self,
_info: &ModuleInfo,
tx: Sender<ModuleUpdateEvent<Self::SendMessage>>,
mut rx: Receiver<Self::ReceiveMessage>,
) -> Result<()> {
let host1 = self.host.clone();
let host2 = self.host.clone();
let format = self.format.clone();
let icons = self.icons.clone();
let re = Regex::new(r"\{([\w-]+)}")?; let re = Regex::new(r"\{([\w-]+)}")?;
let tokens = get_tokens(&re, self.format.as_str()); let tokens = get_tokens(&re, self.format.as_str());
let button = Button::new(); // poll mpd server
let (ui_tx, mut ui_rx) = mpsc::channel(32);
let popup = Popup::new(
"popup-mpd",
info.app,
info.monitor,
Orientation::Horizontal,
info.bar_position,
);
let mpd_popup = MpdPopup::new(popup, ui_tx);
let (tx, rx) = glib::MainContext::channel(glib::PRIORITY_DEFAULT);
let click_tx = tx.clone();
let music_dir = self.music_dir.clone();
button.connect_clicked(move |_| {
click_tx
.send(Event::Open)
.expect("Failed to send popup open event");
});
let host = self.host.clone();
let host2 = self.host.clone();
spawn(async move { spawn(async move {
let client = get_connection(&host) let client = get_client(&host1).await.expect("Failed to connect to MPD");
.await let mut mpd_rx = client.subscribe();
.expect("Unexpected error when trying to connect to MPD server");
loop { loop {
let current_song = client.command(commands::CurrentSong).await; let current_song = client.command(commands::CurrentSong).await;
let status = client.command(commands::Status).await; let status = client.command(commands::Status).await;
if let (Ok(Some(song)), Ok(status)) = (current_song, status) { if let (Ok(Some(song)), Ok(status)) = (current_song, status) {
let string = self let display_string =
.replace_tokens(self.format.as_str(), &tokens, &song.song, &status) replace_tokens(format.as_str(), &tokens, &song.song, &status, &icons);
.await;
tx.send(Event::Update(Box::new(Some((song.song, status, string))))) let update = SongUpdate {
.expect("Failed to send update event"); song: song.song,
status,
display_string,
};
tx.send(ModuleUpdateEvent::Update(Some(update))).await?;
} else { } else {
tx.send(Event::Update(Box::new(None))) tx.send(ModuleUpdateEvent::Update(None)).await?;
.expect("Failed to send update event");
} }
sleep(Duration::from_secs(1)).await; // wait for player state change
if mpd_rx.recv().await.is_err() {
break;
}
} }
Ok::<(), mpsc::error::SendError<ModuleUpdateEvent<Self::SendMessage>>>(())
}); });
// listen to ui events
spawn(async move { spawn(async move {
let client = get_connection(&host2) let client = get_client(&host2).await?;
.await
.expect("Unexpected error when trying to connect to MPD server");
while let Some(event) = ui_rx.recv().await { while let Some(event) = rx.recv().await {
let res = match event { let res = match event {
PopupEvent::Previous => client.command(commands::Previous).await, PlayerCommand::Previous => client.command(commands::Previous).await,
PopupEvent::Toggle => match client.command(commands::Status).await { PlayerCommand::Toggle => match client.command(commands::Status).await {
Ok(status) => match status.state { Ok(status) => match status.state {
PlayState::Playing => client.command(commands::SetPause(true)).await, PlayState::Playing => client.command(commands::SetPause(true)).await,
PlayState::Paused => client.command(commands::SetPause(false)).await, PlayState::Paused => client.command(commands::SetPause(false)).await,
@@ -166,86 +192,300 @@ impl Module<Button> for MpdModule {
}, },
Err(err) => Err(err), Err(err) => Err(err),
}, },
PopupEvent::Next => client.command(commands::Next).await, PlayerCommand::Next => client.command(commands::Next).await,
PlayerCommand::Volume(vol) => client.command(commands::SetVolume(vol)).await,
}; };
if let Err(err) = res { if let Err(err) = res {
error!("Failed to send command to MPD server: {:?}", err); error!("Failed to send command to MPD server: {:?}", err);
} }
} }
Ok::<(), MpdConnectionError>(())
}); });
Ok(())
}
fn into_widget(
self,
context: WidgetContext<Self::SendMessage, Self::ReceiveMessage>,
info: &ModuleInfo,
) -> Result<ModuleWidget<Button>> {
let button = Button::new();
let label = Label::new(None);
label.set_angle(info.bar_position.get_angle());
button.add(&label);
let orientation = info.bar_position.get_orientation();
{
let tx = context.tx.clone();
button.connect_clicked(move |button| {
tx.try_send(ModuleUpdateEvent::TogglePopup(Popup::button_pos(
button,
orientation,
)))
.expect("Failed to send MPD popup open event");
});
}
{ {
let button = button.clone(); let button = button.clone();
let tx = context.tx.clone();
rx.attach(None, move |event| { context.widget_rx.attach(None, move |mut event| {
match event { if let Some(event) = event.take() {
Event::Open => { label.set_label(&event.display_string);
mpd_popup.popup.show(&button); button.show();
} } else {
Event::Update(mut msg) => { button.hide();
if let Some((song, status, string)) = msg.take() { tx.try_send(ModuleUpdateEvent::ClosePopup)
mpd_popup.update(&song, &status, music_dir.as_path()); .expect("Failed to send close popup message");
button.set_label(&string);
button.show();
} else {
button.hide();
}
}
} }
Continue(true) Continue(true)
}); });
}; };
Ok(button) let popup = self.into_popup(context.controller_tx, context.popup_rx);
}
}
impl MpdModule { Ok(ModuleWidget {
/// Replaces each of the formatting tokens in the formatting string widget: button,
/// with actual data pulled from MPD popup,
async fn replace_tokens( })
&self, }
format_string: &str,
tokens: &Vec<String>, fn into_popup(
song: &Song, self,
status: &Status, tx: Sender<Self::ReceiveMessage>,
) -> String { rx: glib::Receiver<Self::SendMessage>,
let mut compiled_string = format_string.to_string(); ) -> Option<gtk::Box> {
for token in tokens { let container = gtk::Box::builder()
let value = self.get_token_value(song, status, token).await; .orientation(Orientation::Horizontal)
compiled_string = .spacing(10)
compiled_string.replace(format!("{{{}}}", token).as_str(), value.as_str()); .name("popup-mpd")
.build();
let album_image = Image::builder()
.width_request(128)
.height_request(128)
.name("album-art")
.build();
let info_box = gtk::Box::new(Orientation::Vertical, 10);
let title_label = IconLabel::new("\u{f886}", None);
let album_label = IconLabel::new("\u{f524}", None);
let artist_label = IconLabel::new("\u{fd01}", None);
title_label.container.set_widget_name("title");
album_label.container.set_widget_name("album");
artist_label.container.set_widget_name("label");
info_box.add(&title_label.container);
info_box.add(&album_label.container);
info_box.add(&artist_label.container);
let controls_box = gtk::Box::builder().name("controls").build();
let btn_prev = Button::builder().label("\u{f9ad}").name("btn-prev").build();
let btn_play_pause = Button::builder().label("").name("btn-play-pause").build();
let btn_next = Button::builder().label("\u{f9ac}").name("btn-next").build();
controls_box.add(&btn_prev);
controls_box.add(&btn_play_pause);
controls_box.add(&btn_next);
info_box.add(&controls_box);
let volume_box = gtk::Box::builder()
.orientation(Orientation::Vertical)
.spacing(5)
.name("volume")
.build();
let volume_slider = Scale::with_range(Orientation::Vertical, 0.0, 100.0, 5.0);
volume_slider.set_inverted(true);
volume_slider.set_widget_name("scale");
let volume_icon = Label::new(Some(&self.icons.volume));
volume_icon.style_context().add_class("icon");
volume_box.pack_start(&volume_slider, true, true, 0);
volume_box.pack_end(&volume_icon, false, false, 0);
container.add(&album_image);
container.add(&info_box);
container.add(&volume_box);
let tx_prev = tx.clone();
btn_prev.connect_clicked(move |_| {
tx_prev
.try_send(PlayerCommand::Previous)
.expect("Failed to send prev track message");
});
let tx_toggle = tx.clone();
btn_play_pause.connect_clicked(move |_| {
tx_toggle
.try_send(PlayerCommand::Toggle)
.expect("Failed to send play/pause track message");
});
let tx_next = tx.clone();
btn_next.connect_clicked(move |_| {
tx_next
.try_send(PlayerCommand::Next)
.expect("Failed to send next track message");
});
let tx_vol = tx;
volume_slider.connect_change_value(move |_, _, val| {
tx_vol
.try_send(PlayerCommand::Volume(val as u8))
.expect("Failed to send volume message");
Inhibit(false)
});
container.show_all();
{
let music_dir = self.music_dir;
rx.attach(None, move |update| {
if let Some(update) = update {
let prev_album = album_label.label.text();
let curr_album = update.song.album().unwrap_or_default();
// only update art when album changes
if prev_album != curr_album {
let cover_path = music_dir.join(
update
.song
.file_path()
.parent()
.expect("Song path should not be root")
.join("cover.jpg"),
);
if let Ok(pixbuf) = Pixbuf::from_file_at_scale(cover_path, 128, 128, true) {
album_image.set_from_pixbuf(Some(&pixbuf));
} else {
album_image.set_from_pixbuf(None);
}
}
title_label
.label
.set_text(update.song.title().unwrap_or_default());
album_label.label.set_text(curr_album);
artist_label
.label
.set_text(update.song.artists().first().unwrap_or(&String::new()));
match update.status.state {
PlayState::Stopped => {
btn_play_pause.set_sensitive(false);
}
PlayState::Playing => {
btn_play_pause.set_sensitive(true);
btn_play_pause.set_label("");
}
PlayState::Paused => {
btn_play_pause.set_sensitive(true);
btn_play_pause.set_label("");
}
}
let enable_prev = match update.status.current_song {
Some((pos, _)) => pos.0 > 0,
None => false,
};
let enable_next = match update.status.current_song {
Some((pos, _)) => pos.0 < update.status.playlist_length,
None => false,
};
btn_prev.set_sensitive(enable_prev);
btn_next.set_sensitive(enable_next);
volume_slider.set_value(update.status.volume as f64);
}
Continue(true)
});
} }
compiled_string
}
/// Converts a string format token value Some(container)
/// into its respective MPD value. }
pub async fn get_token_value(&self, song: &Song, status: &Status, token: &str) -> String { }
let s = match token {
"icon" => { /// Replaces each of the formatting tokens in the formatting string
let icon = match status.state { /// with actual data pulled from MPD
PlayState::Stopped => None, fn replace_tokens(
PlayState::Playing => self.icon_play.as_ref(), format_string: &str,
PlayState::Paused => self.icon_pause.as_ref(), tokens: &Vec<String>,
}; song: &Song,
icon.map(String::as_str) status: &Status,
} icons: &Icons,
"title" => song.title(), ) -> String {
"album" => try_get_first_tag(song.tags.get(&Tag::Album)), let mut compiled_string = format_string.to_string();
"artist" => try_get_first_tag(song.tags.get(&Tag::Artist)), for token in tokens {
"date" => try_get_first_tag(song.tags.get(&Tag::Date)), let value = get_token_value(song, status, icons, token);
"disc" => try_get_first_tag(song.tags.get(&Tag::Disc)), compiled_string =
"genre" => try_get_first_tag(song.tags.get(&Tag::Genre)), compiled_string.replace(format!("{{{}}}", token).as_str(), value.as_str());
"track" => try_get_first_tag(song.tags.get(&Tag::Track)), }
"duration" => return get_duration(status).map(format_time).unwrap_or_default(), compiled_string
}
"elapsed" => return get_elapsed(status).map(format_time).unwrap_or_default(),
_ => Some(token), /// Converts a string format token value
}; /// into its respective MPD value.
s.unwrap_or_default().to_string() fn get_token_value(song: &Song, status: &Status, icons: &Icons, token: &str) -> String {
let s = match token {
"icon" => {
let icon = match status.state {
PlayState::Stopped => None,
PlayState::Playing => Some(&icons.play),
PlayState::Paused => Some(&icons.pause),
};
icon.map(String::as_str)
}
"title" => song.title(),
"album" => try_get_first_tag(song.tags.get(&Tag::Album)),
"artist" => try_get_first_tag(song.tags.get(&Tag::Artist)),
"date" => try_get_first_tag(song.tags.get(&Tag::Date)),
"disc" => try_get_first_tag(song.tags.get(&Tag::Disc)),
"genre" => try_get_first_tag(song.tags.get(&Tag::Genre)),
"track" => try_get_first_tag(song.tags.get(&Tag::Track)),
"duration" => return get_duration(status).map(format_time).unwrap_or_default(),
"elapsed" => return get_elapsed(status).map(format_time).unwrap_or_default(),
_ => Some(token),
};
s.unwrap_or_default().to_string()
}
#[derive(Clone)]
struct IconLabel {
label: Label,
container: gtk::Box,
}
impl IconLabel {
fn new(icon: &str, label: Option<&str>) -> Self {
let container = gtk::Box::new(Orientation::Horizontal, 5);
let icon = Label::new(Some(icon));
let label = Label::new(label);
icon.style_context().add_class("icon");
label.style_context().add_class("label");
container.add(&icon);
container.add(&label);
Self { label, container }
} }
} }

