chore(release): v0.8.0

ci(build): reverse order of fmt/clippy/build
style: run rustfmt
2022-11-30 22:58:31 +00:00 · 2022-11-30 22:56:44 +00:00 · 2022-11-30 22:49:49 +00:00 · 2022-11-30 22:42:31 +00:00 · 2022-11-30 22:40:53 +00:00 · 2022-11-30 22:27:56 +00:00
76 changed files with 8110 additions and 2876 deletions
--- a/.github/scripts/sync-wiki.sh
+++ b/.github/scripts/sync-wiki.sh
@@ -0,0 +1,43 @@
+#!/bin/sh
+set -eu
+
+TEMP_REPO_DIR="wiki_action_$GITHUB_REPOSITORY$GITHUB_SHA"
+TEMP_WIKI_DIR="temp_wiki_$GITHUB_SHA"
+
+WIKI_DIR='docs'
+
+if [ -z "$GH_TOKEN" ]; then
+    echo "Token is not specified"
+    exit 1
+fi
+
+#Clone repo
+echo "Cloning repo https://github.com/$GITHUB_REPOSITORY"
+git clone "https://$GITHUB_ACTOR:$GH_TOKEN@github.com/$GITHUB_REPOSITORY" "$TEMP_REPO_DIR"
+
+#Clone wiki repo
+echo "Cloning wiki repo https://github.com/$GITHUB_REPOSITORY.wiki.git"
+cd "$TEMP_REPO_DIR"
+git clone "https://$GITHUB_ACTOR:$GH_TOKEN@github.com/$GITHUB_REPOSITORY.wiki.git" "$TEMP_WIKI_DIR"
+
+#Get commit details
+author='Jake Stanger'
+email='mail@jstanger.dev'
+message='action: sync wiki'
+
+echo "Copying edited wiki"
+cp -R "$TEMP_WIKI_DIR/.git" "$WIKI_DIR/"
+
+echo "Checking if wiki has changes"
+cd "$WIKI_DIR"
+git config --local user.email "$email"
+git config --local user.name "$author"
+git add .
+
+if git diff-index --quiet HEAD; then
+  echo "Nothing changed"
+  exit 0
+fi
+
+echo "Pushing changes to wiki"
+git commit -m "$message" && git push "https://$GITHUB_ACTOR:$GH_TOKEN@github.com/$GITHUB_REPOSITORY.wiki.git"
--- a/.github/workflows/build.yml
+++ b/.github/workflows/build.yml
@@ -1,6 +1,7 @@
 name: Build

 on:
+  workflow_dispatch:
  push:
    branches: [ "master" ]
  pull_request:
@@ -24,8 +25,8 @@ jobs:
      - name: Install build deps
        run: sudo apt install libgtk-3-dev libgtk-layer-shell-dev

-      - name: Build
-        run: cargo build --verbose
+      - name: Check formatting
+        run: cargo fmt --check

      - name: Clippy
        uses: actions-rs/clippy-check@v1
@@ -33,5 +34,32 @@ jobs:
          token: ${{ secrets.GITHUB_TOKEN }}
          args: --all-features

-      - name: Check formatting
-        run: cargo fmt --check
+      - name: Build
+        run: cargo build --verbose
+
+      - name: Run tests
+        uses: actions-rs/cargo@v1
+        with:
+          command: test
+
+
+
+  build-nix:
+    runs-on: ubuntu-latest
+
+    steps:
+      - uses: actions/checkout@v3
+
+      - uses: cachix/install-nix-action@v17
+        with:
+          install_url: https://nixos.org/nix/install
+          extra_nix_config: |
+            auto-optimise-store = true
+            experimental-features = nix-command flakes
+
+      - uses: cachix/cachix-action@v11
+        with:
+          name: jakestanger
+          signingKey: '${{ secrets.CACHIX_SIGNING_KEY }}'
+
+      - run: nix build --print-build-logs
--- a/.github/workflows/deploy.yml
+++ b/.github/workflows/deploy.yml
@@ -26,6 +26,7 @@ jobs:
        with:
          token: ${{ github.token }}
          tag: ${{ github.ref_name }}
+          excludeTypes: 'build,chore,style'

      - name: Create release
        uses: ncipollo/release-action@v1
--- a/.github/workflows/update-nix-flake-lock.yml
+++ b/.github/workflows/update-nix-flake-lock.yml
@@ -0,0 +1,27 @@
+name: update-nix-flake-lock
+on:
+  workflow_dispatch: # allows manual triggering
+  schedule:
+    - cron: '0 0 1 * *' # first day of every month
+
+jobs:
+  update-nix-flake-lock:
+    runs-on: ubuntu-latest
+
+    steps:
+      - name: Checkout repository
+        uses: actions/checkout@v2
+
+      - name: Install Nix
+        uses: cachix/install-nix-action@v16
+        with:
+          extra_nix_config: |
+            access-tokens = github.com=${{ secrets.GITHUB_TOKEN }}
+
+      - name: Update flake.lock
+        uses: DeterminateSystems/update-flake-lock@vX
+        with:
+          pr-title: "Update flake.lock" # Title of PR to be created
+          pr-labels: |                  # Labels to be set on the PR
+            dependencies
+            automated
--- a/.github/workflows/wiki.yml
+++ b/.github/workflows/wiki.yml
@@ -0,0 +1,17 @@
+name: Sync Wiki
+
+on:
+  push:
+    branches: [ "master" ]
+
+jobs:
+  build:
+    runs-on: ubuntu-latest
+
+    steps:
+      - uses: actions/checkout@v3
+
+      - name: Sync Wiki
+        run: ./.github/scripts/sync-wiki.sh
+        env:
+          GH_TOKEN: ${{ secrets.GITHUB_TOKEN }}
--- a/.idea/runConfigurations/Run.xml
+++ b/.idea/runConfigurations/Run.xml
@@ -12,7 +12,7 @@
    <envs>
      <env name="IRONBAR_CONFIG" value="examples/config.json" />
      <env name="PATH" value="/usr/local/bin:/usr/bin:$USER_HOME$/.local/share/npm/bin" />
-      <env name="RUST_LOG" value="trace" />
+      <env name="RUST_LOG" value="debug" />
    </envs>
    <option name="isRedirectInput" value="false" />
    <option name="redirectInputPath" value="" />
--- a/.idea/runConfigurations/Run__GTK_Debug_.xml
+++ b/.idea/runConfigurations/Run__GTK_Debug_.xml
@@ -12,6 +12,8 @@
    <envs>
      <env name="GTK_DEBUG" value="interactive" />
      <env name="IRONBAR_CONFIG" value="examples/config.json" />
+      <env name="RUST_LOG" value="debug" />
+      <env name="PATH" value="/usr/local/bin:/usr/bin:$USER_HOME$/.local/share/npm/bin" />
    </envs>
    <option name="isRedirectInput" value="false" />
    <option name="redirectInputPath" value="" />
--- a/.idea/runConfigurations/Run__Live_Config_.xml
+++ b/.idea/runConfigurations/Run__Live_Config_.xml
@@ -11,7 +11,7 @@
    <option name="backtrace" value="SHORT" />
    <envs>
      <env name="PATH" value="/usr/local/bin:/usr/bin:$USER_HOME$/.local/share/npm/bin" />
-      <env name="RUST_LOG" value="trace" />
+      <env name="RUST_LOG" value="debug" />
    </envs>
    <option name="isRedirectInput" value="false" />
    <option name="redirectInputPath" value="" />
--- a/CHANGELOG.md
+++ b/CHANGELOG.md
@@ -4,6 +4,74 @@ All notable changes to this project will be documented in this file.
 The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/),
 and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).

+## [v0.7.0] - 2022-11-05
+### :sparkles: New Features
+- [`fad90fd`](https://github.com/JakeStanger/ironbar/commit/fad90fdad683a612497ac7822a66a90f43fce0a2) - **sys-info**: add loads more formatting tokens *(commit by [@JakeStanger](https://github.com/JakeStanger))*
+- [`dec402e`](https://github.com/JakeStanger/ironbar/commit/dec402edd9d6c5b8677ff337699ad99ebc69b776) - **sys-info**: config options for refresh intervals *(commit by [@JakeStanger](https://github.com/JakeStanger))*
+- [`91c57ed`](https://github.com/JakeStanger/ironbar/commit/91c57edc73f15397ea0de70c4a6a6532c35caf2a) - **sys-info**: pango markup support *(commit by [@JakeStanger](https://github.com/JakeStanger))*
+- [`ec1d596`](https://github.com/JakeStanger/ironbar/commit/ec1d59677b13c9654a98d78f909ba2d0fcfbb72d) - **logging**: `IRONBAR_LOG` and `IRONBAR_FILE_LOG` env vars *(commit by [@JakeStanger](https://github.com/JakeStanger))*
+- [`493df6b`](https://github.com/JakeStanger/ironbar/commit/493df6bb49fec8c465706d3f9b395728ba73a621) - **mpd**: add volume slider to popup *(commit by [@JakeStanger](https://github.com/JakeStanger))*
+- [`3750124`](https://github.com/JakeStanger/ironbar/commit/3750124d8cfb4783932a6b3359384f245fcd2394) - new custom module *(commit by [@JakeStanger](https://github.com/JakeStanger))*
+- [`b7792a4`](https://github.com/JakeStanger/ironbar/commit/b7792a415e09fc535750ea5af530f91aa791c4bc) - env var to set custom css location *(commit by [@JakeStanger](https://github.com/JakeStanger))*
+- [`ad77dc4`](https://github.com/JakeStanger/ironbar/commit/ad77dc4e4c2f80fcb4c9604c796be0f981e895ee) - improved logging & error handling *(commit by [@JakeStanger](https://github.com/JakeStanger))*
+
+### :bug: Bug Fixes
+- [`9e6dbbd`](https://github.com/JakeStanger/ironbar/commit/9e6dbbd131a09f101b0d490265fe7d4ec564e38c) - **sys-info**: tokens not replaced if more than one in string *(commit by [@JakeStanger](https://github.com/JakeStanger))*
+- [`f17ae7a`](https://github.com/JakeStanger/ironbar/commit/f17ae7a415b931c64942de085e8889f37b3f9b11) - **script**: not parsing pango markup *(commit by [@JakeStanger](https://github.com/JakeStanger))*
+- [`b66bd78`](https://github.com/JakeStanger/ironbar/commit/b66bd788b23256a2127a1352693fdd3f929d9c4b) - logging for creating bar incorrect still *(commit by [@JakeStanger](https://github.com/JakeStanger))*
+- [`3c43c20`](https://github.com/JakeStanger/ironbar/commit/3c43c20c6ae53a9aa6b67770b0c489806784f4ac) - weird behaviour when config does not exist *(commit by [@JakeStanger](https://github.com/JakeStanger))*
+- [`70e1b52`](https://github.com/JakeStanger/ironbar/commit/70e1b526a9681b16545d7f05d77470d76bd8819e) - **logging**: file log not capturing panics *(commit by [@JakeStanger](https://github.com/JakeStanger))*
+- [`cbd0c49`](https://github.com/JakeStanger/ironbar/commit/cbd0c49e251b5c8e0289ca6200a393d89994992d) - css watcher not working *(commit by [@JakeStanger](https://github.com/JakeStanger))*
+- [`e693c1c`](https://github.com/JakeStanger/ironbar/commit/e693c1c166eef0b5edcdcd033bb12d572e4e5f04) - **mpd**: volume slider causing mpd server errors *(commit by [@JakeStanger](https://github.com/JakeStanger))*
+- [`3a83bd3`](https://github.com/JakeStanger/ironbar/commit/3a83bd31ab165869f7f274b054b2f16485261fd1) - able to insert duplicate keys into collection *(commit by [@JakeStanger](https://github.com/JakeStanger))*
+
+### :recycle: Refactors
+- [`5ebc84c`](https://github.com/JakeStanger/ironbar/commit/5ebc84c7b98cc648a659ca37fdc0f041057f0ea4) - **logging**: consts for default log levels *(commit by [@JakeStanger](https://github.com/JakeStanger))*
+- [`bc625b9`](https://github.com/JakeStanger/ironbar/commit/bc625b929b8644ce92f275b5d98cdf74b93fe067) - clippy & fmt *(commit by [@JakeStanger](https://github.com/JakeStanger))*
+
+### :memo: Documentation Changes
+- [`9d9c275`](https://github.com/JakeStanger/ironbar/commit/9d9c2753137331ae85ac8ab7d75a6de9a9c82042) - update CHANGELOG.md for v0.6.0 [skip ci] *(commit by [@JakeStanger](https://github.com/JakeStanger))*
+- [`27d0479`](https://github.com/JakeStanger/ironbar/commit/27d04795af1c25fe5f765c7480d5dd5d096a8ab7) - **readme**: add warning about crate being outdated *(commit by [@JakeStanger](https://github.com/JakeStanger))*
+- [`a06c4bc`](https://github.com/JakeStanger/ironbar/commit/a06c4bccca6cb51935605ac9239e63024fb7c663) - **examples**: add full system info config *(commit by [@JakeStanger](https://github.com/JakeStanger))*
+- [`0a331f3`](https://github.com/JakeStanger/ironbar/commit/0a331f31381f0d967793c0d8b7a14e2a43bf666f) - **readme**: remove warning about outdated cargo package *(commit by [@JakeStanger](https://github.com/JakeStanger))*
+
+
+## [v0.6.0] - 2022-10-15
+### :sparkles: New Features
+- [`b188bc7`](https://github.com/JakeStanger/ironbar/commit/b188bc714614406935d8bb88a719adab2dfce32f) - initial support for running outside sway *(commit by [@JakeStanger](https://github.com/JakeStanger))*
+- [`324f00c`](https://github.com/JakeStanger/ironbar/commit/324f00cdf9200e3e3ecedfa68ab4c99b170242e2) - wlroots-agnostic support for `focused` module *(commit by [@JakeStanger](https://github.com/JakeStanger))*
+- [`b1c66b9`](https://github.com/JakeStanger/ironbar/commit/b1c66b9117cf8a10350cdb857a5267a1a72ad914) - wlroots-agnostic support for `launcher` module *(commit by [@JakeStanger](https://github.com/JakeStanger))*
+- [`1dd0a9e`](https://github.com/JakeStanger/ironbar/commit/1dd0a9e52f69e672d9ac313c1da0e201c911e6c2) - **launcher**: add popup css selectors *(commit by [@JakeStanger](https://github.com/JakeStanger))*
+- [`06cfad6`](https://github.com/JakeStanger/ironbar/commit/06cfad62e228f7fc63938f2280206450005cb064) - more positioning options *(PR [#23](https://github.com/JakeStanger/ironbar/pull/23) by [@JakeStanger](https://github.com/JakeStanger))*
+
+### :bug: Bug Fixes
+- [`5523e9a`](https://github.com/JakeStanger/ironbar/commit/5523e9af46e457f9d45902debaaacf26b586e457) - **popup**: often opening in wrong place *(commit by [@JakeStanger](https://github.com/JakeStanger))*
+- [`8536ad7`](https://github.com/JakeStanger/ironbar/commit/8536ad719a92aec4166e35b75cb029075ad3ae34) - **mpd**: incorrectly checking for unix sockets *(commit by [@JakeStanger](https://github.com/JakeStanger))*
+- [`bd5bdf5`](https://github.com/JakeStanger/ironbar/commit/bd5bdf5af548304958663d593fccb454afa6c8ff) - logging for creating bar incorrect *(commit by [@JakeStanger](https://github.com/JakeStanger))*
+- [`75339f0`](https://github.com/JakeStanger/ironbar/commit/75339f07ed164fa94838036a604a1dcb6d53564c) - vertical bars ignoring height config option *(commit by [@JakeStanger](https://github.com/JakeStanger))*
+- [`b7b6488`](https://github.com/JakeStanger/ironbar/commit/b7b64886e3c48ace3faffbb1e277275aeeac3adf) - sometimes panicking on startup *(commit by [@JakeStanger](https://github.com/JakeStanger))*
+
+### :recycle: Refactors
+- [`5ce50b0`](https://github.com/JakeStanger/ironbar/commit/5ce50b0987812a1ade2d1262e8d7df6916cfc39a) - tidy and format *(commit by [@JakeStanger](https://github.com/JakeStanger))*
+- [`1b853bc`](https://github.com/JakeStanger/ironbar/commit/1b853bcb71197a4bf3ca75725cc010b1d404c2b3) - fix clippy warning *(commit by [@JakeStanger](https://github.com/JakeStanger))*
+
+### :memo: Documentation Changes
+- [`daafa09`](https://github.com/JakeStanger/ironbar/commit/daafa0943e5b9886b09fd18d6fff04558fb02335) - update CHANGELOG.md for v0.5.2 [skip ci] *(commit by [@JakeStanger](https://github.com/JakeStanger))*
+- [`b352181`](https://github.com/JakeStanger/ironbar/commit/b352181b3d232ccc79ffc1d9e22a633729d01a47) - update json example *(commit by [@JakeStanger](https://github.com/JakeStanger))*
+- [`bb4fe7f`](https://github.com/JakeStanger/ironbar/commit/bb4fe7f7f58fa2a6d0a2259bd9442700d2c884f7) - **readme**: credit smithay client toolkit *(commit by [@JakeStanger](https://github.com/JakeStanger))*
+- [`994d0f5`](https://github.com/JakeStanger/ironbar/commit/994d0f580b4d1b6ff750839652a7f06149743172) - **readme**: update references to sway *(commit by [@JakeStanger](https://github.com/JakeStanger))*
+
+### :boom: BREAKING CHANGES
+- due to [`06cfad6`](https://github.com/JakeStanger/ironbar/commit/06cfad62e228f7fc63938f2280206450005cb064) - more positioning options *(PR [#23](https://github.com/JakeStanger/ironbar/pull/23) by [@JakeStanger](https://github.com/JakeStanger))*:
+
+  The `left` and `right` config options have been renamed to `start` and `end`
+
+
+## [v0.5.2] - 2022-09-07
+### :wrench: Chores
+- [`b801751`](https://github.com/JakeStanger/ironbar/commit/b801751bdabd8416084f46e6b6d803ea28a259ec) - **release**: v0.5.2 *(commit by [@JakeStanger](https://github.com/JakeStanger))*
+
+
 ## [v0.5.1] - 2022-09-06
 ### :bug: Bug Fixes
 - [`b81927e`](https://github.com/JakeStanger/ironbar/commit/b81927e3a57808188e31419695a36aa4ea3f2830) - **launcher**: opening new instances when focused/urgent *(commit by [@JakeStanger](https://github.com/JakeStanger))*
@@ -39,4 +107,7 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0

 [v0.4.0]: https://github.com/JakeStanger/ironbar/compare/v0.3.0...v0.4.0
 [v0.5.0]: https://github.com/JakeStanger/ironbar/compare/v0.4.0...v0.5.0
-[v0.5.1]: https://github.com/JakeStanger/ironbar/compare/v0.5.0...v0.5.1
+[v0.5.1]: https://github.com/JakeStanger/ironbar/compare/v0.5.0...v0.5.1
+[v0.5.2]: https://github.com/JakeStanger/ironbar/compare/v0.5.1...v0.5.2
+[v0.6.0]: https://github.com/JakeStanger/ironbar/compare/v0.5.2...v0.6.0
+[v0.7.0]: https://github.com/JakeStanger/ironbar/compare/v0.6.0...v0.7.0
--- a/CONTRIBUTING.md
+++ b/CONTRIBUTING.md
@@ -14,3 +14,4 @@ I welcome contributions of any kind with open arms. That said, please do stick t

 - For issues:
  - Please provide as much information as you can - share your config, any logs, steps to reproduce...
+  - If reporting an error, please ensure you use `IRONBAR_LOG` or `IRONBAR_FILE_LOG` set to `debug`.
--- a/Cargo.lock
+++ b/Cargo.lock
--- a/Cargo.toml
+++ b/Cargo.toml
@@ -1,38 +1,40 @@
 [package]
 name = "ironbar"
-version = "0.5.2"
+version = "0.8.0"
 edition = "2021"
 license = "MIT"
-description = "Customisable wlroots/sway bar"
-
-# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
+description = "Customisable GTK Layer Shell wlroots/sway bar"

 [dependencies]
-gtk = "0.15.5"
-gtk-layer-shell = "0.4.1"
-glib = "0.15.12"
-tokio = { version = "1.20.1", features = ["macros", "rt-multi-thread", "time"] }
-tracing = "0.1.36"
-tracing-subscriber = { version = "0.3.15", features = ["env-filter"] }
+derive_builder = "0.11.2"
+gtk = "0.16.0"
+gtk-layer-shell = "0.5.0"
+glib = "0.16.2"
+tokio = { version = "1.21.2", features = ["macros", "rt-multi-thread", "time", "process"] }
+tracing = "0.1.37"
+tracing-subscriber = { version = "0.3.16", features = ["env-filter"] }
 tracing-error = "0.2.0"
 tracing-appender = "0.2.2"
 strip-ansi-escapes = "0.1.1"
 color-eyre = "0.6.2"
-futures-util = "0.3.21"
-chrono = "0.4.19"
 serde = { version = "1.0.141", features = ["derive"] }
 serde_json = "1.0.82"
 serde_yaml = "0.9.4"
 toml = "0.5.9"
-cornfig = "0.3.0"
+libcorn = "0.6.0"
 lazy_static = "1.4.0"
-regex = "1.6.0"
-stray = "0.1.1"
+async_once = "0.2.6"
+indexmap = "1.9.1"
+futures-util = "0.3.21"
+chrono = "0.4.19"
+regex = { version = "1.6.0", default-features = false, features = ["std"] }
+stray = { version = "0.1.2" }
 dirs = "4.0.0"
 walkdir = "2.3.2"
-notify = "5.0.0"
+notify = { version = "5.0.0", default-features = false }
 mpd_client = "1.0.0"
-ksway = "0.1.0"
-sysinfo = "0.26.2"
-# required for wrapping ksway
-crossbeam-channel = "0.5.6"
+swayipc-async = { version = "2.0.1" }
+sysinfo = "0.26.4"
+wayland-client = "0.29.5"
+wayland-protocols = { version = "0.29.5", features = ["unstable_protocols", "client"] }
+smithay-client-toolkit = { version = "0.16.0", default-features = false, features = ["calloop"] }
--- a/README.md
+++ b/README.md
@@ -1,16 +1,15 @@
 # Ironbar

-Ironbar is a customisable and feature-rich bar targeting the Sway compositor, written in Rust. 
+Ironbar is a customisable and feature-rich bar for wlroots compositors, written in Rust.
 It uses GTK3 and gtk-layer-shell.

-The bar can be styled to your liking using CSS and hot-loads style changes. 
+The bar can be styled to your liking using CSS and hot-loads style changes.
 For information and examples on styling please see the [wiki](https://github.com/JakeStanger/ironbar/wiki).

 ![Screenshot of fully configured bar with MPD widget open](https://user-images.githubusercontent.com/5057870/184539623-92d56a44-a659-49a9-91f9-5cdc453e5dfb.png)

-## Installation

-Run using `ironbar`.
+## Installation

 ### Cargo

@@ -28,6 +27,49 @@ yay -S ironbar-git

 [aur package](https://aur.archlinux.org/packages/ironbar-git)