View File

@@ -1,175 +0,0 @@
pub use crate::popup::Popup;
use gtk::gdk_pixbuf::Pixbuf;
use gtk::prelude::*;
use gtk::{Button, Image, Label, Orientation};
use mpd_client::responses::{PlayState, Song, Status};
use std::path::Path;
use tokio::sync::mpsc;
#[derive(Clone)]
struct IconLabel {
label: Label,
container: gtk::Box,
}
impl IconLabel {
fn new(icon: &str, label: Option<&str>) -> Self {
let container = gtk::Box::new(Orientation::Horizontal, 5);
let icon = Label::new(Some(icon));
let label = Label::new(label);
icon.style_context().add_class("icon");
label.style_context().add_class("label");
container.add(&icon);
container.add(&label);
Self { label, container }
}
}
#[derive(Clone)]
pub struct MpdPopup {
pub popup: Popup,
cover: Image,
title: IconLabel,
album: IconLabel,
artist: IconLabel,
btn_prev: Button,
btn_play_pause: Button,
btn_next: Button,
}
#[derive(Debug)]
pub enum PopupEvent {
Previous,
Toggle,
Next,
}
impl MpdPopup {
pub fn new(popup: Popup, tx: mpsc::Sender<PopupEvent>) -> Self {
let album_image = Image::builder()
.width_request(128)
.height_request(128)
.name("album-art")
.build();
let info_box = gtk::Box::new(Orientation::Vertical, 10);
let title_label = IconLabel::new("\u{f886}", None);
let album_label = IconLabel::new("\u{f524}", None);
let artist_label = IconLabel::new("\u{fd01}", None);
title_label.container.set_widget_name("title");
album_label.container.set_widget_name("album");
artist_label.container.set_widget_name("label");
info_box.add(&title_label.container);
info_box.add(&album_label.container);
info_box.add(&artist_label.container);
let controls_box = gtk::Box::builder().name("controls").build();
let btn_prev = Button::builder().label("\u{f9ad}").name("btn-prev").build();
let btn_play_pause = Button::builder().label("").name("btn-play-pause").build();
let btn_next = Button::builder().label("\u{f9ac}").name("btn-next").build();
controls_box.add(&btn_prev);
controls_box.add(&btn_play_pause);
controls_box.add(&btn_next);
info_box.add(&controls_box);
popup.container.add(&album_image);
popup.container.add(&info_box);
let tx_prev = tx.clone();
btn_prev.connect_clicked(move |_| {
tx_prev
.try_send(PopupEvent::Previous)
.expect("Failed to send prev track message");
});
let tx_toggle = tx.clone();
btn_play_pause.connect_clicked(move |_| {
tx_toggle
.try_send(PopupEvent::Toggle)
.expect("Failed to send play/pause track message");
});
let tx_next = tx;
btn_next.connect_clicked(move |_| {
tx_next
.try_send(PopupEvent::Next)
.expect("Failed to send next track message");
});
Self {
popup,
cover: album_image,
artist: artist_label,
album: album_label,
title: title_label,
btn_prev,
btn_play_pause,
btn_next,
}
}
pub fn update(&self, song: &Song, status: &Status, path: &Path) {
let prev_album = self.album.label.text();
let curr_album = song.album().unwrap_or_default();
// only update art when album changes
if prev_album != curr_album {
let cover_path = path.join(
song.file_path()
.parent()
.expect("Song path should not be root")
.join("cover.jpg"),
);
if let Ok(pixbuf) = Pixbuf::from_file_at_scale(cover_path, 128, 128, true) {
self.cover.set_from_pixbuf(Some(&pixbuf));
}
}
self.title.label.set_text(song.title().unwrap_or_default());
self.album.label.set_text(song.album().unwrap_or_default());
self.artist
.label
.set_text(song.artists().first().unwrap_or(&String::new()));
match status.state {
PlayState::Stopped => {
self.btn_play_pause.set_sensitive(false);
}
PlayState::Playing => {
self.btn_play_pause.set_sensitive(true);
self.btn_play_pause.set_label("");
}
PlayState::Paused => {
self.btn_play_pause.set_sensitive(true);
self.btn_play_pause.set_label("");
}
}
let enable_prev = match status.current_song {
Some((pos, _)) => pos.0 > 0,
None => false,
};
let enable_next = match status.current_song {
Some((pos, _)) => pos.0 < status.playlist_length,
None => false,
};
self.btn_prev.set_sensitive(enable_prev);
self.btn_next.set_sensitive(enable_next);
}
}

View File

@@ -1,12 +1,13 @@
use crate::modules::{Module, ModuleInfo}; use crate::modules::{Module, ModuleInfo, ModuleUpdateEvent, ModuleWidget, WidgetContext};
use color_eyre::{eyre::Report, eyre::Result, eyre::WrapErr, Section}; use crate::script::exec_command;
use color_eyre::Result;
use gtk::prelude::*; use gtk::prelude::*;
use gtk::Label; use gtk::Label;
use serde::Deserialize; use serde::Deserialize;
use std::process::Command;
use tokio::spawn; use tokio::spawn;
use tokio::sync::mpsc::{Receiver, Sender};
use tokio::time::sleep; use tokio::time::sleep;
use tracing::{error, instrument}; use tracing::error;
#[derive(Debug, Deserialize, Clone)] #[derive(Debug, Deserialize, Clone)]
pub struct ScriptModule { pub struct ScriptModule {
@@ -23,57 +24,53 @@ const fn default_interval() -> u64 {
} }
impl Module<Label> for ScriptModule { impl Module<Label> for ScriptModule {
fn into_widget(self, _info: &ModuleInfo) -> Result<Label> { type SendMessage = String;
let label = Label::builder().use_markup(true).build(); type ReceiveMessage = ();
let (tx, rx) = glib::MainContext::channel(glib::PRIORITY_DEFAULT); fn spawn_controller(
&self,
_info: &ModuleInfo,
tx: Sender<ModuleUpdateEvent<Self::SendMessage>>,
_rx: Receiver<Self::ReceiveMessage>,
) -> Result<()> {
let interval = self.interval;
let path = self.path.clone();
spawn(async move { spawn(async move {
loop { loop {
match self.run_script() { match exec_command(&path) {
Ok(stdout) => tx.send(stdout).expect("Failed to send stdout"), Ok(stdout) => tx
.send(ModuleUpdateEvent::Update(stdout))
.await
.expect("Failed to send stdout"),
Err(err) => error!("{:?}", err), Err(err) => error!("{:?}", err),
} }
sleep(tokio::time::Duration::from_millis(self.interval)).await; sleep(tokio::time::Duration::from_millis(interval)).await;
} }
}); });
Ok(())
}
fn into_widget(
self,
context: WidgetContext<Self::SendMessage, Self::ReceiveMessage>,
info: &ModuleInfo,
) -> Result<ModuleWidget<Label>> {
let label = Label::builder().use_markup(true).build();
label.set_angle(info.bar_position.get_angle());
{ {
let label = label.clone(); let label = label.clone();
rx.attach(None, move |s| { context.widget_rx.attach(None, move |s| {
label.set_label(s.as_str()); label.set_markup(s.as_str());
Continue(true) Continue(true)
}); });
} }
Ok(label) Ok(ModuleWidget {
} widget: label,
} popup: None,
})
impl ScriptModule {
#[instrument]
fn run_script(&self) -> Result<String> {
let output = Command::new("sh")
.arg("-c")
.arg(&self.path)
.output()
.wrap_err("Failed to get script output")?;
if output.status.success() {
let stdout = String::from_utf8(output.stdout)
.map(|output| output.trim().to_string())
.wrap_err("Script stdout not valid UTF-8")?;
Ok(stdout)
} else {
let stderr = String::from_utf8(output.stderr)
.map(|output| output.trim().to_string())
.wrap_err("Script stderr not valid UTF-8")?;
Err(Report::msg(stderr)
.wrap_err("Script returned non-zero error code")
.suggestion("Check the path to your script")
.suggestion("Check the script for errors"))
}
} }
} }

View File

@@ -1,77 +1,452 @@
use crate::modules::{Module, ModuleInfo}; use crate::modules::{Module, ModuleInfo, ModuleUpdateEvent, ModuleWidget, WidgetContext};
use color_eyre::Result; use color_eyre::Result;
use gtk::prelude::*; use gtk::prelude::*;
use gtk::{Label, Orientation}; use gtk::Label;
use regex::{Captures, Regex}; use regex::{Captures, Regex};
use serde::Deserialize; use serde::Deserialize;
use std::collections::HashMap; use std::collections::HashMap;
use sysinfo::{CpuExt, System, SystemExt}; use std::time::Duration;
use sysinfo::{ComponentExt, CpuExt, DiskExt, NetworkExt, RefreshKind, System, SystemExt};
use tokio::spawn; use tokio::spawn;
use tokio::sync::mpsc;
use tokio::sync::mpsc::{Receiver, Sender};
use tokio::time::sleep; use tokio::time::sleep;
#[derive(Debug, Deserialize, Clone)] #[derive(Debug, Deserialize, Clone)]
pub struct SysInfoModule { pub struct SysInfoModule {
/// List of formatting strings. /// List of formatting strings.
format: Vec<String>, format: Vec<String>,
/// Number of seconds between refresh
#[serde(default = "Interval::default")]
interval: Interval,
}
#[derive(Debug, Deserialize, Copy, Clone)]
pub struct Intervals {
#[serde(default = "default_interval")]
memory: u64,
#[serde(default = "default_interval")]
cpu: u64,
#[serde(default = "default_interval")]
temps: u64,
#[serde(default = "default_interval")]
disks: u64,
#[serde(default = "default_interval")]
networks: u64,
#[serde(default = "default_interval")]
system: u64,
}
#[derive(Debug, Deserialize, Copy, Clone)]
#[serde(untagged)]
pub enum Interval {
All(u64),
Individual(Intervals),
}
impl Default for Interval {
fn default() -> Self {
Self::All(default_interval())
}
}
impl Interval {
const fn memory(self) -> u64 {
match self {
Self::All(n) => n,
Self::Individual(intervals) => intervals.memory,
}
}
const fn cpu(self) -> u64 {
match self {
Self::All(n) => n,
Self::Individual(intervals) => intervals.cpu,
}
}
const fn temps(self) -> u64 {
match self {
Self::All(n) => n,
Self::Individual(intervals) => intervals.temps,
}
}
const fn disks(self) -> u64 {
match self {
Self::All(n) => n,
Self::Individual(intervals) => intervals.disks,
}
}
const fn networks(self) -> u64 {
match self {
Self::All(n) => n,
Self::Individual(intervals) => intervals.networks,
}
}
const fn system(self) -> u64 {
match self {
Self::All(n) => n,
Self::Individual(intervals) => intervals.system,
}
}
}
const fn default_interval() -> u64 {
5
}
#[derive(Debug)]
enum RefreshType {
Memory,
Cpu,
Temps,
Disks,
Network,
System,
} }
impl Module<gtk::Box> for SysInfoModule { impl Module<gtk::Box> for SysInfoModule {
fn into_widget(self, _info: &ModuleInfo) -> Result<gtk::Box> { type SendMessage = HashMap<String, String>;
let re = Regex::new(r"\{([\w-]+)}")?; type ReceiveMessage = ();
let container = gtk::Box::new(Orientation::Horizontal, 10); fn spawn_controller(
&self,
_info: &ModuleInfo,
tx: Sender<ModuleUpdateEvent<Self::SendMessage>>,
_rx: Receiver<Self::ReceiveMessage>,
) -> Result<()> {
let interval = self.interval;
let refresh_kind = RefreshKind::everything()
.without_processes()
.without_users_list();
let mut sys = System::new_with_specifics(refresh_kind);
sys.refresh_components_list();
sys.refresh_disks_list();
sys.refresh_networks_list();
let (refresh_tx, mut refresh_rx) = mpsc::channel(16);
// memory refresh
{
let tx = refresh_tx.clone();
spawn(async move {
loop {
tx.send(RefreshType::Memory)
.await
.expect("Failed to send memory refresh");
sleep(Duration::from_secs(interval.memory())).await;
}
});
}
// cpu refresh
{
let tx = refresh_tx.clone();
spawn(async move {
loop {
tx.send(RefreshType::Cpu)
.await
.expect("Failed to send cpu refresh");
sleep(Duration::from_secs(interval.cpu())).await;
}
});
}
// temp refresh
{
let tx = refresh_tx.clone();
spawn(async move {
loop {
tx.send(RefreshType::Temps)
.await
.expect("Failed to send temperature refresh");
sleep(Duration::from_secs(interval.temps())).await;
}
});
}
// disk refresh
{
let tx = refresh_tx.clone();
spawn(async move {
loop {
tx.send(RefreshType::Disks)
.await
.expect("Failed to send disk refresh");
sleep(Duration::from_secs(interval.disks())).await;
}
});
}
// network refresh
{
let tx = refresh_tx.clone();
spawn(async move {
loop {
tx.send(RefreshType::Network)
.await
.expect("Failed to send network refresh");
sleep(Duration::from_secs(interval.networks())).await;
}
});
}
// system refresh
{
let tx = refresh_tx;
spawn(async move {
loop {
tx.send(RefreshType::System)
.await
.expect("Failed to send system refresh");
sleep(Duration::from_secs(interval.system())).await;
}
});
}
spawn(async move {
let mut format_info = HashMap::new();
while let Some(refresh) = refresh_rx.recv().await {
match refresh {
RefreshType::Memory => refresh_memory_tokens(&mut format_info, &mut sys),
RefreshType::Cpu => refresh_cpu_tokens(&mut format_info, &mut sys),
RefreshType::Temps => refresh_temp_tokens(&mut format_info, &mut sys),
RefreshType::Disks => refresh_disk_tokens(&mut format_info, &mut sys),
RefreshType::Network => {
refresh_network_tokens(&mut format_info, &mut sys, interval.networks());
}
RefreshType::System => refresh_system_tokens(&mut format_info, &sys),
};
tx.send(ModuleUpdateEvent::Update(format_info.clone()))
.await
.expect("Failed to send system info map");
}
});
Ok(())
}
fn into_widget(
self,
context: WidgetContext<Self::SendMessage, Self::ReceiveMessage>,
info: &ModuleInfo,
) -> Result<ModuleWidget<gtk::Box>> {
let re = Regex::new(r"\{([^}]+)}")?;
let container = gtk::Box::new(info.bar_position.get_orientation(), 10);
let mut labels = Vec::new(); let mut labels = Vec::new();
for format in &self.format { for format in &self.format {
let label = Label::builder().label(format).name("item").build(); let label = Label::builder()
.label(format)
.use_markup(true)
.name("item")
.build();
label.set_angle(info.bar_position.get_angle());
container.add(&label); container.add(&label);
labels.push(label); labels.push(label);
} }
let (tx, rx) = glib::MainContext::channel(glib::PRIORITY_DEFAULT);
spawn(async move {
let mut sys = System::new_all();
loop {
sys.refresh_all();
let mut format_info = HashMap::new();
let actual_used_memory = sys.total_memory() - sys.available_memory();
let memory_percent = actual_used_memory as f64 / sys.total_memory() as f64 * 100.0;
let cpu_percent = sys.global_cpu_info().cpu_usage();
// TODO: Add remaining format info
format_info.insert("memory-percent", format!("{:0>2.0}", memory_percent));
format_info.insert("cpu-percent", format!("{:0>2.0}", cpu_percent));
tx.send(format_info)
.expect("Failed to send system info map");
sleep(tokio::time::Duration::from_secs(1)).await;
}
});
{ {
let formats = self.format; let formats = self.format;
rx.attach(None, move |info| { context.widget_rx.attach(None, move |info| {
for (format, label) in formats.iter().zip(labels.clone()) { for (format, label) in formats.iter().zip(labels.clone()) {
let format_compiled = re.replace(format, |caps: &Captures| { let format_compiled = re.replace_all(format, |caps: &Captures| {
info.get(&caps[1]) info.get(&caps[1])
.unwrap_or(&caps[0].to_string()) .unwrap_or(&caps[0].to_string())
.to_string() .to_string()
}); });
label.set_text(format_compiled.as_ref()); label.set_markup(format_compiled.as_ref());
} }
Continue(true) Continue(true)
}); });
} }
Ok(container) Ok(ModuleWidget {
widget: container,
popup: None,
})
} }
} }
fn refresh_memory_tokens(format_info: &mut HashMap<String, String>, sys: &mut System) {
sys.refresh_memory();
let total_memory = sys.total_memory();
let available_memory = sys.available_memory();
let actual_used_memory = total_memory - available_memory;
let memory_percent = actual_used_memory as f64 / total_memory as f64 * 100.0;
format_info.insert(
String::from("memory-free"),
(bytes_to_gigabytes(available_memory)).to_string(),
);
format_info.insert(
String::from("memory-used"),
(bytes_to_gigabytes(actual_used_memory)).to_string(),
);
format_info.insert(
String::from("memory-total"),
(bytes_to_gigabytes(total_memory)).to_string(),
);
format_info.insert(
String::from("memory-percent"),
format!("{:0>2.0}", memory_percent),
);
let used_swap = sys.used_swap();
let total_swap = sys.total_swap();
format_info.insert(
String::from("swap-free"),
(bytes_to_gigabytes(sys.free_swap())).to_string(),
);
format_info.insert(
String::from("swap-used"),
(bytes_to_gigabytes(used_swap)).to_string(),
);
format_info.insert(
String::from("swap-total"),
(bytes_to_gigabytes(total_swap)).to_string(),
);
format_info.insert(
String::from("swap-percent"),
format!("{:0>2.0}", used_swap as f64 / total_swap as f64 * 100.0),
);
}
fn refresh_cpu_tokens(format_info: &mut HashMap<String, String>, sys: &mut System) {
sys.refresh_cpu();
let cpu_info = sys.global_cpu_info();
let cpu_percent = cpu_info.cpu_usage();
format_info.insert(
String::from("cpu-percent"),
format!("{:0>2.0}", cpu_percent),
);
}
fn refresh_temp_tokens(format_info: &mut HashMap<String, String>, sys: &mut System) {
sys.refresh_components();
let components = sys.components();
for component in components {
let key = component.label().replace(' ', "-");
let temp = component.temperature();
format_info.insert(format!("temp-c:{key}"), format!("{temp:.0}"));
format_info.insert(format!("temp-f:{key}"), format!("{:.0}", c_to_f(temp)));
}
}
fn refresh_disk_tokens(format_info: &mut HashMap<String, String>, sys: &mut System) {
sys.refresh_disks();
for disk in sys.disks() {
// replace braces to avoid conflict with regex
let key = disk
.mount_point()
.to_str()
.map(|s| s.replace('{', "").replace('}', ""));
if let Some(key) = key {
let total = disk.total_space();
let available = disk.available_space();
let used = total - available;
format_info.insert(
format!("disk-free:{key}"),
bytes_to_gigabytes(available).to_string(),
);
format_info.insert(
format!("disk-used:{key}"),
bytes_to_gigabytes(used).to_string(),
);
format_info.insert(
format!("disk-total:{key}"),
bytes_to_gigabytes(total).to_string(),
);
format_info.insert(
format!("disk-percent:{key}"),
format!("{:0>2.0}", used as f64 / total as f64 * 100.0),
);
}
}
}
fn refresh_network_tokens(
format_info: &mut HashMap<String, String>,
sys: &mut System,
interval: u64,
) {
sys.refresh_networks();
for (iface, network) in sys.networks() {
format_info.insert(
format!("net-down:{iface}"),
format!("{:0>2.0}", bytes_to_megabits(network.received()) / interval),
);
format_info.insert(
format!("net-up:{iface}"),
format!(
"{:0>2.0}",
bytes_to_megabits(network.transmitted()) / interval
),
);
}
}
fn refresh_system_tokens(format_info: &mut HashMap<String, String>, sys: &System) {
// no refresh required for these tokens
let load_average = sys.load_average();
format_info.insert(String::from("load-average:1"), load_average.one.to_string());
format_info.insert(
String::from("load-average:5"),
load_average.five.to_string(),
);
format_info.insert(
String::from("load-average:15"),
load_average.fifteen.to_string(),
);
let uptime = Duration::from_secs(sys.uptime()).as_secs();
let hours = uptime / 3600;
format_info.insert(
String::from("uptime"),
format!("{:0>2}:{:0>2}", hours, (uptime % 3600) / 60),
);
}
/// Converts celsius to fahrenheit.
fn c_to_f(c: f32) -> f32 {
c * 9.0 / 5.0 + 32.0
}
const fn bytes_to_gigabytes(b: u64) -> u64 {
const BYTES_IN_GIGABYTE: u64 = 1_000_000_000;
b / BYTES_IN_GIGABYTE
}
const fn bytes_to_megabits(b: u64) -> u64 {
const BYTES_IN_MEGABIT: u64 = 125_000;
b / BYTES_IN_MEGABIT
}