+### Nix Flake
+
+#### Example
+Here is an example nix flake that uses ironbar, this is just a 
+proof of concept, please adapt it to your config
+
+```nix
+{
+  # Add the ironbar flake input
+  inputs.nixpkgs.url = "github:nixos/nixpkgs/nixos-unstable";
+  inputs.ironbar = {
+    url = "github:JakeStanger/ironbar";
+    inputs.nixpkgs.follows = "nixpkgs";
+  };
+  inputs.hm = {
+    url = "github:nix-community/home-manager";
+    inputs.nixpkgs.follows = "nixpkgs";
+  };
+
+  outputs = inputs: {
+    homeManagerConfigurations."USER@HOSTNAME" = inputs.hm.lib.homeManagerConfiguration {
+      pkgs = nixpkgs.legacyPackages.x86_64-linux;
+      modules = [
+        # And add the home-manager module
+        inputs.ironbar.homeManagerModules.default
+        {
+          # And configure
+          programs.ironbar = {
+            enable = true;
+            config = {};
+            style = "";
+          };
+        }
+      ];
+    };
+  };
+}
+```
+
+#### Binary Caching
+There is also a cachix cache at `https://app.cachix.org/cache/jakestanger`
+incase you don't want to compile ironbar!
+
 ### Source

 ```sh
@@ -40,31 +82,41 @@ install target/release/ironbar ~/.local/bin/ironbar

 [repo](https://github.com/jakestanger/ironbar)

+## Running
+
+All of the above installation methods provide a binary called `ironbar`.
+
+You can set the `IRONBAR_LOG` or `IRONBAR_FILE_LOG` environment variables to 
+`error`, `warn`, `info`, `debug` or `trace` to configure the log output level.
+These default to `IRONBAR_LOG=info` and `IRONBAR_FILE_LOG=error`.
+File output can be found at `~/.local/share/ironbar/error.log`.
+
 ## Configuration

-Ironbar gives a lot of flexibility when configuring, including multiple file formats 
-and options for scaling complexity: you can use a single config across all monitors, 
-or configure different/multiple bars per monitor. 
+Ironbar gives a lot of flexibility when configuring, including multiple file formats
+and options for scaling complexity: you can use a single config across all monitors,
+or configure different/multiple bars per monitor.

 A full configuration guide can be found [here](https://github.com/JakeStanger/ironbar/wiki/configuration-guide).

 ## Styling

-To get started, create a stylesheet at `.config/ironbar/style.css`. Changes will be hot-reloaded every time you save the file.
+To get started, create a stylesheet at `.config/ironbar/style.css`. Changes will be hot-reloaded every time you save the
+file.

 A full styling guide can be found [here](https://github.com/JakeStanger/ironbar/wiki/styling-guide).

 ## Project Status

-This project is in alpha, but should be usable. 
-Everything that is implemented works and should be documented. 
+This project is in alpha, but should be usable.
+Everything that is implemented works and should be documented.
 Proper error handling is in place so things should either fail gracefully with detail, or not fail at all.

 There is currently room for lots more modules, and lots more configuration options for the existing modules.
 The current configuration schema is not set in stone and breaking changes could come along at any point;
 until the project matures I am more interested in ease of use than backwards compatibility.

-A few bugs do exist, and I am sure there are plenty more to be found. 
+A few bugs do exist, and I am sure there are plenty more to be found.

 The project will be *actively developed* as I am using it on my daily driver.
 Bugs will be fixed, features will be added, code will be refactored.
@@ -77,3 +129,4 @@ Please check [here](https://github.com/JakeStanger/ironbar/blob/master/CONTRIBUT

 - [Waybar](https://github.com/Alexays/Waybar) - A lot of the initial inspiration, and a pretty great bar.
 - [Rustbar](https://github.com/zeroeightysix/rustbar) - Served as a good demo for writing a basic GTK bar in Rust
+- [Smithay Client Toolkit](https://github.com/Smithay/client-toolkit) - Essential in being able to communicate to Wayland
--- a/docs/Configuration
+++ b/docs/Configuration
@@ -0,0 +1,288 @@
+By default, you get a single bar at the bottom of all your screens.
+To change that, you'll unsurprisingly need a config file.
+
+This page details putting together the skeleton for your config to get you to a stage where you can start configuring modules.
+It may look long and overwhelming, but that is just because the bar supports a lot of scenarios! 
+
+If you want to see some ready-to-go config files check the [examples folder](https://github.com/JakeStanger/ironbar/tree/master/examples) 
+and the example pages in the sidebar.
+
+## 1. Create config file
+
+The config file lives inside the `ironbar` directory in your XDG_CONFIG_DIR, which is usually `~/.config/ironbar`.
+
+Ironbar supports a range of configuration formats, so you can pick your favourite:
+
+- `config.json`
+- `config.toml`
+- `config.yaml`
+- `config.corn` (Experimental, includes variable support for re-using blocks.
+  See [here](https://github.com/jakestanger/corn) for info)
+
+You can also override the default config path using the `IRONBAR_CONFIG` environment variable.
+
+## 2. Pick your use-case
+
+Ironbar gives you a few ways to configure the bar to suit your needs.
+This allows you to keep your config simple and relatively flat if your use-case is simple,
+and make it more complex if required.
+
+### a) I want the same bar across all monitors
+
+Place the bar config inside the top-level object. This is automatically applied to each of your monitors.
+
+<details>
+<summary>JSON</summary>
+
+```json
+{
+  "position": "bottom",
+  "height": 42,
+  "start": [],
+  "center": [],
+  "end": []
+}
+```
+
+</details>
+
+<details>
+<summary>TOML</summary>
+
+```toml
+position = "bottom"
+height = 42
+start = []
+center = []
+end = []
+```
+
+</details>
+
+<details>
+<summary>YAML</summary>
+
+```yaml
+position: "bottom"
+height: 42
+start: [ ]
+center: [ ]
+end: [ ]
+```
+
+</details>
+
+<details>
+<summary>Corn</summary>
+
+```
+{
+  position = "bottom"
+  height = 42
+  start = []
+  center = []
+  end = []
+}
+```
+
+</details>
+
+### b) I want my config to differ across one or more monitors
+
+Create a map/object called `monitors` inside the top-level object.
+Each of the map's keys should be an output name,
+and each value should be an object containing the bar config.
+
+To find your output names, run `wayland-info | grep wl_output -A1`.
+
+<details>
+<summary>JSON</summary>
+
+```json
+{
+  "monitors": {
+    "DP-1": {
+      "start": []
+    },
+    "DP-2": {
+      "position": "bottom",
+      "height": 30,
+      "start": []
+    }
+  }
+}
+```
+
+</details>
+
+<details>
+<summary>TOML</summary>
+
+```toml
+[monitors]
+
+[monitors.DP-1]
+start = []
+
+[monitors.DP-2]
+position = "bottom"
+height = 30
+start = []
+```
+
+</details>
+
+<details>
+<summary>YAML</summary>
+
+```yaml
+monitors:
+  DP-1:
+    start: [ ]
+  DP-2:
+    position: "bottom"
+    height: 30
+    start: [ ]
+```
+
+</details>
+
+<details>
+<summary>Corn</summary>
+
+```
+{
+  monitors.DP-1.start = []
+  monitors.DP-2 = {
+    position = "bottom"
+    height = 30
+    start = []
+  }
+}
+```
+
+</details>
+
+### c) I want one or more monitors to have multiple bars
+
+Create a map/object called `monitors` inside the top-level object.
+Each of the map's keys should be an output name.
+If you want the screen to have multiple bars, use an array of bar config objects.
+If you want the screen to have a single bar, use an object.
+
+To find your output names, run `wayland-info | grep wl_output -A1`.
+
+<details>
+<summary>JSON</summary>
+
+```json
+{
+  "monitors": {
+    "DP-1": [
+      {
+        "start": []
+      },
+      {
+        "position": "top",
+        "start": []
+      }
+    ],
+    "DP-2": {
+      "position": "bottom",
+      "height": 30,
+      "start": []
+    }
+  }
+}
+```
+
+</details>
+
+<details>
+<summary>TOML</summary>
+
+```toml
+[monitors]
+
+[[monitors.DP-1]]
+start = []
+
+[[monitors.DP-2]]
+position = "top"
+start = []
+
+[monitors.DP-2]
+position = "bottom"
+height = 30
+start = []
+```
+
+</details>
+
+<details>
+<summary>YAML</summary>
+
+```yaml
+monitors:
+  DP-1:
+    - start: [ ]
+    - position: "top"
+      start: [ ]
+  DP-2:
+    position: "bottom"
+    height: 30
+    start: [ ]
+```
+
+</details>
+
+<details>
+<summary>Corn</summary>
+
+```
+{
+  monitors.DP-1 = [
+    { start = [] }
+    { position = "top" start = [] }
+  ]
+  monitors.DP-2 = {
+    position = "bottom"
+    height = 30
+    start = []
+  }
+}
+```
+
+</details>
+
+## 3. Write your bar config(s)
+
+Once you have the basic config structure set up, it's time to actually configure your bar(s).
+
+Check [here](config) for an example config file for a fully configured bar in each format.
+
+### 3.1 Top-level options
+
+The following table lists each of the top-level bar config options:
+
+| Name              | Type                                   | Default  | Description                                                                             |
+|-------------------|----------------------------------------|----------|-----------------------------------------------------------------------------------------|
+| `position`        | `top` or `bottom` or `left` or `right` | `bottom` | The bar's position on screen.                                                           |
+| `anchor_to_edges` | `boolean`                              | `false`  | Whether to anchor the bar to the edges of the screen. Setting to false centres the bar. |
+| `height`          | `integer`                              | `42`     | The bar's height in pixels.                                                             |
+| `start`           | `Module[]`                             | `[]`     | Array of left or top modules.                                                           |
+| `center`          | `Module[]`                             | `[]`     | Array of center modules.                                                                |
+| `end`             | `Module[]`                             | `[]`     | Array of right or bottom modules.                                                       |
+
+### 3.2 Module-level options
+
+The following table lists each of the module-level options that are present on **all** modules.
+For details on available modules and each of their config options, check the sidebar.
+
+For information on the `Script` type, and embedding scripts in strings, see [here](script).
+
+| Name       | Type               | Default | Description                                                                                                        |
+|------------|--------------------|---------|--------------------------------------------------------------------------------------------------------------------|
+| `show_if`  | `Script [polling]` | `null`  | Polls the script to check its exit code. If exit code is zero, the module is shown. For other codes, it is hidden. |
+| `on_click` | `Script [polling]` | `null`  | Runs the script when the module is clicked.                                                                        |
+| `tooltip`  | `string`           | `null`  | Shows this text on hover. Supports embedding scripts between `{{double braces}}`.                                  |
--- a/docs/Home.md
+++ b/docs/Home.md
@@ -0,0 +1,4 @@
+Welcome to the Ironbar wiki.
+
+Detail about each module, and their configuration and styling options can be found on the sidebar.
+You can also find an example configuration and stylesheet there.
--- a/docs/Scripts.md
+++ b/docs/Scripts.md
@@ -0,0 +1,102 @@
+There are various places inside the configuration (other than the `script` module)
+that allow script input to dynamically set values.
+
+Scripts are passed to `sh -c`.
+
+Two types of scripts exist: polling and watching:
+
+- Polling scripts will run and wait for exit.
+  Normally they will repeat this at an interval, hence the name, although in some cases they may only run on a user
+  event.
+  If the script exited code 0, the `stdout` will be used. Otherwise, `stderr` will be printed to the log.
+- Watching scripts start a long-running process. Every time the process writes to `stdout`, the last line is captured
+  and used.
+
+One should prefer to use watch-mode where possible, as it removes the overhead of regularly spawning processes.
+That said, there are some cases which only support polling. These are indicated by `Script [polling]` as the option
+type.
+
+## Writing script configs
+
+There are two available config formats for scripts, shorthand as a string, or longhand as an object.
+Shorthand can be used in all cases, but there are some cases (such as embedding scripts inside strings) where longhand
+cannot be used.
+
+In both formats, `mode` is one of `poll` or `watch` and `interval` is the number of milliseconds to wait between
+spawning the script.
+
+Both `mode` and `interval` are optional and can be excluded to fall back to their defaults of `poll` and `5000`
+respectively.
+
+### Shorthand (string)
+
+Shorthand scripts should be written in the format:
+
+```
+mode:interval:script
+```
+
+For example:
+
+```
+poll:5000:uptime -p | cut -d ' ' -f2-
+```
+
+#### Embedding
+
+Some string config options support "embedding scripts". This allows you to mix static/dynamic content.
+An example of this is the common `tooltip` option.
+
+Scripts can be embedded in these cases using `{{double braces}}` and the shorthand syntax:
+
+```json
+"Up: {{30000:uptime -p | cut -d ' ' -f2-}}"
+```
+
+### Longhand (object)
+
+An object consisting of the `cmd` key and optionally the `mode` and/or `interval` keys.
+
+<details>
+<summary>JSON</summary>
+
+```json
+{
+  "mode": "poll",
+  "interval": 5000,
+  "cmd": "uptime -p | cut -d ' ' -f2-"
+}
+```
+</details>
+
+<details>
+<summary>YAML</summary>
+
+```yaml
+mode: poll
+interval: 5000
+cmd: "uptime -p | cut -d ' ' -f2-"
+```
+</details>
+
+<details>
+<summary>YAML</summary>
+
+```toml
+mode = "poll"
+interval = 5000
+cmd = "uptime -p | cut -d ' ' -f2-"
+```
+</details>
+
+<details>
+<summary>Corn</summary>
+
+```corn
+{
+  mode = "poll"
+  interval = 5000
+  cmd = "uptime -p | cut -d ' ' -f2-"
+}
+```
+</details>
--- a/docs/Styling
+++ b/docs/Styling
@@ -0,0 +1,20 @@
+Ironbar ships with no styles by default, so will fall back to the default GTK styles.
+
+To style the bar, create a file at `~/.config/ironbar/style.css`.
+
+Style changes are hot-loaded so there is no need to reload the bar.
+
+A reminder: since the bar is GTK-based, it uses GTK's implementation of CSS,
+which only includes a subset of the full web spec (plus a few non-standard properties).
+
+The below table describes the selectors provided by the bar itself.
+Information on styling individual modules can be found on their pages in the sidebar.
+
+| Selector       | Description                               |
+|----------------|-------------------------------------------|
+| `.background`  | Top-level window                          |
+| `#bar`         | Bar root box                              |
+| `#bar #start`  | Bar left or top modules container box     |
+| `#bar #center` | Bar center modules container box          |
+| `#bar #end`    | Bar right or bottom modules container box |
+| `.container`   | All of the above                          |
--- a/docs/_Sidebar.md
+++ b/docs/_Sidebar.md
@@ -0,0 +1,26 @@
+# Guides
+
+- [Configuration guide](configuration-guide)
+  - [Scripts](scripts)
+- [Styling guide](styling-guide)
+
+# Examples
+
+- [Config](config)
+- [Stylesheet](stylesheet)
+
+## Custom
+
+- [Power Menu](power-menu)
+
+# Modules
+
+- [Clock](clock)
+- [Custom](custom)
+- [Focused](focused)
+- [Launcher](launcher)
+- [MPD](mpd)
+- [Script](script)
+- [Sys_Info](sys-info)
+- [Tray](tray)
+- [Workspaces](workspaces)
--- a/docs/_imgs/custom-power-menu.png
+++ b/docs/_imgs/custom-power-menu.png
--- a/docs/examples/Config.md
+++ b/docs/examples/Config.md
@@ -0,0 +1,202 @@
+The below config shows a module of each type being used.
+
+The Corn format makes heavy use of variables 
+to show how module configs can be easily referenced to improve readability 
+and reduce config length when using multiple bars.
+
+<details>
+<summary>JSON</summary>
+
+```json
+{
+  "start": [
+    {
+      "all_monitors": false,
+      "name_map": {
+        "1": "ﭮ",
+        "2": "",
+        "3": "",
+        "Code": "",
+        "Games": ""
+      },
+      "type": "workspaces"
+    },
+    {
+      "favorites": [
+        "firefox",
+        "discord",
+        "Steam"
+      ],
+      "icon_theme": "Paper",
+      "show_icons": true,
+      "show_names": false,
+      "type": "launcher"
+    }
+  ],
+  "end": [
+    {
+      "music_dir": "/home/jake/Music",
+      "type": "mpd"
+    },
+    {
+      "host": "chloe:6600",
+      "type": "mpd"
+    },
+    {
+      "path": "/home/jake/bin/phone-battery",
+      "type": "script"
+    },
+    {
+      "format": [
+        "{cpu-percent}% ",
+        "{memory-percent}% "
+      ],
+      "type": "sys-info"
+    },
+    {
+      "type": "clock"
+    }
+  ]
+}
+```
+
+</details>
+
+<details>
+<summary>TOML</summary>
+
+```toml
+[[start]]
+all_monitors = false
+type = 'workspaces'
+
+[start.name_map]
+1 = 'ﭮ'
+2 = ''
+3 = ''
+Code = ''
+Games = ''
+
+[[start]]
+icon_theme = 'Paper'
+show_icons = true
+show_names = false
+type = 'launcher'
+favorites = [
+    'firefox',
+    'discord',
+    'Steam',
+]
+
+[[end]]
+music_dir = '/home/jake/Music'
+type = 'mpd'
+
+[[end]]
+host = 'chloe:6600'
+type = 'mpd'
+
+[[end]]
+path = '/home/jake/bin/phone-battery'
+type = 'script'
+
+[[end]]
+type = 'sys-info'
+format = [
+    '{cpu-percent}% ',
+    '{memory-percent}% ',
+]
+
+[[end]]
+type = 'clock'
+```
+
+</details>
+
+<details>
+<summary>YAML</summary>
+
+```yaml
+---
+start:
+  - all_monitors: false
+    name_map:
+      "1": ﭮ
+      "2": 
+      "3": 
+      Code: 
+      Games: 
+    type: workspaces
+  - favorites:
+      - firefox
+      - discord
+      - Steam
+    icon_theme: Paper
+    show_icons: true
+    show_names: false
+    type: launcher
+end:
+  - music_dir: /home/jake/Music
+    type: mpd
+  - host: "chloe:6600"
+    type: mpd
+  - path: /home/jake/bin/phone-battery
+    type: script
+  - format:
+      - "{cpu-percent}% "
+      - "{memory-percent}% "
+    type: sys-info
+  - type: clock
+```
+</details>
+
+<details>
+<summary>Corn</summary>
+
+```corn
+let {
+    $workspaces = {
+        type = "workspaces"
+        all_monitors = false
+        name_map = {
+            1 = "ﭮ"
+            2 = ""
+            3 = ""
+            Games = ""
+            Code = ""
+        }
+    }
+
+    $launcher = {
+        type = "launcher"
+        favorites = ["firefox" "discord" "Steam"]
+        show_names = false
+        show_icons = true
+        icon_theme = "Paper"
+    }
+
+    $mpd_local = { type = "mpd" music_dir = "/home/jake/Music" }
+    $mpd_server = { type = "mpd" host = "chloe:6600" }
+
+    $sys_info = {
+        type = "sys-info"
+        format = ["{cpu-percent}% " "{memory-percent}% "]
+    }
+
+    $tray = { type = "tray" }
+    $clock = { type = "clock" }
+    
+    $phone_battery = {
+    type = "script"
+    path = "/home/jake/bin/phone-battery"
+    }
+    
+    $start = [ $workspaces $launcher ]
+    $end = [ $mpd_local $mpd_server $phone_battery $sys_info $clock ]
+}
+in {
+    start = $start
+    end = $end
+}
+```
+</details>
--- a/docs/examples/Stylesheet.md
+++ b/docs/examples/Stylesheet.md
@@ -0,0 +1,142 @@
+The below example is a full stylesheet for all modules:
+
+```css
+* {
+    /* a nerd font is required to be installed for icons */
+    font-family: Noto Sans Nerd Font, sans-serif;
+    font-size: 16px;
+    border: none;
+}
+
+#bar {
+    border-top: 1px solid #424242;
+}
+
+.container {
+    background-color: #2d2d2d;
+}
+
+.container#end > * + * {
+    margin-left: 20px;
+}
+
+.popup {
+    background-color: #2d2d2d;
+    border: 1px solid #424242;
+}
+
+#workspaces .item {
+    color: white;
+    background-color: #2d2d2d;
+    border-radius: 0;
+}
+
+#workspaces .item.focused {
+    box-shadow: inset 0 -3px;
+    background-color: #1c1c1c;
+}
+
+#workspaces *:not(.focused):hover {
+    box-shadow: inset 0 -3px;
+}
+
+#launcher .item {
+    border-radius: 0;
+    background-color: #2d2d2d;
+    margin-right: 4px;
+}
+
+#launcher .item:not(.focused):hover {
+    background-color: #1c1c1c;
+}
+
+#launcher .open {
+    border-bottom: 2px solid #6699cc;
+}
+
+#launcher .focused {
+    color: white;
+    background-color: black;
+    border-bottom: 4px solid #6699cc;
+}
+
+#launcher .urgent {
+    color: white;
+    background-color: #8f0a0a;
+}
+
+#script {
+    color: white;
+}
+
+#sysinfo {
+    color: white;
+}
+
+#tray .item {
+    background-color: #2d2d2d;
+}
+
+#mpd {
+    background-color: #2d2d2d;
+    color: white;
+}
+
+#popup-mpd {
+    color: white;
+    padding: 1em;
+}
+
+#popup-mpd #album-art {
+    margin-right: 1em;
+}
+
+#popup-mpd #title .icon, #popup-mpd #title .label {
+    font-size: 1.7em;
+}
+
+#popup-mpd #controls * {
+    border-radius: 0;
+    background-color: #2d2d2d;
+    color: white;
+}
+
+#popup-mpd #controls *:disabled {
+    color: #424242;
+}
+
+#clock {
+    color: white;
+    background-color: #2d2d2d;
+    font-weight: bold;
+}
+
+#popup-clock {
+    padding: 1em;
+}
+
+#popup-clock #calendar-clock {
+    color: white;
+    font-size: 2.5em;
+    padding-bottom: 0.1em;
+}
+
+#popup-clock #calendar {
+    background-color: #2d2d2d;
+    color: white;
+}
+
+#popup-clock #calendar .header {
+    padding-top: 1em;
+    border-top: 1px solid #424242;
+    font-size: 1.5em;
+}
+
+#popup-clock #calendar:selected {
+    background-color: #6699cc;
+}
+
+#focused {
+    color: white;
+}
+```
--- a/docs/examples/custom/Power-Menu.md
+++ b/docs/examples/custom/Power-Menu.md
@@ -0,0 +1,230 @@
+Creates a button on the bar, which opens a popup. The popup contains a header, shutdown button, restart button, and uptime.
+
+![A screenshot of the custom power menu module open, with some other modules present on the bar](../../_imgs/custom-power-menu.png)
+
+## Configuration
+
+<details>
+<summary>JSON</summary>
+
+```json
+{
+  "end": [
+    {
+      "type": "clock"
+    },
+    {
+      "bar": [
+        {
+          "on_click": "popup:toggle",
+          "label": "",
+          "name": "power-btn",
+          "type": "button"
+        }
+      ],
+      "class": "power-menu",
+      "popup": [
+        {
+          "orientation": "vertical",
+          "type": "box",
+          "widgets": [
+            {
+              "label": "Power menu",
+              "name": "header",
+              "type": "label"
+            },
+            {
+              "type": "box",
+              "widgets": [
+                {
+                  "class": "power-btn",
+                  "on_click": "!shutdown now",
+                  "label": "<span font-size='40pt'></span>",
+                  "type": "button"
+                },
+                {
+                  "class": "power-btn",
+                  "on_click": "!reboot",
+                  "label": "<span font-size='40pt'></span>",
+                  "type": "button"
+                }
+              ]
+            },
+            {
+              "label": "Up: {{30000:uptime -p | cut -d ' ' -f2-}}",
+              "name": "uptime",
+              "type": "label"
+            }
+          ]
+        }
+      ],
+      "type": "custom"
+    }
+  ]
+}
+```
+
+</details>
+
+<details>
+<summary>TOML</summary>
+
+```toml
+[[end]]
+type = 'clock'
+
+[[end]]
+class = 'power-menu'
+type = 'custom'
+
+[[end.bar]]
+on_click = 'popup:toggle'
+label = ''
+name = 'power-btn'
+type = 'button'
+
+[[end.popup]]
+orientation = 'vertical'
+type = 'box'
+
+[[end.popup.widgets]]
+label = 'Power menu'
+name = 'header'
+type = 'label'
+
+[[end.popup.widgets]]
+type = 'box'
+
+[[end.popup.widgets.widgets]]
+class = 'power-btn'
+on_click = '!shutdown now'
+label = '''<span font-size='40pt'></span>'''
+type = 'button'
+
+[[end.popup.widgets.widgets]]
+class = 'power-btn'
+on_click = '!reboot'
+label = '''<span font-size='40pt'></span>'''
+type = 'button'
+
+[[end.popup.widgets]]
+label = '''Up: {{30000:uptime -p | cut -d ' ' -f2-}}'''
+name = 'uptime'
+type = 'label'
+```
+
+</details>
+
+<details>
+<summary>YAML</summary>
+
+```yaml
+end:
+- type: clock
+- bar:
+  - on_click: popup:toggle
+    label: 
+    name: power-btn
+    type: button
+  class: power-menu
+  popup:
+  - orientation: vertical
+    type: box
+    widgets:
+    - label: Power menu
+      name: header
+      type: label
+    - type: box
+      widgets:
+      - class: power-btn
+        on_click: '!shutdown now'
+        label: <span font-size='40pt'></span>
+        type: button
+      - class: power-btn
+        on_click: '!reboot'
+        label: <span font-size='40pt'></span>
+        type: button
+    - label: 'Up: {{30000:uptime -p | cut -d '' '' -f2-}}'
+      name: uptime
+      type: label
+  type: custom
+```
+
+</details>
+
+<details>
+<summary>Corn</summary>
+
+```corn
+let {
+    $power_menu = {
+        type = "custom"
+        class = "power-menu"
+
+        bar = [ { type = "button" name="power-btn" label = "" on_click = "popup:toggle" } ]
+
+        popup = [ {
+            type = "box"
+            orientation = "vertical"
+            widgets = [
+                { type = "label" name = "header" label = "Power menu" }
+                {
+                    type = "box"
+                    widgets = [
+                        { type = "button" class="power-btn" label = "<span font-size='40pt'></span>" on_click = "!shutdown now" }
+                        { type = "button" class="power-btn" label = "<span font-size='40pt'></span>" on_click = "!reboot" }
+                    ]
+                }
+                { type = "label" name = "uptime" label = "Up: {{30000:uptime -p | cut -d ' ' -f2-}}" }
+            ]
+        } ]
+    }
+} in {
+    end = [ $power_menu ]
+}
+```
+</details>
+
+## Styling
+
+```css
+.power-menu {
+    margin-left: 10px;
+}
+
+.power-menu #power-btn {
+    color: white;
+    background-color: #2d2d2d;
+}
+
+.power-menu #power-btn:hover {
+    background-color: #1c1c1c;
+}
+
+.popup-power-menu {
+    padding: 1em;
+}
+
+.popup-power-menu #header {
+    color: white;
+    font-size: 1.4em;
+    border-bottom: 1px solid white;
+    padding-bottom: 0.4em;
+    margin-bottom: 0.8em;
+}
+
+.popup-power-menu .power-btn {
+    color: white;
+    background-color: #2d2d2d;
+    border: 1px solid white;
+    padding: 0.6em 1em;
+}
+
+.popup-power-menu .power-btn + .power-btn {
+    margin-left: 1em;
+}
+
+.popup-power-menu .power-btn:hover {
+    background-color: #1c1c1c;
+}
+```
--- a/docs/modules/Clock.md
+++ b/docs/modules/Clock.md
@@ -0,0 +1,77 @@
+Displays the current date and time. 
+Clicking on the widget opens a popup with the time and a calendar.
+
+![Screenshot of clock widget with popup open](https://user-images.githubusercontent.com/5057870/184540521-2278bdec-9742-46f0-9ac2-58a7b6f6ea1d.png)
+
+
+## Configuration
+
+> Type: `clock`
+
+| Name     | Type   | Default          | Description                                                                                                                                |
+|----------|--------|------------------|--------------------------------------------------------------------------------------------------------------------------------------------|
+| `format` | `string` | `%d/%m/%Y %H:%M` | Date/time format string. Detail on available tokens can be found here: <https://docs.rs/chrono/latest/chrono/format/strftime/index.html> |
+
+<details>
+<summary>JSON</summary>
+
+```json
+{
+  "end": [
+    {
+      "type": "clock",
+      "format": "%d/%m/%Y %H:%M"
+    }
+  ]
+}
+
+```
+
+</details>
+
+<details>
+<summary>TOML</summary>
+
+```toml
+[[end]]
+type = "clock"
+format = "%d/%m/%Y %H:%M"
+```
+
+</details>
+
+<details>
+<summary>YAML</summary>
+
+```yaml
+end:
+  - type: "clock"
+    format: "%d/%m/%Y %H:%M"
+```
+
+</details>
+
+<details>
+<summary>Corn</summary>
+
+```corn
+{
+  end = [
+    {
+      type = "clock"
+      format = "%d/%m/%Y %H:%M"
+    }
+  ]
+}
+```
+
+</details>
+
+## Styling
+
+| Selector                      | Description                                                                        |
+|-------------------------------|------------------------------------------------------------------------------------|
+| `#clock`                      | Clock widget button                                                                |
+| `#popup-clock`                | Clock popup box                                                                    |
+| `#popup-clock #calendar-clock` | Clock inside the popup                                                             |
+| `#popup-clock #calendar`       | Calendar widget inside the popup. GTK provides some OOTB styling options for this. |
--- a/docs/modules/Custom.md
+++ b/docs/modules/Custom.md
@@ -0,0 +1,272 @@
+Allows you to compose custom modules consisting of multiple widgets, including popups. 
+Labels can display dynamic content from scripts, and buttons can interact with the bar or execute commands on click.
+
+![Custom module with a button on the bar, and the popup open. The popup contains a header, shutdown button and restart button.](https://user-images.githubusercontent.com/5057870/196058785-042ef171-7e77-4d5c-921a-eca03c6424bd.png)
+
+## Configuration
+
+> Type: `custom`
+
+This module can be quite fiddly to configure as you effectively have to build a tree of widgets by hand.
+It is well worth looking at the examples.
+
+| Name    | Type       | Default | Description                          |
+|---------|------------|---------|--------------------------------------|
+| `class` | `string`   | `null`  | Container class name.                |
+| `bar`   | `Widget[]` | `null`  | List of widgets to add to the bar.   |
+| `popup` | `Widget[]` | `[]`    | List of widgets to add to the popup. |
+
+### `Widget`
+
+| Name          | Type                         | Default      | Description                                                               |
+|---------------|------------------------------|--------------|---------------------------------------------------------------------------|
+| `widget_type` | `box` or `label` or `button` | `null`       | Type of GTK widget to create.                                             |
+| `name`        | `string`                     | `null`       | Widget name.                                                              |
+| `class`       | `string`                     | `null`       | Widget class name.                                                        |
+| `label`       | `string`                     | `null`       | [`label` and `button`] Widget text label. Pango markup supported.         |
+| `on_click`    | `string`                     | `null`       | [`button`] Command to execute. More on this [below](#commands).           |
+| `orientation` | `horizontal` or `vertical`   | `horizontal` | [`box`] Whether child widgets should be horizontally or vertically added. |
+| `widgets`     | `Widget[]`                   | `[]`         | [`box`] List of widgets to add to this box.                               |
+
+### Labels
+
+Labels can interpolate text from scripts to dynamically show content. 
+This can be done by including scripts in `{{double braces}}` using the shorthand script syntax.
+
+For example, the following label would output your system uptime, updated every 30 seconds.
+
+```
+Uptime: {{30000:uptime -p | cut -d ' ' -f2-}}
+```
+
+Both polling and watching mode are supported. For more information on script syntax, see [here](script).
+
+### Commands
+
+Buttons can execute commands that interact with the bar, 
+as well as any arbitrary shell command.
+
+To execute shell commands, prefix them with an `!`. 
+For example, if you want to run `~/.local/bin/my-script.sh` on click, 
+you'd set `on_click` to `!~/.local/bin/my-script.sh`.
+
+The following bar commands are supported:
+
+- `popup:toggle`
+- `popup:open`
+- `popup:close`
+
+XML is arguably better-suited and easier to read for this sort of markup, 
+but currently is not supported.
+Nonetheless, it may be worth comparing the examples to the below equivalent
+to help get your head around what's going on:
+
+
+```xml
+<?xml version="1.0" encoding="utf-8" ?>
+<custom class="power-menu">
+    <bar>
+        <button name="power-btn" label="" on_click="popup:toggle"/>
+    </bar>
+    <popup>
+        <box orientation="vertical">
+            <label name="header" label="Power menu" />
+            <box>
+                <button class="power-btn" label="" on_click="!shutdown now" />
+                <button class="power-btn" label="" on_click="!reboot" />
+            </box>
+            <label name="uptime" label="Uptime: {{30000:uptime -p | cut -d ' ' -f2-}}" />
+        </box>
+    </popup>
+</custom>
+```
+
+<details>
+<summary>JSON</summary>
+
+```json
+{
+  "end": [
+    {
+      "type": "clock"
+    },
+    {
+      "bar": [
+        {
+          "on_click": "popup:toggle",
+          "label": "",
+          "name": "power-btn",
+          "type": "button"
+        }
+      ],
+      "class": "power-menu",
+      "popup": [
+        {
+          "orientation": "vertical",
+          "type": "box",
+          "widgets": [
+            {
+              "label": "Power menu",
+              "name": "header",
+              "type": "label"
+            },
+            {
+              "type": "box",
+              "widgets": [
+                {
+                  "class": "power-btn",
+                  "on_click": "!shutdown now",
+                  "label": "<span font-size='40pt'></span>",
+                  "type": "button"
+                },
+                {
+                  "class": "power-btn",
+                  "on_click": "!reboot",
+                  "label": "<span font-size='40pt'></span>",
+                  "type": "button"
+                }
+              ]
+            },
+            {
+              "label": "Uptime: {{30000:uptime -p | cut -d ' ' -f2-}}",
+              "name": "uptime",
+              "type": "label"
+            }
+          ]
+        }
+      ],
+      "type": "custom"
+    }
+  ]
+}
+```
+
+</details>
+
+<details>
+<summary>TOML</summary>
+
+```toml
+[[end]]
+type = 'clock'
+
+[[end]]
+class = 'power-menu'
+type = 'custom'
+
+[[end.bar]]
+on_click = 'popup:toggle'
+label = ''
+name = 'power-btn'
+type = 'button'
+
+[[end.popup]]
+orientation = 'vertical'
+type = 'box'
+
+[[end.popup.widgets]]
+label = 'Power menu'
+name = 'header'
+type = 'label'
+
+[[end.popup.widgets]]
+type = 'box'
+
+[[end.popup.widgets.widgets]]
+class = 'power-btn'
+on_click = '!shutdown now'
+label = '''<span font-size='40pt'></span>'''
+type = 'button'
+
+[[end.popup.widgets.widgets]]
+class = 'power-btn'
+on_click = '!reboot'
+label = '''<span font-size='40pt'></span>'''
+type = 'button'
+
+[[end.popup.widgets]]
+label = '''Uptime: {{30000:uptime -p | cut -d ' ' -f2-}}'''
+name = 'uptime'
+type = 'label'
+```
+
+</details>
+
+<details>
+<summary>YAML</summary>
+
+```yaml
+end:
+- type: clock
+- bar:
+  - on_click: popup:toggle
+    label: 
+    name: power-btn
+    type: button
+  class: power-menu
+  popup:
+  - orientation: vertical
+    type: box
+    widgets:
+    - label: Power menu
+      name: header
+      type: label
+    - type: box
+      widgets:
+      - class: power-btn
+        on_click: '!shutdown now'
+        label: <span font-size='40pt'></span>
+        type: button
+      - class: power-btn
+        on_click: '!reboot'