View File

@@ -0,0 +1,74 @@
use async_once::AsyncOnce;
use lazy_static::lazy_static;
use stray::message::{NotifierItemCommand, NotifierItemMessage};
use stray::StatusNotifierWatcher;
use tokio::spawn;
use tokio::sync::{broadcast, mpsc};
use tracing::debug;
pub struct TrayEventReceiver {
tx: mpsc::Sender<NotifierItemCommand>,
b_tx: broadcast::Sender<NotifierItemMessage>,
_b_rx: broadcast::Receiver<NotifierItemMessage>,
}
impl TrayEventReceiver {
async fn new() -> stray::error::Result<Self> {
let (tx, rx) = mpsc::channel(16);
let (b_tx, b_rx) = broadcast::channel(16);
let tray = StatusNotifierWatcher::new(rx).await?;
let mut host = tray.create_notifier_host("ironbar").await?;
let b_tx2 = b_tx.clone();
spawn(async move {
while let Ok(message) = host.recv().await {
b_tx2.send(message)?;
}
Ok::<(), broadcast::error::SendError<NotifierItemMessage>>(())
});
Ok(Self {
tx,
b_tx,
_b_rx: b_rx,
})
}
pub fn subscribe(
&self,
) -> (
mpsc::Sender<NotifierItemCommand>,
broadcast::Receiver<NotifierItemMessage>,
) {
(self.tx.clone(), self.b_tx.subscribe())
}
}
lazy_static! {
static ref CLIENT: AsyncOnce<TrayEventReceiver> = AsyncOnce::new(async {
const MAX_RETRIES: i32 = 10;
// sometimes this can fail
let mut retries = 0;
let value = loop {
retries += 1;
let tray = TrayEventReceiver::new().await;
if tray.is_ok() || retries == MAX_RETRIES {
break tray;
}
debug!("Failed to create StatusNotifierWatcher (attempt {retries})");
};
value.expect("Failed to create StatusNotifierWatcher")
});
}
pub async fn get_tray_event_client() -> &'static TrayEventReceiver {
CLIENT.get().await
}

View File

@@ -1,26 +1,23 @@
use crate::modules::{Module, ModuleInfo}; mod client;
use crate::await_sync;
use crate::modules::tray::client::get_tray_event_client;
use crate::modules::{Module, ModuleInfo, ModuleUpdateEvent, ModuleWidget, WidgetContext};
use color_eyre::Result; use color_eyre::Result;
use futures_util::StreamExt;
use gtk::prelude::*; use gtk::prelude::*;
use gtk::{IconLookupFlags, IconTheme, Image, Menu, MenuBar, MenuItem, SeparatorMenuItem}; use gtk::{IconLookupFlags, IconTheme, Image, Menu, MenuBar, MenuItem, SeparatorMenuItem};
use serde::Deserialize; use serde::Deserialize;
use std::collections::HashMap; use std::collections::HashMap;
use stray::message::menu::{MenuItem as MenuItemInfo, MenuType, TrayMenu}; use stray::message::menu::{MenuItem as MenuItemInfo, MenuType};
use stray::message::tray::StatusNotifierItem; use stray::message::tray::StatusNotifierItem;
use stray::message::{NotifierItemCommand, NotifierItemMessage}; use stray::message::{NotifierItemCommand, NotifierItemMessage};
use stray::SystemTray;
use tokio::spawn; use tokio::spawn;
use tokio::sync::mpsc; use tokio::sync::mpsc;
use tokio::sync::mpsc::{Receiver, Sender};
#[derive(Debug, Deserialize, Clone)] #[derive(Debug, Deserialize, Clone)]
pub struct TrayModule; pub struct TrayModule;
#[derive(Debug)]
enum TrayUpdate {
Update(String, Box<StatusNotifierItem>, Option<TrayMenu>),
Remove(String),
}
/// Gets a GTK `Image` component /// Gets a GTK `Image` component
/// for the status notifier item's icon. /// for the status notifier item's icon.
fn get_icon(item: &StatusNotifierItem) -> Option<Image> { fn get_icon(item: &StatusNotifierItem) -> Option<Image> {
@@ -39,7 +36,7 @@ fn get_icon(item: &StatusNotifierItem) -> Option<Image> {
/// for the provided submenu array. /// for the provided submenu array.
fn get_menu_items( fn get_menu_items(
menu: &[MenuItemInfo], menu: &[MenuItemInfo],
tx: &mpsc::Sender<NotifierItemCommand>, tx: &Sender<NotifierItemCommand>,
id: &str, id: &str,
path: &str, path: &str,
) -> Vec<MenuItem> { ) -> Vec<MenuItem> {
@@ -90,72 +87,88 @@ fn get_menu_items(
} }
impl Module<MenuBar> for TrayModule { impl Module<MenuBar> for TrayModule {
fn into_widget(self, _info: &ModuleInfo) -> Result<MenuBar> { type SendMessage = NotifierItemMessage;
let container = MenuBar::new(); type ReceiveMessage = NotifierItemCommand;
let (tx, rx) = glib::MainContext::channel(glib::PRIORITY_DEFAULT); fn spawn_controller(
let (ui_tx, ui_rx) = mpsc::channel(32); &self,
_info: &ModuleInfo,
tx: Sender<ModuleUpdateEvent<Self::SendMessage>>,
mut rx: Receiver<Self::ReceiveMessage>,
) -> Result<()> {
let client = await_sync(async { get_tray_event_client().await });
let (tray_tx, mut tray_rx) = client.subscribe();
// listen to tray updates
spawn(async move { spawn(async move {
// FIXME: Can only spawn one of these at a time - means cannot have tray on multiple bars while let Ok(message) = tray_rx.recv().await {
let mut tray = SystemTray::new(ui_rx).await; tx.send(ModuleUpdateEvent::Update(message)).await?;
// listen for tray updates & send message to update UI
while let Some(message) = tray.next().await {
match message {
NotifierItemMessage::Update {
address: id,
item,
menu,
} => {
tx.send(TrayUpdate::Update(id, Box::new(item), menu))
.expect("Failed to send tray update event");
}
NotifierItemMessage::Remove { address: id } => {
tx.send(TrayUpdate::Remove(id))
.expect("Failed to send tray remove event");
}
}
} }
Ok::<(), mpsc::error::SendError<ModuleUpdateEvent<Self::SendMessage>>>(())
}); });
// send tray commands
spawn(async move {
while let Some(cmd) = rx.recv().await {
tray_tx.send(cmd).await?;
}
Ok::<(), mpsc::error::SendError<NotifierItemCommand>>(())
});
Ok(())
}
fn into_widget(
self,
context: WidgetContext<Self::SendMessage, Self::ReceiveMessage>,
_info: &ModuleInfo,
) -> Result<ModuleWidget<MenuBar>> {
let container = MenuBar::new();
{ {
let container = container.clone(); let container = container.clone();
let mut widgets = HashMap::new(); let mut widgets = HashMap::new();
// listen for UI updates // listen for UI updates
rx.attach(None, move |update| { context.widget_rx.attach(None, move |update| {
match update { match update {
TrayUpdate::Update(id, item, menu) => { NotifierItemMessage::Update {
let menu_item = widgets.remove(id.as_str()).unwrap_or_else(|| { item,
address,
menu,
} => {
let menu_item = widgets.remove(address.as_str()).unwrap_or_else(|| {
let menu_item = MenuItem::new(); let menu_item = MenuItem::new();
menu_item.style_context().add_class("item"); menu_item.style_context().add_class("item");
if let Some(image) = get_icon(&item) { if let Some(image) = get_icon(&item) {
image.set_widget_name(id.as_str()); image.set_widget_name(address.as_str());
menu_item.add(&image); menu_item.add(&image);
} }
container.add(&menu_item); container.add(&menu_item);
menu_item.show_all(); menu_item.show_all();
menu_item menu_item
}); });
if let (Some(menu_opts), Some(menu_path)) = (menu, item.menu) { if let (Some(menu_opts), Some(menu_path)) = (menu, item.menu) {
let submenus = menu_opts.submenus; let submenus = menu_opts.submenus;
if !submenus.is_empty() { if !submenus.is_empty() {
let menu = Menu::new(); let menu = Menu::new();
get_menu_items(&submenus, &ui_tx.clone(), &id, &menu_path) get_menu_items(
.iter() &submenus,
.for_each(|item| menu.add(item)); &context.controller_tx.clone(),
&address,
&menu_path,
)
.iter()
.for_each(|item| menu.add(item));
menu_item.set_submenu(Some(&menu)); menu_item.set_submenu(Some(&menu));
} }
} }
widgets.insert(address, menu_item);
widgets.insert(id, menu_item);
} }
TrayUpdate::Remove(id) => { NotifierItemMessage::Remove { address } => {
if let Some(widget) = widgets.get(&id) { if let Some(widget) = widgets.get(&address) {
container.remove(widget); container.remove(widget);
} }
} }
@@ -165,6 +178,9 @@ impl Module<MenuBar> for TrayModule {
}); });
}; };
Ok(container) Ok(ModuleWidget {
widget: container,
popup: None,
})
} }
} }

View File

@@ -1,62 +1,79 @@
use crate::modules::{Module, ModuleInfo}; use crate::await_sync;
use crate::sway::{get_client, Workspace}; use crate::modules::{Module, ModuleInfo, ModuleUpdateEvent, ModuleWidget, WidgetContext};
use crate::sway::{get_client, get_sub_client};
use color_eyre::{Report, Result}; use color_eyre::{Report, Result};
use gtk::prelude::*; use gtk::prelude::*;
use gtk::{Button, Orientation}; use gtk::Button;
use ksway::IpcCommand;
use serde::Deserialize; use serde::Deserialize;
use std::collections::HashMap; use std::collections::HashMap;
use swayipc_async::{Workspace, WorkspaceChange, WorkspaceEvent};
use tokio::spawn; use tokio::spawn;
use tokio::sync::mpsc; use tokio::sync::mpsc::{Receiver, Sender};
use tokio::task::spawn_blocking; use tracing::trace;
use tracing::{debug, trace};
#[derive(Debug, Deserialize, Clone)] #[derive(Debug, Deserialize, Clone)]
pub struct WorkspacesModule { pub struct WorkspacesModule {
/// Map of actual workspace names to custom names. /// Map of actual workspace names to custom names.
name_map: Option<HashMap<String, String>>, name_map: Option<HashMap<String, String>>,
/// Whether to display icons for all monitors. /// Whether to display buttons for all monitors.
#[serde(default = "crate::config::default_false")] #[serde(default = "crate::config::default_false")]
all_monitors: bool, all_monitors: bool,
} }
impl Workspace { #[derive(Clone, Debug)]
fn as_button(&self, name_map: &HashMap<String, String>, tx: &mpsc::Sender<String>) -> Button { pub enum WorkspaceUpdate {
let button = Button::builder() Init(Vec<Workspace>),
.label(name_map.get(self.name.as_str()).unwrap_or(&self.name)) Update(Box<WorkspaceEvent>),
.build(); }
let style_context = button.style_context(); /// Creates a button from a workspace
style_context.add_class("item"); fn create_button(
name: &str,
focused: bool,
name_map: &HashMap<String, String>,
tx: &Sender<String>,
) -> Button {
let button = Button::builder()
.label(name_map.get(name).map_or(name, String::as_str))
.build();
if self.focused { let style_context = button.style_context();
style_context.add_class("focused"); style_context.add_class("item");
}
{ if focused {
let tx = tx.clone(); style_context.add_class("focused");
let name = self.name.clone();
button.connect_clicked(move |_item| {
tx.try_send(name.clone())
.expect("Failed to send workspace click event");
});
}
button
} }
{
let tx = tx.clone();
let name = name.to_string();
button.connect_clicked(move |_item| {
tx.try_send(name.clone())
.expect("Failed to send workspace click event");
});
}
button
} }
impl Module<gtk::Box> for WorkspacesModule { impl Module<gtk::Box> for WorkspacesModule {
fn into_widget(self, info: &ModuleInfo) -> Result<gtk::Box> { type SendMessage = WorkspaceUpdate;
let container = gtk::Box::new(Orientation::Horizontal, 0); type ReceiveMessage = String;
fn spawn_controller(
&self,
info: &ModuleInfo,
tx: Sender<ModuleUpdateEvent<Self::SendMessage>>,
mut rx: Receiver<Self::ReceiveMessage>,
) -> Result<()> {
let workspaces = { let workspaces = {
trace!("Getting current workspaces"); trace!("Getting current workspaces");
let sway = get_client(); let workspaces = await_sync(async {
let mut sway = sway.lock().expect("Failed to get lock on Sway IPC client"); let sway = get_client().await;
let raw = sway.ipc(IpcCommand::GetWorkspaces)?; let mut sway = sway.lock().await;
let workspaces = serde_json::from_slice::<Vec<Workspace>>(&raw)?; sway.get_workspaces().await
})?;
if self.all_monitors { if self.all_monitors {
workspaces workspaces
@@ -69,108 +86,154 @@ impl Module<gtk::Box> for WorkspacesModule {
} }
}; };
let name_map = self.name_map.unwrap_or_default(); tx.try_send(ModuleUpdateEvent::Update(WorkspaceUpdate::Init(workspaces)))
.expect("Failed to send initial workspace list");
let mut button_map: HashMap<String, Button> = HashMap::new();
let (ui_tx, mut ui_rx) = mpsc::channel(32);
trace!("Creating workspace buttons");
for workspace in workspaces {
let item = workspace.as_button(&name_map, &ui_tx);
container.add(&item);
button_map.insert(workspace.name, item);
}
let (tx, rx) = glib::MainContext::channel(glib::PRIORITY_DEFAULT);
spawn_blocking(move || {
trace!("Starting workspace event listener task");
let srx = {
let sway = get_client();
let mut sway = sway.lock().expect("Failed to get lock on Sway IPC client");
// Subscribe & send events
spawn(async move {
let mut srx = {
let sway = get_sub_client();
sway.subscribe_workspace() sway.subscribe_workspace()
}; };
while let Ok(payload) = srx.recv() { trace!("Set up Sway workspace subscription");
tx.send(payload).expect("Failed to send workspace event");
while let Ok(payload) = srx.recv().await {
tx.send(ModuleUpdateEvent::Update(WorkspaceUpdate::Update(payload)))
.await
.expect("Failed to send workspace update");
} }
}); });
{ // Change workspace focus
trace!("Setting up sway event handler");
let menubar = container.clone();
let output_name = info.output_name.to_string();
rx.attach(None, move |event| {
debug!("Received workspace event {:?}", event);
match event.change.as_str() {
"focus" => {
let old = event.old.and_then(|old| button_map.get(&old.name));
if let Some(old) = old {
old.style_context().remove_class("focused");
}
let new = event.current.and_then(|new| button_map.get(&new.name));
if let Some(new) = new {
new.style_context().add_class("focused");
}
trace!("{:?} {:?}", old, new);
}
"init" => {
if let Some(workspace) = event.current {
if self.all_monitors || workspace.output == output_name {
let item = workspace.as_button(&name_map, &ui_tx);
item.show();
menubar.add(&item);
button_map.insert(workspace.name, item);
}
}
}
"move" => {
if let Some(workspace) = event.current {
if !self.all_monitors {
if workspace.output == output_name {
let item = workspace.as_button(&name_map, &ui_tx);
item.show();
menubar.add(&item);
button_map.insert(workspace.name, item);
} else if let Some(item) = button_map.get(&workspace.name) {
menubar.remove(item);
}
}
}
}
"empty" => {
if let Some(workspace) = event.current {
if let Some(item) = button_map.get(&workspace.name) {
menubar.remove(item);
}
}
}
_ => {}
}
Continue(true)
});
}
spawn(async move { spawn(async move {
trace!("Setting up UI event handler"); trace!("Setting up UI event handler");
let sway = get_client(); let sway = get_client().await;
while let Some(name) = ui_rx.recv().await { while let Some(name) = rx.recv().await {
let mut sway = sway let mut sway = sway.lock().await;
.lock() sway.run_command(format!("workspace {}", name)).await?;
.expect("Failed to get write lock on Sway IPC client");
sway.run(format!("workspace {}", name))?;
} }
Ok::<(), Report>(()) Ok::<(), Report>(())
}); });
Ok(container) Ok(())
}
fn into_widget(
self,
context: WidgetContext<Self::SendMessage, Self::ReceiveMessage>,
info: &ModuleInfo,
) -> Result<ModuleWidget<gtk::Box>> {
let container = gtk::Box::new(info.bar_position.get_orientation(), 0);
let name_map = self.name_map.unwrap_or_default();
let mut button_map: HashMap<String, Button> = HashMap::new();
{
let container = container.clone();
let output_name = info.output_name.to_string();
context.widget_rx.attach(None, move |event| {
match event {
WorkspaceUpdate::Init(workspaces) => {
trace!("Creating workspace buttons");
for workspace in workspaces {
let item = create_button(
&workspace.name,
workspace.focused,
&name_map,
&context.controller_tx,
);
container.add(&item);
button_map.insert(workspace.name, item);
}
container.show_all();
}
WorkspaceUpdate::Update(event) if event.change == WorkspaceChange::Focus => {
let old = event
.old
.and_then(|old| old.name)
.and_then(|name| button_map.get(&name));
if let Some(old) = old {
old.style_context().remove_class("focused");
}
let new = event
.current
.and_then(|old| old.name)
.and_then(|new| button_map.get(&new));
if let Some(new) = new {
new.style_context().add_class("focused");
}
}
WorkspaceUpdate::Update(event) if event.change == WorkspaceChange::Init => {
if let Some(workspace) = event.current {
if self.all_monitors
|| workspace.output.unwrap_or_default() == output_name
{
let name = workspace.name.unwrap_or_default();
let item = create_button(
&name,
workspace.focused,
&name_map,
&context.controller_tx,
);
item.show();
container.add(&item);
if !name.is_empty() {
button_map.insert(name, item);
}
}
}
}
WorkspaceUpdate::Update(event) if event.change == WorkspaceChange::Move => {
if let Some(workspace) = event.current {
if !self.all_monitors {
if workspace.output.unwrap_or_default() == output_name {
let name = workspace.name.unwrap_or_default();
let item = create_button(
&name,
workspace.focused,
&name_map,
&context.controller_tx,
);
item.show();
container.add(&item);
if !name.is_empty() {
button_map.insert(name, item);
}
} else if let Some(item) =
button_map.get(&workspace.name.unwrap_or_default())
{
container.remove(item);
}
}
}
}
WorkspaceUpdate::Update(event) if event.change == WorkspaceChange::Empty => {
if let Some(workspace) = event.current {
if let Some(item) = button_map.get(&workspace.name.unwrap_or_default())
{
container.remove(item);
}
}
}
WorkspaceUpdate::Update(_) => {}
};
Continue(true)
});
}
Ok(ModuleWidget {
widget: container,
popup: None,
})
} }
} }

View File

@@ -1,27 +1,31 @@
use std::collections::HashMap;
use crate::config::BarPosition; use crate::config::BarPosition;
use crate::modules::ModuleInfo;
use gtk::gdk::Monitor; use gtk::gdk::Monitor;
use gtk::prelude::*; use gtk::prelude::*;
use gtk::{Application, ApplicationWindow, Button, Orientation}; use gtk::{ApplicationWindow, Button, Orientation};
use tracing::debug;
#[derive(Debug, Clone)] #[derive(Debug, Clone)]
pub struct Popup { pub struct Popup {
pub window: ApplicationWindow, pub window: ApplicationWindow,
pub container: gtk::Box, pub cache: HashMap<usize, gtk::Box>,
monitor: Monitor, monitor: Monitor,
pos: BarPosition,
} }
impl Popup { impl Popup {
/// Creates a new popup window. /// Creates a new popup window.
/// This includes setting up gtk-layer-shell /// This includes setting up gtk-layer-shell
/// and an empty `gtk::Box` container. /// and an empty `gtk::Box` container.
pub fn new( pub fn new(module_info: &ModuleInfo) -> Self {
name: &str, let pos = module_info.bar_position;
app: &Application, let orientation = pos.get_orientation();
monitor: &Monitor,
orientation: Orientation, let win = ApplicationWindow::builder()
bar_position: &BarPosition, .application(module_info.app)
) -> Self { .build();
let win = ApplicationWindow::builder().application(app).build();
gtk_layer_shell::init_for_window(&win); gtk_layer_shell::init_for_window(&win);
gtk_layer_shell::set_layer(&win, gtk_layer_shell::Layer::Overlay); gtk_layer_shell::set_layer(&win, gtk_layer_shell::Layer::Overlay);
@@ -29,57 +33,69 @@ impl Popup {
gtk_layer_shell::set_margin( gtk_layer_shell::set_margin(
&win, &win,
gtk_layer_shell::Edge::Top, gtk_layer_shell::Edge::Top,
if bar_position == &BarPosition::Top { if pos == BarPosition::Top { 5 } else { 0 },
5
} else {
0
},
); );
gtk_layer_shell::set_margin( gtk_layer_shell::set_margin(
&win, &win,
gtk_layer_shell::Edge::Bottom, gtk_layer_shell::Edge::Bottom,
if bar_position == &BarPosition::Bottom { if pos == BarPosition::Bottom { 5 } else { 0 },
5 );
} else { gtk_layer_shell::set_margin(
0 &win,
}, gtk_layer_shell::Edge::Left,
if pos == BarPosition::Left { 5 } else { 0 },
);
gtk_layer_shell::set_margin(
&win,
gtk_layer_shell::Edge::Right,
if pos == BarPosition::Right { 5 } else { 0 },
); );
gtk_layer_shell::set_margin(&win, gtk_layer_shell::Edge::Left, 0);
gtk_layer_shell::set_margin(&win, gtk_layer_shell::Edge::Right, 0);
gtk_layer_shell::set_anchor( gtk_layer_shell::set_anchor(
&win, &win,
gtk_layer_shell::Edge::Top, gtk_layer_shell::Edge::Top,
bar_position == &BarPosition::Top, pos == BarPosition::Top || orientation == Orientation::Vertical,
); );
gtk_layer_shell::set_anchor( gtk_layer_shell::set_anchor(
&win, &win,
gtk_layer_shell::Edge::Bottom, gtk_layer_shell::Edge::Bottom,
bar_position == &BarPosition::Bottom, pos == BarPosition::Bottom,
);
gtk_layer_shell::set_anchor(
&win,
gtk_layer_shell::Edge::Left,
pos == BarPosition::Left || orientation == Orientation::Horizontal,
);
gtk_layer_shell::set_anchor(
&win,
gtk_layer_shell::Edge::Right,
pos == BarPosition::Right,
); );
gtk_layer_shell::set_anchor(&win, gtk_layer_shell::Edge::Left, true);
gtk_layer_shell::set_anchor(&win, gtk_layer_shell::Edge::Right, false);
let content = gtk::Box::builder() win.connect_leave_notify_event(move |win, ev| {
.orientation(orientation)
.spacing(0)
.hexpand(false)
.name(name)
.build();
content.style_context().add_class("popup");
win.add(&content);
win.connect_leave_notify_event(|win, ev| {
const THRESHOLD: f64 = 3.0; const THRESHOLD: f64 = 3.0;
let (w, _h) = win.size(); let (w, h) = win.size();
let (x, y) = ev.position(); let (x, y) = ev.position();
// some child widgets trigger this event // some child widgets trigger this event
// so check we're actually outside the window // so check we're actually outside the window
if x < THRESHOLD || y < THRESHOLD || x > f64::from(w) - THRESHOLD { let hide = match pos {
BarPosition::Top => {
x < THRESHOLD || y > f64::from(h) - THRESHOLD || x > f64::from(w) - THRESHOLD
}
BarPosition::Bottom => {
x < THRESHOLD || y < THRESHOLD || x > f64::from(w) - THRESHOLD
}
BarPosition::Left => {
y < THRESHOLD || x > f64::from(w) - THRESHOLD || y > f64::from(h) - THRESHOLD
}
BarPosition::Right => {
y < THRESHOLD || x < THRESHOLD || y > f64::from(h) - THRESHOLD
}
};
if hide {
win.hide(); win.hide();
} }
@@ -88,15 +104,37 @@ impl Popup {
Self { Self {
window: win, window: win,
container: content, cache: HashMap::new(),
monitor: monitor.clone(), monitor: module_info.monitor.clone(),
pos,
} }
} }
/// Shows the popover pub fn register_content(&mut self, key: usize, content: gtk::Box) {
pub fn show(&self, button: &Button) { debug!("Registered popup content for #{}", key);
self.cache.insert(key, content);
}
pub fn show_content(&self, key: usize) {
self.clear_window();
if let Some(content) = self.cache.get(&key) {
content.style_context().add_class("popup");
self.window.add(content);
}
}
fn clear_window(&self) {
let children = self.window.children();
for child in children {
self.window.remove(&child);
}
}
/// Shows the popup
pub fn show(&self, geometry: ButtonGeometry) {
self.window.show_all(); self.window.show_all();
self.set_pos(button); self.set_pos(geometry);
} }
/// Hides the popover /// Hides the popover
@@ -104,27 +142,89 @@ impl Popup {
self.window.hide(); self.window.hide();
} }
/// Sets the popover's X position relative to the left border of the screen /// Checks if the popup is currently visible
fn set_pos(&self, button: &Button) { pub fn is_visible(&self) -> bool {
let widget_width = button.allocation().width(); self.window.is_visible()
let screen_width = self.monitor.workarea().width(); }
let popup_width = self.window.allocated_width();
let top_level = button.toplevel().expect("Failed to get top-level widget"); /// Sets the popup's X/Y position relative to the left or border of the screen
let (widget_x, _) = button /// (depending on orientation).
.translate_coordinates(&top_level, 0, 0) fn set_pos(&self, geometry: ButtonGeometry) {
.unwrap_or((0, 0)); let orientation = self.pos.get_orientation();
let widget_center = f64::from(widget_x) + f64::from(widget_width) / 2.0; let mon_workarea = self.monitor.workarea();
let screen_size = if orientation == Orientation::Horizontal {
mon_workarea.width()
} else {
mon_workarea.height()
};
let mut offset = (widget_center - (f64::from(popup_width) / 2.0)).round(); let (popup_width, popup_height) = self.window.size();
let popup_size = if orientation == Orientation::Horizontal {
popup_width
} else {
popup_height
};
let widget_center = f64::from(geometry.position) + f64::from(geometry.size) / 2.0;
let bar_offset = (f64::from(screen_size) - f64::from(geometry.bar_size)) / 2.0;
let mut offset = bar_offset + (widget_center - (f64::from(popup_size) / 2.0)).round();
if offset < 5.0 { if offset < 5.0 {
offset = 5.0; offset = 5.0;
} else if offset > f64::from(screen_width - popup_width) - 5.0 { } else if offset > f64::from(screen_size - popup_size) - 5.0 {
offset = f64::from(screen_width - popup_width) - 5.0; offset = f64::from(screen_size - popup_size) - 5.0;
} }
gtk_layer_shell::set_margin(&self.window, gtk_layer_shell::Edge::Left, offset as i32); let edge = if orientation == Orientation::Horizontal {
gtk_layer_shell::Edge::Left
} else {
gtk_layer_shell::Edge::Top
};
gtk_layer_shell::set_margin(&self.window, edge, offset as i32);
}
/// Gets the absolute X position of the button
/// and its width / height (depending on orientation).
pub fn button_pos(button: &Button, orientation: Orientation) -> ButtonGeometry {
let button_size = if orientation == Orientation::Horizontal {
button.allocation().width()
} else {
button.allocation().height()
};
let top_level = button.toplevel().expect("Failed to get top-level widget");
let bar_size = if orientation == Orientation::Horizontal {
top_level.allocation().width()
} else {
top_level.allocation().height()
};
let (button_x, button_y) = button
.translate_coordinates(&top_level, 0, 0)
.unwrap_or((0, 0));
let button_pos = if orientation == Orientation::Horizontal {
button_x
} else {
button_y
};
ButtonGeometry {
position: button_pos,
size: button_size,
bar_size,
}
} }
} }
#[derive(Debug, Copy, Clone)]
pub struct ButtonGeometry {
position: i32,
size: i32,
bar_size: i32,
}