+        label: <span font-size='40pt'></span>
+        type: button
+    - label: 'Uptime: {{30000:uptime -p | cut -d '' '' -f2-}}'
+      name: uptime
+      type: label
+  type: custom
+```
+
+</details>
+
+<details>
+<summary>Corn</summary>
+
+```corn
+let {
+    $power_menu = {
+        type = "custom"
+        class = "power-menu"
+
+        bar = [ { type = "button" name="power-btn" label = "" on_click = "popup:toggle" } ]
+
+        popup = [ {
+            type = "box"
+            orientation = "vertical"
+            widgets = [
+                { type = "label" name = "header" label = "Power menu" }
+                {
+                    type = "box"
+                    widgets = [
+                        { type = "button" class="power-btn" label = "<span font-size='40pt'></span>" on_click = "!shutdown now" }
+                        { type = "button" class="power-btn" label = "<span font-size='40pt'></span>" on_click = "!reboot" }
+                    ]
+                }
+                { type = "label" name = "uptime" label = "Uptime: {{30000:uptime -p | cut -d ' ' -f2-}}" }
+            ]
+        } ]
+    }
+} in {
+    end = [ $power_menu ]
+}
+```
+
+</details>
+
+## Styling
+
+Since the widgets are all custom, you can target them using `#name` and `.class`.
+
+| Selector  | Description             |
+|-----------|-------------------------|
+| `#custom` | Custom widget container |
--- a/docs/modules/Focused.md
+++ b/docs/modules/Focused.md
@@ -0,0 +1,90 @@
+Displays the title and/or icon of the currently focused window.
+
+![Screenshot of focused widget, showing this page open on firefox](https://user-images.githubusercontent.com/5057870/184714118-c1fb1c67-cd8c-4cc0-b5cd-6faccff818ac.png)
+
+
+## Configuration
+
+> Type: `focused`
+
+| Name         | Type      | Default | Description                     |
+|--------------|-----------|---------|---------------------------------|
+| `show_icon`  | `boolean` | `true`  | Whether to show the app's icon  |
+| `show_title` | `boolean` | `true`  | Whether to show the app's title |
+| `icon_size`  | `integer` | `32`    | Size of icon in pixels          |
+| `icon_theme` | `string`  | `null`  | GTK icon theme to use           |
+
+<details>
+<summary>JSON</summary>
+
+```json
+{
+  "end": [
+    {
+      "type": "focused",
+      "show_icon": true,
+      "show_title": true,
+      "icon_size": 32,
+      "icon_theme": "Paper"
+    }
+  ]
+}
+
+```
+
+</details>
+
+<details>
+<summary>TOML</summary>
+
+```toml
+[[end]]
+type = "focused"
+show_icon = true
+show_title = true
+icon_size = 32
+icon_theme = "Paper"
+```
+
+</details>
+
+<details>
+<summary>YAML</summary>
+
+```yaml
+end:
+  - type: "focused"
+    show_icon: true
+    show_title: true
+    icon_size: 32
+    icon_theme: "Paper"
+```
+
+</details>
+
+<details>
+<summary>Corn</summary>
+
+```corn
+{
+  end = [
+    {
+      type = "focused"
+      show_icon = true
+      show_title = true
+      icon_size = 32
+      icon_theme = "Paper"
+    }
+  ]
+}
+```
+
+</details>
+
+## Styling
+
+| Selector                 | Description        |
+|--------------------------|--------------------|
+| `#focused`               | Focused widget box |
+| `#focused #icon`         | App icon           |
+| `#focused #label`        | App name           |
--- a/docs/modules/Launcher.md
+++ b/docs/modules/Launcher.md
@@ -0,0 +1,103 @@
+Windows-style taskbar that displays running windows, grouped by program.
+Hovering over a program with multiple windows open shows a popup with each window.
+Clicking an icon/popup item focuses or launches the program.
+Optionally displays a launchable set of favourites.
+
+![Screenshot showing several open applications, including a focused terminal.](https://user-images.githubusercontent.com/5057870/184540058-120e190e-2a45-4167-99c7-ed76482d1f16.png)
+
+## Configuration
+
+> Type: `launcher`
+
+|              | Type       | Default | Description                                                                                         |
+|--------------|------------|---------|-----------------------------------------------------------------------------------------------------|
+| `favorites`  | `string[]` | `[]`    | List of app IDs (or classes) to always show at the start of the launcher                            |
+| `show_names` | `boolean`  | `false` | Whether to show app names on the button label. Names will still show on tooltips when set to false. |
+| `show_icons` | `boolean`  | `true`  | Whether to show app icons on the button.                                                            |
+| `icon_theme` | `string`   | `null`  | GTK icon theme to use.                                                                              |
+
+<details>
+<summary>JSON</summary>
+
+```json
+{
+  "start": [
+    {
+      "type": "launcher",
+      "favourites": [
+        "firefox",
+        "discord"
+      ],
+      "show_names": false,
+      "show_icons": true,
+      "icon_theme": "Paper"
+    }
+  ]
+}
+
+
+```
+
+</details>
+
+<details>
+<summary>TOML</summary>
+
+```toml
+[[start]]
+type = "launcher"
+favorites = ["firefox", "discord"]
+show_names = false
+show_icons = true
+icon_theme = "Paper"
+```
+
+</details>
+
+<details>
+<summary>YAML</summary>
+
+```yaml
+start:
+  - type: "launcher"
+    favorites:
+      - firefox
+      - discord
+    show_names: false
+    show_icons: true
+    icon_theme: "Paper"
+```
+
+</details>
+
+<details>
+<summary>Corn</summary>
+
+```corn
+{
+  start = [
+    {
+      type = "launcher"
+      favorites = ["firefox" "discord"]
+      show_names = false
+      show_icons = true
+      icon_theme = "Paper"
+
+    }
+  ]
+}
+```
+
+</details>
+
+## Styling
+
+| Selector                      | Description              |
+|-------------------------------|--------------------------|
+| `#launcher`                   | Launcher widget box      |
+| `#launcher .item`             | App button               |
+| `#launcher .item.open`        | App button (open app)    |
+| `#launcher .item.focused`     | App button (focused app) |
+| `#launcher .item.urgent`      | App button (urgent app)  |
+| `#launcher-popup`             | Popup container          |
+| `#launcher-popup .popup-item` | Window button in popup   |
--- a/docs/modules/MPD.md
+++ b/docs/modules/MPD.md
@@ -0,0 +1,131 @@
+Displays currently playing song from MPD.
+Clicking on the widget opens a popout displaying info about the current song, album art
+and playback controls.
+
+![Screenshot showing MPD widget with track playing with popout open](https://user-images.githubusercontent.com/5057870/184539664-a8f3ad5b-69c0-492d-a27d-82303c09a347.png)
+
+## Configuration
+
+> Type: `mpd`
+
+|                | Type     | Default                     | Description                                                           |
+|----------------|----------|-----------------------------|-----------------------------------------------------------------------|
+| `host`         | `string` | `localhost:6600`            | TCP or Unix socket for the MPD server.                                |
+| `format`       | `string` | `{icon} {title} / {artist}` | Format string for the widget. More info below.                        |
+| `icons.play`   | `string` | ``                         | Icon to show when playing.                                            |
+| `icons.pause`  | `string` | ``                         | Icon to show when paused.                                             |
+| `icons.volume` | `string` | `墳`                         | Icon to show under popup volume slider.                               |
+| `music_dir`    | `string` | `$HOME/Music`               | Path to MPD server's music directory on disc. Required for album art. |
+
+<details>
+<summary>JSON</summary>
+
+```json
+{
+  "start": [
+    {
+      "type": "mpd",
+      "format": "{icon} {title} / {artist}",
+      "icons": {
+        "play": "",
+        "pause": ""
+      },
+      "music_dir": "/home/jake/Music"
+    }
+  ]
+}
+```
+
+</details>
+
+<details>
+<summary>TOML</summary>
+
+```toml
+[[start]]
+type = "mpd"
+format = "{icon} {title} / {artist}"
+music_dir = "/home/jake/Music"
+
+[[start.icons]]
+play = ""
+pause = ""
+```
+
+</details>
+
+<details>
+<summary>YAML</summary>
+
+```yaml
+start:
+  - type: "mpd"
+    format: "{icon} {title} / {artist}"
+    icons:
+      play: ""
+      pause: ""
+    music_dir: "/home/jake/Music"
+```
+
+</details>
+
+<details>
+<summary>Corn</summary>
+
+```corn
+{
+  start = [
+    {
+      type = "mpd"
+      format = "{icon} {title} / {artist}"
+      icons.play = ""
+      icons.pause = ""
+      music_dir = "/home/jake/Music"
+    }
+  ]
+}
+```
+
+</details>
+
+### Formatting Tokens
+
+The following tokens can be used in the `format` config option,
+and will be replaced with values from the currently playing track:
+
+| Token        | Description                          |
+|--------------|--------------------------------------|
+| `{icon}`     | Either `icons.play` or `icons.pause` |
+| `{title}`    | Title                                |
+| `{album}`    | Album name                           |
+| `{artist}`   | Artist name                          |
+| `{date}`     | Release date                         |
+| `{track}`    | Track number                         |
+| `{disc}`     | Disc number                          |
+| `{genre}`    | Genre                                |
+| `{duration}` | Duration in `mm:ss`                  |
+| `{elapsed}`  | Time elapsed in `mm:ss`              |
+
+## Styling
+
+| Selector                               | Description                              |
+|----------------------------------------|------------------------------------------|
+| `#mpd`                                 | Tray widget button                       |
+| `#popup-mpd`                           | Popup box                                |
+| `#popup-mpd #album-art`                | Album art image inside popup box         |
+| `#popup-mpd #title`                    | Track title container inside popup box   |
+| `#popup-mpd #title .icon`              | Track title icon label inside popup box  |
+| `#popup-mpd #title .label`             | Track title label inside popup box       |
+| `#popup-mpd #album`                    | Track album container inside popup box   |
+| `#popup-mpd #album .icon`              | Track album icon label inside popup box  |
+| `#popup-mpd #album .label`             | Track album label inside popup box       |
+| `#popup-mpd #artist`                   | Track artist container inside popup box  |
+| `#popup-mpd #artist .icon`             | Track artist icon label inside popup box |
+| `#popup-mpd #artist .label`            | Track artist label inside popup box      |
+| `#popup-mpd #controls`                 | Controls container inside popup box      |
+| `#popup-mpd #controls #btn-prev`       | Previous button inside popup box         |
+| `#popup-mpd #controls #btn-play-pause` | Play/pause button inside popup box       |
+| `#popup-mpd #controls #btn-next`       | Next button inside popup box             |
+| `#popup-mpd #volume`                   | Volume container inside popup box        |
+| `#popup-mpd #volume #slider`           | Volume slider popup box                  |
+| `#popup-mpd #volume .icon`             | Volume icon label inside popup box       |
--- a/docs/modules/Script.md
+++ b/docs/modules/Script.md
@@ -0,0 +1,87 @@
+Executes a script and shows the result of `stdout` on a label.
+Pango markup is supported.
+
+## Configuration
+
+> Type: `script`
+
+| Name       | Type                  | Default | Description                                             |
+|------------|-----------------------|---------|---------------------------------------------------------|
+| `cmd`      | `string`              | `null`  | Path to the script on disk                              |
+| `mode`     | `'poll'` or `'watch'` | `poll`  | See [#modes](#modes)                                    |
+| `interval` | `number`              | `5000`  | Number of milliseconds to wait between executing script |
+
+### Modes
+
+- Use `poll` to run the script wait for it to exit. On exit, the label is updated to show everything the script wrote to `stdout`.
+- Use `watch` to start a long-running script. Every time the script writes to `stdout`, the label is updated to show the latest line.
+    Note this does not work for all programs as they may use block-buffering instead of line-buffering when they detect output being piped. 
+
+<details>
+<summary>JSON</summary>
+
+```json
+{
+  "end": [
+    {
+      "type": "script",
+      "cmd": "/home/jake/.local/bin/phone-battery",
+      "mode": "poll",
+      "interval": 5000
+    }
+  ]
+}
+
+```
+
+</details>
+
+<details>
+<summary>TOML</summary>
+
+```toml
+[[end]]
+type = "script"
+cmd = "/home/jake/.local/bin/phone-battery"
+mode = "poll"
+interval = 5000
+```
+
+</details>
+
+<details>
+<summary>YAML</summary>
+
+```yaml
+end:
+  - type: "script"
+    cmd: "/home/jake/.local/bin/phone-battery"
+    mode: 'poll'
+    interval : 5000
+```
+
+</details>
+
+<details>
+<summary>Corn</summary>
+
+```corn
+{
+  end = [
+    {
+      type = "script"
+      cmd = "/home/jake/.local/bin/phone-battery"
+      mode = "poll"
+      interval = 5000
+    }
+  ]
+}
+```
+
+</details>
+
+## Styling
+
+| Selector      | Description         |
+|---------------|---------------------|
+| `#script`     | Script widget label |
--- a/docs/modules/Sys-Info.md
+++ b/docs/modules/Sys-Info.md
@@ -0,0 +1,176 @@
+Displays one or more labels containing system information. 
+
+Separating information across several labels allows for styling each one independently. 
+Pango markup is supported.
+
+![Screenshot showing sys-info module with widgets for all of the types of formatting tokens](https://user-images.githubusercontent.com/5057870/196059090-4056d083-69f0-4e6f-9673-9e35dc29d9f0.png)
+
+
+## Configuration
+
+> Type: `sys_info`
+
+| Name               | Type               | Default | Description                                                                                                                    |
+|--------------------|--------------------|---------|--------------------------------------------------------------------------------------------------------------------------------|
+| `format`           | `string[]`         | `null`  | Array of strings including formatting tokens. For available tokens see below.                                                  |
+| `interval`         | `integer` or `Map` | `5`     | Seconds between refreshing. Can be a single value for all data or a map of individual refresh values for different data types. |
+| `interval.memory`  | `integer`          | `5`     | Seconds between refreshing memory data                                                                                         |
+| `interval.cpu`     | `integer`          | `5`     | Seconds between refreshing cpu data                                                                                            |
+| `interval.temps`   | `integer`          | `5`     | Seconds between refreshing temperature data                                                                                    |
+| `interval.disks`   | `integer`          | `5`     | Seconds between refreshing disk data                                                                                           |
+| `interval.network` | `integer`          | `5`     | Seconds between refreshing network data                                                                                        |
+
+<details>
+<summary>JSON</summary>
+
+```json
+{
+  "end": [
+    {
+      "format": [
+        " {cpu_percent}% | {temp_c:k10temp_Tccd1}°C",
+        " {memory_used} / {memory_total} GB ({memory_percent}%)",
+        "| {swap_used} / {swap_total} GB ({swap_percent}%)",
+        " {disk_used:/} / {disk_total:/} GB ({disk_percent:/}%)",
+        "李 {net_down:enp39s0} / {net_up:enp39s0} Mbps",
+        "猪 {load_average:1} | {load_average:5} | {load_average:15}",
+        " {uptime}"
+      ],
+      "interval": {
+        "cpu": 1,
+        "disks": 300,
+        "memory": 30,
+        "networks": 3,
+        "temps": 5
+      },
+      "type": "sys_info"
+    }
+  ]
+}
+```
+
+</details>
+
+<details>
+<summary>TOML</summary>
+
+```toml
+[[end]]
+type = 'sys_info'
+format = [
+    ' {cpu_percent}% | {temp_c:k10temp_Tccd1}°C',
+    ' {memory_used} / {memory_total} GB ({memory_percent}%)',
+    '| {swap_used} / {swap_total} GB ({swap_percent}%)',
+    ' {disk_used:/} / {disk_total:/} GB ({disk_percent:/}%)',
+    '李 {net_down:enp39s0} / {net_up:enp39s0} Mbps',
+    '猪 {load_average:1} | {load_average:5} | {load_average:15}',
+    ' {uptime}',
+]
+
+[end.interval]
+cpu = 1
+disks = 300
+memory = 30
+networks = 3
+temps = 5
+
+
+```
+
+</details>
+
+<details>
+<summary>YAML</summary>
+
+```yaml
+end:
+- format:
+  - ' {cpu_percent}% | {temp_c:k10temp_Tccd1}°C'
+  - ' {memory_used} / {memory_total} GB ({memory_percent}%)'
+  - '| {swap_used} / {swap_total} GB ({swap_percent}%)'
+  - ' {disk_used:/} / {disk_total:/} GB ({disk_percent:/}%)'
+  - '李 {net_down:enp39s0} / {net_up:enp39s0} Mbps'
+  - '猪 {load_average:1} | {load_average:5} | {load_average:15}'
+  - ' {uptime}'
+  interval:
+    cpu: 1
+    disks: 300
+    memory: 30
+    networks: 3
+    temps: 5
+  type: sys_info
+```
+
+</details>
+
+<details>
+<summary>Corn</summary>
+
+```corn
+{
+  end = [
+    {
+      type = "sys_info"
+
+      interval.memory = 30
+      interval.cpu = 1
+      interval.temps = 5
+      interval.disks = 300
+      interval.networks = 3
+
+      format = [
+        " {cpu_percent}% | {temp_c:k10temp_Tccd1}°C"
+        " {memory_used} / {memory_total} GB ({memory_percent}%)"
+        "| {swap_used} / {swap_total} GB ({swap_percent}%)"
+        " {disk_used:/} / {disk_total:/} GB ({disk_percent:/}%)"
+        "李 {net_down:enp39s0} / {net_up:enp39s0} Mbps"
+        "猪 {load_average:1} | {load_average:5} | {load_average:15}"
+        " {uptime}"
+      ]
+    }
+  ]
+}
+```
+
+</details>
+
+### Formatting Tokens
+
+The following tokens can be used in the `format` configuration option:
+
+| Token                    | Description                                                                        |
+|--------------------------|------------------------------------------------------------------------------------|
+| **CPU**                  |                                                                                    |
+| `{cpu_percent}`          | Total CPU utilisation percentage                                                   |
+| **Memory**               |                                                                                    |
+| `{memory_free}`          | Memory free in GB.                                                                 |
+| `{memory_used}`          | Memory used in GB.                                                                 |
+| `{memory_total}`         | Memory total in GB.                                                                |
+| `{memory_percent}`       | Memory utilisation percentage.                                                     |
+| `{swap_free}`            | Swap free in GB.                                                                   |
+| `{swap_used}`            | Swap used in GB.                                                                   |
+| `{swap_total}`           | Swap total in GB.                                                                  |
+| `{swap_percent}`         | Swap utilisation percentage.                                                       |
+| **Temperature**          |                                                                                    |
+| `{temp_c:[sensor]}`      | Temperature in degrees C. Replace `[sensor]` with the sensor label.                |
+| `{temp_f:[sensor]}`      | Temperature in degrees F. Replace `[sensor]` with the sensor label.                |
+| **Disk**                 |                                                                                    |
+| `{disk_free:[mount]}`    | Disk free space in GB. Replace `[mount]` with the disk mountpoint.                 |
+| `{disk_used:[mount]}`    | Disk used space in GB. Replace `[mount]` with the disk mountpoint.                 |
+| `{disk_total:[mount]}`   | Disk total space in GB. Replace `[mount]` with the disk mountpoint.                |
+| `{disk_percent:[mount]}` | Disk utilisation percentage. Replace `[mount]` with the disk mountpoint.           |
+| **Network**              |                                                                                    |
+| `{net_down:[adapter]}`   | Average network download speed in Mbps. Replace `[adapter]` with the adapter name. |
+| `{net_up:[adapter]}`     | Average network upload speed in Mbps. Replace `[adapter]` with the adapter name.   |
+| **System**               |                                                                                    |
+| `{load_average:1}`       | 1-minute load average.                                                             |
+| `{load_average:5}`       | 5-minute load average.                                                             |
+| `{load_average:15}`      | 15-minute load average.                                                            |
+| `{uptime}`               | System uptime formatted as `HH:mm`.                                                |
+
+## Styling
+
+| Selector         | Description                  |
+|------------------|------------------------------|
+| `#sysinfo`       | Sysinfo widget box           |
+| `#sysinfo #item` | Individual information label |
--- a/docs/modules/Tray.md
+++ b/docs/modules/Tray.md
@@ -0,0 +1,64 @@
+Displays a fully interactive icon tray using the KDE `libappindicator` protocol. 
+
+![Screenshot showing icon tray widget](https://user-images.githubusercontent.com/5057870/184540135-78ffd79d-f802-4c79-b09a-05a733dadc55.png)
+
+## Configuration
+
+> Type: `tray`
+
+***This module provides no configuration options.***
+
+<details>
+<summary>JSON</summary>
+
+```json
+{
+  "end": [
+    {
+      "type": "tray"
+    }
+  ]
+}
+```
+
+</details>
+
+<details>
+<summary>TOML</summary>
+
+```toml
+[[end]]
+type = "tray"
+```
+
+</details>
+
+<details>
+<summary>YAML</summary>
+
+```yaml
+end:
+  - type: "tray"
+```
+
+</details>
+
+<details>
+<summary>Corn</summary>
+
+```corn
+{
+  end = [
+    { type = "tray" }
+  ]
+}
+```
+
+</details>
+
+## Styling
+
+| Selector      | Description      |
+|---------------|------------------|
+| `#tray`       | Tray widget box  |
+| `#tray .item` | Tray icon button |
--- a/docs/modules/Workspaces.md
+++ b/docs/modules/Workspaces.md
@@ -0,0 +1,94 @@
+> ⚠ **This module is currently only supported on Sway**
+
+Shows all current Sway workspaces. Clicking a workspace changes focus to it.
+
+![Screenshot showing workspaces widget using custom icons with browser workspace focused](https://user-images.githubusercontent.com/5057870/184540156-26cfe4ec-ab8d-4e0f-a883-8b641025366b.png)
+
+## Configuration
+
+> Type: `workspaces`
+
+| Name           | Type                  | Default | Description                                                                                                          |
+|----------------|-----------------------|---------|----------------------------------------------------------------------------------------------------------------------|
+| `name_map`     | `Map<string, string>` | `{}`    | A map of actual workspace names to their display labels. Workspaces use their actual name if not present in the map. |
+| `all_monitors` | `boolean`             | `false` | Whether to display workspaces from all monitors. When `false`, only shows workspaces on the current monitor.         |
+
+<details>
+<summary>JSON</summary>
+
+```json
+{
+  "end": [
+    {
+      "type": "workspaces",
+      "name_map": {
+        "1": "",
+        "2": "",
+        "3": ""
+      },
+      "all_monitors": false
+    }
+  ]
+}
+```
+
+</details>
+
+<details>
+<summary>TOML</summary>
+
+```toml
+[[end]]
+type = "workspaces"
+all_monitors = false
+
+[[end.name_map]]
+1 = ""
+2 = ""
+3 = ""
+
+```
+
+</details>
+
+<details>
+<summary>YAML</summary>
+
+```yaml
+end:
+  - type: "workspaces"
+    name_map:
+      1: ""
+      2: ""
+      3: ""
+    all_monitors: false
+```
+
+</details>
+
+<details>
+<summary>Corn</summary>
+
+```corn
+{
+  end = [
+    {
+      type = "workspaces",
+      name_map.1 = ""
+      name_map.2 = ""
+      name_map.3 = ""
+      all_monitors = false
+    }
+  ]
+}
+```
+
+</details>
+
+## Styling
+
+| Selector                    | Description                          |
+|-----------------------------|--------------------------------------|
+| `#workspaces`               | Workspaces widget box                |
+| `#workspaces .item`         | Workspace button                     |
+| `#workspaces .item.focused` | Workspace button (workspace focused) |
--- a/examples/config.corn
+++ b/examples/config.corn
@@ -23,21 +23,59 @@ let {
    $mpd_server = { type = "mpd" host = "chloe:6600" }

    $sys_info = {
-        type = "sys-info"
-        format = ["{cpu-percent}% " "{memory-percent}% "]
+        type = "sys_info"
+        format = ["{cpu_percent}% " "{memory_percent}% "]
    }

    $tray = { type = "tray" }
-    $clock = { type = "clock" }
+    $clock = {
+        type = "clock"
+        // show-if = "500:[ $(($(date +%s) % 2)) -eq 0 ]"
+        show_if.cmd = "exit 0"
+        show_if.interval = 500
+    }

    $phone_battery = {
        type = "script"
-        path = "/home/jake/bin/phone-battery"
+        cmd = "/home/jake/bin/phone-battery"
+    }
+
+    $log_tail = {
+        type = "script"
+        path = "tail -f /home/jake/.local/share/ironbar/error.log"
+        mode = "watch"
+    }
+
+    $power_menu = {
+        type = "custom"
+        class = "power-menu"
+
+        bar = [ { type = "button" name="power-btn" label = "" on_click = "popup:toggle" } ]
+
+        popup = [ {
+            type = "box"
+            orientation = "vertical"
+            widgets = [
+                { type = "label" name = "header" label = "Power menu" }
+                {
+                    type = "box"
+                    widgets = [
+                        { type = "button" class="power-btn" label = "<span font-size='40pt'></span>" on_click = "!shutdown now" }
+                        { type = "button" class="power-btn" label = "<span font-size='40pt'></span>" on_click = "!reboot" }
+                    ]
+                }
+                { type = "label" name = "uptime" label = "Up: {{30000:uptime -p | cut -d ' ' -f2-}}" }
+            ]
+        } ]
+
+        tooltip = "Up: {{30000:uptime -p | cut -d ' ' -f2-}}"
    }

    $left = [ $workspaces $launcher ]
-    $right = [ $mpd_local $mpd_server $phone_battery $sys_info $clock ]
+    $right = [ $mpd_local $mpd_server $phone_battery $sys_info $power_menu $clock ]
 }
 in {
-    left = $left right = $right
+    anchor_to_edges = true
+    position = "top"
+    start = $left end = $right
 }
--- a/examples/config.json
+++ b/examples/config.json
@@ -1,18 +1,43 @@
 {
-  "monitors": {
-    "DP-1": [
-      {
-        "left": [{"type":  "clock"}]
-      },
-      {
-        "position": "top",
-        "left": []
-      }
-    ],
-    "DP-2": {
-      "position": "bottom",
-      "height": 30,
-      "left": []
+  "start": [
+    {
+      "type": "workspaces"
+    },
+    {
+      "type": "launcher",
+      "icon_theme": "Paper",
+      "favorites": [
+        "firefox",
+        "discord",
+        "Steam"
+      ],
+      "show_names": false
    }
-  }
+  ],
+  "end": [
+    {
+      "type": "mpd"
+    },
+    {
+      "type": "mpd",
+      "host": "chloe:6600"
+    },
+    {
+      "path": "/home/jake/bin/phone-battery",
+      "type": "script"
+    },
+    {
+      "format": [
+        "{cpu_percent}% ",
+        "{memory_percent}% "
+      ],
+      "type": "sys_info"
+    },
+    {
+      "type": "tray"
+    },
+    {
+      "type": "clock"
+    }
+  ]
 }
--- a/examples/custom.corn
+++ b/examples/custom.corn
@@ -0,0 +1,29 @@
+let {
+    $button = { type = "button" name="power-btn" label = "" on_click = "popup:toggle" }
+
+    $popup = {
+        type = "box"
+        orientation = "vertical"
+        widgets = [
+            { type = "label" name = "header" label = "Power menu" }
+            {
+                type = "box"
+                widgets = [
+                    { type = "button" class="power-btn" label = "<span font-size='40pt'></span>" on_click = "!shutdown now" }
+                    { type = "button" class="power-btn" label = "<span font-size='40pt'></span>" on_click = "!reboot" }
+                ]
+            }
+            { type = "label" name = "uptime" label = "Uptime: {{30000:uptime -p | cut -d ' ' -f2-}}" }
+        ]
+    }
+
+    $power_menu = {
+        type = "custom"
+        class = "power-menu"
+
+        bar = [ $button ]
+        popup = [ $popup ]
+    }
+} in {
+    end = [ $power_menu { type = "clock" }  ]
+}
--- a/examples/sys-info.corn
+++ b/examples/sys-info.corn
@@ -0,0 +1,23 @@
+{
+    end = [
+        {
+            type = "sys_info"
+
+            interval.memory = 30
+            interval.cpu = 1
+            interval.temps = 5
+            interval.disks = 300
+            interval.networks = 3
+
+            format = [
+                " {cpu_percent}% | {temp_c:k10temp_Tccd1}°C"
+                " {memory_used} / {memory_total} GB ({memory_percent}%)"
+                "| {swap_used} / {swap_total} GB ({swap_percent}%)"
+                " {disk_used:/} / {disk_total:/} GB ({disk_percent:/}%)"
+                "李 {net_down:enp39s0} / {net_up:enp39s0} Mbps"
+                "猪 {load_average:1} | {load_average:5} | {load_average:15}"
+                " {uptime}"
+            ]
+        }
+    ]
+}
--- a/flake.lock
+++ b/flake.lock
@@ -0,0 +1,64 @@
+{
+  "nodes": {
+    "flake-utils": {
+      "locked": {
+        "lastModified": 1659877975,
+        "narHash": "sha256-zllb8aq3YO3h8B/U0/J1WBgAL8EX5yWf5pMj3G0NAmc=",
+        "owner": "numtide",
+        "repo": "flake-utils",
+        "rev": "c0e246b9b83f637f4681389ecabcb2681b4f3af0",
+        "type": "github"
+      },
+      "original": {
+        "owner": "numtide",
+        "repo": "flake-utils",
+        "type": "github"
+      }
+    },
+    "nixpkgs": {
+      "locked": {
+        "lastModified": 1668994630,
+        "narHash": "sha256-1lqx6HLyw6fMNX/hXrrETG1vMvZRGm2XVC9O/Jt0T6c=",
+        "owner": "nixos",
+        "repo": "nixpkgs",
+        "rev": "af50806f7c6ab40df3e6b239099e8f8385f6c78b",
+        "type": "github"
+      },
+      "original": {
+        "owner": "nixos",
+        "ref": "nixos-unstable",
+        "repo": "nixpkgs",
+        "type": "github"
+      }
+    },
+    "root": {
+      "inputs": {
+        "nixpkgs": "nixpkgs",
+        "rust-overlay": "rust-overlay"
+      }
+    },
+    "rust-overlay": {
+      "inputs": {
+        "flake-utils": "flake-utils",
+        "nixpkgs": [
+          "nixpkgs"
+        ]
+      },
+      "locked": {
+        "lastModified": 1669084742,
+        "narHash": "sha256-aLYwYVnrmEE1LVqd17v99CuqVmAZQrlgi2DVTAs4wFg=",
+        "owner": "oxalica",
+        "repo": "rust-overlay",
+        "rev": "9652ef34c7439eca9f86cee11e94dbef5c9adb09",
+        "type": "github"
+      },
+      "original": {
+        "owner": "oxalica",
+        "repo": "rust-overlay",
+        "type": "github"
+      }
+    }
+  },
+  "root": "root",
+  "version": 7
+}
--- a/flake.nix
+++ b/flake.nix
@@ -0,0 +1,142 @@
+{
+  description = "Nix Flake for ironbar";
+  inputs = {
+    nixpkgs.url = "github:nixos/nixpkgs/nixos-unstable";
+    rust-overlay = {
+      url = "github:oxalica/rust-overlay";
+      inputs.nixpkgs.follows = "nixpkgs";
+    };
+    #nci.url = "github:yusdacra/nix-cargo-integration";
+    #nci.inputs.nixpkgs.follows = "nixpkgs";
+    #nci.inputs.rust-overlay.follows = "rust-overlay";
+  };
+  outputs = {
+    self,
+    nixpkgs,
+    rust-overlay,
+    ...
+  }: let
+    inherit (nixpkgs) lib;
+    genSystems = lib.genAttrs [
+      "aarch64-linux"
+      "x86_64-linux"
+    ];
+    pkgsFor = system:
+      import nixpkgs {
+        inherit system;
+
+        overlays = [
+          self.overlays.default
+          rust-overlay.overlays.default
+        ];
+      };
+    mkRustToolchain = pkgs: pkgs.rust-bin.stable.latest.default;
+  in {
+    overlays.default = final: prev: let
+      rust = mkRustToolchain final;
+
+      rustPlatform = prev.makeRustPlatform {
+        cargo = rust;
+        rustc = rust;
+      };
+    in {
+      ironbar = rustPlatform.buildRustPackage {
+        pname = "ironbar";
+        version = self.rev or "dirty";
+        src = builtins.path {
+          name = "ironbar";
+          path = prev.lib.cleanSource ./.;
+        };
+        cargoDeps = rustPlatform.importCargoLock {lockFile = ./Cargo.lock;};
+        cargoLock.lockFile = ./Cargo.lock;
+        nativeBuildInputs = with prev; [pkg-config];
+        buildInputs = with prev; [gtk3 gdk-pixbuf gtk-layer-shell libxkbcommon];
+      };
+    };
+    packages = genSystems (
+      system: let
+        pkgs = pkgsFor system;
+      in
+        (self.overlays.default pkgs pkgs)
+        // {
+          default = self.packages.${system}.ironbar;
+        }
+    );
+    devShells = genSystems (system: let
+      pkgs = pkgsFor system;
+      rust = mkRustToolchain pkgs;
+    in {
+      default = pkgs.mkShell {
+        packages = with pkgs; [
+          rust
+          rust-analyzer-unwrapped
+          gcc
+          gtk3
+          gtk-layer-shell
+          pkg-config
+        ];
+
+        RUST_SRC_PATH = "${rust}/lib/rustlib/src/rust/library";
+      };
+    });
+    homeManagerModules.default = {
+      config,
+      lib,
+      pkgs,
+      ...
+    }: let
+      cfg = config.programs.ironbar;
+      defaultIronbarPackage = self.packages.${pkgs.system}.default;
+      jsonFormat = pkgs.formats.json {};
+    in {
+      options.programs.ironbar = {
+        enable = lib.mkEnableOption "ironbar status bar";
+        package = lib.mkOption {
+          type = with lib.types; package;
+          default = defaultIronbarPackage;
+          description = "The package for ironbar to use";
+        };
+        systemd = lib.mkOption {
+          type = lib.types.bool;
+          default = pkgs.stdenv.isLinux;
+          description = "Whether to enable to systemd service for ironbar";
+        };
+        style = lib.mkOption {
+          type = lib.types.lines;
+          default = "";
+          description = "The stylesheet to apply to ironbar";
+        };
+        config = lib.mkOption {
+          type = jsonFormat.type;
+          default = {};
+          description = "The config to pass to ironbar";
+        };
+      };
+      config = lib.mkIf cfg.enable {
+        home.packages = [cfg.package];
+        xdg.configFile = {
+          "ironbar/config.json" = lib.mkIf (cfg.config != "") {
+            source = jsonFormat.generate "ironbar-config" cfg.config;
+          };
+          "ironbar/style.css" = lib.mkIf (cfg.style != "") {
+            text = cfg.style;
+          };
+        };
+        systemd.user.services.ironbar = lib.mkIf cfg.systemd {
+          Unit = {
+            Description = "Systemd service for Ironbar";
+            Requires = ["graphical-session.target"];
+          };
+          Service = {
+            Type = "simple";
+            ExecStart = "${cfg.package}/bin/ironbar";
+          };
+          Install.WantedBy = [
+            (lib.mkIf config.wayland.windowManager.hyprland.systemdIntegration "hyprland-session.target")
+            (lib.mkIf config.wayland.windowManager.sway.systemdIntegration "sway-session.target")
+          ];
+        };
+      };
+    };
+  };
+}
--- a/src/bar.rs
+++ b/src/bar.rs
@@ -1,11 +1,26 @@
+use crate::bridge_channel::BridgeChannel;
 use crate::config::{BarPosition, ModuleConfig};
-use crate::modules::{Module, ModuleInfo, ModuleLocation};
-use crate::Config;
+use crate::dynamic_string::DynamicString;
+use crate::modules::custom::ExecEvent;
+use crate::modules::launcher::{ItemEvent, LauncherUpdate};
+use crate::modules::mpd::{PlayerCommand, SongUpdate};
+use crate::modules::workspaces::WorkspaceUpdate;
+use crate::modules::{Module, ModuleInfoBuilder, ModuleLocation, ModuleUpdateEvent, WidgetContext};
+use crate::popup::Popup;
+use crate::script::{OutputStream, Script};
+use crate::{await_sync, Config};
+use chrono::{DateTime, Local};
 use color_eyre::Result;
 use gtk::gdk::Monitor;
 use gtk::prelude::*;
 use gtk::{Application, ApplicationWindow, Orientation};
-use tracing::{debug, info};
+use std::collections::HashMap;
+use std::sync::{Arc, RwLock};
+use stray::message::NotifierItemCommand;
+use stray::NotifierItemMessage;
+use tokio::spawn;
+use tokio::sync::mpsc;
+use tracing::{debug, error, info, trace};

 /// Creates a new window for a bar,
 /// sets it up and adds its widgets.
@@ -17,30 +32,49 @@ pub fn create_bar(
 ) -> Result<()> {
    let win = ApplicationWindow::builder().application(app).build();

-    setup_layer_shell(&win, monitor, &config.position);
+    setup_layer_shell(&win, monitor, config.position, config.anchor_to_edges);
+
+    let orientation = config.position.get_orientation();

    let content = gtk::Box::builder()
-        .orientation(Orientation::Horizontal)
+        .orientation(orientation)
        .spacing(0)
        .hexpand(false)
-        .height_request(config.height)
-        .name("bar")
+        .name("bar");
+
+    let content = if orientation == Orientation::Horizontal {
+        content.height_request(config.height)
+    } else {
+        content.width_request(config.height)
+    }
+    .build();
+
+    let start = gtk::Box::builder()
+        .orientation(orientation)
+        .spacing(0)
+        .name("start")
+        .build();
+    let center = gtk::Box::builder()
+        .orientation(orientation)
+        .spacing(0)
+        .name("center")
+        .build();
+    let end = gtk::Box::builder()
+        .orientation(orientation)
+        .spacing(0)
+        .name("end")
        .build();

-    let left = gtk::Box::builder().spacing(0).name("left").build();
-    let center = gtk::Box::builder().spacing(0).name("center").build();
-    let right = gtk::Box::builder().spacing(0).name("right").build();
-
    content.style_context().add_class("container");
-    left.style_context().add_class("container");
+    start.style_context().add_class("container");
    center.style_context().add_class("container");
-    right.style_context().add_class("container");
+    end.style_context().add_class("container");

-    content.add(&left);
+    content.add(&start);
    content.set_center_widget(Some(&center));
-    content.pack_end(&right, false, false, 0);
+    content.pack_end(&end, false, false, 0);

-    load_modules(&left, &center, &right, app, config, monitor, monitor_name)?;
+    load_modules(&start, &center, &end, app, config, monitor, monitor_name)?;
    win.add(&content);

    win.connect_destroy_event(|_, _| {
@@ -50,7 +84,11 @@ pub fn create_bar(
    });

    debug!("Showing bar");
-    win.show_all();
+    start.show();
+    center.show();
+    end.show();
+    content.show();
+    win.show();

    Ok(())
 }
@@ -65,40 +103,29 @@ fn load_modules(
    monitor: &Monitor,
    output_name: &str,
 ) -> Result<()> {
-    if let Some(modules) = config.left {
-        let info = ModuleInfo {
-            app,
-            location: ModuleLocation::Left,
-            bar_position: &config.position,
-            monitor,
-            output_name,
-        };
+    let mut info_builder = ModuleInfoBuilder::default();
+    let info_builder = info_builder
+        .app(app)
+        .bar_position(config.position)
+        .monitor(monitor)
+        .output_name(output_name);

-        add_modules(left, modules, &info)?;
+    if let Some(modules) = config.start {
+        let info_builder = info_builder.location(ModuleLocation::Left);
+
+        add_modules(left, modules, info_builder)?;
    }

    if let Some(modules) = config.center {
-        let info = ModuleInfo {
-            app,
-            location: ModuleLocation::Center,
-            bar_position: &config.position,
-            monitor,
-            output_name,
-        };
+        let info_builder = info_builder.location(ModuleLocation::Center);

-        add_modules(center, modules, &info)?;
+        add_modules(center, modules, info_builder)?;
    }

-    if let Some(modules) = config.right {
-        let info = ModuleInfo {
-            app,
-            location: ModuleLocation::Right,
-            bar_position: &config.position,
-            monitor,
-            output_name,
-        };
+    if let Some(modules) = config.end {
+        let info_builder = info_builder.location(ModuleLocation::Right);

-        add_modules(right, modules, &info)?;
+        add_modules(right, modules, info_builder)?;
    }

    Ok(())
@@ -106,34 +133,185 @@ fn load_modules(

 /// Adds modules into a provided GTK box,
 /// which should be one of its left, center or right containers.
-fn add_modules(content: &gtk::Box, modules: Vec<ModuleConfig>, info: &ModuleInfo) -> Result<()> {
+fn add_modules(
+    content: &gtk::Box,
+    modules: Vec<ModuleConfig>,
+    info_builder: &mut ModuleInfoBuilder,
+) -> Result<()> {
+    let base_popup_info = info_builder.module_name("").build()?;
+    let popup = Popup::new(&base_popup_info);
+    let popup = Arc::new(RwLock::new(popup));
+
    macro_rules! add_module {
-        ($module:expr, $name:literal) => {{
-            let widget = $module.into_widget(&info)?;
-            widget.set_widget_name($name);
-            content.add(&widget);
-            debug!("Added module of type {}", $name);
-        }};
+        ($module:expr, $id:expr, $name:literal, $send_message:ty, $receive_message:ty) => {
+            let info = info_builder.module_name($name).build()?;
+
+            let (w_tx, w_rx) = glib::MainContext::channel::<$send_message>(glib::PRIORITY_DEFAULT);
+            let (p_tx, p_rx) = glib::MainContext::channel::<$send_message>(glib::PRIORITY_DEFAULT);
+
+            let channel = BridgeChannel::<ModuleUpdateEvent<$send_message>>::new();
+            let (ui_tx, ui_rx) = mpsc::channel::<$receive_message>(16);
+
+            $module.spawn_controller(&info, channel.create_sender(), ui_rx)?;
+
+            let context = WidgetContext {
+                id: $id,
+                widget_rx: w_rx,
+                popup_rx: p_rx,
+                tx: channel.create_sender(),
+                controller_tx: ui_tx,
+            };
+
+            let common = $module.common.clone();
+
+            let widget = $module.into_widget(context, &info)?;
+
+            let container = gtk::EventBox::new();
+            container.add(&widget.widget);
+
+            content.add(&container);
+            widget.widget.set_widget_name(info.module_name);
+
+            if let Some(show_if) = common.show_if {
+                let script = Script::new_polling(show_if);
+                let container = container.clone();
+
+                let (tx, rx) = glib::MainContext::channel(glib::PRIORITY_DEFAULT);
+
+                spawn(async move {
+                    script
+                        .run(|(_, success)| {
+                            tx.send(success)
+                                .expect("Failed to send widget visibility toggle message");
+                        })
+                        .await;
+                });
+
+                rx.attach(None, move |success| {
+                    if success {
+                        container.show_all()
+                    } else {
+                        container.hide()
+                    };
+                    Continue(true)
+                });
+            } else {
+                container.show_all();
+            }
+
+            if let Some(on_click) = common.on_click {
+                let script = Script::new_polling(on_click);
+                container.connect_button_press_event(move |_, _| {
+                    trace!("Running on-click script");
+                    match await_sync(async { script.get_output().await }) {
+                        Ok((OutputStream::Stderr(out), _)) => error!("{out}"),
+                        Err(err) => error!("{err:?}"),
+                        _ => {}
+                    }
+                    Inhibit(false)
+                });
+            }
+
+            if let Some(tooltip) = common.tooltip {
+                DynamicString::new(&tooltip, move |string| {
+                    container.set_tooltip_text(Some(&string));
+                    Continue(true)
+                });
+            }
+
+            let has_popup = widget.popup.is_some();
+            if let Some(popup_content) = widget.popup {
+                popup
+                    .write()
+                    .expect("Failed to get write lock on popup")
+                    .register_content($id, popup_content);
+            }
+
+            let popup2 = Arc::clone(&popup);
+            channel.recv(move |ev| {
+                let popup = popup2.clone();
+                match ev {
+                    ModuleUpdateEvent::Update(update) => {
+                        if has_popup {
+                            p_tx.send(update.clone())
+                                .expect("Failed to send update to popup");
+                        }
+
+                        w_tx.send(update).expect("Failed to send update to module");
+                    }
+                    ModuleUpdateEvent::TogglePopup(geometry) => {
+                        debug!("Toggling popup for {} [#{}]", $name, $id);
+                        let popup = popup.read().expect("Failed to get read lock on popup");
+                        if popup.is_visible() {
+                            popup.hide()
+                        } else {
+                            popup.show_content($id);
+                            popup.show(geometry);
+                        }
+                    }
+                    ModuleUpdateEvent::OpenPopup(geometry) => {
+                        debug!("Opening popup for {} [#{}]", $name, $id);
+
+                        let popup = popup.read().expect("Failed to get read lock on popup");
+                        popup.hide();
+                        popup.show_content($id);
+                        popup.show(geometry);
+                    }
+                    ModuleUpdateEvent::ClosePopup => {
+                        debug!("Closing popup for {} [#{}]", $name, $id);
+
+                        let popup = popup.read().expect("Failed to get read lock on popup");
+                        popup.hide();
+                    }
+                }
+
+                Continue(true)
+            });
+        };
    }

-    for config in modules {
+    for (id, config) in modules.into_iter().enumerate() {
        match config {
-            ModuleConfig::Clock(module) => add_module!(module, "clock"),
-            ModuleConfig::Mpd(module) => add_module!(module, "mpd"),
-            ModuleConfig::Tray(module) => add_module!(module, "tray"),
-            ModuleConfig::Workspaces(module) => add_module!(module, "workspaces"),
-            ModuleConfig::SysInfo(module) => add_module!(module, "sysinfo"),
-            ModuleConfig::Launcher(module) => add_module!(module, "launcher"),
-            ModuleConfig::Script(module) => add_module!(module, "script"),
-            ModuleConfig::Focused(module) => add_module!(module, "focused"),
+            ModuleConfig::Clock(module) => {
+                add_module!(module, id, "clock", DateTime<Local>, ());
+            }
+            ModuleConfig::Script(module) => {
+                add_module!(module, id, "script", String, ());
+            }
+            ModuleConfig::SysInfo(module) => {
+                add_module!(module, id, "sysinfo", HashMap<String, String>, ());
+            }
+            ModuleConfig::Focused(module) => {
+                add_module!(module, id, "focused", (String, String), ());
+            }
+            ModuleConfig::Workspaces(module) => {
+                add_module!(module, id, "workspaces", WorkspaceUpdate, String);
+            }
+            ModuleConfig::Tray(module) => {
+                add_module!(module, id, "tray", NotifierItemMessage, NotifierItemCommand);
+            }
+            ModuleConfig::Mpd(module) => {
+                add_module!(module, id, "mpd", Option<SongUpdate>, PlayerCommand);
+            }
+            ModuleConfig::Launcher(module) => {
+                add_module!(module, id, "launcher", LauncherUpdate, ItemEvent);
+            }
+            ModuleConfig::Custom(module) => {
+                add_module!(module, id, "custom", (), ExecEvent);
+            }
        }
    }

    Ok(())
 }

-/// Sets up GTK layer shell for a provided aplication window.
-fn setup_layer_shell(win: &ApplicationWindow, monitor: &Monitor, position: &BarPosition) {
+/// Sets up GTK layer shell for a provided application window.
+fn setup_layer_shell(
+    win: &ApplicationWindow,
+    monitor: &Monitor,
+    position: BarPosition,
+    anchor_to_edges: bool,
+) {
    gtk_layer_shell::init_for_window(win);
    gtk_layer_shell::set_monitor(win, monitor);
    gtk_layer_shell::set_layer(win, gtk_layer_shell::Layer::Top);
@@ -144,16 +322,30 @@ fn setup_layer_shell(win: &ApplicationWindow, monitor: &Monitor, position: &BarP
    gtk_layer_shell::set_margin(win, gtk_layer_shell::Edge::Left, 0);
    gtk_layer_shell::set_margin(win, gtk_layer_shell::Edge::Right, 0);

+    let bar_orientation = position.get_orientation();
+
    gtk_layer_shell::set_anchor(
        win,
        gtk_layer_shell::Edge::Top,
-        position == &BarPosition::Top,
+        position == BarPosition::Top
+            || (bar_orientation == Orientation::Vertical && anchor_to_edges),
    );
    gtk_layer_shell::set_anchor(
        win,
        gtk_layer_shell::Edge::Bottom,
-        position == &BarPosition::Bottom,
+        position == BarPosition::Bottom
+            || (bar_orientation == Orientation::Vertical && anchor_to_edges),
+    );
+    gtk_layer_shell::set_anchor(
+        win,
+        gtk_layer_shell::Edge::Left,
+        position == BarPosition::Left
+            || (bar_orientation == Orientation::Horizontal && anchor_to_edges),
+    );
+    gtk_layer_shell::set_anchor(
+        win,
+        gtk_layer_shell::Edge::Right,
+        position == BarPosition::Right
+            || (bar_orientation == Orientation::Horizontal && anchor_to_edges),
    );
-    gtk_layer_shell::set_anchor(win, gtk_layer_shell::Edge::Left, true);
-    gtk_layer_shell::set_anchor(win, gtk_layer_shell::Edge::Right, true);
 }
--- a/src/bridge_channel.rs
+++ b/src/bridge_channel.rs
@@ -0,0 +1,43 @@
+use tokio::spawn;
+use tokio::sync::mpsc;
+
+/// MPSC async -> sync channel.
+/// The sender uses `tokio::sync::mpsc`
+/// while the receiver uses `glib::MainContext::channel`.
+///
+/// This makes it possible to send events asynchronously
+/// and receive them on the main thread,
+/// allowing UI updates to be handled on the receiving end.
+pub struct BridgeChannel<T> {
+    async_tx: mpsc::Sender<T>,
+    sync_rx: glib::Receiver<T>,
+}
+
+impl<T: Send + 'static> BridgeChannel<T> {
+    /// Creates a new channel
+    pub fn new() -> Self {
+        let (async_tx, mut async_rx) = mpsc::channel(32);
+        let (sync_tx, sync_rx) = glib::MainContext::channel(glib::PRIORITY_DEFAULT);
+
+        spawn(async move {
+            while let Some(val) = async_rx.recv().await {
+                sync_tx.send(val).expect("Failed to send message");
+            }
+        });
+
+        Self { async_tx, sync_rx }
+    }
+
+    /// Gets a clone of the sender.
+    pub fn create_sender(&self) -> mpsc::Sender<T> {
+        self.async_tx.clone()
+    }
+
+    /// Attaches a callback to the receiver.
+    pub fn recv<F>(self, f: F) -> glib::SourceId
+    where
+        F: FnMut(T) -> glib::Continue + 'static,
+    {
+        self.sync_rx.attach(None, f)
+    }
+}
--- a/src/clients/mod.rs
+++ b/src/clients/mod.rs
@@ -0,0 +1,4 @@
+pub mod mpd;
+pub mod sway;
+pub mod system_tray;
+pub mod wayland;
--- a/src/clients/mpd.rs
+++ b/src/clients/mpd.rs
@@ -0,0 +1,167 @@
+use lazy_static::lazy_static;
+use mpd_client::client::{CommandError, Connection, ConnectionEvent, Subsystem};
+use mpd_client::commands::Command;
+use mpd_client::protocol::MpdProtocolError;
+use mpd_client::responses::Status;
+use mpd_client::Client;
+use std::collections::HashMap;
+use std::fmt::{Display, Formatter};
+use std::os::unix::fs::FileTypeExt;
+use std::path::PathBuf;
+use std::sync::Arc;
+use std::time::Duration;
+use tokio::net::{TcpStream, UnixStream};
+use tokio::spawn;
+use tokio::sync::broadcast::{channel, error::SendError, Receiver, Sender};
+use tokio::sync::Mutex;
+use tokio::time::sleep;
+use tracing::debug;
+
+lazy_static! {
+    static ref CONNECTIONS: Arc<Mutex<HashMap<String, Arc<MpdClient>>>> =
+        Arc::new(Mutex::new(HashMap::new()));
+}
+
+pub struct MpdClient {
+    client: Client,
+    tx: Sender<()>,
+    _rx: Receiver<()>,
+}
+
+#[derive(Debug)]
+pub enum MpdConnectionError {
+    MaxRetries,
+    ProtocolError(MpdProtocolError),
+}
+
+impl Display for MpdConnectionError {
+    fn fmt(&self, f: &mut Formatter<'_>) -> std::fmt::Result {
+        match self {
+            Self::MaxRetries => write!(f, "Reached max retries"),
+            Self::ProtocolError(e) => write!(f, "{:?}", e),
+        }
+    }
+}
+
+impl std::error::Error for MpdConnectionError {}
+
+impl MpdClient {
+    async fn new(host: &str) -> Result<Self, MpdConnectionError> {
+        debug!("Creating new MPD connection to {}", host);
+
+        let (client, mut state_changes) =
+            wait_for_connection(host, Duration::from_secs(5), None).await?;
+
+        let (tx, rx) = channel(16);
+        let tx2 = tx.clone();
+
+        spawn(async move {
+            while let Some(change) = state_changes.next().await {
+                debug!("Received state change: {:?}", change);
+
+                if let ConnectionEvent::SubsystemChange(
+                    Subsystem::Player | Subsystem::Queue | Subsystem::Mixer,
+                ) = change
+                {
+                    tx2.send(())?;
+                }
+            }
+
+            Ok::<(), SendError<()>>(())
+        });
+
+        Ok(Self {
+            client,
+            tx,
+            _rx: rx,
+        })
+    }
+
+    pub fn subscribe(&self) -> Receiver<()> {
+        self.tx.subscribe()
+    }
+
+    pub async fn command<C: Command>(&self, command: C) -> Result<C::Response, CommandError> {
+        self.client.command(command).await
+    }
+}
+
+pub async fn get_client(host: &str) -> Result<Arc<MpdClient>, MpdConnectionError> {
+    let mut connections = CONNECTIONS.lock().await;
+    match connections.get(host) {
+        None => {
+            let client = MpdClient::new(host).await?;
+            let client = Arc::new(client);
+            connections.insert(host.to_string(), Arc::clone(&client));
+            Ok(client)
+        }
+        Some(client) => Ok(Arc::clone(client)),
+    }
+}
+
+async fn wait_for_connection(
+    host: &str,
+    interval: Duration,
+    max_retries: Option<usize>,
+) -> Result<Connection, MpdConnectionError> {
+    let mut retries = 0;
+    let max_retries = max_retries.unwrap_or(usize::MAX);
+
+    loop {
+        if retries == max_retries {
+            break Err(MpdConnectionError::MaxRetries);
+        }
+
+        retries += 1;
+
+        match try_get_mpd_conn(host).await {
+            Ok(conn) => break Ok(conn),
+            Err(err) => {
+                if retries == max_retries {
+                    break Err(MpdConnectionError::ProtocolError(err));
+                }
+            }
+        }
+
+        sleep(interval).await;
+    }
+}
+
+/// Cycles through each MPD host and
+/// returns the first one which connects,
+/// or none if there are none
+async fn try_get_mpd_conn(host: &str) -> Result<Connection, MpdProtocolError> {
+    if is_unix_socket(host) {
+        connect_unix(host).await
+    } else {
+        connect_tcp(host).await
+    }
+}
+
+fn is_unix_socket(host: &str) -> bool {
+    let path = PathBuf::from(host);
+    path.exists()
+        && path
+            .metadata()
+            .map_or(false, |metadata| metadata.file_type().is_socket())
+}
+
+async fn connect_unix(host: &str) -> Result<Connection, MpdProtocolError> {
+    let connection = UnixStream::connect(host).await?;
+    Client::connect(connection).await
+}
+
+async fn connect_tcp(host: &str) -> Result<Connection, MpdProtocolError> {
+    let connection = TcpStream::connect(host).await?;
+    Client::connect(connection).await
+}
+
+/// Gets the duration of the current song
+pub fn get_duration(status: &Status) -> Option<u64> {
+    status.duration.map(|duration| duration.as_secs())
+}
+
+/// Gets the elapsed time of the current song
+pub fn get_elapsed(status: &Status) -> Option<u64> {
+    status.elapsed.map(|duration| duration.as_secs())
+}
--- a/src/clients/sway.rs
+++ b/src/clients/sway.rs
@@ -0,0 +1,74 @@
+use async_once::AsyncOnce;
+use color_eyre::Report;
+use futures_util::StreamExt;
+use lazy_static::lazy_static;
+use std::sync::Arc;
+use swayipc_async::{Connection, Event, EventType, WorkspaceEvent};
+use tokio::spawn;
+use tokio::sync::broadcast::{channel, Receiver, Sender};
+use tokio::sync::Mutex;
+use tracing::{info, trace};
+
+pub struct SwayEventClient {
+    workspace_tx: Sender<Box<WorkspaceEvent>>,
+    _workspace_rx: Receiver<Box<WorkspaceEvent>>,
+}
+
+impl SwayEventClient {
+    fn new() -> Self {
+        let (workspace_tx, workspace_rx) = channel(16);
+
+        let workspace_tx2 = workspace_tx.clone();
+
+        spawn(async move {
+            let workspace_tx = workspace_tx2;
+
+            let client = Connection::new().await?;
+            info!("Sway IPC subscription client connected");
+
+            let event_types = [EventType::Workspace];
+
+            let mut events = client.subscribe(event_types).await?;
+
+            while let Some(event) = events.next().await {
+                trace!("event: {:?}", event);
+                if let Event::Workspace(ev) = event? {
+                    workspace_tx.send(ev)?;
+                };
+            }
+
+            Ok::<(), Report>(())
+        });
+
+        Self {
+            workspace_tx,
+            _workspace_rx: workspace_rx,
+        }
+    }
+
+    /// Gets an event receiver for workspace events
+    pub fn subscribe_workspace(&self) -> Receiver<Box<WorkspaceEvent>> {
+        self.workspace_tx.subscribe()
+    }
+}
+
+lazy_static! {
+    static ref CLIENT: AsyncOnce<Arc<Mutex<Connection>>> = AsyncOnce::new(async {
+        let client = Connection::new()
+            .await
+            .expect("Failed to connect to Sway socket");
+        Arc::new(Mutex::new(client))
+    });
+    static ref SUB_CLIENT: SwayEventClient = SwayEventClient::new();
+}
+
+/// Gets the sway IPC client
+pub async fn get_client() -> Arc<Mutex<Connection>> {
+    let client = CLIENT.get().await;
+    Arc::clone(client)
+}
+
+/// Gets the sway IPC event subscription client
+pub fn get_sub_client() -> &'static SwayEventClient {
+    &SUB_CLIENT
+}
--- a/src/clients/system_tray.rs
+++ b/src/clients/system_tray.rs
@@ -0,0 +1,74 @@
+use async_once::AsyncOnce;
+use lazy_static::lazy_static;
+use stray::message::{NotifierItemCommand, NotifierItemMessage};
+use stray::StatusNotifierWatcher;
+use tokio::spawn;
+use tokio::sync::{broadcast, mpsc};
+use tracing::debug;
+
+pub struct TrayEventReceiver {
+    tx: mpsc::Sender<NotifierItemCommand>,
+    b_tx: broadcast::Sender<NotifierItemMessage>,
+    _b_rx: broadcast::Receiver<NotifierItemMessage>,
+}
+
+impl TrayEventReceiver {
+    async fn new() -> stray::error::Result<Self> {
+        let (tx, rx) = mpsc::channel(16);
+        let (b_tx, b_rx) = broadcast::channel(16);
+
+        let tray = StatusNotifierWatcher::new(rx).await?;
+        let mut host = tray.create_notifier_host("ironbar").await?;
+
+        let b_tx2 = b_tx.clone();
+        spawn(async move {
+            while let Ok(message) = host.recv().await {
+                b_tx2.send(message)?;
+            }
+
+            Ok::<(), broadcast::error::SendError<NotifierItemMessage>>(())
+        });
+
+        Ok(Self {
+            tx,
+            b_tx,
+            _b_rx: b_rx,
+        })
+    }
+
+    pub fn subscribe(
+        &self,
+    ) -> (
+        mpsc::Sender<NotifierItemCommand>,
+        broadcast::Receiver<NotifierItemMessage>,
+    ) {
+        (self.tx.clone(), self.b_tx.subscribe())
+    }
+}
+
+lazy_static! {
+    static ref CLIENT: AsyncOnce<TrayEventReceiver> = AsyncOnce::new(async {
+        const MAX_RETRIES: i32 = 10;
+
+        // sometimes this can fail
+        let mut retries = 0;
+
+        let value = loop {
+            retries += 1;
+
+            let tray = TrayEventReceiver::new().await;
+
+            if tray.is_ok() || retries == MAX_RETRIES {
+                break tray;
+            }
+
+            debug!("Failed to create StatusNotifierWatcher (attempt {retries})");
+        };
+
+        value.expect("Failed to create StatusNotifierWatcher")
+    });
+}
+
+pub async fn get_tray_event_client() -> &'static TrayEventReceiver {
+    CLIENT.get().await
+}
--- a/src/clients/wayland/client.rs
+++ b/src/clients/wayland/client.rs
@@ -0,0 +1,129 @@
+use super::toplevel::{ToplevelEvent, ToplevelInfo};
+use super::toplevel_manager::listen_for_toplevels;
+use super::ToplevelChange;
+use super::{Env, ToplevelHandler};
+use color_eyre::Report;
+use indexmap::IndexMap;
+use smithay_client_toolkit::environment::Environment;
+use smithay_client_toolkit::output::{with_output_info, OutputInfo};
+use smithay_client_toolkit::reexports::calloop;
+use smithay_client_toolkit::{new_default_environment, WaylandSource};
+use std::sync::{Arc, RwLock};
+use std::time::Duration;
+use tokio::sync::{broadcast, oneshot};
+use tokio::task::spawn_blocking;
+use tracing::{error, trace};
+use wayland_client::protocol::wl_seat::WlSeat;
+use wayland_protocols::wlr::unstable::foreign_toplevel::v1::client::{
+    zwlr_foreign_toplevel_handle_v1::ZwlrForeignToplevelHandleV1,
+    zwlr_foreign_toplevel_manager_v1::ZwlrForeignToplevelManagerV1,
+};
+
+pub struct WaylandClient {
+    pub outputs: Vec<OutputInfo>,
+    pub seats: Vec<WlSeat>,
+    pub toplevels: Arc<RwLock<IndexMap<usize, (ToplevelInfo, ZwlrForeignToplevelHandleV1)>>>,
+    toplevel_tx: broadcast::Sender<ToplevelEvent>,
+    _toplevel_rx: broadcast::Receiver<ToplevelEvent>,
+}
+
+impl WaylandClient {
+    pub(super) async fn new() -> Self {
+        let (output_tx, output_rx) = oneshot::channel();
+        let (seat_tx, seat_rx) = oneshot::channel();
+
+        let (toplevel_tx, toplevel_rx) = broadcast::channel(32);
+
+        let toplevel_tx2 = toplevel_tx.clone();
+
+        let toplevels = Arc::new(RwLock::new(IndexMap::new()));
+        let toplevels2 = toplevels.clone();
+
+        // `queue` is not send so we need to handle everything inside the task
+        spawn_blocking(move || {
+            let (env, _display, queue) =
+                new_default_environment!(Env, fields = [toplevel: ToplevelHandler::init()])
+                    .expect("Failed to connect to Wayland compositor");
+
+            let outputs = Self::get_outputs(&env);
+            output_tx
+                .send(outputs)
+                .expect("Failed to send outputs out of task");
+
+            let seats = env.get_all_seats();
+            seat_tx
+                .send(
+                    seats
+                        .into_iter()
+                        .map(|seat| seat.detach())
+                        .collect::<Vec<WlSeat>>(),
+                )
+                .expect("Failed to send seats out of task");
+
+            let _toplevel_manager = env.require_global::<ZwlrForeignToplevelManagerV1>();
+
+            let _listener = listen_for_toplevels(env, move |handle, event, _ddata| {
+                trace!("Received toplevel event: {:?}", event);
+
+                if event.change == ToplevelChange::Close {
+                    toplevels2
+                        .write()
+                        .expect("Failed to get write lock on toplevels")
+                        .remove(&event.toplevel.id);
+                } else {
+                    toplevels2
+                        .write()
+                        .expect("Failed to get write lock on toplevels")
+                        .insert(event.toplevel.id, (event.toplevel.clone(), handle));
+                }
+
+                toplevel_tx2
+                    .send(event)
+                    .expect("Failed to send toplevel event");
+            });
+
+            let mut event_loop =
+                calloop::EventLoop::<()>::try_new().expect("Failed to create new event loop");
+            WaylandSource::new(queue)
+                .quick_insert(event_loop.handle())
+                .expect("Failed to insert event loop into wayland event queue");
+
+            loop {
+                // TODO: Avoid need for duration here - can we force some event when sending requests?
+                if let Err(err) = event_loop.dispatch(Duration::from_millis(50), &mut ()) {
+                    error!(
+                        "{:?}",
+                        Report::new(err).wrap_err("Failed to dispatch pending wayland events")
+                    );
+                }
+            }
+        });
+
+        let outputs = output_rx
+            .await
+            .expect("Failed to receive outputs from task");
+
+        let seats = seat_rx.await.expect("Failed to receive seats from task");
+
+        Self {
+            outputs,
+            seats,
+            toplevels,
+            toplevel_tx,
+            _toplevel_rx: toplevel_rx,
+        }
+    }
+
+    pub fn subscribe_toplevels(&self) -> broadcast::Receiver<ToplevelEvent> {
+        self.toplevel_tx.subscribe()
+    }
+
+    fn get_outputs(env: &Environment<Env>) -> Vec<OutputInfo> {
+        let outputs = env.get_all_outputs();
+
+        outputs
+            .iter()
+            .filter_map(|output| with_output_info(output, Clone::clone))
+            .collect()
+    }
+}
--- a/src/clients/wayland/mod.rs
+++ b/src/clients/wayland/mod.rs
@@ -0,0 +1,53 @@
+mod client;
+mod toplevel;
+mod toplevel_manager;
+
+extern crate smithay_client_toolkit as sctk;
+
+use async_once::AsyncOnce;
+use lazy_static::lazy_static;
+pub use toplevel::{ToplevelChange, ToplevelEvent, ToplevelInfo};
+use toplevel_manager::{ToplevelHandler, ToplevelHandling, ToplevelStatusListener};
+use wayland_client::{Attached, DispatchData, Interface};
+use wayland_protocols::wlr::unstable::foreign_toplevel::v1::client::{
+    zwlr_foreign_toplevel_handle_v1::ZwlrForeignToplevelHandleV1,
+    zwlr_foreign_toplevel_manager_v1::ZwlrForeignToplevelManagerV1,
+};
+
+pub use client::WaylandClient;
+
+/// A utility for lazy-loading globals.
+/// Taken from `smithay_client_toolkit` where it's not exposed
+#[derive(Debug)]
+enum LazyGlobal<I: Interface> {
+    Unknown,
+    Seen { id: u32, version: u32 },
+    Bound(Attached<I>),
+}
+
+sctk::default_environment!(Env,
+    fields = [
+        toplevel: ToplevelHandler
+    ],
+    singles = [
+        ZwlrForeignToplevelManagerV1 => toplevel
+    ],
+);
+
+impl ToplevelHandling for Env {
+    fn listen<F>(&mut self, f: F) -> ToplevelStatusListener
+    where
+        F: FnMut(ZwlrForeignToplevelHandleV1, ToplevelEvent, DispatchData) + 'static,
+    {
+        self.toplevel.listen(f)
+    }
+}
+
+lazy_static! {
+    static ref CLIENT: AsyncOnce<WaylandClient> =
+        AsyncOnce::new(async { WaylandClient::new().await });
+}
+
+pub async fn get_client() -> &'static WaylandClient {
+    CLIENT.get().await
+}
--- a/src/clients/wayland/toplevel.rs
+++ b/src/clients/wayland/toplevel.rs
@@ -0,0 +1,151 @@
+use std::collections::HashSet;
+use std::sync::{Arc, RwLock};
+use std::sync::atomic::{AtomicUsize, Ordering};
+use tracing::trace;
+use wayland_client::{DispatchData, Main};
+use wayland_protocols::wlr::unstable::foreign_toplevel::v1::client::zwlr_foreign_toplevel_handle_v1::{Event, ZwlrForeignToplevelHandleV1};
+
+const STATE_ACTIVE: u32 = 2;
+const STATE_FULLSCREEN: u32 = 3;
+
+static COUNTER: AtomicUsize = AtomicUsize::new(1);
+fn get_id() -> usize {
+    COUNTER.fetch_add(1, Ordering::Relaxed)
+}
+
+#[derive(Debug, Clone, Default)]
+pub struct ToplevelInfo {
+    pub id: usize,
+    pub app_id: String,
+    pub title: String,
+    pub active: bool,
+    pub fullscreen: bool,
+
+    ready: bool,
+}
+
+impl ToplevelInfo {
+    fn new() -> Self {
+        let id = get_id();
+        Self {
+            id,
+            ..Default::default()
+        }
+    }
+}
+
+pub struct Toplevel;
+
+#[derive(Debug, Clone)]
+pub struct ToplevelEvent {
+    pub toplevel: ToplevelInfo,
+    pub change: ToplevelChange,
+}
+
+#[derive(Debug, Clone, PartialEq, Eq)]
+pub enum ToplevelChange {
+    New,
+    Close,
+    Title(String),
+    Focus(bool),
+    Fullscreen(bool),
+}
+
+fn toplevel_implem<F>(event: Event, info: &mut ToplevelInfo, implem: &mut F, ddata: DispatchData)
+where
+    F: FnMut(ToplevelEvent, DispatchData),
+{
+    trace!("event: {event:?} (info: {info:?})");
+
+    let change = match event {
+        Event::AppId { app_id } => {
+            info.app_id = app_id;
+            None
+        }
+        Event::Title { title } => {
+            info.title = title.clone();
+
+            if info.ready {
+                Some(ToplevelChange::Title(title))
+            } else {
+                None
+            }
+        }
+        Event::State { state } => {
+            // state is received as a `Vec<u8>` where every 4 bytes make up a `u32`
+            // the u32 then represents a value in the `State` enum.
+            assert_eq!(state.len() % 4, 0);
+
+            let state = (0..state.len() / 4)
+                .map(|i| {
+                    let slice: [u8; 4] = state[i * 4..i * 4 + 4]
+                        .try_into()
+                        .expect("Received invalid state length");
+                    u32::from_le_bytes(slice)
+                })
+                .collect::<HashSet<_>>();
+
+            let new_active = state.contains(&STATE_ACTIVE);
+            let new_fullscreen = state.contains(&STATE_FULLSCREEN);
+
+            let change = if info.ready && new_active != info.active {
+                Some(ToplevelChange::Focus(new_active))
+            } else if info.ready && new_fullscreen != info.fullscreen {
+                Some(ToplevelChange::Fullscreen(new_fullscreen))
+            } else {
+                None
+            };
+
+            info.active = new_active;
+            info.fullscreen = new_fullscreen;
+
+            change
+        }
+        Event::Closed => {
+            if info.ready {
+                Some(ToplevelChange::Close)
+            } else {
+                None
+            }
+        }
+        Event::OutputEnter { output: _ } => None,
+        Event::OutputLeave { output: _ } => None,
+        Event::Parent { parent: _ } => None,
+        Event::Done => {
+            if info.ready || info.app_id.is_empty() {
+                None