35
src/script.rs Normal file
View File

@@ -0,0 +1,35 @@
use color_eyre::eyre::WrapErr;
use color_eyre::{Help, Report, Result};
use std::process::Command;
use tracing::instrument;
/// Attempts to execute a given command.
/// If the command returns status 0,
/// the `stdout` is returned.
/// Otherwise, an `Err` variant
/// containing the `stderr` is returned.
#[instrument]
pub fn exec_command(command: &str) -> Result<String> {
let output = Command::new("sh")
.arg("-c")
.arg(command)
.output()
.wrap_err("Failed to get script output")?;
if output.status.success() {
let stdout = String::from_utf8(output.stdout)
.map(|output| output.trim().to_string())
.wrap_err("Script stdout not valid UTF-8")?;
Ok(stdout)
} else {
let stderr = String::from_utf8(output.stderr)
.map(|output| output.trim().to_string())
.wrap_err("Script stderr not valid UTF-8")?;
Err(Report::msg(stderr)
.wrap_err("Script returned non-zero error code")
.suggestion("Check the path to your script")
.suggestion("Check the script for errors"))
}
}

View File

@@ -2,10 +2,13 @@ use color_eyre::{Help, Report};
use glib::Continue; use glib::Continue;
use gtk::prelude::CssProviderExt; use gtk::prelude::CssProviderExt;
use gtk::{gdk, gio, CssProvider, StyleContext}; use gtk::{gdk, gio, CssProvider, StyleContext};
use notify::{Event, RecursiveMode, Result, Watcher}; use notify::event::{DataChange, ModifyKind};
use notify::{recommended_watcher, Event, EventKind, RecursiveMode, Result, Watcher};
use std::path::PathBuf; use std::path::PathBuf;
use std::time::Duration;
use tokio::spawn; use tokio::spawn;
use tracing::{error, info}; use tokio::time::sleep;
use tracing::{debug, error, info};
/// Attempts to load CSS file at the given path /// Attempts to load CSS file at the given path
/// and attach if to the current GTK application. /// and attach if to the current GTK application.
@@ -15,13 +18,14 @@ use tracing::{error, info};
pub fn load_css(style_path: PathBuf) { pub fn load_css(style_path: PathBuf) {
let provider = CssProvider::new(); let provider = CssProvider::new();
if let Err(err) = provider.load_from_file(&gio::File::for_path(&style_path)) { match provider.load_from_file(&gio::File::for_path(&style_path)) {
error!("{:?}", Report::new(err) Ok(()) => debug!("Loaded css from '{}'", style_path.display()),
Err(err) => error!("{:?}", Report::new(err)
.wrap_err("Failed to load CSS") .wrap_err("Failed to load CSS")
.suggestion("Check the CSS file for errors") .suggestion("Check the CSS file for errors")
.suggestion("GTK CSS uses a subset of the full CSS spec and many properties are not available. Ensure you are not using any unsupported property.") .suggestion("GTK CSS uses a subset of the full CSS spec and many properties are not available. Ensure you are not using any unsupported property.")
); )
} };
let screen = gdk::Screen::default().expect("Failed to get default GTK screen"); let screen = gdk::Screen::default().expect("Failed to get default GTK screen");
StyleContext::add_provider_for_screen(&screen, &provider, 800); StyleContext::add_provider_for_screen(&screen, &provider, 800);
@@ -29,24 +33,27 @@ pub fn load_css(style_path: PathBuf) {
let (tx, rx) = glib::MainContext::channel(glib::PRIORITY_DEFAULT); let (tx, rx) = glib::MainContext::channel(glib::PRIORITY_DEFAULT);
spawn(async move { spawn(async move {
match notify::recommended_watcher(move |res: Result<Event>| match res { let mut watcher = recommended_watcher(move |res: Result<Event>| match res {
Ok(event) => { Ok(event) if event.kind == EventKind::Modify(ModifyKind::Data(DataChange::Any)) => {
debug!("{event:?}");
if let Some(path) = event.paths.first() { if let Some(path) = event.paths.first() {
tx.send(path.clone()) tx.send(path.clone())
.expect("Failed to send style changed message"); .expect("Failed to send style changed message");
} }
} }
Err(e) => error!("Error occurred when watching stylesheet: {:?}", e), Err(e) => error!("Error occurred when watching stylesheet: {:?}", e),
}) { _ => {}
Ok(mut watcher) => { })
watcher .expect("Failed to create CSS file watcher");
.watch(&style_path, RecursiveMode::NonRecursive)
.expect("Unexpected error when attempting to watch CSS"); watcher
} .watch(&style_path, RecursiveMode::NonRecursive)
Err(err) => error!( .expect("Failed to start CSS file watcher");
"{:?}", debug!("Installed CSS file watcher on '{}'", style_path.display());
Report::new(err).wrap_err("Failed to start CSS watcher")
), // avoid watcher from dropping
loop {
sleep(Duration::from_secs(1)).await;
} }
}); });

74
src/sway.rs Normal file
View File

@@ -0,0 +1,74 @@
use async_once::AsyncOnce;
use color_eyre::Report;
use futures_util::StreamExt;
use lazy_static::lazy_static;
use std::sync::Arc;
use swayipc_async::{Connection, Event, EventType, WorkspaceEvent};
use tokio::spawn;
use tokio::sync::broadcast::{channel, Receiver, Sender};
use tokio::sync::Mutex;
use tracing::{info, trace};
pub struct SwayEventClient {
workspace_tx: Sender<Box<WorkspaceEvent>>,
_workspace_rx: Receiver<Box<WorkspaceEvent>>,
}
impl SwayEventClient {
fn new() -> Self {
let (workspace_tx, workspace_rx) = channel(16);
let workspace_tx2 = workspace_tx.clone();
spawn(async move {
let workspace_tx = workspace_tx2;
let client = Connection::new().await?;
info!("Sway IPC subscription client connected");
let event_types = [EventType::Workspace];
let mut events = client.subscribe(event_types).await?;
while let Some(event) = events.next().await {
trace!("event: {:?}", event);
if let Event::Workspace(ev) = event? {
workspace_tx.send(ev)?;
};
}
Ok::<(), Report>(())
});
Self {
workspace_tx,
_workspace_rx: workspace_rx,
}
}
/// Gets an event receiver for workspace events
pub fn subscribe_workspace(&self) -> Receiver<Box<WorkspaceEvent>> {
self.workspace_tx.subscribe()
}
}
lazy_static! {
static ref CLIENT: AsyncOnce<Arc<Mutex<Connection>>> = AsyncOnce::new(async {
let client = Connection::new()
.await
.expect("Failed to connect to Sway socket");
Arc::new(Mutex::new(client))
});
static ref SUB_CLIENT: SwayEventClient = SwayEventClient::new();
}
/// Gets the sway IPC client
pub async fn get_client() -> Arc<Mutex<Connection>> {
let client = CLIENT.get().await;
Arc::clone(client)
}
/// Gets the sway IPC event subscription client
pub fn get_sub_client() -> &'static SwayEventClient {
&SUB_CLIENT
}