+            } else {
+                info.ready = true;
+                Some(ToplevelChange::New)
+            }
+        }
+        _ => unreachable!(),
+    };
+
+    if let Some(change) = change {
+        let event = ToplevelEvent {
+            change,
+            toplevel: info.clone(),
+        };
+
+        implem(event, ddata);
+    }
+}
+
+impl Toplevel {
+    pub fn init<F>(handle: &Main<ZwlrForeignToplevelHandleV1>, mut callback: F) -> Self
+    where
+        F: FnMut(ToplevelEvent, DispatchData) + 'static,
+    {
+        let inner = Arc::new(RwLock::new(ToplevelInfo::new()));
+
+        handle.quick_assign(move |_handle, event, ddata| {
+            let mut inner = inner
+                .write()
+                .expect("Failed to get write lock on toplevel inner state");
+            toplevel_implem(event, &mut inner, &mut callback, ddata);
+        });
+
+        Self
+    }
+}
--- a/src/clients/wayland/toplevel_manager.rs
+++ b/src/clients/wayland/toplevel_manager.rs
@@ -0,0 +1,164 @@
+use super::toplevel::{Toplevel, ToplevelEvent};
+use super::LazyGlobal;
+use smithay_client_toolkit::environment::{Environment, GlobalHandler};
+use std::cell::RefCell;
+use std::rc;
+use std::rc::Rc;
+use tracing::warn;
+use wayland_client::protocol::wl_registry::WlRegistry;
+use wayland_client::{Attached, DispatchData};
+use wayland_protocols::wlr::unstable::foreign_toplevel::v1::client::{
+    zwlr_foreign_toplevel_handle_v1::ZwlrForeignToplevelHandleV1,
+    zwlr_foreign_toplevel_manager_v1::{self, ZwlrForeignToplevelManagerV1},
+};
+
+struct ToplevelHandlerInner {
+    manager: LazyGlobal<ZwlrForeignToplevelManagerV1>,
+    registry: Option<Attached<WlRegistry>>,
+    toplevels: Vec<Toplevel>,
+}
+
+impl ToplevelHandlerInner {
+    const fn new() -> Self {
+        let toplevels = vec![];
+
+        Self {
+            registry: None,
+            manager: LazyGlobal::Unknown,
+            toplevels,
+        }
+    }
+}
+
+pub struct ToplevelHandler {
+    inner: Rc<RefCell<ToplevelHandlerInner>>,
+    status_listeners: Rc<RefCell<Vec<rc::Weak<RefCell<ToplevelStatusCallback>>>>>,
+}
+
+impl ToplevelHandler {
+    pub fn init() -> Self {
+        let inner = Rc::new(RefCell::new(ToplevelHandlerInner::new()));
+
+        Self {
+            inner,
+            status_listeners: Rc::new(RefCell::new(Vec::new())),
+        }
+    }
+}
+
+impl GlobalHandler<ZwlrForeignToplevelManagerV1> for ToplevelHandler {
+    fn created(
+        &mut self,
+        registry: Attached<WlRegistry>,
+        id: u32,
+        version: u32,
+        _ddata: DispatchData,
+    ) {
+        let mut inner = RefCell::borrow_mut(&self.inner);
+        if inner.registry.is_none() {
+            inner.registry = Some(registry);
+        }
+        if let LazyGlobal::Unknown = inner.manager {
+            inner.manager = LazyGlobal::Seen { id, version }
+        } else {
+            warn!(
+                "Compositor advertised zwlr_foreign_toplevel_manager_v1 multiple times, ignoring."
+            );
+        }
+    }
+
+    fn get(&self) -> Option<Attached<ZwlrForeignToplevelManagerV1>> {
+        let mut inner = RefCell::borrow_mut(&self.inner);
+
+        match inner.manager {
+            LazyGlobal::Bound(ref mgr) => Some(mgr.clone()),
+            LazyGlobal::Unknown => None,
+            LazyGlobal::Seen { id, version } => {
+                let registry = inner.registry.as_ref().expect("Failed to get registry");
+                // current max protocol version = 3
+                let version = std::cmp::min(version, 3);
+                let manager = registry.bind::<ZwlrForeignToplevelManagerV1>(version, id);
+
+                {
+                    let inner = self.inner.clone();
+                    let status_listeners = self.status_listeners.clone();
+
+                    manager.quick_assign(move |_, event, _ddata| {
+                        let mut inner = RefCell::borrow_mut(&inner);
+                        let status_listeners = status_listeners.clone();
+
+                        match event {
+                            zwlr_foreign_toplevel_manager_v1::Event::Toplevel {
+                                toplevel: handle,
+                            } => {
+                                let toplevel =
+                                    Toplevel::init(&handle.clone(), move |event, ddata| {
+                                        notify_status_listeners(
+                                            &handle,
+                                            &event,
+                                            ddata,
+                                            &status_listeners,
+                                        );
+                                    });
+
+                                inner.toplevels.push(toplevel);
+                            }
+                            zwlr_foreign_toplevel_manager_v1::Event::Finished => {}
+                            _ => unreachable!(),
+                        }
+                    });
+                }
+
+                inner.manager = LazyGlobal::Bound((*manager).clone());
+                Some((*manager).clone())
+            }
+        }
+    }
+}
+
+type ToplevelStatusCallback =
+    dyn FnMut(ZwlrForeignToplevelHandleV1, ToplevelEvent, DispatchData) + 'static;
+
+/// Notifies the callbacks of an event on the toplevel
+fn notify_status_listeners(
+    toplevel: &ZwlrForeignToplevelHandleV1,
+    event: &ToplevelEvent,
+    mut ddata: DispatchData,
+    listeners: &RefCell<Vec<rc::Weak<RefCell<ToplevelStatusCallback>>>>,
+) {
+    listeners.borrow_mut().retain(|lst| {
+        rc::Weak::upgrade(lst).map_or(false, |cb| {
+            (cb.borrow_mut())(toplevel.clone(), event.clone(), ddata.reborrow());
+            true
+        })
+    });
+}
+
+pub struct ToplevelStatusListener {
+    _cb: Rc<RefCell<ToplevelStatusCallback>>,
+}
+
+pub trait ToplevelHandling {
+    fn listen<F>(&mut self, f: F) -> ToplevelStatusListener
+    where
+        F: FnMut(ZwlrForeignToplevelHandleV1, ToplevelEvent, DispatchData) + 'static;
+}
+
+impl ToplevelHandling for ToplevelHandler {
+    fn listen<F>(&mut self, f: F) -> ToplevelStatusListener
+    where
+        F: FnMut(ZwlrForeignToplevelHandleV1, ToplevelEvent, DispatchData) + 'static,
+    {
+        let rc = Rc::new(RefCell::new(f)) as Rc<_>;
+        self.status_listeners.borrow_mut().push(Rc::downgrade(&rc));
+        ToplevelStatusListener { _cb: rc }
+    }
+}
+
+pub fn listen_for_toplevels<E, F>(env: Environment<E>, f: F) -> ToplevelStatusListener
+where
+    E: ToplevelHandling,
+    F: FnMut(ZwlrForeignToplevelHandleV1, ToplevelEvent, DispatchData) + 'static,
+{
+    env.with_inner(move |inner| ToplevelHandling::listen(inner, f))
+}
--- a/src/collection.rs
+++ b/src/collection.rs
@@ -1,146 +0,0 @@
-use serde::Serialize;
-use std::slice::{Iter, IterMut};
-
-/// An ordered map.
-/// Internally this is just two vectors -
-/// one for keys and one for values.
-#[derive(Debug, Clone, Serialize)]
-pub struct Collection<TKey, TData> {
-    keys: Vec<TKey>,
-    values: Vec<TData>,
-}
-
-impl<TKey: PartialEq, TData> Collection<TKey, TData> {
-    /// Creates a new empty collection.
-    pub const fn new() -> Self {
-        Self {
-            keys: vec![],
-            values: vec![],
-        }
-    }
-
-    /// Inserts a new key/value pair at the end of the collection.
-    pub fn insert(&mut self, key: TKey, value: TData) {
-        self.keys.push(key);
-        self.values.push(value);
-
-        assert_eq!(self.keys.len(), self.values.len());
-    }
-
-    /// Gets a reference of the value for the specified key
-    /// if it exists in the collection.
-    pub fn get(&self, key: &TKey) -> Option<&TData> {
-        let index = self.keys.iter().position(|k| k == key);
-        match index {
-            Some(index) => self.values.get(index),
-            None => None,
-        }
-    }
-
-    /// Gets a mutable reference for the value with the specified key
-    /// if it exists in the collection.
-    pub fn get_mut(&mut self, key: &TKey) -> Option<&mut TData> {
-        let index = self.keys.iter().position(|k| k == key);
-        match index {
-            Some(index) => self.values.get_mut(index),
-            None => None,
-        }
-    }
-
-    /// Removes the key/value from the collection
-    /// if it exists
-    /// and returns the removed value.
-    pub fn remove(&mut self, key: &TKey) -> Option<TData> {
-        assert_eq!(self.keys.len(), self.values.len());
-
-        let index = self.keys.iter().position(|k| k == key);
-        if let Some(index) = index {
-            self.keys.remove(index);
-            Some(self.values.remove(index))
-        } else {
-            None
-        }
-    }
-
-    /// Gets the length of the collection.
-    pub fn len(&self) -> usize {
-        self.keys.len()
-    }
-
-    /// Gets a reference to the first value in the collection.
-    pub fn first(&self) -> Option<&TData> {
-        self.values.first()
-    }
-
-    /// Gets the values as a slice.
-    pub fn as_slice(&self) -> &[TData] {
-        self.values.as_slice()
-    }
-
-    /// Checks whether the collection is empty.
-    pub fn is_empty(&self) -> bool {
-        self.keys.is_empty()
-    }
-
-    /// Gets an iterator for the collection.
-    pub fn iter(&self) -> Iter<'_, TData> {
-        self.values.iter()
-    }
-
-    /// Gets a mutable iterator for the collection
-    pub fn iter_mut(&mut self) -> IterMut<'_, TData> {
-        self.values.iter_mut()
-    }
-}
-
-impl<TKey: PartialEq, TData> From<(TKey, TData)> for Collection<TKey, TData> {
-    fn from((key, value): (TKey, TData)) -> Self {
-        let mut collection = Self::new();
-        collection.insert(key, value);
-        collection
-    }
-}
-
-impl<TKey: PartialEq, TData> FromIterator<(TKey, TData)> for Collection<TKey, TData> {
-    fn from_iter<T: IntoIterator<Item = (TKey, TData)>>(iter: T) -> Self {
-        let mut collection = Self::new();
-        for (key, value) in iter {
-            collection.insert(key, value);
-        }
-
-        collection
-    }
-}
-
-impl<'a, TKey: PartialEq, TData> IntoIterator for &'a Collection<TKey, TData> {
-    type Item = &'a TData;
-    type IntoIter = CollectionIntoIterator<'a, TKey, TData>;
-
-    fn into_iter(self) -> Self::IntoIter {
-        CollectionIntoIterator {
-            collection: self,
-            index: 0,
-        }
-    }
-}
-
-pub struct CollectionIntoIterator<'a, TKey, TData> {
-    collection: &'a Collection<TKey, TData>,
-    index: usize,
-}
-
-impl<'a, TKey: PartialEq, TData> Iterator for CollectionIntoIterator<'a, TKey, TData> {
-    type Item = &'a TData;
-
-    fn next(&mut self) -> Option<Self::Item> {
-        let res = self.collection.values.get(self.index);
-        self.index += 1;
-        res
-    }
-}
-
-impl<TKey: PartialEq, TData> Default for Collection<TKey, TData> {
-    fn default() -> Self {
-        Self::new()
-    }
-}
--- a/src/config.rs
+++ b/src/config.rs
@@ -1,4 +1,5 @@
 use crate::modules::clock::ClockModule;
+use crate::modules::custom::CustomModule;
 use crate::modules::focused::FocusedModule;
 use crate::modules::launcher::LauncherModule;
 use crate::modules::mpd::MpdModule;
@@ -6,17 +7,27 @@ use crate::modules::script::ScriptModule;
 use crate::modules::sysinfo::SysInfoModule;
 use crate::modules::tray::TrayModule;
 use crate::modules::workspaces::WorkspacesModule;
+use crate::script::ScriptInput;
 use color_eyre::eyre::{Context, ContextCompat};
 use color_eyre::{eyre, Help, Report};
 use dirs::config_dir;
 use eyre::Result;
+use gtk::Orientation;
 use serde::Deserialize;
 use std::collections::HashMap;
 use std::path::{Path, PathBuf};
 use std::{env, fs};
+use tracing::instrument;

 #[derive(Debug, Deserialize, Clone)]
-#[serde(tag = "type", rename_all = "kebab-case")]
+pub struct CommonConfig {
+    pub show_if: Option<ScriptInput>,
+    pub on_click: Option<ScriptInput>,
+    pub tooltip: Option<String>,
+}
+
+#[derive(Debug, Deserialize, Clone)]
+#[serde(tag = "type", rename_all = "snake_case")]
 pub enum ModuleConfig {
    Clock(ClockModule),
    Mpd(MpdModule),
@@ -26,6 +37,7 @@ pub enum ModuleConfig {
    Launcher(LauncherModule),
    Script(ScriptModule),
    Focused(FocusedModule),
+    Custom(CustomModule),
 }

 #[derive(Debug, Deserialize, Clone)]
@@ -35,11 +47,13 @@ pub enum MonitorConfig {
    Multiple(Vec<Config>),
 }

-#[derive(Debug, Deserialize, Clone, PartialEq, Eq)]
-#[serde(rename_all = "kebab-case")]
+#[derive(Debug, Deserialize, Copy, Clone, PartialEq, Eq)]
+#[serde(rename_all = "snake_case")]
 pub enum BarPosition {
    Top,
    Bottom,
+    Left,
+    Right,
 }

 impl Default for BarPosition {
@@ -48,16 +62,36 @@ impl Default for BarPosition {
    }
 }

-#[derive(Debug, Deserialize, Clone, Default)]
+impl BarPosition {
+    pub fn get_orientation(self) -> Orientation {
+        if self == Self::Top || self == Self::Bottom {
+            Orientation::Horizontal
+        } else {
+            Orientation::Vertical
+        }
+    }
+
+    pub const fn get_angle(self) -> f64 {
+        match self {
+            Self::Top | Self::Bottom => 0.0,
+            Self::Left => 90.0,
+            Self::Right => 270.0,
+        }
+    }
+}
+
+#[derive(Debug, Deserialize, Clone)]
 pub struct Config {
    #[serde(default = "default_bar_position")]
    pub position: BarPosition,
+    #[serde(default = "default_true")]
+    pub anchor_to_edges: bool,
    #[serde(default = "default_bar_height")]
    pub height: i32,

-    pub left: Option<Vec<ModuleConfig>>,
+    pub start: Option<Vec<ModuleConfig>>,
    pub center: Option<Vec<ModuleConfig>>,
-    pub right: Option<Vec<ModuleConfig>>,
+    pub end: Option<Vec<ModuleConfig>>,

    pub monitors: Option<HashMap<String, MonitorConfig>>,
 }
@@ -73,18 +107,23 @@ const fn default_bar_height() -> i32 {
 impl Config {
    /// Attempts to load the config file from file,
    /// parse it and return a new instance of `Self`.
+    #[instrument]
    pub fn load() -> Result<Self> {
-        let config_path = if let Ok(config_path) = env::var("IRONBAR_CONFIG") {
-            let path = PathBuf::from(config_path);
-            if path.exists() {
-                Ok(path)
-            } else {
-                Err(Report::msg("Specified config file does not exist")
+        let config_path = env::var("IRONBAR_CONFIG").map_or_else(
+            |_| Self::try_find_config(),
+            |config_path| {
+                let path = PathBuf::from(config_path);
+                if path.exists() {
+                    Ok(path)
+                } else {
+                    Err(Report::msg(format!(
+                        "Specified config file does not exist: {}",
+                        path.display()
+                    ))
                    .note("Config file was specified using `IRONBAR_CONFIG` environment variable"))
-            }
-        } else {
-            Self::try_find_config()
-        }?;
+                }
+            },
+        )?;

        Self::load_file(&config_path)
    }
@@ -93,6 +132,7 @@ impl Config {
    /// by checking each valid format's extension.
    ///
    /// Returns the path of the first valid match, if any.
+    #[instrument]
    fn try_find_config() -> Result<PathBuf> {
        let config_dir = config_dir().wrap_err("Failed to locate user config dir")?;

@@ -110,10 +150,15 @@ impl Config {
            }
        });

-        match file {
-            Some(file) => Ok(file),
-            None => Err(Report::msg("Could not find config file")),
-        }
+        file.map_or_else(
+            || {
+                Err(Report::msg("Could not find config file")
+                    .suggestion("Ironbar does not include a configuration out of the box")
+                    .suggestion("A guide on writing a config can be found on the wiki:")
+                    .suggestion("https://github.com/JakeStanger/ironbar/wiki/configuration-guide"))
+            },
+            Ok,
+        )
    }

    /// Loads the config file at the specified path
@@ -130,14 +175,7 @@ impl Config {
            "json" => serde_json::from_slice(&file).wrap_err("Invalid JSON config"),
            "toml" => toml::from_slice(&file).wrap_err("Invalid TOML config"),
            "yaml" | "yml" => serde_yaml::from_slice(&file).wrap_err("Invalid YAML config"),
-            "corn" => {
-                // corn doesn't support deserialization yet
-                // so serialize the interpreted result then deserialize that
-                let file =
-                    String::from_utf8(file).wrap_err("Config file contains invalid UTF-8")?;
-                let config = cornfig::parse(&file).wrap_err("Invalid corn config")?.value;
-                Ok(serde_json::from_str(&serde_json::to_string(&config)?)?)
-            }
+            "corn" => libcorn::from_slice(&file).wrap_err("Invalid Corn config"),
            _ => unreachable!(),
        }
    }
--- a/src/dynamic_string.rs
+++ b/src/dynamic_string.rs
@@ -0,0 +1,143 @@
+use crate::script::{OutputStream, Script};
+use gtk::prelude::*;
+use indexmap::IndexMap;
+use std::sync::{Arc, Mutex};
+use tokio::spawn;
+
+#[derive(Debug)]
+enum DynamicStringSegment {
+    Static(String),
+    Dynamic(Script),
+}
+
+pub struct DynamicString {
+    // pub label: gtk::Label,
+}
+
+impl DynamicString {
+    pub fn new<F>(input: &str, f: F) -> Self
+    where
+        F: FnMut(String) -> Continue + 'static,
+    {
+        let mut segments = vec![];
+
+        let mut chars = input.chars().collect::<Vec<_>>();
+        while !chars.is_empty() {
+            let char = &chars[..=1];
+
+            let (token, skip) = if let ['{', '{'] = char {
+                const SKIP_BRACKETS: usize = 4;
+
+                let str = chars
+                    .iter()
+                    .skip(2)
+                    .enumerate()
+                    .take_while(|(i, &c)| c != '}' && chars[i + 1] != '}')
+                    .map(|(_, c)| c)
+                    .collect::<String>();
+
+                let len = str.len();
+
+                (
+                    DynamicStringSegment::Dynamic(Script::from(str.as_str())),
+                    len + SKIP_BRACKETS,
+                )
+            } else {
+                let str = chars
+                    .iter()
+                    .enumerate()
+                    .take_while(|(i, &c)| !(c == '{' && chars[i + 1] == '{'))
+                    .map(|(_, c)| c)
+                    .collect::<String>();
+
+                let len = str.len();
+
+                (DynamicStringSegment::Static(str), len)
+            };
+
+            assert_ne!(skip, 0);
+
+            segments.push(token);
+            chars.drain(..skip);
+        }
+
+        let label_parts = Arc::new(Mutex::new(IndexMap::new()));
+        let (tx, rx) = glib::MainContext::channel(glib::PRIORITY_DEFAULT);
+
+        for (i, segment) in segments.into_iter().enumerate() {
+            match segment {
+                DynamicStringSegment::Static(str) => {
+                    label_parts
+                        .lock()
+                        .expect("Failed to get lock on label parts")
+                        .insert(i, str);
+                }
+                DynamicStringSegment::Dynamic(script) => {
+                    let tx = tx.clone();
+                    let label_parts = label_parts.clone();
+
+                    spawn(async move {
+                        script
+                            .run(|(out, _)| {
+                                if let OutputStream::Stdout(out) = out {
+                                    let mut label_parts = label_parts
+                                        .lock()
+                                        .expect("Failed to get lock on label parts");
+
+                                    label_parts
+                                        // .lock()
+                                        // .expect("Failed to get lock on label parts")
+                                        .insert(i, out);
+
+                                    let string = label_parts
+                                        .iter()
+                                        .map(|(_, part)| part.as_str())
+                                        .collect::<String>();
+
+                                    tx.send(string).expect("Failed to send update");
+                                }
+                            })
+                            .await;
+                    });
+                }
+            }
+        }
+
+        // initialize
+        {
+            let label_parts = label_parts
+                .lock()
+                .expect("Failed to get lock on label parts")
+                .iter()
+                .map(|(_, part)| part.as_str())
+                .collect::<String>();
+
+            tx.send(label_parts).expect("Failed to send update");
+        }
+
+        rx.attach(None, f);
+
+        // Self { label }
+        Self {}
+    }
+}
+
+#[cfg(test)]
+mod tests {
+    use super::*;
+
+    #[tokio::test]
+    async fn test() {
+        // TODO: see if we can run gtk tests in ci
+        if gtk::init().is_ok() {
+            let label = gtk::Label::new(None);
+            DynamicString::new(
+                "Uptime: {{1000:uptime -p | cut -d ' ' -f2-}}",
+                move |string| {
+                    label.set_label(&string);
+                    Continue(true)
+                },
+            );
+        }
+    }
+}
--- a/src/icon.rs
+++ b/src/icon.rs
@@ -68,17 +68,12 @@ fn parse_desktop_file(path: PathBuf) -> io::Result<HashMap<String, String>> {

 /// Attempts to get the icon name from the app's `.desktop` file.
 fn get_desktop_icon_name(app_id: &str) -> Option<String> {
-    match find_desktop_file(app_id) {
-        Some(file) => {
-            let map = parse_desktop_file(file);
-
-            match map {
-                Ok(map) => map.get("Icon").map(std::string::ToString::to_string),
-                Err(_) => None,
-            }
-        }
-        None => None,
-    }
+    find_desktop_file(app_id).and_then(|file| {
+        let map = parse_desktop_file(file);
+        map.map_or(None, |map| {
+            map.get("Icon").map(std::string::ToString::to_string)
+        })
+    })
 }

 enum IconLocation {
@@ -137,11 +132,7 @@ pub fn get_icon(theme: &IconTheme, app_id: &str, size: i32) -> Option<Pixbuf> {
    match icon_location {
        Some(IconLocation::Theme(icon_name)) => {
            let icon = theme.load_icon(&icon_name, size, IconLookupFlags::FORCE_SIZE);
-
-            match icon {
-                Ok(icon) => icon,
-                Err(_) => None,
-            }
+            icon.map_or(None, |icon| icon)
        }
        Some(IconLocation::File(path)) => Pixbuf::from_file_at_scale(path, size, size, true).ok(),
        None => None,
--- a/src/logging.rs
+++ b/src/logging.rs
@@ -31,10 +31,15 @@ impl<'a> MakeWriter<'a> for MakeFileWriter {
 /// The returned `WorkerGuard` must remain in scope
 /// for the lifetime of the application for logging to file to work.
 pub fn install_tracing() -> Result<WorkerGuard> {
+    const DEFAULT_LOG: &str = "info";
+    const DEFAULT_FILE_LOG: &str = "warn";
+
    let fmt_layer = fmt::layer().with_target(true);
-    let filter_layer = EnvFilter::try_from_default_env().or_else(|_| EnvFilter::try_new("info"))?;
-    let file_filter_layer =
-        EnvFilter::try_from_default_env().or_else(|_| EnvFilter::try_new("warn"))?;
+    let filter_layer =
+        EnvFilter::try_from_env("IRONBAR_LOG").or_else(|_| EnvFilter::try_new(DEFAULT_LOG))?;
+
+    let file_filter_layer = EnvFilter::try_from_env("IRONBAR_FILE_LOG")
+        .or_else(|_| EnvFilter::try_new(DEFAULT_FILE_LOG))?;

    let log_path = data_dir().unwrap_or(env::current_dir()?).join("ironbar");

--- a/src/main.rs
+++ b/src/main.rs
@@ -1,32 +1,44 @@
 mod bar;
-mod collection;
+mod bridge_channel;
+mod clients;
 mod config;
+mod dynamic_string;
 mod icon;
 mod logging;
 mod modules;
 mod popup;
+mod script;
 mod style;
-mod sway;

 use crate::bar::create_bar;
 use crate::config::{Config, MonitorConfig};
 use crate::style::load_css;
-use crate::sway::{get_client, SwayOutput};
 use color_eyre::eyre::Result;
 use color_eyre::Report;
 use dirs::config_dir;
 use gtk::gdk::Display;
 use gtk::prelude::*;
 use gtk::Application;
-use ksway::IpcCommand;
-use std::env;
+use std::future::Future;
+use std::path::PathBuf;
 use std::process::exit;
+use std::{env, panic};
+use tokio::runtime::Handle;
+use tokio::task::block_in_place;

 use crate::logging::install_tracing;
+use clients::wayland::{self, WaylandClient};
 use tracing::{debug, error, info};

 const VERSION: &str = env!("CARGO_PKG_VERSION");

+#[repr(i32)]
+enum ErrorCode {
+    GtkDisplay = 1,
+    CreateBars = 2,
+    Config = 3,
+}
+
 #[tokio::main]
 async fn main() -> Result<()> {
    // Disable backtraces by default
@@ -38,53 +50,67 @@ async fn main() -> Result<()> {
    // otherwise file logging drops
    let _guard = install_tracing()?;

-    color_eyre::install()?;
+    let hook_builder = color_eyre::config::HookBuilder::default();
+    let (panic_hook, eyre_hook) = hook_builder.into_hooks();
+
+    eyre_hook.install()?;
+
+    // custom hook allows tracing_appender to capture panics
+    panic::set_hook(Box::new(move |panic_info| {
+        error!("{}", panic_hook.panic_report(panic_info));
+    }));

    info!("Ironbar version {}", VERSION);
    info!("Starting application");

+    let wayland_client = wayland::get_client().await;
+
    let app = Application::builder()
        .application_id("dev.jstanger.ironbar")
        .build();

    app.connect_activate(move |app| {
-        let display = match Display::default() {
-            Some(display) => display,
-            None => {
+        let display = Display::default().map_or_else(
+            || {
                let report = Report::msg("Failed to get default GTK display");
                error!("{:?}", report);
-                exit(1)
-            }
-        };
+                exit(ErrorCode::GtkDisplay as i32)
+            },
+            |display| display,
+        );

        let config = match Config::load() {
            Ok(config) => config,
            Err(err) => {
                error!("{:?}", err);
-                Config::default()
+                exit(ErrorCode::Config as i32)
            }
        };
        debug!("Loaded config file");

-        if let Err(err) = create_bars(app, &display, &config) {
+        if let Err(err) = create_bars(app, &display, wayland_client, &config) {
            error!("{:?}", err);
-            exit(2);
+            exit(ErrorCode::CreateBars as i32);
        }

        debug!("Created bars");

-        let style_path = match config_dir() {
-            Some(dir) => dir.join("ironbar").join("style.css"),
-            None => {
-                let report = Report::msg("Failed to locate user config dir");
-                error!("{:?}", report);
-                exit(3);
-            }
-        };
+        let style_path = env::var("IRONBAR_CSS").ok().map_or_else(
+            || {
+                config_dir().map_or_else(
+                    || {
+                        let report = Report::msg("Failed to locate user config dir");
+                        error!("{:?}", report);
+                        exit(ErrorCode::CreateBars as i32);
+                    },
+                    |dir| dir.join("ironbar").join("style.css"),
+                )
+            },
+            PathBuf::from,
+        );

        if style_path.exists() {
            load_css(style_path);
-            debug!("Loaded CSS watcher file");
        }
    });

@@ -96,42 +122,40 @@ async fn main() -> Result<()> {
 }

 /// Creates each of the bars across each of the (configured) outputs.
-fn create_bars(app: &Application, display: &Display, config: &Config) -> Result<()> {
-    let outputs = {
-        let sway = get_client();
-        let mut sway = sway.lock().expect("Failed to get lock on Sway IPC client");
+fn create_bars(
+    app: &Application,
+    display: &Display,
+    wl: &WaylandClient,
+    config: &Config,
+) -> Result<()> {
+    let outputs = wl.outputs.as_slice();

-        let outputs = sway.ipc(IpcCommand::GetOutputs);
-
-        match outputs {
-            Ok(outputs) => Ok(outputs),
-            Err(err) => Err(err),
-        }
-    }?;
-
-    let outputs = serde_json::from_slice::<Vec<SwayOutput>>(&outputs)?;
-
-    debug!("Received {} outputs from Sway IPC", outputs.len());
+    debug!("Received {} outputs from Wayland", outputs.len());
+    debug!("Outputs: {:?}", outputs);

    let num_monitors = display.n_monitors();

    for i in 0..num_monitors {
-        let monitor = display.monitor(i).ok_or_else(|| Report::msg("GTK and Sway are reporting a different number of outputs - this is a severe bug and should never happen"))?;
-        let monitor_name = &outputs.get(i as usize).ok_or_else(|| Report::msg("GTK and Sway are reporting a different set of outputs - this is a severe bug and should never happen"))?.name;
+        let monitor = display.monitor(i).ok_or_else(|| Report::msg("GTK and Sway are reporting a different set of outputs - this is a severe bug and should never happen"))?;
+        let output = outputs.get(i as usize).ok_or_else(|| Report::msg("GTK and Sway are reporting a different set of outputs - this is a severe bug and should never happen"))?;
+        let monitor_name = &output.name;

-        info!("Creating bar on '{}'", monitor_name);
-
-        // TODO: Could we use an Arc<Config> here to avoid cloning?
+        // TODO: Could we use an Arc<Config> or `Cow<Config>` here to avoid cloning?
        config.monitors.as_ref().map_or_else(
-            || create_bar(app, &monitor, monitor_name, config.clone()),
+            || {
+                info!("Creating bar on '{}'", monitor_name);
+                create_bar(app, &monitor, monitor_name, config.clone())
+            },
            |config| {
                let config = config.get(monitor_name);
                match &config {
                    Some(MonitorConfig::Single(config)) => {
+                        info!("Creating bar on '{}'", monitor_name);
                        create_bar(app, &monitor, monitor_name, config.clone())
                    }
                    Some(MonitorConfig::Multiple(configs)) => {
                        for config in configs {
+                            info!("Creating bar on '{}'", monitor_name);
                            create_bar(app, &monitor, monitor_name, config.clone())?;
                        }

@@ -145,3 +169,15 @@ fn create_bars(app: &Application, display: &Display, config: &Config) -> Result<

    Ok(())
 }
+
+/// Blocks on a `Future` until it resolves.
+///
+/// This is not an `async` operation
+/// so can be used outside of an async function.
+///
+/// Do note it must be called from within a Tokio runtime still.
+///
+/// Use sparingly! Prefer async functions wherever possible.
+pub fn await_sync<F: Future>(f: F) -> F::Output {
+    block_in_place(|| Handle::current().block_on(f))
+}
--- a/src/modules/clock.rs
+++ b/src/modules/clock.rs
@@ -0,0 +1,124 @@
+use crate::config::CommonConfig;
+use crate::modules::{Module, ModuleInfo, ModuleUpdateEvent, ModuleWidget, WidgetContext};
+use crate::popup::Popup;
+use chrono::{DateTime, Local};
+use color_eyre::Result;
+use glib::Continue;
+use gtk::prelude::*;
+use gtk::{Align, Button, Calendar, Label, Orientation};
+use serde::Deserialize;
+use tokio::spawn;
+use tokio::sync::mpsc;
+use tokio::time::sleep;
+
+#[derive(Debug, Deserialize, Clone)]
+pub struct ClockModule {
+    /// Date/time format string.
+    /// Default: `%d/%m/%Y %H:%M`
+    ///
+    /// Detail on available tokens can be found here:
+    /// <https://docs.rs/chrono/latest/chrono/format/strftime/index.html>
+    #[serde(default = "default_format")]
+    format: String,
+
+    #[serde(flatten)]
+    pub common: CommonConfig,
+}
+
+fn default_format() -> String {
+    String::from("%d/%m/%Y %H:%M")
+}
+
+impl Module<Button> for ClockModule {
+    type SendMessage = DateTime<Local>;
+    type ReceiveMessage = ();
+
+    fn spawn_controller(
+        &self,
+        _info: &ModuleInfo,
+        tx: mpsc::Sender<ModuleUpdateEvent<Self::SendMessage>>,
+        _rx: mpsc::Receiver<Self::ReceiveMessage>,
+    ) -> Result<()> {
+        spawn(async move {
+            loop {
+                let date = Local::now();
+                tx.send(ModuleUpdateEvent::Update(date))
+                    .await
+                    .expect("Failed to send date");
+                sleep(tokio::time::Duration::from_millis(500)).await;
+            }
+        });
+
+        Ok(())
+    }
+
+    fn into_widget(
+        self,
+        context: WidgetContext<Self::SendMessage, Self::ReceiveMessage>,
+        info: &ModuleInfo,
+    ) -> Result<ModuleWidget<Button>> {
+        let button = Button::new();
+        let label = Label::new(None);
+        label.set_angle(info.bar_position.get_angle());
+        button.add(&label);
+
+        let orientation = info.bar_position.get_orientation();
+        button.connect_clicked(move |button| {
+            context
+                .tx
+                .try_send(ModuleUpdateEvent::TogglePopup(Popup::button_pos(
+                    button,
+                    orientation,
+                )))
+                .expect("Failed to toggle popup");
+        });
+
+        let format = self.format.clone();
+        {
+            context.widget_rx.attach(None, move |date| {
+                let date_string = format!("{}", date.format(&format));
+                label.set_label(&date_string);
+                Continue(true)
+            });
+        }
+
+        let popup = self.into_popup(context.controller_tx, context.popup_rx);
+
+        Ok(ModuleWidget {
+            widget: button,
+            popup,
+        })
+    }
+
+    fn into_popup(
+        self,
+        _tx: mpsc::Sender<Self::ReceiveMessage>,
+        rx: glib::Receiver<Self::SendMessage>,
+    ) -> Option<gtk::Box> {
+        let container = gtk::Box::builder()
+            .orientation(Orientation::Vertical)
+            .name("popup-clock")
+            .build();
+
+        let clock = Label::builder()
+            .name("calendar-clock")
+            .halign(Align::Center)
+            .build();
+        let format = "%H:%M:%S";
+
+        container.add(&clock);
+
+        let calendar = Calendar::builder().name("calendar").build();
+        container.add(&calendar);
+
+        {
+            rx.attach(None, move |date| {
+                let date_string = format!("{}", date.format(format));
+                clock.set_label(&date_string);
+                Continue(true)
+            });
+        }
+
+        Some(container)
+    }
+}
--- a/src/modules/clock/mod.rs
+++ b/src/modules/clock/mod.rs
@@ -1,71 +0,0 @@
-mod popup;
-
-use self::popup::Popup;
-use crate::modules::{Module, ModuleInfo};
-use chrono::Local;
-use color_eyre::Result;
-use glib::Continue;
-use gtk::prelude::*;
-use gtk::{Button, Orientation};
-use serde::Deserialize;
-use tokio::spawn;
-use tokio::time::sleep;
-
-#[derive(Debug, Deserialize, Clone)]
-pub struct ClockModule {
-    /// Date/time format string.
-    /// Default: `%d/%m/%Y %H:%M`
-    ///
-    /// Detail on available tokens can be found here:
-    /// <https://docs.rs/chrono/latest/chrono/format/strftime/index.html>
-    #[serde(default = "default_format")]
-    pub(crate) format: String,
-}
-
-fn default_format() -> String {
-    String::from("%d/%m/%Y %H:%M")
-}
-
-impl Module<Button> for ClockModule {
-    fn into_widget(self, info: &ModuleInfo) -> Result<Button> {
-        let button = Button::new();
-
-        let popup = Popup::new(
-            "popup-clock",
-            info.app,
-            info.monitor,
-            Orientation::Vertical,
-            info.bar_position,
-        );
-        popup.add_clock_widgets();
-
-        button.show_all();
-
-        button.connect_clicked(move |button| {
-            popup.show(button);
-        });
-
-        let (tx, rx) = glib::MainContext::channel(glib::PRIORITY_DEFAULT);
-        spawn(async move {
-            let format = self.format.as_str();
-            loop {
-                let date = Local::now();
-                let date_string = format!("{}", date.format(format));
-
-                tx.send(date_string).expect("Failed to send date string");
-
-                sleep(tokio::time::Duration::from_millis(500)).await;
-            }
-        });
-
-        {
-            let button = button.clone();
-            rx.attach(None, move |s| {
-                button.set_label(s.as_str());
-                Continue(true)
-            });
-        }
-
-        Ok(button)
-    }
-}
--- a/src/modules/clock/popup.rs
+++ b/src/modules/clock/popup.rs
@@ -1,40 +0,0 @@
-pub use crate::popup::Popup;
-use chrono::Local;
-use gtk::prelude::*;
-use gtk::{Align, Calendar, Label};
-use tokio::spawn;
-use tokio::time::sleep;
-
-impl Popup {
-    pub fn add_clock_widgets(&self) {
-        let clock = Label::builder()
-            .name("calendar-clock")
-            .halign(Align::Center)
-            .build();
-        let format = "%H:%M:%S";
-
-        self.container.add(&clock);
-
-        let calendar = Calendar::builder().name("calendar").build();
-        self.container.add(&calendar);
-
-        let (tx, rx) = glib::MainContext::channel(glib::PRIORITY_DEFAULT);
-        spawn(async move {
-            loop {
-                let date = Local::now();
-                let date_string = format!("{}", date.format(format));
-
-                tx.send(date_string).expect("Failed to send date string");
-
-                sleep(tokio::time::Duration::from_millis(500)).await;
-            }
-        });
-
-        {
-            rx.attach(None, move |s| {
-                clock.set_label(s.as_str());
-                Continue(true)
-            });
-        }
-    }
-}
--- a/src/modules/custom.rs
+++ b/src/modules/custom.rs
@@ -0,0 +1,256 @@
+use crate::config::CommonConfig;
+use crate::dynamic_string::DynamicString;
+use crate::modules::{Module, ModuleInfo, ModuleUpdateEvent, ModuleWidget, WidgetContext};
+use crate::popup::{ButtonGeometry, Popup};
+use crate::script::Script;
+use color_eyre::{Report, Result};
+use gtk::prelude::*;
+use gtk::{Button, Label, Orientation};
+use serde::Deserialize;
+use tokio::spawn;
+use tokio::sync::mpsc::{Receiver, Sender};
+use tracing::{debug, error};
+
+#[derive(Debug, Deserialize, Clone)]
+pub struct CustomModule {
+    /// Container class name
+    class: Option<String>,
+    /// Widgets to add to the bar container
+    bar: Vec<Widget>,
+    /// Widgets to add to the popup container
+    popup: Option<Vec<Widget>>,
+
+    #[serde(flatten)]
+    pub common: CommonConfig,
+}
+
+/// Attempts to parse an `Orientation` from `String`
+fn try_get_orientation(orientation: &str) -> Result<Orientation> {
+    match orientation.to_lowercase().as_str() {
+        "horizontal" | "h" => Ok(Orientation::Horizontal),
+        "vertical" | "v" => Ok(Orientation::Vertical),
+        _ => Err(Report::msg("Invalid orientation string in config")),
+    }
+}
+
+/// Widget attributes
+#[derive(Debug, Deserialize, Clone)]
+pub struct Widget {
+    /// Type of GTK widget to add
+    #[serde(rename = "type")]
+    widget_type: WidgetType,
+    widgets: Option<Vec<Widget>>,
+    label: Option<String>,
+    name: Option<String>,
+    class: Option<String>,
+    on_click: Option<String>,
+    orientation: Option<String>,
+}
+
+/// Supported GTK widget types
+#[derive(Debug, Deserialize, Clone)]
+#[serde(rename_all = "snake_case")]
+pub enum WidgetType {
+    Box,
+    Label,
+    Button,
+}
+
+impl Widget {
+    /// Creates this widget and adds it to the parent container
+    fn add_to(self, parent: &gtk::Box, tx: Sender<ExecEvent>, bar_orientation: Orientation) {
+        match self.widget_type {
+            WidgetType::Box => parent.add(&self.into_box(&tx, bar_orientation)),
+            WidgetType::Label => parent.add(&self.into_label()),
+            WidgetType::Button => parent.add(&self.into_button(tx, bar_orientation)),
+        }
+    }
+
+    /// Creates a `gtk::Box` from this widget
+    fn into_box(self, tx: &Sender<ExecEvent>, bar_orientation: Orientation) -> gtk::Box {
+        let mut builder = gtk::Box::builder();
+
+        if let Some(name) = self.name {
+            builder = builder.name(&name);
+        }
+
+        if let Some(orientation) = self.orientation {
+            builder = builder
+                .orientation(try_get_orientation(&orientation).unwrap_or(Orientation::Horizontal));
+        }
+
+        let container = builder.build();
+
+        if let Some(class) = self.class {
+            container.style_context().add_class(&class);
+        }
+
+        if let Some(widgets) = self.widgets {
+            widgets
+                .into_iter()
+                .for_each(|widget| widget.add_to(&container, tx.clone(), bar_orientation));
+        }
+
+        container
+    }
+
+    /// Creates a `gtk::Label` from this widget
+    fn into_label(self) -> Label {
+        let mut builder = Label::builder().use_markup(true);
+
+        if let Some(name) = self.name {
+            builder = builder.name(&name);
+        }
+
+        let label = builder.build();
+
+        if let Some(class) = self.class {
+            label.style_context().add_class(&class);
+        }
+
+        let text = self.label.map_or_else(String::new, |text| text);
+
+        {
+            let label = label.clone();
+            DynamicString::new(&text, move |string| {
+                label.set_label(&string);
+                Continue(true)
+            });
+        }
+
+        label
+
+        // DynamicString::new(label, &text)
+    }
+
+    /// Creates a `gtk::Button` from this widget
+    fn into_button(self, tx: Sender<ExecEvent>, bar_orientation: Orientation) -> Button {
+        let mut builder = Button::builder();
+
+        if let Some(name) = self.name {
+            builder = builder.name(&name);
+        }
+
+        let button = builder.build();
+
+        if let Some(text) = self.label {
+            let label = Label::new(None);
+            label.set_use_markup(true);
+            label.set_markup(&text);
+            button.add(&label);
+        }
+
+        if let Some(class) = self.class {
+            button.style_context().add_class(&class);
+        }
+
+        if let Some(exec) = self.on_click {
+            button.connect_clicked(move |button| {
+                tx.try_send(ExecEvent {
+                    cmd: exec.clone(),
+                    geometry: Popup::button_pos(button, bar_orientation),
+                })
+                .expect("Failed to send exec message");
+            });
+        }
+
+        button
+    }
+}
+
+#[derive(Debug)]
+pub struct ExecEvent {
+    cmd: String,
+    geometry: ButtonGeometry,
+}
+
+impl Module<gtk::Box> for CustomModule {
+    type SendMessage = ();
+    type ReceiveMessage = ExecEvent;
+
+    fn spawn_controller(
+        &self,
+        _info: &ModuleInfo,
+        tx: Sender<ModuleUpdateEvent<Self::SendMessage>>,
+        mut rx: Receiver<Self::ReceiveMessage>,
+    ) -> Result<()> {
+        spawn(async move {
+            while let Some(event) = rx.recv().await {
+                if event.cmd.starts_with('!') {
+                    let script = Script::from(&event.cmd[1..]);
+
+                    debug!("executing command: '{}'", script.cmd);
+                    // TODO: Migrate to use script.run
+                    if let Err(err) = script.get_output().await {
+                        error!("{err:?}");
+                    }
+                } else if event.cmd == "popup:toggle" {
+                    tx.send(ModuleUpdateEvent::TogglePopup(event.geometry))
+                        .await
+                        .expect("Failed to send open popup event");
+                } else if event.cmd == "popup:open" {
+                    tx.send(ModuleUpdateEvent::OpenPopup(event.geometry))
+                        .await
+                        .expect("Failed to send open popup event");
+                } else if event.cmd == "popup:close" {
+                    tx.send(ModuleUpdateEvent::ClosePopup)
+                        .await
+                        .expect("Failed to send open popup event");
+                } else {
+                    error!("Received invalid command: '{}'", event.cmd);
+                }
+            }
+        });
+
+        Ok(())
+    }
+
+    fn into_widget(
+        self,
+        context: WidgetContext<Self::SendMessage, Self::ReceiveMessage>,
+        info: &ModuleInfo,
+    ) -> Result<ModuleWidget<gtk::Box>> {
+        let orientation = info.bar_position.get_orientation();
+        let container = gtk::Box::builder().orientation(orientation).build();
+
+        if let Some(ref class) = self.class {
+            container.style_context().add_class(class);
+        }
+
+        self.bar.clone().into_iter().for_each(|widget| {
+            widget.add_to(&container, context.controller_tx.clone(), orientation);
+        });
+
+        let popup = self.into_popup(context.controller_tx, context.popup_rx);
+
+        Ok(ModuleWidget {
+            widget: container,
+            popup,
+        })
+    }
+
+    fn into_popup(
+        self,
+        tx: Sender<Self::ReceiveMessage>,
+        _rx: glib::Receiver<Self::SendMessage>,
+    ) -> Option<gtk::Box>
+    where
+        Self: Sized,
+    {
+        let container = gtk::Box::builder().name("popup-custom").build();
+
+        if let Some(class) = self.class {
+            container
+                .style_context()
+                .add_class(format!("popup-{class}").as_str());
+        }
+
+        if let Some(popup) = self.popup {
+            popup
+                .into_iter()
+                .for_each(|widget| widget.add_to(&container, tx.clone(), Orientation::Horizontal));
+        }
+
+        Some(container)
+    }
+}
--- a/src/modules/focused.rs
+++ b/src/modules/focused.rs
@@ -1,12 +1,14 @@
-use crate::icon;
-use crate::modules::{Module, ModuleInfo};
-use crate::sway::get_client;
+use crate::clients::wayland::{self, ToplevelChange};
+use crate::config::CommonConfig;
+use crate::modules::{Module, ModuleInfo, ModuleUpdateEvent, ModuleWidget, WidgetContext};
+use crate::{await_sync, icon};
 use color_eyre::Result;
 use glib::Continue;
 use gtk::prelude::*;
-use gtk::{IconTheme, Image, Label, Orientation};
+use gtk::{IconTheme, Image, Label};
 use serde::Deserialize;
-use tokio::task::spawn_blocking;
+use tokio::spawn;
+use tokio::sync::mpsc::{Receiver, Sender};

 #[derive(Debug, Deserialize, Clone)]
 pub struct FocusedModule {
@@ -22,6 +24,9 @@ pub struct FocusedModule {
    icon_size: i32,
    /// GTK icon theme to use.
    icon_theme: Option<String>,
+
+    #[serde(flatten)]
+    pub common: CommonConfig,
 }

 const fn default_icon_size() -> i32 {
@@ -29,14 +34,69 @@ const fn default_icon_size() -> i32 {
 }

 impl Module<gtk::Box> for FocusedModule {
-    fn into_widget(self, _info: &ModuleInfo) -> Result<gtk::Box> {
+    type SendMessage = (String, String);
+    type ReceiveMessage = ();
+
+    fn spawn_controller(
+        &self,
+        _info: &ModuleInfo,
+        tx: Sender<ModuleUpdateEvent<Self::SendMessage>>,
+        _rx: Receiver<Self::ReceiveMessage>,
+    ) -> Result<()> {
+        let focused = await_sync(async {
+            let wl = wayland::get_client().await;
+            let toplevels = wl
+                .toplevels
+                .read()
+                .expect("Failed to get read lock on toplevels")
+                .clone();
+
+            toplevels.into_iter().find(|(_, (top, _))| top.active)
+        });
+
+        if let Some((_, (top, _))) = focused {
+            tx.try_send(ModuleUpdateEvent::Update((top.title.clone(), top.app_id)))?;
+        }
+
+        spawn(async move {
+            let mut wlrx = {
+                let wl = wayland::get_client().await;
+                wl.subscribe_toplevels()
+            };
+
+            while let Ok(event) = wlrx.recv().await {
+                let update = match event.change {
+                    ToplevelChange::Focus(focus) => focus,
+                    ToplevelChange::Title(_) => event.toplevel.active,
+                    _ => false,
+                };
+
+                if update {
+                    tx.send(ModuleUpdateEvent::Update((
+                        event.toplevel.title,
+                        event.toplevel.app_id,
+                    )))
+                    .await
+                    .expect("Failed to send focus update");
+                }
+            }
+        });
+
+        Ok(())
+    }
+
+    fn into_widget(
+        self,
+        context: WidgetContext<Self::SendMessage, Self::ReceiveMessage>,
+        info: &ModuleInfo,
+    ) -> Result<ModuleWidget<gtk::Box>> {
        let icon_theme = IconTheme::new();

        if let Some(theme) = self.icon_theme {
            icon_theme.set_custom_theme(Some(&theme));
        }

-        let container = gtk::Box::new(Orientation::Horizontal, 5);
+        let container = gtk::Box::new(info.bar_position.get_orientation(), 5);

        let icon = Image::builder().name("icon").build();
        let label = Label::builder().name("label").build();
@@ -44,59 +104,25 @@ impl Module<gtk::Box> for FocusedModule {
        container.add(&icon);
        container.add(&label);

-        let (tx, rx) = glib::MainContext::channel(glib::PRIORITY_DEFAULT);
-
-        let focused = {
-            let sway = get_client();
-            let mut sway = sway.lock().expect("Failed to get lock on Sway IPC client");
-            sway.get_open_windows()?
-                .into_iter()
-                .find(|node| node.focused)
-        };
-
-        if let Some(focused) = focused {
-            tx.send(focused)?;
-        }
-
-        spawn_blocking(move || {
-            let srx = {
-                let sway = get_client();
-                let mut sway = sway.lock().expect("Failed to get lock on Sway IPC client");
-                sway.subscribe_window()
-            };
-
-            while let Ok(payload) = srx.recv() {
-                let update = match payload.change.as_str() {
-                    "focus" => true,
-                    "title" => payload.container.focused,
-                    _ => false,
-                };
-
-                if update {
-                    tx.send(payload.container)
-                        .expect("Failed to sendf focus update");
-                }
-            }
-        });
-
        {
-            rx.attach(None, move |node| {
-                let value = node.name.as_deref().unwrap_or_else(|| node.get_id());
-
-                let pixbuf = icon::get_icon(&icon_theme, node.get_id(), self.icon_size);
+            context.widget_rx.attach(None, move |(name, id)| {
+                let pixbuf = icon::get_icon(&icon_theme, &id, self.icon_size);

                if self.show_icon {
                    icon.set_pixbuf(pixbuf.as_ref());
                }

                if self.show_title {
-                    label.set_label(value);
+                    label.set_label(&name);
                }

                Continue(true)
            });
        }

-        Ok(container)
+        Ok(ModuleWidget {
+            widget: container,
+            popup: None,
+        })
    }
 }
--- a/src/modules/launcher/item.rs
+++ b/src/modules/launcher/item.rs
@@ -1,292 +1,258 @@
-use crate::collection::Collection;
-use crate::icon::{find_desktop_file, get_icon};
-use crate::modules::launcher::open_state::OpenState;
-use crate::modules::launcher::popup::Popup;
-use crate::modules::launcher::FocusEvent;
-use crate::sway::SwayNode;
-use crate::Report;
-use color_eyre::Help;
+use super::open_state::OpenState;
+use crate::clients::wayland::ToplevelInfo;
+use crate::icon::get_icon;
+use crate::modules::launcher::{ItemEvent, LauncherUpdate};
+use crate::modules::ModuleUpdateEvent;
+use crate::popup::Popup;
 use gtk::prelude::*;
-use gtk::{Button, IconTheme, Image};
-use std::process::{Command, Stdio};
+use gtk::{Button, IconTheme, Image, Orientation};
+use indexmap::IndexMap;
 use std::rc::Rc;
-use std::sync::{Arc, RwLock};
-use tokio::spawn;
-use tokio::sync::mpsc;
-use tracing::error;
+use std::sync::RwLock;
+use tokio::sync::mpsc::Sender;

 #[derive(Debug, Clone)]
-pub struct LauncherItem {
+pub struct Item {
    pub app_id: String,
    pub favorite: bool,
-    pub windows: Rc<RwLock<Collection<i32, LauncherWindow>>>,
-    pub state: Arc<RwLock<State>>,
-    pub button: Button,
-}
-
-#[derive(Debug, Clone)]
-pub struct LauncherWindow {
-    pub con_id: i32,
-    pub name: Option<String>,
    pub open_state: OpenState,
+    pub windows: IndexMap<usize, Window>,
+    pub name: String,
 }

-#[derive(Debug, Clone)]
-pub struct State {
-    pub is_xwayland: bool,
-    pub open_state: OpenState,
-}
-
-#[derive(Debug, Clone)]
-pub struct ButtonConfig {
-    pub icon_theme: IconTheme,
-    pub show_names: bool,
-    pub show_icons: bool,
-    pub popup: Popup,
-    pub tx: mpsc::Sender<FocusEvent>,
-}
-
-impl LauncherItem {
-    pub fn new(app_id: String, favorite: bool, config: &ButtonConfig) -> Self {
-        let button = Button::new();
-        button.style_context().add_class("item");
-
-        let state = State {
-            open_state: OpenState::Closed,
-            is_xwayland: false,
-        };
-
-        let item = Self {
+impl Item {
+    pub fn new(app_id: String, open_state: OpenState, favorite: bool) -> Self {
+        Self {
            app_id,
            favorite,
-            windows: Rc::new(RwLock::new(Collection::new())),
-            state: Arc::new(RwLock::new(state)),
-            button,
-        };
-
-        item.configure_button(config);
-        item
+            open_state,
+            windows: IndexMap::new(),
+            name: String::new(),
+        }
    }

-    pub fn from_node(node: &SwayNode, config: &ButtonConfig) -> Self {
-        let button = Button::new();
-        button.style_context().add_class("item");
+    /// Merges the provided node into this launcher item
+    pub fn merge_toplevel(&mut self, node: ToplevelInfo) -> Window {
+        let id = node.id;

-        let windows = Collection::from((
-            node.id,
-            LauncherWindow {
-                con_id: node.id,
-                name: node.name.clone(),
-                open_state: OpenState::from_node(node),
-            },
-        ));
+        if self.windows.is_empty() {
+            self.name = node.title.clone();
+        }

-        let state = State {
-            open_state: OpenState::from_node(node),
-            is_xwayland: node.is_xwayland(),
-        };
+        let window: Window = node.into();
+        self.windows.insert(id, window.clone());

-        let item = Self {
-            app_id: node.get_id().to_string(),
-            favorite: false,
-            windows: Rc::new(RwLock::new(windows)),
-            state: Arc::new(RwLock::new(state)),
-            button,
-        };
+        self.recalculate_open_state();

-        item.configure_button(config);
-        item
+        window
    }

-    fn configure_button(&self, config: &ButtonConfig) {
-        let button = &self.button;
+    pub fn unmerge_toplevel(&mut self, node: &ToplevelInfo) {
+        self.windows.remove(&node.id);
+        self.recalculate_open_state();
+    }

-        let windows = self
-            .windows
-            .read()
-            .expect("Failed to get read lock on windows");
-
-        let name = if windows.len() == 1 {
-            windows
-                .first()
-                .expect("Failed to get first window")
-                .name
-                .as_ref()
-        } else {
-            Some(&self.app_id)
-        };
-
-        if let Some(name) = name {
-            self.set_title(name, config);
-        }
-
-        if config.show_icons {
-            let icon = get_icon(&config.icon_theme, &self.app_id, 32);
-            if icon.is_some() {
-                let image = Image::from_pixbuf(icon.as_ref());
-                button.set_image(Some(&image));
-                button.set_always_show_image(true);
-            }
-        }
-
-        let app_id = self.app_id.clone();
-        let state = Arc::clone(&self.state);
-        let tx_click = config.tx.clone();
-
-        let (focus_tx, mut focus_rx) = mpsc::channel(32);
-
-        button.connect_clicked(move |_| {
-            let state = state.read().expect("Failed to get read lock on state");
-            if state.open_state.is_open() {
-                focus_tx.try_send(()).expect("Failed to send focus event");
-            } else {
-                // attempt to find desktop file and launch
-                match find_desktop_file(&app_id) {
-                    Some(file) => {
-                        if let Err(err) = Command::new("gtk-launch")
-                            .arg(
-                                file.file_name()
-                                    .expect("File segment missing from path to desktop file"),
-                            )
-                            .stdout(Stdio::null())
-                            .stderr(Stdio::null())
-                            .spawn()
-                        {
-                            error!(
-                                "{:?}",
-                                Report::new(err)
-                                    .wrap_err("Failed to run gtk-launch command.")
-                                    .suggestion("Perhaps the desktop file is invalid?")
-                            );
-                        }
-                    }
-                    None => error!("Could not find desktop file for {}", app_id),
-                }
-            }
-        });
-
-        let app_id = self.app_id.clone();
-        let state = Arc::clone(&self.state);
-
-        spawn(async move {
-            while focus_rx.recv().await == Some(()) {
-                let state = state.read().expect("Failed to get read lock on state");
-                if state.is_xwayland {
-                    tx_click
-                        .try_send(FocusEvent::Class(app_id.clone()))
-                        .expect("Failed to send focus event");
-                } else {
-                    tx_click
-                        .try_send(FocusEvent::AppId(app_id.clone()))
-                        .expect("Failed to send focus event");
-                }
-            }
-        });
-
-        let popup = config.popup.clone();
-        let popup2 = config.popup.clone();
-        let windows = Rc::clone(&self.windows);
-        let tx_hover = config.tx.clone();
-
-        button.connect_enter_notify_event(move |button, _| {
-            let windows = windows.read().expect("Failed to get read lock on windows");
-            if windows.len() > 1 {
-                popup.set_windows(windows.as_slice(), &tx_hover);
-                popup.show(button);
+    pub fn set_window_name(&mut self, window_id: usize, name: String) {
+        if let Some(window) = self.windows.get_mut(&window_id) {
+            if let OpenState::Open { focused: true, .. } = window.open_state {
+                self.name = name.clone();
            }

-            Inhibit(false)
-        });
-
-        {}
-
-        button.connect_leave_notify_event(move |_, e| {
-            let (_, y) = e.position();
-            // hover boundary
-            if y > 2.0 {
-                popup2.hide();
-            }
-
-            Inhibit(false)
-        });
-
-        let style = button.style_context();
-
-        style.add_class("launcher-item");
-        self.update_button_classes(&self.state.read().expect("Failed to get read lock on state"));
-
-        button.show_all();
-    }
-
-    pub fn set_title(&self, title: &str, config: &ButtonConfig) {
-        if config.show_names {
-            self.button.set_label(title);
-        } else {
-            self.button.set_tooltip_text(Some(title));
-        };
-    }
-
-    /// Updates the classnames on the GTK button
-    /// based on its current state.
-    ///
-    /// State must be passed as an arg here rather than
-    /// using `self.state` to avoid a weird `RwLock` issue.
-    pub fn update_button_classes(&self, state: &State) {
-        let style = self.button.style_context();
-
-        if self.favorite {
-            style.add_class("favorite");
-        } else {
-            style.remove_class("favorite");
-        }
-
-        if state.open_state.is_open() {
-            style.add_class("open");
-        } else {
-            style.remove_class("open");
-        }
-
-        if state.open_state.is_focused() {
-            style.add_class("focused");
-        } else {
-            style.remove_class("focused");
-        }
-
-        if state.open_state.is_urgent() {
-            style.add_class("urgent");
-        } else {
-            style.remove_class("urgent");
+            window.name = name;
        }
    }

-    /// Sets the open state for a specific window on the item
-    /// and updates the item state based on all its windows.
-    pub fn set_window_open_state(&self, window_id: i32, new_state: OpenState, state: &mut State) {
-        let mut windows = self
-            .windows
-            .write()
-            .expect("Failed to get write lock on windows");
+    pub fn set_window_focused(&mut self, window_id: usize, focused: bool) {
+        if let Some(window) = self.windows.get_mut(&window_id) {
+            window.open_state =
+                OpenState::merge_states(&[&window.open_state, &OpenState::focused(focused)]);

-        let window = windows.iter_mut().find(|w| w.con_id == window_id);
-        if let Some(window) = window {
-            window.open_state = new_state;
-
-            state.open_state =
-                OpenState::merge_states(windows.iter().map(|w| &w.open_state).collect());
+            self.recalculate_open_state();
        }
    }

-    /// Sets the open state on the item and all its windows.
-    /// This overrides the existing open states.
-    pub fn set_open_state(&self, new_state: OpenState, state: &mut State) {
-        state.open_state = new_state;
-        let mut windows = self
-            .windows
-            .write()
-            .expect("Failed to get write lock on windows");
-
-        windows
-            .iter_mut()
-            .for_each(|window| window.open_state = new_state);
+    /// Sets this item's open state
+    /// to the merged result of its windows' open states
+    fn recalculate_open_state(&mut self) {
+        let new_state = OpenState::merge_states(
+            &self
+                .windows
+                .iter()
+                .map(|(_, win)| &win.open_state)
+                .collect::<Vec<_>>(),
+        );
+        self.open_state = new_state;
+    }
+}
+
+impl From<ToplevelInfo> for Item {
+    fn from(toplevel: ToplevelInfo) -> Self {
+        let open_state = OpenState::from_toplevel(&toplevel);
+        let name = toplevel.title.clone();
+        let app_id = toplevel.app_id.clone();
+
+        let mut windows = IndexMap::new();
+        windows.insert(toplevel.id, toplevel.into());
+
+        Self {
+            app_id,
+            favorite: false,
+            open_state,
+            windows,
+            name,
+        }
+    }
+}
+
+#[derive(Clone, Debug)]
+pub struct Window {
+    pub id: usize,
+    pub name: String,
+    pub open_state: OpenState,
+}
+
+impl From<ToplevelInfo> for Window {
+    fn from(node: ToplevelInfo) -> Self {
+        let open_state = OpenState::from_toplevel(&node);
+
+        Self {
+            id: node.id,
+            name: node.title,
+            open_state,
+        }
+    }
+}
+
+pub struct MenuState {
+    pub num_windows: usize,
+}
+
+pub struct ItemButton {
+    pub button: Button,
+    pub persistent: bool,
+    pub show_names: bool,
+    pub menu_state: Rc<RwLock<MenuState>>,
+}
+
+impl ItemButton {
+    pub fn new(
+        item: &Item,
+        show_names: bool,
+        show_icons: bool,
+        orientation: Orientation,
+        icon_theme: &IconTheme,
+        tx: &Sender<ModuleUpdateEvent<LauncherUpdate>>,
+        controller_tx: &Sender<ItemEvent>,
+    ) -> Self {
+        let mut button = Button::builder();
+
+        if show_names {
+            button = button.label(&item.name);
+        }
+
+        if show_icons {
+            let icon = get_icon(icon_theme, &item.app_id, 32);
+            if icon.is_some() {
+                let image = Image::from_pixbuf(icon.as_ref());
+                button = button.image(&image).always_show_image(true);
+            }
+        }
+
+        let button = button.build();
+
+        let style_context = button.style_context();
+        style_context.add_class("item");
+
+        if item.favorite {
+            style_context.add_class("favorite");
+        }
+        if item.open_state.is_open() {
+            style_context.add_class("open");
+        }
+        if item.open_state.is_focused() {
+            style_context.add_class("focused");
+        }
+
+        {
+            let app_id = item.app_id.clone();
+            let tx = controller_tx.clone();
+            button.connect_clicked(move |button| {
+                // lazy check :|
+                let style_context = button.style_context();
+                if style_context.has_class("open") {
+                    tx.try_send(ItemEvent::FocusItem(app_id.clone()))
+                        .expect("Failed to send item focus event");
+                } else {
+                    tx.try_send(ItemEvent::OpenItem(app_id.clone()))
+                        .expect("Failed to send item open event");
+                }
+            });
+        }
+
+        let menu_state = Rc::new(RwLock::new(MenuState {
+            num_windows: item.windows.len(),
+        }));
+
+        {
+            let app_id = item.app_id.clone();
+            let tx = tx.clone();
+            let menu_state = menu_state.clone();
+
+            button.connect_enter_notify_event(move |button, _| {
+                let menu_state = menu_state
+                    .read()
+                    .expect("Failed to get read lock on item menu state");
+
+                if menu_state.num_windows > 1 {
+                    tx.try_send(ModuleUpdateEvent::Update(LauncherUpdate::Hover(
+                        app_id.clone(),
+                    )))
+                    .expect("Failed to send item open popup event");
+
+                    tx.try_send(ModuleUpdateEvent::OpenPopup(Popup::button_pos(
+                        button,
+                        orientation,
+                    )))
+                    .expect("Failed to send item open popup event");
+                } else {
+                    tx.try_send(ModuleUpdateEvent::ClosePopup)
+                        .expect("Failed to send item close popup event");
+                }
+
+                Inhibit(false)
+            });
+        }
+
+        button.show_all();
+
+        Self {
+            button,
+            persistent: item.favorite,
+            show_names,
+            menu_state,
+        }
+    }
+
+    pub fn set_open(&self, open: bool) {
+        self.update_class("open", open);
+
+        if !open {
+            self.set_focused(false);
+        }
+    }
+
+    pub fn set_focused(&self, focused: bool) {
+        self.update_class("focused", focused);
+    }
+
+    /// Adds or removes a class to the button based on `toggle`.
+    fn update_class(&self, class: &str, toggle: bool) {
+        let style_context = self.button.style_context();
+
+        if toggle {
+            style_context.add_class(class);
+        } else {
+            style_context.remove_class(class);
+        }
    }
 }
--- a/src/modules/launcher/mod.rs
+++ b/src/modules/launcher/mod.rs
@@ -1,26 +1,28 @@
 mod item;
 mod open_state;
-mod popup;

-use crate::collection::Collection;
-use crate::modules::launcher::item::{ButtonConfig, LauncherItem, LauncherWindow};
-use crate::modules::launcher::open_state::OpenState;
-use crate::modules::launcher::popup::Popup;
-use crate::modules::{Module, ModuleInfo};
-use crate::sway::{get_client, SwayNode};
-use color_eyre::{Report, Result};
+use self::item::{Item, ItemButton, Window};
+use self::open_state::OpenState;
+use crate::clients::wayland::{self, ToplevelChange};
+use crate::config::CommonConfig;
+use crate::icon::find_desktop_file;
+use crate::modules::{Module, ModuleInfo, ModuleUpdateEvent, ModuleWidget, WidgetContext};
+use color_eyre::{Help, Report};
+use glib::Continue;
 use gtk::prelude::*;
-use gtk::{IconTheme, Orientation};
+use gtk::{Button, IconTheme, Orientation};
+use indexmap::IndexMap;
 use serde::Deserialize;
-use std::rc::Rc;
+use std::process::{Command, Stdio};
+use std::sync::{Arc, Mutex};
 use tokio::spawn;
 use tokio::sync::mpsc;
-use tokio::task::spawn_blocking;
-use tracing::debug;
+use tokio::sync::mpsc::{Receiver, Sender};
+use tracing::{debug, error, trace};

 #[derive(Debug, Deserialize, Clone)]
 pub struct LauncherModule {
-    /// List of app IDs (or classes) to always show regardles of open state,
+    /// List of app IDs (or classes) to always show regardless of open state,
    /// in the order specified.
    favorites: Option<Vec<String>>,
    /// Whether to show application names on the bar.
@@ -32,279 +34,508 @@ pub struct LauncherModule {

    /// Name of the GTK icon theme to use.
    icon_theme: Option<String>,
+
+    #[serde(flatten)]
+    pub common: CommonConfig,
+}
+
+#[derive(Debug, Clone)]
+pub enum LauncherUpdate {
+    /// Adds item
+    AddItem(Item),
+    /// Adds window to item with `app_id`
+    AddWindow(String, Window),
+    /// Removes item with `app_id`
+    RemoveItem(String),
+    /// Removes window from item with `app_id`.
+    RemoveWindow(String, usize),
+    /// Sets title for `app_id`
+    Title(String, usize, String),
+    /// Marks the item with `app_id` as focused or not focused
+    Focus(String, bool),
+    /// Declares the item with `app_id` has been hovered over
+    Hover(String),
 }

 #[derive(Debug)]
-pub enum FocusEvent {
-    AppId(String),
-    Class(String),
-    ConId(i32),
+pub enum ItemEvent {
+    FocusItem(String),
+    FocusWindow(usize),
+    OpenItem(String),
 }

-type AppId = String;
-
-struct Launcher {
-    items: Collection<AppId, LauncherItem>,
-    container: gtk::Box,
-    button_config: ButtonConfig,
+enum ItemOrWindow {
+    Item(Item),
+    Window(Window),
 }

-impl Launcher {
-    fn new(favorites: Vec<String>, container: gtk::Box, button_config: ButtonConfig) -> Self {
-        let items = favorites
-            .into_iter()
-            .map(|app_id| {
-                (
-                    app_id.clone(),
-                    LauncherItem::new(app_id, true, &button_config),
-                )
-            })
-            .collect::<Collection<_, _>>();
-
-        for item in &items {
-            container.add(&item.button);
-        }
-
-        Self {
-            items,
-            container,
-            button_config,
-        }
-    }
-
-    /// Adds a new window to the launcher.
-    /// This gets added to an existing group
-    /// if an instance of the program is already open.
-    fn add_window(&mut self, node: SwayNode) {
-        let id = node.get_id().to_string();
-
-        debug!("Adding window with ID {}", id);
-
-        if let Some(item) = self.items.get_mut(&id) {
-            let mut state = item
-                .state