View File

@@ -1,224 +0,0 @@
use color_eyre::{Report, Result};
use crossbeam_channel::Receiver;
use ksway::{Error, IpcCommand, IpcEvent};
use lazy_static::lazy_static;
use serde::Deserialize;
use std::sync::{Arc, Mutex};
use tokio::spawn;
use tracing::{debug, info, trace};
pub mod node;
#[derive(Deserialize, Debug, Clone)]
pub struct WorkspaceEvent {
pub change: String,
pub old: Option<Workspace>,
pub current: Option<Workspace>,
}
#[derive(Deserialize, Debug, Clone)]
pub struct Workspace {
pub name: String,
pub focused: bool,
// pub num: i32,
pub output: String,
}
#[derive(Debug, Deserialize, Clone)]
pub struct WindowEvent {
pub change: String,
pub container: SwayNode,
}
#[derive(Debug, Deserialize, Clone)]
pub struct SwayNode {
#[serde(rename = "type")]
pub node_type: String,
pub id: i32,
pub name: Option<String>,
pub app_id: Option<String>,
pub focused: bool,
pub urgent: bool,
pub nodes: Vec<SwayNode>,
pub floating_nodes: Vec<SwayNode>,
pub shell: Option<String>,
pub window_properties: Option<WindowProperties>,
}
#[derive(Debug, Deserialize, Clone)]
pub struct WindowProperties {
pub class: Option<String>,
}
#[derive(Deserialize)]
pub struct SwayOutput {
pub name: String,
}
type Broadcaster<T> = Arc<Mutex<UnboundedBroadcast<T>>>;
pub struct SwayClient {
client: ksway::Client,
workspace_bc: Broadcaster<WorkspaceEvent>,
window_bc: Broadcaster<WindowEvent>,
}
impl SwayClient {
fn connect() -> Result<Self> {
let client = match ksway::Client::connect() {
Ok(client) => Ok(client),
Err(err) => Err(get_client_error(err)),
}?;
info!("Sway IPC client connected");
let workspace_bc = Arc::new(Mutex::new(UnboundedBroadcast::new()));
let window_bc = Arc::new(Mutex::new(UnboundedBroadcast::new()));
let workspace_bc2 = workspace_bc.clone();
let window_bc2 = window_bc.clone();
spawn(async move {
let mut sub_client = match ksway::Client::connect() {
Ok(client) => Ok(client),
Err(err) => Err(get_client_error(err)),
}
.expect("Failed to connect to Sway IPC server");
info!("Sway IPC subscription client connected");
let event_types = vec![IpcEvent::Window, IpcEvent::Workspace];
let rx = match sub_client.subscribe(event_types) {
Ok(res) => Ok(res),
Err(err) => Err(get_client_error(err)),
}
.expect("Failed to subscribe to Sway IPC server");
loop {
while let Ok((ev_type, payload)) = rx.try_recv() {
debug!("Received sway event {:?}", ev_type);
match ev_type {
IpcEvent::Workspace => {
let json = serde_json::from_slice::<WorkspaceEvent>(&payload).expect(
"Received invalid workspace event payload from Sway IPC server",
);
workspace_bc
.lock()
.expect("Failed to get lock on workspace event bus")
.send(json)
.expect("Failed to broadcast workspace event");
}
IpcEvent::Window => {
let json = serde_json::from_slice::<WindowEvent>(&payload).expect(
"Received invalid window event payload from Sway IPC server",
);
window_bc
.lock()
.expect("Failed to get lock on window event bus")
.send(json)
.expect("Failed to broadcast window event");
}
_ => {}
}
}
match sub_client.poll() {
Ok(()) => Ok(()),
Err(err) => Err(get_client_error(err)),
}
.expect("Failed to poll Sway IPC client");
}
});
Ok(Self {
client,
workspace_bc: workspace_bc2,
window_bc: window_bc2,
})
}
pub fn ipc(&mut self, command: IpcCommand) -> Result<Vec<u8>> {
debug!("Sending command: {:?}", command);
match self.client.ipc(command) {
Ok(res) => Ok(res),
Err(err) => Err(get_client_error(err)),
}
}
pub(crate) fn run(&mut self, cmd: String) -> Result<Vec<u8>> {
debug!("Sending command: {}", cmd);
match self.client.run(cmd) {
Ok(res) => Ok(res),
Err(err) => Err(get_client_error(err)),
}
}
pub fn subscribe_workspace(&mut self) -> Receiver<WorkspaceEvent> {
trace!("Adding new workspace subscriber");
self.workspace_bc
.lock()
.expect("Failed to get lock on workspace event bus")
.subscribe()
}
pub fn subscribe_window(&mut self) -> Receiver<WindowEvent> {
trace!("Adding new window subscriber");
self.window_bc
.lock()
.expect("Failed to get lock on window event bus")
.subscribe()
}
}
/// Gets an error report from a `ksway` error enum variant
pub fn get_client_error(error: Error) -> Report {
match error {
Error::SockPathNotFound => Report::msg("Sway socket path not found"),
Error::SubscriptionError => Report::msg("Sway IPC subscription error"),
Error::AlreadySubscribed => Report::msg("Already subscribed to Sway IPC server"),
Error::Io(err) => Report::new(err),
}
}
lazy_static! {
static ref CLIENT: Arc<Mutex<SwayClient>> = {
let client = SwayClient::connect();
match client {
Ok(client) => Arc::new(Mutex::new(client)),
Err(err) => panic!("{:?}", err),
}
};
}
pub fn get_client() -> Arc<Mutex<SwayClient>> {
Arc::clone(&CLIENT)
}
/// Crossbeam channel wrapper
/// which sends messages to all receivers.
pub struct UnboundedBroadcast<T> {
channels: Vec<crossbeam_channel::Sender<T>>,
}
impl<T: 'static + Clone + Send + Sync> UnboundedBroadcast<T> {
/// Creates a new broadcaster.
pub const fn new() -> Self {
Self { channels: vec![] }
}
/// Creates a new sender/receiver pair.
/// The sender is stored locally and the receiver is returned.
pub fn subscribe(&mut self) -> Receiver<T> {
let (tx, rx) = crossbeam_channel::unbounded();
self.channels.push(tx);
rx
}
/// Attempts to send a messsge to all receivers.
pub fn send(&self, message: T) -> Result<(), crossbeam_channel::SendError<T>> {
for c in &self.channels {
c.send(message.clone())?;
}
Ok(())
}
}

View File

@@ -1,57 +0,0 @@
use crate::sway::{SwayClient, SwayNode};
use color_eyre::Result;
use ksway::IpcCommand;
impl SwayNode {
/// Gets either the `app_id` or `class`
/// depending on whether this is a native Wayland
/// or xwayland application.
pub fn get_id(&self) -> &str {
self.app_id.as_ref().map_or_else(
|| {
self.window_properties
.as_ref()
.expect("Cannot find node window properties")
.class
.as_ref()
.expect("Cannot find node name")
},
|app_id| app_id,
)
}
/// Checks whether this application
/// is running under xwayland.
pub fn is_xwayland(&self) -> bool {
self.shell == Some(String::from("xwayland"))
}
}
/// Recursively checks the provided node for any child application nodes.
/// Returns a list of any found application nodes.
fn check_node(node: SwayNode, window_nodes: &mut Vec<SwayNode>) {
if node.name.is_some() && (node.node_type == "con" || node.node_type == "floating_con") {
window_nodes.push(node);
} else {
node.nodes.into_iter().for_each(|node| {
check_node(node, window_nodes);
});
node.floating_nodes.into_iter().for_each(|node| {
check_node(node, window_nodes);
});
}
}
impl SwayClient {
/// Gets a flat vector of all currently open windows.
pub fn get_open_windows(&mut self) -> Result<Vec<SwayNode>> {
let root_node = self.ipc(IpcCommand::GetTree)?;
let root_node = serde_json::from_slice(&root_node)?;
let mut window_nodes = vec![];
check_node(root_node, &mut window_nodes);
Ok(window_nodes)
}
}

129
src/wayland/client.rs Normal file
View File

@@ -0,0 +1,129 @@
use super::{Env, ToplevelHandler};
use crate::wayland::toplevel::{ToplevelEvent, ToplevelInfo};
use crate::wayland::toplevel_manager::listen_for_toplevels;
use crate::wayland::ToplevelChange;
use color_eyre::Report;
use indexmap::IndexMap;
use smithay_client_toolkit::environment::Environment;
use smithay_client_toolkit::output::{with_output_info, OutputInfo};
use smithay_client_toolkit::reexports::calloop;
use smithay_client_toolkit::{new_default_environment, WaylandSource};
use std::sync::{Arc, RwLock};
use std::time::Duration;
use tokio::sync::{broadcast, oneshot};
use tokio::task::spawn_blocking;
use tracing::{error, trace};
use wayland_client::protocol::wl_seat::WlSeat;
use wayland_protocols::wlr::unstable::foreign_toplevel::v1::client::{
zwlr_foreign_toplevel_handle_v1::ZwlrForeignToplevelHandleV1,
zwlr_foreign_toplevel_manager_v1::ZwlrForeignToplevelManagerV1,
};
pub struct WaylandClient {
pub outputs: Vec<OutputInfo>,
pub seats: Vec<WlSeat>,
pub toplevels: Arc<RwLock<IndexMap<usize, (ToplevelInfo, ZwlrForeignToplevelHandleV1)>>>,
toplevel_tx: broadcast::Sender<ToplevelEvent>,
_toplevel_rx: broadcast::Receiver<ToplevelEvent>,
}
impl WaylandClient {
pub(super) async fn new() -> Self {
let (output_tx, output_rx) = oneshot::channel();
let (seat_tx, seat_rx) = oneshot::channel();
let (toplevel_tx, toplevel_rx) = broadcast::channel(32);
let toplevel_tx2 = toplevel_tx.clone();
let toplevels = Arc::new(RwLock::new(IndexMap::new()));
let toplevels2 = toplevels.clone();
// `queue` is not send so we need to handle everything inside the task
spawn_blocking(move || {
let (env, _display, queue) =
new_default_environment!(Env, fields = [toplevel: ToplevelHandler::init()])
.expect("Failed to connect to Wayland compositor");
let outputs = Self::get_outputs(&env);
output_tx
.send(outputs)
.expect("Failed to send outputs out of task");
let seats = env.get_all_seats();
seat_tx
.send(
seats
.into_iter()
.map(|seat| seat.detach())
.collect::<Vec<WlSeat>>(),
)
.expect("Failed to send seats out of task");
let _toplevel_manager = env.require_global::<ZwlrForeignToplevelManagerV1>();
let _listener = listen_for_toplevels(env, move |handle, event, _ddata| {
trace!("Received toplevel event: {:?}", event);
if event.change == ToplevelChange::Close {
toplevels2
.write()
.expect("Failed to get write lock on toplevels")
.remove(&event.toplevel.id);
} else {
toplevels2
.write()
.expect("Failed to get write lock on toplevels")
.insert(event.toplevel.id, (event.toplevel.clone(), handle));
}
toplevel_tx2
.send(event)
.expect("Failed to send toplevel event");
});
let mut event_loop =
calloop::EventLoop::<()>::try_new().expect("Failed to create new event loop");
WaylandSource::new(queue)
.quick_insert(event_loop.handle())
.expect("Failed to insert event loop into wayland event queue");
loop {
// TODO: Avoid need for duration here - can we force some event when sending requests?
if let Err(err) = event_loop.dispatch(Duration::from_millis(50), &mut ()) {
error!(
"{:?}",
Report::new(err).wrap_err("Failed to dispatch pending wayland events")
);
}
}
});
let outputs = output_rx
.await
.expect("Failed to receive outputs from task");
let seats = seat_rx.await.expect("Failed to receive seats from task");
Self {
outputs,
seats,
toplevels,
toplevel_tx,
_toplevel_rx: toplevel_rx,
}
}
pub fn subscribe_toplevels(&self) -> broadcast::Receiver<ToplevelEvent> {
self.toplevel_tx.subscribe()
}
fn get_outputs(env: &Environment<Env>) -> Vec<OutputInfo> {
let outputs = env.get_all_outputs();
outputs
.iter()
.filter_map(|output| with_output_info(output, Clone::clone))
.collect()
}
}