-                .write()
-                .expect("Failed to get write lock on state");
-            let new_open_state = OpenState::from_node(&node);
-            state.open_state = OpenState::merge_states(vec![&state.open_state, &new_open_state]);
-            state.is_xwayland = node.is_xwayland();
-
-            item.update_button_classes(&state);
-
-            let mut windows = item
-                .windows
-                .write()
-                .expect("Failed to get write lock on windows");
-
-            windows.insert(
-                node.id,
-                LauncherWindow {
-                    con_id: node.id,
-                    name: node.name,
-                    open_state: new_open_state,
-                },
-            );
-        } else {
-            let item = LauncherItem::from_node(&node, &self.button_config);
-
-            self.container.add(&item.button);
-            self.items.insert(id, item);
-        }
-    }
-
-    /// Removes a window from the launcher.
-    /// This removes it from the group if multiple instances were open.
-    /// The button will remain on the launcher if it is favourited.
-    fn remove_window(&mut self, window: &SwayNode) {
-        let id = window.get_id().to_string();
-
-        debug!("Removing window with ID {}", id);
-
-        let item = self.items.get_mut(&id);
-
-        let remove = if let Some(item) = item {
-            let windows = Rc::clone(&item.windows);
-            let mut windows = windows
-                .write()
-                .expect("Failed to get write lock on windows");
-
-            windows.remove(&window.id);
-
-            if windows.is_empty() {
-                let mut state = item.state.write().expect("Failed to get lock on windows");
-                state.open_state = OpenState::Closed;
-                item.update_button_classes(&state);
-
-                if item.favorite {
-                    false
-                } else {
-                    self.container.remove(&item.button);
-                    true
-                }
-            } else {
-                false
-            }
-        } else {
-            false
-        };
-
-        if remove {
-            self.items.remove(&id);
-        }
-    }
-
-    /// Unfocuses the currently focused window
-    /// and focuses the newly focused one.
-    fn set_window_focused(&mut self, node: &SwayNode) {
-        let id = node.get_id().to_string();
-
-        debug!("Setting window with ID {} focused", id);
-
-        let prev_focused = self.items.iter_mut().find(|item| {
-            item.state
-                .read()
-                .expect("Failed to get read lock on state")
-                .open_state
-                .is_focused()
-        });
-
-        if let Some(prev_focused) = prev_focused {
-            let mut state = prev_focused
-                .state
-                .write()
-                .expect("Failed to get write lock on state");
-
-            // if a window from the same item took focus,
-            // we don't need to unfocus the item.
-            if prev_focused.app_id != id {
-                prev_focused.set_open_state(OpenState::open(), &mut state);
-                prev_focused.update_button_classes(&state);
-            }
-        }
-
-        let item = self.items.get_mut(&id);
-        if let Some(item) = item {
-            let mut state = item
-                .state
-                .write()
-                .expect("Failed to get write lock on state");
-            item.set_window_open_state(node.id, OpenState::focused(), &mut state);
-            item.update_button_classes(&state);
-        }
-    }
-
-    /// Updates the window title for the given node.
-    fn set_window_title(&mut self, window: SwayNode) {
-        let id = window.get_id().to_string();
-        let item = self.items.get_mut(&id);
-
-        debug!("Updating title for window with ID {}", id);
-
-        if let (Some(item), Some(name)) = (item, window.name) {
-            let mut windows = item
-                .windows
-                .write()
-                .expect("Failed to get write lock on windows");
-            if windows.len() == 1 {
-                item.set_title(&name, &self.button_config);
-            } else if let Some(window) = windows.get_mut(&window.id) {
-                window.name = Some(name);
-            } else {
-                // This should never happen
-                // But makes more sense to wipe title than keep old one in case of error
-                item.set_title("", &self.button_config);
-            }
-        }
-    }
-
-    /// Updates the window urgency based on the given node.
-    fn set_window_urgent(&mut self, node: &SwayNode) {
-        let id = node.get_id().to_string();
-        let item = self.items.get_mut(&id);
-
-        debug!(
-            "Setting urgency to {} for window with ID {}",
-            node.urgent, id
-        );
-
-        if let Some(item) = item {
-            let mut state = item
-                .state
-                .write()
-                .expect("Failed to get write lock on state");
-
-            item.set_window_open_state(node.id, OpenState::urgent(node.urgent), &mut state);
-            item.update_button_classes(&state);
-        }
-    }
+enum ItemOrWindowId {
+    Item,
+    Window,
 }

 impl Module<gtk::Box> for LauncherModule {
-    fn into_widget(self, info: &ModuleInfo) -> Result<gtk::Box> {
-        let icon_theme = IconTheme::new();
+    type SendMessage = LauncherUpdate;
+    type ReceiveMessage = ItemEvent;

-        if let Some(theme) = self.icon_theme {
-            icon_theme.set_custom_theme(Some(&theme));
-        }
+    fn spawn_controller(
+        &self,
+        _info: &ModuleInfo,
+        tx: Sender<ModuleUpdateEvent<Self::SendMessage>>,
+        mut rx: Receiver<Self::ReceiveMessage>,
+    ) -> crate::Result<()> {
+        let items = self
+            .favorites
+            .as_ref()
+            .map_or_else(IndexMap::new, |favorites| {
+                favorites
+                    .iter()
+                    .map(|app_id| {
+                        (
+                            app_id.to_string(),
+                            Item::new(app_id.to_string(), OpenState::Closed, true),
+                        )
+                    })
+                    .collect::<IndexMap<_, _>>()
+            });

-        let popup = Popup::new(
-            "popup-launcher",
-            info.app,
-            info.monitor,
-            Orientation::Vertical,
-            info.bar_position,
-        );
-        let container = gtk::Box::new(Orientation::Horizontal, 0);
-
-        let (ui_tx, mut ui_rx) = mpsc::channel(32);
-
-        let button_config = ButtonConfig {
-            icon_theme,
-            show_names: self.show_names,
-            show_icons: self.show_icons,
-            popup,
-            tx: ui_tx,
-        };
-
-        let mut launcher = Launcher::new(
-            self.favorites.unwrap_or_default(),
-            container.clone(),
-            button_config,
-        );
-
-        let open_windows = {
-            let sway = get_client();
-            let mut sway = sway.lock().expect("Failed to get lock on Sway IPC client");
-            sway.get_open_windows()
-        }?;
-
-        for window in open_windows {
-            launcher.add_window(window);
-        }
-
-        let (tx, rx) = glib::MainContext::channel(glib::PRIORITY_DEFAULT);
-
-        spawn_blocking(move || {
-            let srx = {
-                let sway = get_client();
-                let mut sway = sway.lock().expect("Failed to get lock on Sway IPC client");
-                sway.subscribe_window()
-            };
-
-            while let Ok(payload) = srx.recv() {
-                tx.send(payload)
-                    .expect("Failed to send window event payload");
-            }
-        });
+        let items = Arc::new(Mutex::new(items));

        {
+            let items = Arc::clone(&items);
+            let tx = tx.clone();
+            spawn(async move {
+                let wl = wayland::get_client().await;
+                let open_windows = wl
+                    .toplevels
+                    .read()
+                    .expect("Failed to get read lock on toplevels");
+
+                let mut items = items.lock().expect("Failed to get lock on items");
+
+                for (_, (window, _)) in open_windows.clone() {
+                    let item = items.get_mut(&window.app_id);
+                    match item {
+                        Some(item) => {
+                            item.merge_toplevel(window);
+                        }
+                        None => {
+                            items.insert(window.app_id.clone(), window.into());
+                        }
+                    }
+                }
+
+                let items = items.iter();
+                for (_, item) in items {
+                    tx.try_send(ModuleUpdateEvent::Update(LauncherUpdate::AddItem(
+                        item.clone(),
+                    )))?;
+                }
+
+                Ok::<(), Report>(())
+            });
+        }
+
+        let items2 = Arc::clone(&items);
+        spawn(async move {
+            let items = items2;
+
+            let mut wlrx = {
+                let wl = wayland::get_client().await;
+                wl.subscribe_toplevels()
+            };
+
+            let send_update = |update: LauncherUpdate| tx.send(ModuleUpdateEvent::Update(update));
+
+            while let Ok(event) = wlrx.recv().await {
+                trace!("event: {:?}", event);
+
+                let window = event.toplevel;
+                let app_id = window.app_id.clone();
+
+                let items = || items.lock().expect("Failed to get lock on items");
+
+                match event.change {
+                    ToplevelChange::New => {
+                        let new_item = {
+                            let mut items = items();
+                            let item = items.get_mut(&app_id);
+                            match item {
+                                None => {
+                                    let item: Item = window.into();
+                                    items.insert(app_id.clone(), item.clone());
+
+                                    ItemOrWindow::Item(item)
+                                }
+                                Some(item) => {
+                                    let window = item.merge_toplevel(window);
+                                    ItemOrWindow::Window(window)
+                                }
+                            }
+                        };
+
+                        match new_item {
+                            ItemOrWindow::Item(item) => {
+                                send_update(LauncherUpdate::AddItem(item)).await
+                            }
+                            ItemOrWindow::Window(window) => {
+                                send_update(LauncherUpdate::AddWindow(app_id, window)).await
+                            }
+                        }?;
+                    }
+                    ToplevelChange::Close => {
+                        let remove_item = {
+                            let mut items = items();
+                            let item = items.get_mut(&app_id);
+                            match item {
+                                Some(item) => {
+                                    item.unmerge_toplevel(&window);
+
+                                    if item.windows.is_empty() {
+                                        items.remove(&app_id);
+                                        Some(ItemOrWindowId::Item)
+                                    } else {
+                                        Some(ItemOrWindowId::Window)
+                                    }
+                                }
+                                None => None,
+                            }
+                        };
+
+                        match remove_item {
+                            Some(ItemOrWindowId::Item) => {
+                                send_update(LauncherUpdate::RemoveItem(app_id)).await?;
+                            }
+                            Some(ItemOrWindowId::Window) => {
+                                send_update(LauncherUpdate::RemoveWindow(app_id, window.id))
+                                    .await?;
+                            }
+                            None => {}
+                        };
+                    }
+                    ToplevelChange::Focus(focused) => {
+                        let update_title = if focused {
+                            if let Some(item) = items().get_mut(&app_id) {
+                                item.set_window_focused(window.id, true);
+
+                                // might be switching focus between windows of same app
+                                if item.windows.len() > 1 {
+                                    item.set_window_name(window.id, window.title.clone());
+                                    true
+                                } else {
+                                    false
+                                }
+                            } else {
+                                false
+                            }
+                        } else {
+                            false
+                        };
+
+                        send_update(LauncherUpdate::Focus(app_id.clone(), focused)).await?;
+
+                        if update_title {
+                            send_update(LauncherUpdate::Title(app_id, window.id, window.title))
+                                .await?;
+                        }
+                    }
+                    ToplevelChange::Title(title) => {
+                        if let Some(item) = items().get_mut(&app_id) {
+                            item.set_window_name(window.id, title.clone());
+                        }
+
+                        send_update(LauncherUpdate::Title(app_id, window.id, title)).await?;
+                    }
+                    ToplevelChange::Fullscreen(_) => {}
+                }
+            }
+
+            Ok::<(), mpsc::error::SendError<ModuleUpdateEvent<LauncherUpdate>>>(())
+        });
+
+        // listen to ui events
+        spawn(async move {
+            while let Some(event) = rx.recv().await {
+                trace!("{:?}", event);
+
+                if let ItemEvent::OpenItem(app_id) = event {
+                    find_desktop_file(&app_id).map_or_else(
+                        || error!("Could not find desktop file for {}", app_id),
+                        |file| {
+                            if let Err(err) = Command::new("gtk-launch")
+                                .arg(
+                                    file.file_name()
+                                        .expect("File segment missing from path to desktop file"),
+                                )
+                                .stdout(Stdio::null())
+                                .stderr(Stdio::null())
+                                .spawn()
+                            {
+                                error!(
+                                    "{:?}",
+                                    Report::new(err)
+                                        .wrap_err("Failed to run gtk-launch command.")
+                                        .suggestion("Perhaps the desktop file is invalid?")
+                                );
+                            }
+                        },
+                    );
+                } else {
+                    let wl = wayland::get_client().await;
+                    let items = items.lock().expect("Failed to get lock on items");
+
+                    let id = match event {
+                        ItemEvent::FocusItem(app_id) => items
+                            .get(&app_id)
+                            .and_then(|item| item.windows.first().map(|(_, win)| win.id)),
+                        ItemEvent::FocusWindow(id) => Some(id),
+                        ItemEvent::OpenItem(_) => unreachable!(),
+                    };
+
+                    if let Some(id) = id {
+                        let toplevels = wl
+                            .toplevels
+                            .read()
+                            .expect("Failed to get read lock on toplevels");
+                        let seat = wl.seats.first().expect("Failed to get Wayland seat");
+                        if let Some((_top, handle)) = toplevels.get(&id) {
+                            handle.activate(seat);
+                        };
+                    }
+                }
+            }
+
+            Ok::<(), swayipc_async::Error>(())
+        });
+
+        Ok(())
+    }
+
+    fn into_widget(
+        self,
+        context: WidgetContext<Self::SendMessage, Self::ReceiveMessage>,
+        info: &ModuleInfo,
+    ) -> crate::Result<ModuleWidget<gtk::Box>> {
+        let icon_theme = IconTheme::new();
+        if let Some(ref theme) = self.icon_theme {
+            icon_theme.set_custom_theme(Some(theme));
+        }
+
+        let container = gtk::Box::new(info.bar_position.get_orientation(), 0);
+
+        {
+            let container = container.clone();
+
+            let show_names = self.show_names;
+            let show_icons = self.show_icons;
+            let orientation = info.bar_position.get_orientation();
+
+            let mut buttons = IndexMap::<String, ItemButton>::new();
+
+            let controller_tx2 = context.controller_tx.clone();
+            context.widget_rx.attach(None, move |event| {
+                match event {
+                    LauncherUpdate::AddItem(item) => {
+                        debug!("Adding item with id {}", item.app_id);
+
+                        if let Some(button) = buttons.get(&item.app_id) {
+                            button.set_open(true);
+                        } else {
+                            let button = ItemButton::new(
+                                &item,
+                                show_names,
+                                show_icons,
+                                orientation,
+                                &icon_theme,
+                                &context.tx,
+                                &controller_tx2,
+                            );
+
+                            container.add(&button.button);
+                            buttons.insert(item.app_id, button);
+                        }
+                    }
+                    LauncherUpdate::AddWindow(app_id, _) => {
+                        if let Some(button) = buttons.get(&app_id) {
+                            button.set_open(true);
+
+                            let mut menu_state = button
+                                .menu_state
+                                .write()
+                                .expect("Failed to get write lock on item menu state");
+                            menu_state.num_windows += 1;
+                        }
+                    }
+                    LauncherUpdate::RemoveItem(app_id) => {
+                        debug!("Removing item with id {}", app_id);
+
+                        if let Some(button) = buttons.get(&app_id) {
+                            if button.persistent {
+                                button.set_open(false);
+                                if button.show_names {
+                                    button.button.set_label(&app_id);
+                                }
+                            } else {
+                                container.remove(&button.button);
+                                buttons.remove(&app_id);
+                            }
+                        }
+                    }
+                    LauncherUpdate::RemoveWindow(app_id, _) => {
+                        if let Some(button) = buttons.get(&app_id) {
+                            let mut menu_state = button
+                                .menu_state
+                                .write()
+                                .expect("Failed to get write lock on item menu state");
+                            menu_state.num_windows -= 1;
+                        }
+                    }
+                    LauncherUpdate::Focus(app_id, focus) => {
+                        debug!("Changing focus to {} on item with id {}", focus, app_id);
+
+                        if let Some(button) = buttons.get(&app_id) {
+                            button.set_focused(focus);
+                        }
+                    }
+                    LauncherUpdate::Title(app_id, _, name) => {
+                        debug!("Updating title for item with id {}: {:?}", app_id, name);
+
+                        if show_names {
+                            if let Some(button) = buttons.get(&app_id) {
+                                button.button.set_label(&name);
+                            }
+                        }
+                    }
+                    LauncherUpdate::Hover(_) => {}
+                };
+
+                Continue(true)
+            });
+        }
+
+        let popup = self.into_popup(context.controller_tx, context.popup_rx);
+        Ok(ModuleWidget {
+            widget: container,
+            popup,
+        })
+    }
+
+    fn into_popup(
+        self,
+        controller_tx: Sender<Self::ReceiveMessage>,
+        rx: glib::Receiver<Self::SendMessage>,
+    ) -> Option<gtk::Box> {
+        const MAX_WIDTH: i32 = 250;
+
+        let container = gtk::Box::builder()
+            .orientation(Orientation::Vertical)
+            .name("popup-launcher")
+            .build();
+
+        // we need some content to force the container to have a size
+        let placeholder = Button::with_label("PLACEHOLDER");
+        placeholder.set_width_request(MAX_WIDTH);
+        container.add(&placeholder);
+
+        let mut buttons = IndexMap::<String, IndexMap<usize, Button>>::new();
+
+        {
+            let container = container.clone();
            rx.attach(None, move |event| {
-                match event.change.as_str() {
-                    "new" => launcher.add_window(event.container),
-                    "close" => launcher.remove_window(&event.container),
-                    "focus" => launcher.set_window_focused(&event.container),
-                    "title" => launcher.set_window_title(event.container),
-                    "urgent" => launcher.set_window_urgent(&event.container),
+                match event {
+                    LauncherUpdate::AddItem(item) => {
+                        let app_id = item.app_id.clone();
+                        trace!("Adding item with id '{app_id}' to the popup: {item:?}");
+
+                        let window_buttons = item
+                            .windows
+                            .into_iter()
+                            .map(|(_, win)| {
+                                let button = Button::builder()
+                                    .label(&clamp(&win.name))
+                                    .height_request(40)
+                                    .build();
+
+                                {
+                                    let tx = controller_tx.clone();
+                                    button.connect_clicked(move |button| {
+                                        tx.try_send(ItemEvent::FocusWindow(win.id))
+                                            .expect("Failed to send window click event");
+
+                                        if let Some(win) = button.window() {
+                                            win.hide();
+                                        }
+                                    });
+                                }
+
+                                (win.id, button)
+                            })
+                            .collect();
+
+                        buttons.insert(app_id, window_buttons);
+                    }
+                    LauncherUpdate::AddWindow(app_id, win) => {
+                        debug!(
+                            "Adding new window to popup for '{app_id}': '{}' ({})",
+                            win.name, win.id
+                        );
+
+                        if let Some(buttons) = buttons.get_mut(&app_id) {
+                            let button = Button::builder()
+                                .height_request(40)
+                                .label(&clamp(&win.name))
+                                .build();
+
+                            {
+                                let tx = controller_tx.clone();
+                                button.connect_clicked(move |button| {
+                                    tx.try_send(ItemEvent::FocusWindow(win.id))
+                                        .expect("Failed to send window click event");
+
+                                    if let Some(win) = button.window() {
+                                        win.hide();
+                                    }
+                                });
+                            }
+
+                            buttons.insert(win.id, button);
+                        }
+                    }
+                    LauncherUpdate::RemoveWindow(app_id, win_id) => {
+                        debug!("Removing window from popup for '{app_id}': {win_id}");
+
+                        if let Some(buttons) = buttons.get_mut(&app_id) {
+                            buttons.remove(&win_id);
+                        }
+                    }
+                    LauncherUpdate::Title(app_id, win_id, title) => {
+                        debug!(
+                            "Updating window title on popup for '{app_id}'/{win_id} to '{title}'"
+                        );
+
+                        if let Some(buttons) = buttons.get_mut(&app_id) {
+                            if let Some(button) = buttons.get(&win_id) {
+                                button.set_label(&title);
+                            }
+                        }
+                    }
+                    LauncherUpdate::Hover(app_id) => {
+                        // empty current buttons
+                        for child in container.children() {
+                            container.remove(&child);
+                        }
+
+                        // add app's buttons
+                        if let Some(buttons) = buttons.get(&app_id) {
+                            for (_, button) in buttons {
+                                button.style_context().add_class("popup-item");
+                                container.add(button);
+                            }
+
+                            container.show_all();
+                            container.set_width_request(MAX_WIDTH);
+                        }
+                    }
                    _ => {}
                }

@@ -312,22 +543,21 @@ impl Module<gtk::Box> for LauncherModule {
            });
        }

-        spawn(async move {
-            let sway = get_client();
-
-            while let Some(event) = ui_rx.recv().await {
-                let selector = match event {
-                    FocusEvent::AppId(app_id) => format!("[app_id={}]", app_id),
-                    FocusEvent::Class(class) => format!("[class={}]", class),
-                    FocusEvent::ConId(id) => format!("[con_id={}]", id),
-                };
-                let mut sway = sway.lock().expect("Failed to get lock on Sway IPC client");
-                sway.run(format!("{} focus", selector))?;
-            }
-
-            Ok::<(), Report>(())
-        });
-
-        Ok(container)
+        Some(container)
+    }
+}
+
+/// Clamps a string at 24 characters.
+///
+/// This is a hacky number derived from
+/// "what fits inside the 250px popup"
+/// and probably won't hold up with wide fonts.
+fn clamp(str: &str) -> String {
+    const MAX_CHARS: usize = 24;
+
+    if str.len() > MAX_CHARS {
+        str.chars().take(MAX_CHARS - 3).collect::<String>() + "..."
+    } else {
+        str.to_string()
    }
 }
--- a/src/modules/launcher/open_state.rs
+++ b/src/modules/launcher/open_state.rs
@@ -1,43 +1,23 @@
-use crate::sway::SwayNode;
+use crate::clients::wayland::ToplevelInfo;

 /// Open state for a launcher item, or item window.
 #[derive(Debug, Clone, Eq, PartialEq, Copy)]
 pub enum OpenState {
    Closed,
-    Open { focused: bool, urgent: bool },
+    Open { focused: bool },
 }

 impl OpenState {
    /// Creates from `SwayNode`
-    pub const fn from_node(node: &SwayNode) -> Self {
+    pub const fn from_toplevel(toplevel: &ToplevelInfo) -> Self {
        Self::Open {
-            focused: node.focused,
-            urgent: node.urgent,
-        }
-    }
-
-    /// Creates open without focused/urgent
-    pub const fn open() -> Self {
-        Self::Open {
-            focused: false,
-            urgent: false,
+            focused: toplevel.active,
        }
    }

    /// Creates open with focused
-    pub const fn focused() -> Self {
-        Self::Open {
-            focused: true,
-            urgent: false,
-        }
-    }
-
-    /// Creates open with urgent
-    pub const fn urgent(urgent: bool) -> Self {
-        Self::Open {
-            focused: false,
-            urgent,
-        }
+    pub const fn focused(focused: bool) -> Self {
+        Self::Open { focused }
    }

    /// Checks if open
@@ -47,24 +27,18 @@ impl OpenState {

    /// Checks if open with focus
    pub const fn is_focused(self) -> bool {
-        matches!(self, Self::Open { focused: true, .. })
-    }
-
-    /// check if open with urgent
-    pub const fn is_urgent(self) -> bool {
-        matches!(self, Self::Open { urgent: true, .. })
+        matches!(self, Self::Open { focused: true })
    }

    /// Merges states together to produce a single state.
    /// This is effectively an OR operation,
    /// so sets state to open and flags to true if any state is open
    /// or any instance of the flag is true.
-    pub fn merge_states(states: Vec<&Self>) -> Self {
+    pub fn merge_states(states: &[&Self]) -> Self {
        states.iter().fold(Self::Closed, |merged, current| {
            if merged.is_open() || current.is_open() {
                Self::Open {
                    focused: merged.is_focused() || current.is_focused(),
-                    urgent: merged.is_urgent() || current.is_urgent(),
                }
            } else {
                Self::Closed
--- a/src/modules/launcher/popup.rs
+++ b/src/modules/launcher/popup.rs
@@ -1,36 +0,0 @@
-use crate::modules::launcher::item::LauncherWindow;
-use crate::modules::launcher::FocusEvent;
-pub use crate::popup::Popup;
-use gtk::prelude::*;
-use gtk::Button;
-use tokio::sync::mpsc;
-
-impl Popup {
-    pub fn set_windows(&self, windows: &[LauncherWindow], tx: &mpsc::Sender<FocusEvent>) {
-        // clear
-        for child in self.container.children() {
-            self.container.remove(&child);
-        }
-
-        for window in windows {
-            let mut button_builder = Button::builder().height_request(40);
-
-            if let Some(name) = &window.name {
-                button_builder = button_builder.label(name);
-            }
-
-            let button = button_builder.build();
-
-            let con_id = window.con_id;
-            let window = self.window.clone();
-            let tx = tx.clone();
-            button.connect_clicked(move |_| {
-                tx.try_send(FocusEvent::ConId(con_id))
-                    .expect("Failed to send focus event");
-                window.hide();
-            });
-
-            self.container.add(&button);
-        }
-    }
-}
--- a/src/modules/mod.rs
+++ b/src/modules/mod.rs
@@ -5,6 +5,7 @@
 /// Clicking the widget opens a popup containing the current time
 /// with second-level precision and a calendar.
 pub mod clock;
+pub mod custom;
 pub mod focused;
 pub mod launcher;
 pub mod mpd;
@@ -14,12 +15,13 @@ pub mod tray;
 pub mod workspaces;

 use crate::config::BarPosition;
+use crate::popup::ButtonGeometry;
 use color_eyre::Result;
-/// Shamelessly stolen from here:
-/// <https://github.com/zeroeightysix/rustbar/blob/master/src/modules/module.rs>
+use derive_builder::Builder;
 use glib::IsA;
 use gtk::gdk::Monitor;
 use gtk::{Application, Widget};
+use tokio::sync::mpsc;

 #[derive(Clone)]
 pub enum ModuleLocation {
@@ -28,19 +30,70 @@ pub enum ModuleLocation {
    Right,
 }

+#[derive(Builder)]
 pub struct ModuleInfo<'a> {
    pub app: &'a Application,
    pub location: ModuleLocation,
-    pub bar_position: &'a BarPosition,
+    pub bar_position: BarPosition,
    pub monitor: &'a Monitor,
    pub output_name: &'a str,
+    pub module_name: &'a str,
+}
+
+#[derive(Debug)]
+pub enum ModuleUpdateEvent<T> {
+    /// Sends an update to the module UI
+    Update(T),
+    /// Toggles the open state of the popup.
+    TogglePopup(ButtonGeometry),
+    /// Force sets the popup open.
+    /// Takes the button X position and width.
+    OpenPopup(ButtonGeometry),
+    /// Force sets the popup closed.
+    ClosePopup,
+}
+
+pub struct WidgetContext<TSend, TReceive> {
+    pub id: usize,
+    pub tx: mpsc::Sender<ModuleUpdateEvent<TSend>>,
+    pub controller_tx: mpsc::Sender<TReceive>,
+    pub widget_rx: glib::Receiver<TSend>,
+    pub popup_rx: glib::Receiver<TSend>,
+}
+
+pub struct ModuleWidget<W: IsA<Widget>> {
+    pub widget: W,
+    pub popup: Option<gtk::Box>,
 }

 pub trait Module<W>
 where
    W: IsA<Widget>,
 {
-    /// Consumes the module config
-    /// and produces a GTK widget of type `W`
-    fn into_widget(self, info: &ModuleInfo) -> Result<W>;
+    type SendMessage;
+    type ReceiveMessage;
+
+    fn spawn_controller(
+        &self,
+        info: &ModuleInfo,
+        tx: mpsc::Sender<ModuleUpdateEvent<Self::SendMessage>>,
+        rx: mpsc::Receiver<Self::ReceiveMessage>,
+    ) -> Result<()>;
+
+    fn into_widget(
+        self,
+        context: WidgetContext<Self::SendMessage, Self::ReceiveMessage>,
+        info: &ModuleInfo,
+    ) -> Result<ModuleWidget<W>>;
+
+    fn into_popup(
+        self,
+        _tx: mpsc::Sender<Self::ReceiveMessage>,
+        _rx: glib::Receiver<Self::SendMessage>,
+    ) -> Option<gtk::Box>
+    where
+        Self: Sized,
+    {
+        None
+    }
 }
--- a/src/modules/mpd.rs
+++ b/src/modules/mpd.rs
@@ -0,0 +1,492 @@
+use crate::clients::mpd::{get_client, get_duration, get_elapsed, MpdConnectionError};
+use crate::config::CommonConfig;
+use crate::modules::{Module, ModuleInfo, ModuleUpdateEvent, ModuleWidget, WidgetContext};
+use crate::popup::Popup;
+use color_eyre::Result;
+use dirs::{audio_dir, home_dir};
+use glib::Continue;
+use gtk::gdk_pixbuf::Pixbuf;
+use gtk::prelude::*;
+use gtk::{Button, Image, Label, Orientation, Scale};
+use mpd_client::commands;
+use mpd_client::responses::{PlayState, Song, Status};
+use mpd_client::tag::Tag;
+use regex::Regex;
+use serde::Deserialize;
+use std::path::PathBuf;
+use tokio::spawn;
+use tokio::sync::mpsc;
+use tokio::sync::mpsc::{Receiver, Sender};
+use tracing::error;
+
+#[derive(Debug)]
+pub enum PlayerCommand {
+    Previous,
+    Toggle,
+    Next,
+    Volume(u8),
+}
+
+#[derive(Debug, Deserialize, Clone)]
+pub struct Icons {
+    /// Icon to display when playing.
+    #[serde(default = "default_icon_play")]
+    play: String,
+    /// Icon to display when paused.
+    #[serde(default = "default_icon_pause")]
+    pause: String,
+    /// Icon to display under volume slider
+    #[serde(default = "default_icon_volume")]
+    volume: String,
+}
+
+impl Default for Icons {
+    fn default() -> Self {
+        Self {
+            pause: default_icon_pause(),
+            play: default_icon_play(),
+            volume: default_icon_volume(),
+        }