54
src/wayland/mod.rs Normal file
View File

@@ -0,0 +1,54 @@
mod client;
mod toplevel;
mod toplevel_manager;
extern crate smithay_client_toolkit as sctk;
use self::toplevel_manager::ToplevelHandler;
pub use crate::wayland::toplevel::{ToplevelChange, ToplevelEvent, ToplevelInfo};
use crate::wayland::toplevel_manager::{ToplevelHandling, ToplevelStatusListener};
use async_once::AsyncOnce;
use lazy_static::lazy_static;
use wayland_client::{Attached, DispatchData, Interface};
use wayland_protocols::wlr::unstable::foreign_toplevel::v1::client::{
zwlr_foreign_toplevel_handle_v1::ZwlrForeignToplevelHandleV1,
zwlr_foreign_toplevel_manager_v1::ZwlrForeignToplevelManagerV1,
};
pub use client::WaylandClient;
/// A utility for lazy-loading globals.
/// Taken from `smithay_client_toolkit` where it's not exposed
#[derive(Debug)]
enum LazyGlobal<I: Interface> {
Unknown,
Seen { id: u32, version: u32 },
Bound(Attached<I>),
}
sctk::default_environment!(Env,
fields = [
toplevel: ToplevelHandler
],
singles = [
ZwlrForeignToplevelManagerV1 => toplevel
],
);
impl ToplevelHandling for Env {
fn listen<F>(&mut self, f: F) -> ToplevelStatusListener
where
F: FnMut(ZwlrForeignToplevelHandleV1, ToplevelEvent, DispatchData) + 'static,
{
self.toplevel.listen(f)
}
}
lazy_static! {
static ref CLIENT: AsyncOnce<WaylandClient> =
AsyncOnce::new(async { WaylandClient::new().await });
}
pub async fn get_client() -> &'static WaylandClient {
CLIENT.get().await
}

151
src/wayland/toplevel.rs Normal file
View File

@@ -0,0 +1,151 @@
use std::collections::HashSet;
use std::sync::{Arc, RwLock};
use std::sync::atomic::{AtomicUsize, Ordering};
use tracing::trace;
use wayland_client::{DispatchData, Main};
use wayland_protocols::wlr::unstable::foreign_toplevel::v1::client::zwlr_foreign_toplevel_handle_v1::{Event, ZwlrForeignToplevelHandleV1};
const STATE_ACTIVE: u32 = 2;
const STATE_FULLSCREEN: u32 = 3;
static COUNTER: AtomicUsize = AtomicUsize::new(1);
fn get_id() -> usize {
COUNTER.fetch_add(1, Ordering::Relaxed)
}
#[derive(Debug, Clone, Default)]
pub struct ToplevelInfo {
pub id: usize,
pub app_id: String,
pub title: String,
pub active: bool,
pub fullscreen: bool,
ready: bool,
}
impl ToplevelInfo {
fn new() -> Self {
let id = get_id();
Self {
id,
..Default::default()
}
}
}
pub struct Toplevel;
#[derive(Debug, Clone)]
pub struct ToplevelEvent {
pub toplevel: ToplevelInfo,
pub change: ToplevelChange,
}
#[derive(Debug, Clone, PartialEq, Eq)]
pub enum ToplevelChange {
New,
Close,
Title(String),
Focus(bool),
Fullscreen(bool),
}
fn toplevel_implem<F>(event: Event, info: &mut ToplevelInfo, implem: &mut F, ddata: DispatchData)
where
F: FnMut(ToplevelEvent, DispatchData),
{
trace!("event: {event:?} (info: {info:?})");
let change = match event {
Event::AppId { app_id } => {
info.app_id = app_id;
None
}
Event::Title { title } => {
info.title = title.clone();
if info.ready {
Some(ToplevelChange::Title(title))
} else {
None
}
}
Event::State { state } => {
// state is received as a `Vec<u8>` where every 4 bytes make up a `u32`
// the u32 then represents a value in the `State` enum.
assert_eq!(state.len() % 4, 0);
let state = (0..state.len() / 4)
.map(|i| {
let slice: [u8; 4] = state[i * 4..i * 4 + 4]
.try_into()
.expect("Received invalid state length");
u32::from_le_bytes(slice)
})
.collect::<HashSet<_>>();
let new_active = state.contains(&STATE_ACTIVE);
let new_fullscreen = state.contains(&STATE_FULLSCREEN);
let change = if info.ready && new_active != info.active {
Some(ToplevelChange::Focus(new_active))
} else if info.ready && new_fullscreen != info.fullscreen {
Some(ToplevelChange::Fullscreen(new_fullscreen))
} else {
None
};
info.active = new_active;
info.fullscreen = new_fullscreen;
change
}
Event::Closed => {
if info.ready {
Some(ToplevelChange::Close)
} else {
None
}
}
Event::OutputEnter { output: _ } => None,
Event::OutputLeave { output: _ } => None,
Event::Parent { parent: _ } => None,
Event::Done => {
if info.ready || info.app_id.is_empty() {
None
} else {
info.ready = true;
Some(ToplevelChange::New)
}
}
_ => unreachable!(),
};
if let Some(change) = change {
let event = ToplevelEvent {
change,
toplevel: info.clone(),
};
implem(event, ddata);
}
}
impl Toplevel {
pub fn init<F>(handle: &Main<ZwlrForeignToplevelHandleV1>, mut callback: F) -> Self
where
F: FnMut(ToplevelEvent, DispatchData) + 'static,
{
let inner = Arc::new(RwLock::new(ToplevelInfo::new()));
handle.quick_assign(move |_handle, event, ddata| {
let mut inner = inner
.write()
.expect("Failed to get write lock on toplevel inner state");
toplevel_implem(event, &mut inner, &mut callback, ddata);
});
Self
}
}

View File

@@ -0,0 +1,164 @@
use crate::wayland::toplevel::{Toplevel, ToplevelEvent};
use crate::wayland::LazyGlobal;
use smithay_client_toolkit::environment::{Environment, GlobalHandler};
use std::cell::RefCell;
use std::rc;
use std::rc::Rc;
use tracing::warn;
use wayland_client::protocol::wl_registry::WlRegistry;
use wayland_client::{Attached, DispatchData};
use wayland_protocols::wlr::unstable::foreign_toplevel::v1::client::{
zwlr_foreign_toplevel_handle_v1::ZwlrForeignToplevelHandleV1,
zwlr_foreign_toplevel_manager_v1::{self, ZwlrForeignToplevelManagerV1},
};
struct ToplevelHandlerInner {
manager: LazyGlobal<ZwlrForeignToplevelManagerV1>,
registry: Option<Attached<WlRegistry>>,
toplevels: Vec<Toplevel>,
}
impl ToplevelHandlerInner {
const fn new() -> Self {
let toplevels = vec![];
Self {
registry: None,
manager: LazyGlobal::Unknown,
toplevels,
}
}
}
pub struct ToplevelHandler {
inner: Rc<RefCell<ToplevelHandlerInner>>,
status_listeners: Rc<RefCell<Vec<rc::Weak<RefCell<ToplevelStatusCallback>>>>>,
}
impl ToplevelHandler {
pub fn init() -> Self {
let inner = Rc::new(RefCell::new(ToplevelHandlerInner::new()));
Self {
inner,
status_listeners: Rc::new(RefCell::new(Vec::new())),
}
}
}
impl GlobalHandler<ZwlrForeignToplevelManagerV1> for ToplevelHandler {
fn created(
&mut self,
registry: Attached<WlRegistry>,
id: u32,
version: u32,
_ddata: DispatchData,
) {
let mut inner = RefCell::borrow_mut(&self.inner);
if inner.registry.is_none() {
inner.registry = Some(registry);
}
if let LazyGlobal::Unknown = inner.manager {
inner.manager = LazyGlobal::Seen { id, version }
} else {
warn!(
"Compositor advertised zwlr_foreign_toplevel_manager_v1 multiple times, ignoring."
);
}
}
fn get(&self) -> Option<Attached<ZwlrForeignToplevelManagerV1>> {
let mut inner = RefCell::borrow_mut(&self.inner);
match inner.manager {
LazyGlobal::Bound(ref mgr) => Some(mgr.clone()),
LazyGlobal::Unknown => None,
LazyGlobal::Seen { id, version } => {
let registry = inner.registry.as_ref().expect("Failed to get registry");
// current max protocol version = 3
let version = std::cmp::min(version, 3);
let manager = registry.bind::<ZwlrForeignToplevelManagerV1>(version, id);
{
let inner = self.inner.clone();
let status_listeners = self.status_listeners.clone();
manager.quick_assign(move |_, event, _ddata| {
let mut inner = RefCell::borrow_mut(&inner);
let status_listeners = status_listeners.clone();
match event {
zwlr_foreign_toplevel_manager_v1::Event::Toplevel {
toplevel: handle,
} => {
let toplevel =
Toplevel::init(&handle.clone(), move |event, ddata| {
notify_status_listeners(
&handle,
&event,
ddata,
&status_listeners,
);
});
inner.toplevels.push(toplevel);
}
zwlr_foreign_toplevel_manager_v1::Event::Finished => {}
_ => unreachable!(),
}
});
}
inner.manager = LazyGlobal::Bound((*manager).clone());
Some((*manager).clone())
}
}
}
}
type ToplevelStatusCallback =
dyn FnMut(ZwlrForeignToplevelHandleV1, ToplevelEvent, DispatchData) + 'static;
/// Notifies the callbacks of an event on the toplevel
fn notify_status_listeners(
toplevel: &ZwlrForeignToplevelHandleV1,
event: &ToplevelEvent,
mut ddata: DispatchData,
listeners: &RefCell<Vec<rc::Weak<RefCell<ToplevelStatusCallback>>>>,
) {
listeners.borrow_mut().retain(|lst| {
rc::Weak::upgrade(lst).map_or(false, |cb| {
(cb.borrow_mut())(toplevel.clone(), event.clone(), ddata.reborrow());
true
})
});
}
pub struct ToplevelStatusListener {
_cb: Rc<RefCell<ToplevelStatusCallback>>,
}
pub trait ToplevelHandling {
fn listen<F>(&mut self, f: F) -> ToplevelStatusListener
where
F: FnMut(ZwlrForeignToplevelHandleV1, ToplevelEvent, DispatchData) + 'static;
}
impl ToplevelHandling for ToplevelHandler {
fn listen<F>(&mut self, f: F) -> ToplevelStatusListener
where
F: FnMut(ZwlrForeignToplevelHandleV1, ToplevelEvent, DispatchData) + 'static,
{
let rc = Rc::new(RefCell::new(f)) as Rc<_>;
self.status_listeners.borrow_mut().push(Rc::downgrade(&rc));
ToplevelStatusListener { _cb: rc }
}
}
pub fn listen_for_toplevels<E, F>(env: Environment<E>, f: F) -> ToplevelStatusListener
where
E: ToplevelHandling,
F: FnMut(ZwlrForeignToplevelHandleV1, ToplevelEvent, DispatchData) + 'static,
{
env.with_inner(move |inner| ToplevelHandling::listen(inner, f))
}