+    }
+}
+
+#[derive(Debug, Deserialize, Clone)]
+pub struct MpdModule {
+    /// TCP or Unix socket address.
+    #[serde(default = "default_socket")]
+    host: String,
+    /// Format of current song info to display on the bar.
+    #[serde(default = "default_format")]
+    format: String,
+
+    /// Player state icons
+    #[serde(default)]
+    icons: Icons,
+
+    /// Path to root of music directory.
+    #[serde(default = "default_music_dir")]
+    music_dir: PathBuf,
+
+    #[serde(flatten)]
+    pub common: CommonConfig,
+}
+
+fn default_socket() -> String {
+    String::from("localhost:6600")
+}
+
+fn default_format() -> String {
+    String::from("{icon}  {title} / {artist}")
+}
+
+fn default_icon_play() -> String {
+    String::from("")
+}
+
+fn default_icon_pause() -> String {
+    String::from("")
+}
+
+fn default_icon_volume() -> String {
+    String::from("墳")
+}
+
+fn default_music_dir() -> PathBuf {
+    audio_dir().unwrap_or_else(|| home_dir().map(|dir| dir.join("Music")).unwrap_or_default())
+}
+
+/// Attempts to read the first value for a tag
+/// (since the MPD client returns a vector of tags, or None)
+pub fn try_get_first_tag(vec: Option<&Vec<String>>) -> Option<&str> {
+    vec.and_then(|vec| vec.first().map(String::as_str))
+}
+
+/// Formats a duration given in seconds
+/// in hh:mm format
+fn format_time(time: u64) -> String {
+    let minutes = (time / 60) % 60;
+    let seconds = time % 60;
+
+    format!("{:0>2}:{:0>2}", minutes, seconds)
+}
+
+/// Extracts the formatting tokens from a formatting string
+fn get_tokens(re: &Regex, format_string: &str) -> Vec<String> {
+    re.captures_iter(format_string)
+        .map(|caps| caps[1].to_string())
+        .collect::<Vec<_>>()
+}
+
+#[derive(Clone, Debug)]
+pub struct SongUpdate {
+    song: Song,
+    status: Status,
+    display_string: String,
+}
+
+impl Module<Button> for MpdModule {
+    type SendMessage = Option<SongUpdate>;
+    type ReceiveMessage = PlayerCommand;
+
+    fn spawn_controller(
+        &self,
+        _info: &ModuleInfo,
+        tx: Sender<ModuleUpdateEvent<Self::SendMessage>>,
+        mut rx: Receiver<Self::ReceiveMessage>,
+    ) -> Result<()> {
+        let host1 = self.host.clone();
+        let host2 = self.host.clone();
+        let format = self.format.clone();
+        let icons = self.icons.clone();
+
+        let re = Regex::new(r"\{([\w-]+)}")?;
+        let tokens = get_tokens(&re, self.format.as_str());
+
+        // poll mpd server
+        spawn(async move {
+            let client = get_client(&host1).await.expect("Failed to connect to MPD");
+            let mut mpd_rx = client.subscribe();
+
+            loop {
+                let current_song = client.command(commands::CurrentSong).await;
+                let status = client.command(commands::Status).await;
+
+                if let (Ok(Some(song)), Ok(status)) = (current_song, status) {
+                    let display_string =
+                        replace_tokens(format.as_str(), &tokens, &song.song, &status, &icons);
+
+                    let update = SongUpdate {
+                        song: song.song,
+                        status,
+                        display_string,
+                    };
+
+                    tx.send(ModuleUpdateEvent::Update(Some(update))).await?;
+                } else {
+                    tx.send(ModuleUpdateEvent::Update(None)).await?;
+                }
+
+                // wait for player state change
+                if mpd_rx.recv().await.is_err() {
+                    break;
+                }
+            }
+
+            Ok::<(), mpsc::error::SendError<ModuleUpdateEvent<Self::SendMessage>>>(())
+        });
+
+        // listen to ui events
+        spawn(async move {
+            let client = get_client(&host2).await?;
+
+            while let Some(event) = rx.recv().await {
+                let res = match event {
+                    PlayerCommand::Previous => client.command(commands::Previous).await,
+                    PlayerCommand::Toggle => match client.command(commands::Status).await {
+                        Ok(status) => match status.state {
+                            PlayState::Playing => client.command(commands::SetPause(true)).await,
+                            PlayState::Paused => client.command(commands::SetPause(false)).await,
+                            PlayState::Stopped => Ok(()),
+                        },
+                        Err(err) => Err(err),
+                    },
+                    PlayerCommand::Next => client.command(commands::Next).await,
+                    PlayerCommand::Volume(vol) => client.command(commands::SetVolume(vol)).await,
+                };
+
+                if let Err(err) = res {
+                    error!("Failed to send command to MPD server: {:?}", err);
+                }
+            }
+
+            Ok::<(), MpdConnectionError>(())
+        });
+
+        Ok(())
+    }
+
+    fn into_widget(
+        self,
+        context: WidgetContext<Self::SendMessage, Self::ReceiveMessage>,
+        info: &ModuleInfo,
+    ) -> Result<ModuleWidget<Button>> {
+        let button = Button::new();
+        let label = Label::new(None);
+        label.set_angle(info.bar_position.get_angle());
+        button.add(&label);
+
+        let orientation = info.bar_position.get_orientation();
+
+        {
+            let tx = context.tx.clone();
+
+            button.connect_clicked(move |button| {
+                tx.try_send(ModuleUpdateEvent::TogglePopup(Popup::button_pos(
+                    button,
+                    orientation,
+                )))
+                .expect("Failed to send MPD popup open event");
+            });
+        }
+
+        {
+            let button = button.clone();
+            let tx = context.tx.clone();
+
+            context.widget_rx.attach(None, move |mut event| {
+                if let Some(event) = event.take() {
+                    label.set_label(&event.display_string);
+                    button.show();
+                } else {
+                    button.hide();
+                    tx.try_send(ModuleUpdateEvent::ClosePopup)
+                        .expect("Failed to send close popup message");
+                }
+
+                Continue(true)
+            });
+        };
+
+        let popup = self.into_popup(context.controller_tx, context.popup_rx);
+
+        Ok(ModuleWidget {
+            widget: button,
+            popup,
+        })
+    }
+
+    fn into_popup(
+        self,
+        tx: Sender<Self::ReceiveMessage>,
+        rx: glib::Receiver<Self::SendMessage>,
+    ) -> Option<gtk::Box> {
+        let container = gtk::Box::builder()
+            .orientation(Orientation::Horizontal)
+            .spacing(10)
+            .name("popup-mpd")
+            .build();
+
+        let album_image = Image::builder()
+            .width_request(128)
+            .height_request(128)
+            .name("album-art")
+            .build();
+
+        let info_box = gtk::Box::new(Orientation::Vertical, 10);
+        let title_label = IconLabel::new("\u{f886}", None);
+        let album_label = IconLabel::new("\u{f524}", None);
+        let artist_label = IconLabel::new("\u{fd01}", None);
+
+        title_label.container.set_widget_name("title");
+        album_label.container.set_widget_name("album");
+        artist_label.container.set_widget_name("label");
+
+        info_box.add(&title_label.container);
+        info_box.add(&album_label.container);
+        info_box.add(&artist_label.container);
+
+        let controls_box = gtk::Box::builder().name("controls").build();
+        let btn_prev = Button::builder().label("\u{f9ad}").name("btn-prev").build();
+        let btn_play_pause = Button::builder().label("").name("btn-play-pause").build();
+        let btn_next = Button::builder().label("\u{f9ac}").name("btn-next").build();
+
+        controls_box.add(&btn_prev);
+        controls_box.add(&btn_play_pause);
+        controls_box.add(&btn_next);
+
+        info_box.add(&controls_box);
+
+        let volume_box = gtk::Box::builder()
+            .orientation(Orientation::Vertical)
+            .spacing(5)
+            .name("volume")
+            .build();
+
+        let volume_slider = Scale::with_range(Orientation::Vertical, 0.0, 100.0, 5.0);
+        volume_slider.set_inverted(true);
+        volume_slider.set_widget_name("scale");
+
+        let volume_icon = Label::new(Some(&self.icons.volume));
+        volume_icon.style_context().add_class("icon");
+
+        volume_box.pack_start(&volume_slider, true, true, 0);
+        volume_box.pack_end(&volume_icon, false, false, 0);
+
+        container.add(&album_image);
+        container.add(&info_box);
+        container.add(&volume_box);
+
+        let tx_prev = tx.clone();
+        btn_prev.connect_clicked(move |_| {
+            tx_prev
+                .try_send(PlayerCommand::Previous)
+                .expect("Failed to send prev track message");
+        });
+
+        let tx_toggle = tx.clone();
+        btn_play_pause.connect_clicked(move |_| {
+            tx_toggle
+                .try_send(PlayerCommand::Toggle)
+                .expect("Failed to send play/pause track message");
+        });
+
+        let tx_next = tx.clone();
+        btn_next.connect_clicked(move |_| {
+            tx_next
+                .try_send(PlayerCommand::Next)
+                .expect("Failed to send next track message");
+        });
+
+        let tx_vol = tx;
+        volume_slider.connect_change_value(move |_, _, val| {
+            tx_vol
+                .try_send(PlayerCommand::Volume(val as u8))
+                .expect("Failed to send volume message");
+
+            Inhibit(false)
+        });
+
+        container.show_all();
+
+        {
+            let music_dir = self.music_dir;
+
+            rx.attach(None, move |update| {
+                if let Some(update) = update {
+                    let prev_album = album_label.label.text();
+                    let curr_album = update.song.album().unwrap_or_default();
+
+                    // only update art when album changes
+                    if prev_album != curr_album {
+                        let cover_path = music_dir.join(
+                            update
+                                .song
+                                .file_path()
+                                .parent()
+                                .expect("Song path should not be root")
+                                .join("cover.jpg"),
+                        );
+
+                        Pixbuf::from_file_at_scale(cover_path, 128, 128, true).map_or_else(
+                            |_| {
+                                album_image.set_from_pixbuf(None);
+                            },
+                            |pixbuf| {
+                                album_image.set_from_pixbuf(Some(&pixbuf));
+                            },
+                        );
+                    }
+
+                    title_label
+                        .label
+                        .set_text(update.song.title().unwrap_or_default());
+                    album_label.label.set_text(curr_album);
+                    artist_label
+                        .label
+                        .set_text(update.song.artists().first().unwrap_or(&String::new()));
+
+                    match update.status.state {
+                        PlayState::Stopped => {
+                            btn_play_pause.set_sensitive(false);
+                        }
+                        PlayState::Playing => {
+                            btn_play_pause.set_sensitive(true);
+                            btn_play_pause.set_label("");
+                        }
+                        PlayState::Paused => {
+                            btn_play_pause.set_sensitive(true);
+                            btn_play_pause.set_label("");
+                        }
+                    }
+
+                    let enable_prev = match update.status.current_song {
+                        Some((pos, _)) => pos.0 > 0,
+                        None => false,
+                    };
+
+                    let enable_next = match update.status.current_song {
+                        Some((pos, _)) => pos.0 < update.status.playlist_length,
+                        None => false,
+                    };
+
+                    btn_prev.set_sensitive(enable_prev);
+                    btn_next.set_sensitive(enable_next);
+
+                    volume_slider.set_value(update.status.volume as f64);
+                }
+
+                Continue(true)
+            });
+        }
+
+        Some(container)
+    }
+}
+
+/// Replaces each of the formatting tokens in the formatting string
+/// with actual data pulled from MPD
+fn replace_tokens(
+    format_string: &str,
+    tokens: &Vec<String>,
+    song: &Song,
+    status: &Status,
+    icons: &Icons,
+) -> String {
+    let mut compiled_string = format_string.to_string();
+    for token in tokens {
+        let value = get_token_value(song, status, icons, token);
+        compiled_string =
+            compiled_string.replace(format!("{{{}}}", token).as_str(), value.as_str());
+    }
+    compiled_string
+}
+
+/// Converts a string format token value
+/// into its respective MPD value.
+fn get_token_value(song: &Song, status: &Status, icons: &Icons, token: &str) -> String {
+    let s = match token {
+        "icon" => {
+            let icon = match status.state {
+                PlayState::Stopped => None,
+                PlayState::Playing => Some(&icons.play),
+                PlayState::Paused => Some(&icons.pause),
+            };
+            icon.map(String::as_str)
+        }
+        "title" => song.title(),
+        "album" => try_get_first_tag(song.tags.get(&Tag::Album)),
+        "artist" => try_get_first_tag(song.tags.get(&Tag::Artist)),
+        "date" => try_get_first_tag(song.tags.get(&Tag::Date)),
+        "disc" => try_get_first_tag(song.tags.get(&Tag::Disc)),
+        "genre" => try_get_first_tag(song.tags.get(&Tag::Genre)),
+        "track" => try_get_first_tag(song.tags.get(&Tag::Track)),
+        "duration" => return get_duration(status).map(format_time).unwrap_or_default(),
+
+        "elapsed" => return get_elapsed(status).map(format_time).unwrap_or_default(),
+        _ => Some(token),
+    };
+    s.unwrap_or_default().to_string()
+}
+
+#[derive(Clone)]
+struct IconLabel {
+    label: Label,
+    container: gtk::Box,
+}
+
+impl IconLabel {
+    fn new(icon: &str, label: Option<&str>) -> Self {
+        let container = gtk::Box::new(Orientation::Horizontal, 5);
+
+        let icon = Label::new(Some(icon));
+        let label = Label::new(label);
+
+        icon.style_context().add_class("icon");
+        label.style_context().add_class("label");
+
+        container.add(&icon);
+        container.add(&label);
+
+        Self { label, container }
+    }
+}
--- a/src/modules/mpd/client.rs
+++ b/src/modules/mpd/client.rs
@@ -1,90 +0,0 @@
-use lazy_static::lazy_static;
-use mpd_client::client::Connection;
-use mpd_client::protocol::MpdProtocolError;
-use mpd_client::responses::Status;
-use mpd_client::Client;
-use std::collections::HashMap;
-use std::path::PathBuf;
-use std::sync::Arc;
-use std::time::Duration;
-use tokio::net::{TcpStream, UnixStream};
-use tokio::sync::Mutex;
-use tokio::time::sleep;
-
-lazy_static! {
-    static ref CLIENTS: Arc<Mutex<HashMap<String, Arc<Client>>>> =
-        Arc::new(Mutex::new(HashMap::new()));
-}
-
-pub async fn get_connection(host: &str) -> Option<Arc<Client>> {
-    let mut clients = CLIENTS.lock().await;
-
-    match clients.get(host) {
-        Some(client) => Some(Arc::clone(client)),
-        None => {
-            let client = wait_for_connection(host, Duration::from_secs(5), None).await?;
-            let client = Arc::new(client);
-            clients.insert(host.to_string(), Arc::clone(&client));
-            Some(client)
-        }
-    }
-}
-
-async fn wait_for_connection(
-    host: &str,
-    interval: Duration,
-    max_retries: Option<usize>,
-) -> Option<Client> {
-    let mut retries = 0;
-    let max_retries = max_retries.unwrap_or(usize::MAX);
-
-    loop {
-        if retries == max_retries {
-            break None;
-        }
-
-        if let Some(conn) = try_get_mpd_conn(host).await {
-            break Some(conn.0);
-        }
-
-        retries += 1;
-        sleep(interval).await;
-    }
-}
-
-/// Cycles through each MPD host and
-/// returns the first one which connects,
-/// or none if there are none
-async fn try_get_mpd_conn(host: &str) -> Option<Connection> {
-    let connection = if is_unix_socket(host) {
-        connect_unix(host).await
-    } else {
-        connect_tcp(host).await
-    };
-
-    connection.ok()
-}
-
-fn is_unix_socket(host: &str) -> bool {
-    PathBuf::from(host).is_file()
-}
-
-async fn connect_unix(host: &str) -> Result<Connection, MpdProtocolError> {
-    let connection = UnixStream::connect(host).await?;
-    Client::connect(connection).await
-}
-
-async fn connect_tcp(host: &str) -> Result<Connection, MpdProtocolError> {
-    let connection = TcpStream::connect(host).await?;
-    Client::connect(connection).await
-}
-
-/// Gets the duration of the current song
-pub fn get_duration(status: &Status) -> Option<u64> {
-    status.duration.map(|duration| duration.as_secs())
-}
-
-/// Gets the elapsed time of the current song
-pub fn get_elapsed(status: &Status) -> Option<u64> {
-    status.elapsed.map(|duration| duration.as_secs())
-}
--- a/src/modules/mpd/mod.rs
+++ b/src/modules/mpd/mod.rs
@@ -1,251 +0,0 @@
-mod client;
-mod popup;
-
-use self::popup::Popup;
-use crate::modules::mpd::client::{get_connection, get_duration, get_elapsed};
-use crate::modules::mpd::popup::{MpdPopup, PopupEvent};
-use crate::modules::{Module, ModuleInfo};
-use color_eyre::Result;
-use dirs::{audio_dir, home_dir};
-use glib::Continue;
-use gtk::prelude::*;
-use gtk::{Button, Orientation};
-use mpd_client::commands;
-use mpd_client::responses::{PlayState, Song, Status};
-use mpd_client::tag::Tag;
-use regex::Regex;
-use serde::Deserialize;
-use std::path::PathBuf;
-use std::time::Duration;
-use tokio::spawn;
-use tokio::sync::mpsc;
-use tokio::time::sleep;
-use tracing::error;
-
-#[derive(Debug, Deserialize, Clone)]
-pub struct MpdModule {
-    /// TCP or Unix socket address.
-    #[serde(default = "default_socket")]
-    host: String,
-    /// Format of current song info to display on the bar.
-    #[serde(default = "default_format")]
-    format: String,
-    /// Icon to display when playing.
-    #[serde(default = "default_icon_play")]
-    icon_play: Option<String>,
-    /// Icon to display when paused.
-    #[serde(default = "default_icon_pause")]
-    icon_pause: Option<String>,
-
-    /// Path to root of music directory.
-    #[serde(default = "default_music_dir")]
-    music_dir: PathBuf,
-}
-
-fn default_socket() -> String {
-    String::from("localhost:6600")
-}
-
-fn default_format() -> String {
-    String::from("{icon}  {title} / {artist}")
-}
-
-#[allow(clippy::unnecessary_wraps)]
-fn default_icon_play() -> Option<String> {
-    Some(String::from(""))
-}
-
-#[allow(clippy::unnecessary_wraps)]
-fn default_icon_pause() -> Option<String> {
-    Some(String::from(""))
-}
-
-fn default_music_dir() -> PathBuf {
-    audio_dir().unwrap_or_else(|| home_dir().map(|dir| dir.join("Music")).unwrap_or_default())
-}
-
-/// Attempts to read the first value for a tag
-/// (since the MPD client returns a vector of tags, or None)
-pub fn try_get_first_tag(vec: Option<&Vec<String>>) -> Option<&str> {
-    match vec {
-        Some(vec) => vec.first().map(String::as_str),
-        None => None,
-    }
-}
-
-/// Formats a duration given in seconds
-/// in hh:mm format
-fn format_time(time: u64) -> String {
-    let minutes = (time / 60) % 60;
-    let seconds = time % 60;
-
-    format!("{:0>2}:{:0>2}", minutes, seconds)
-}
-
-/// Extracts the formatting tokens from a formatting string
-fn get_tokens(re: &Regex, format_string: &str) -> Vec<String> {
-    re.captures_iter(format_string)
-        .map(|caps| caps[1].to_string())
-        .collect::<Vec<_>>()
-}
-
-enum Event {
-    Open,
-    Update(Box<Option<(Song, Status, String)>>),
-}
-
-impl Module<Button> for MpdModule {
-    fn into_widget(self, info: &ModuleInfo) -> Result<Button> {
-        let re = Regex::new(r"\{([\w-]+)}")?;
-        let tokens = get_tokens(&re, self.format.as_str());
-
-        let button = Button::new();
-
-        let (ui_tx, mut ui_rx) = mpsc::channel(32);
-
-        let popup = Popup::new(
-            "popup-mpd",
-            info.app,
-            info.monitor,
-            Orientation::Horizontal,
-            info.bar_position,
-        );
-        let mpd_popup = MpdPopup::new(popup, ui_tx);
-
-        let (tx, rx) = glib::MainContext::channel(glib::PRIORITY_DEFAULT);
-        let click_tx = tx.clone();
-
-        let music_dir = self.music_dir.clone();
-
-        button.connect_clicked(move |_| {
-            click_tx
-                .send(Event::Open)
-                .expect("Failed to send popup open event");
-        });
-
-        let host = self.host.clone();
-        let host2 = self.host.clone();
-        spawn(async move {
-            let client = get_connection(&host)
-                .await
-                .expect("Unexpected error when trying to connect to MPD server");
-
-            loop {
-                let current_song = client.command(commands::CurrentSong).await;
-                let status = client.command(commands::Status).await;
-
-                if let (Ok(Some(song)), Ok(status)) = (current_song, status) {
-                    let string = self
-                        .replace_tokens(self.format.as_str(), &tokens, &song.song, &status)
-                        .await;
-
-                    tx.send(Event::Update(Box::new(Some((song.song, status, string)))))
-                        .expect("Failed to send update event");
-                } else {
-                    tx.send(Event::Update(Box::new(None)))
-                        .expect("Failed to send update event");
-                }
-
-                sleep(Duration::from_secs(1)).await;
-            }
-        });
-
-        spawn(async move {
-            let client = get_connection(&host2)
-                .await
-                .expect("Unexpected error when trying to connect to MPD server");
-
-            while let Some(event) = ui_rx.recv().await {
-                let res = match event {
-                    PopupEvent::Previous => client.command(commands::Previous).await,
-                    PopupEvent::Toggle => match client.command(commands::Status).await {
-                        Ok(status) => match status.state {
-                            PlayState::Playing => client.command(commands::SetPause(true)).await,
-                            PlayState::Paused => client.command(commands::SetPause(false)).await,
-                            PlayState::Stopped => Ok(()),
-                        },
-                        Err(err) => Err(err),
-                    },
-                    PopupEvent::Next => client.command(commands::Next).await,
-                };
-
-                if let Err(err) = res {
-                    error!("Failed to send command to MPD server: {:?}", err);
-                }
-            }
-        });
-
-        {
-            let button = button.clone();
-
-            rx.attach(None, move |event| {
-                match event {
-                    Event::Open => {
-                        mpd_popup.popup.show(&button);
-                    }
-                    Event::Update(mut msg) => {
-                        if let Some((song, status, string)) = msg.take() {
-                            mpd_popup.update(&song, &status, music_dir.as_path());
-
-                            button.set_label(&string);
-                            button.show();
-                        } else {
-                            button.hide();
-                        }
-                    }
-                }
-
-                Continue(true)
-            });
-        };
-
-        Ok(button)
-    }
-}
-
-impl MpdModule {
-    /// Replaces each of the formatting tokens in the formatting string
-    /// with actual data pulled from MPD
-    async fn replace_tokens(
-        &self,
-        format_string: &str,
-        tokens: &Vec<String>,
-        song: &Song,
-        status: &Status,
-    ) -> String {
-        let mut compiled_string = format_string.to_string();
-        for token in tokens {
-            let value = self.get_token_value(song, status, token).await;
-            compiled_string =
-                compiled_string.replace(format!("{{{}}}", token).as_str(), value.as_str());
-        }
-        compiled_string
-    }
-
-    /// Converts a string format token value
-    /// into its respective MPD value.
-    pub async fn get_token_value(&self, song: &Song, status: &Status, token: &str) -> String {
-        let s = match token {
-            "icon" => {
-                let icon = match status.state {
-                    PlayState::Stopped => None,
-                    PlayState::Playing => self.icon_play.as_ref(),
-                    PlayState::Paused => self.icon_pause.as_ref(),
-                };
-                icon.map(String::as_str)
-            }
-            "title" => song.title(),
-            "album" => try_get_first_tag(song.tags.get(&Tag::Album)),
-            "artist" => try_get_first_tag(song.tags.get(&Tag::Artist)),
-            "date" => try_get_first_tag(song.tags.get(&Tag::Date)),
-            "disc" => try_get_first_tag(song.tags.get(&Tag::Disc)),
-            "genre" => try_get_first_tag(song.tags.get(&Tag::Genre)),
-            "track" => try_get_first_tag(song.tags.get(&Tag::Track)),
-            "duration" => return get_duration(status).map(format_time).unwrap_or_default(),
-
-            "elapsed" => return get_elapsed(status).map(format_time).unwrap_or_default(),
-            _ => Some(token),
-        };
-        s.unwrap_or_default().to_string()
-    }
-}
--- a/src/modules/mpd/popup.rs
+++ b/src/modules/mpd/popup.rs
@@ -1,175 +0,0 @@
-pub use crate::popup::Popup;
-use gtk::gdk_pixbuf::Pixbuf;
-use gtk::prelude::*;
-use gtk::{Button, Image, Label, Orientation};
-use mpd_client::responses::{PlayState, Song, Status};
-use std::path::Path;
-use tokio::sync::mpsc;
-
-#[derive(Clone)]
-struct IconLabel {
-    label: Label,
-    container: gtk::Box,
-}
-
-impl IconLabel {
-    fn new(icon: &str, label: Option<&str>) -> Self {
-        let container = gtk::Box::new(Orientation::Horizontal, 5);
-
-        let icon = Label::new(Some(icon));
-        let label = Label::new(label);
-
-        icon.style_context().add_class("icon");
-        label.style_context().add_class("label");
-
-        container.add(&icon);
-        container.add(&label);
-
-        Self { label, container }
-    }
-}
-
-#[derive(Clone)]
-pub struct MpdPopup {
-    pub popup: Popup,
-
-    cover: Image,
-
-    title: IconLabel,
-    album: IconLabel,
-    artist: IconLabel,
-
-    btn_prev: Button,
-    btn_play_pause: Button,
-    btn_next: Button,
-}
-
-#[derive(Debug)]
-pub enum PopupEvent {
-    Previous,
-    Toggle,
-    Next,
-}
-
-impl MpdPopup {
-    pub fn new(popup: Popup, tx: mpsc::Sender<PopupEvent>) -> Self {
-        let album_image = Image::builder()
-            .width_request(128)
-            .height_request(128)
-            .name("album-art")
-            .build();
-
-        let info_box = gtk::Box::new(Orientation::Vertical, 10);
-
-        let title_label = IconLabel::new("\u{f886}", None);
-        let album_label = IconLabel::new("\u{f524}", None);
-        let artist_label = IconLabel::new("\u{fd01}", None);
-
-        title_label.container.set_widget_name("title");
-        album_label.container.set_widget_name("album");
-        artist_label.container.set_widget_name("label");
-
-        info_box.add(&title_label.container);
-        info_box.add(&album_label.container);
-        info_box.add(&artist_label.container);
-
-        let controls_box = gtk::Box::builder().name("controls").build();
-
-        let btn_prev = Button::builder().label("\u{f9ad}").name("btn-prev").build();
-        let btn_play_pause = Button::builder().label("").name("btn-play-pause").build();
-        let btn_next = Button::builder().label("\u{f9ac}").name("btn-next").build();
-
-        controls_box.add(&btn_prev);
-        controls_box.add(&btn_play_pause);
-        controls_box.add(&btn_next);
-
-        info_box.add(&controls_box);
-
-        popup.container.add(&album_image);
-        popup.container.add(&info_box);
-
-        let tx_prev = tx.clone();
-        btn_prev.connect_clicked(move |_| {
-            tx_prev
-                .try_send(PopupEvent::Previous)
-                .expect("Failed to send prev track message");
-        });
-
-        let tx_toggle = tx.clone();
-        btn_play_pause.connect_clicked(move |_| {
-            tx_toggle
-                .try_send(PopupEvent::Toggle)
-                .expect("Failed to send play/pause track message");
-        });
-
-        let tx_next = tx;
-        btn_next.connect_clicked(move |_| {
-            tx_next
-                .try_send(PopupEvent::Next)
-                .expect("Failed to send next track message");
-        });
-
-        Self {
-            popup,
-            cover: album_image,
-            artist: artist_label,
-            album: album_label,
-            title: title_label,
-            btn_prev,
-            btn_play_pause,
-            btn_next,
-        }
-    }
-
-    pub fn update(&self, song: &Song, status: &Status, path: &Path) {
-        let prev_album = self.album.label.text();
-        let curr_album = song.album().unwrap_or_default();
-
-        // only update art when album changes
-        if prev_album != curr_album {
-            let cover_path = path.join(
-                song.file_path()
-                    .parent()
-                    .expect("Song path should not be root")
-                    .join("cover.jpg"),
-            );
-
-            if let Ok(pixbuf) = Pixbuf::from_file_at_scale(cover_path, 128, 128, true) {
-                self.cover.set_from_pixbuf(Some(&pixbuf));
-            }
-        }
-
-        self.title.label.set_text(song.title().unwrap_or_default());
-        self.album.label.set_text(song.album().unwrap_or_default());
-        self.artist
-            .label
-            .set_text(song.artists().first().unwrap_or(&String::new()));
-
-        match status.state {
-            PlayState::Stopped => {
-                self.btn_play_pause.set_sensitive(false);
-            }
-            PlayState::Playing => {
-                self.btn_play_pause.set_sensitive(true);
-                self.btn_play_pause.set_label("");
-            }
-            PlayState::Paused => {
-                self.btn_play_pause.set_sensitive(true);
-                self.btn_play_pause.set_label("");
-            }
-        }
-
-        let enable_prev = match status.current_song {
-            Some((pos, _)) => pos.0 > 0,
-            None => false,
-        };
-
-        let enable_next = match status.current_song {
-            Some((pos, _)) => pos.0 < status.playlist_length,
-            None => false,
-        };
-
-        self.btn_prev.set_sensitive(enable_prev);
-        self.btn_next.set_sensitive(enable_next);
-    }
-}
--- a/src/modules/script.rs
+++ b/src/modules/script.rs
@@ -1,20 +1,32 @@
-use crate::modules::{Module, ModuleInfo};
-use color_eyre::{eyre::Report, eyre::Result, eyre::WrapErr, Section};
+use crate::config::CommonConfig;
+use crate::modules::{Module, ModuleInfo, ModuleUpdateEvent, ModuleWidget, WidgetContext};
+use crate::script::{OutputStream, Script, ScriptMode};
+use color_eyre::{Help, Report, Result};
 use gtk::prelude::*;
 use gtk::Label;
 use serde::Deserialize;
-use std::process::Command;
 use tokio::spawn;
-use tokio::time::sleep;
-use tracing::{error, instrument};
+use tokio::sync::mpsc::{Receiver, Sender};
+use tracing::error;

 #[derive(Debug, Deserialize, Clone)]
 pub struct ScriptModule {
    /// Path to script to execute.
-    path: String,
+    cmd: String,
+    /// Script execution mode
+    #[serde(default = "default_mode")]
+    mode: ScriptMode,
    /// Time in milliseconds between executions.
    #[serde(default = "default_interval")]
    interval: u64,
+
+    #[serde(flatten)]
+    pub common: CommonConfig,
+}
+
+/// `Mode::Poll`
+const fn default_mode() -> ScriptMode {
+    ScriptMode::Poll
 }

 /// 5000ms
@@ -22,58 +34,65 @@ const fn default_interval() -> u64 {
    5000
 }

+impl From<&ScriptModule> for Script {
+    fn from(module: &ScriptModule) -> Self {
+        Self {
+            mode: module.mode,
+            cmd: module.cmd.clone(),
+            interval: module.interval,
+        }
+    }
+}
+
 impl Module<Label> for ScriptModule {
-    fn into_widget(self, _info: &ModuleInfo) -> Result<Label> {
-        let label = Label::builder().use_markup(true).build();
+    type SendMessage = String;
+    type ReceiveMessage = ();
+
+    fn spawn_controller(
+        &self,
+        _info: &ModuleInfo,
+        tx: Sender<ModuleUpdateEvent<Self::SendMessage>>,
+        _rx: Receiver<Self::ReceiveMessage>,
+    ) -> Result<()> {
+        let script: Script = self.into();

-        let (tx, rx) = glib::MainContext::channel(glib::PRIORITY_DEFAULT);
        spawn(async move {
-            loop {
-                match self.run_script() {
-                    Ok(stdout) => tx.send(stdout).expect("Failed to send stdout"),
-                    Err(err) => error!("{:?}", err),
-                }
-
-                sleep(tokio::time::Duration::from_millis(self.interval)).await;
-            }
+            script.run(move |(out, _)| match out {
+               OutputStream::Stdout(stdout) => {
+                   tx.try_send(ModuleUpdateEvent::Update(stdout))
+                       .expect("Failed to send stdout"); }
+               OutputStream::Stderr(stderr) => {
+                   error!("{:?}", Report::msg(stderr)
+                                    .wrap_err("Watched script error:")
+                                    .suggestion("Check the path to your script")
+                                    .suggestion("Check the script for errors")
+                                    .suggestion("If you expect the script to write to stderr, consider redirecting its output to /dev/null to suppress these messages"));
+               }
+           }).await;
        });

+        Ok(())
+    }
+
+    fn into_widget(
+        self,
+        context: WidgetContext<Self::SendMessage, Self::ReceiveMessage>,
+        info: &ModuleInfo,
+    ) -> Result<ModuleWidget<Label>> {
+        let label = Label::builder().use_markup(true).build();
+        label.set_angle(info.bar_position.get_angle());
+
        {
            let label = label.clone();
-            rx.attach(None, move |s| {
-                label.set_label(s.as_str());
+            context.widget_rx.attach(None, move |s| {
+                label.set_markup(s.as_str());
                Continue(true)
            });
        }

-        Ok(label)
-    }
-}
-
-impl ScriptModule {
-    #[instrument]
-    fn run_script(&self) -> Result<String> {
-        let output = Command::new("sh")
-            .arg("-c")
-            .arg(&self.path)
-            .output()
-            .wrap_err("Failed to get script output")?;
-
-        if output.status.success() {
-            let stdout = String::from_utf8(output.stdout)
-                .map(|output| output.trim().to_string())
-                .wrap_err("Script stdout not valid UTF-8")?;
-
-            Ok(stdout)
-        } else {
-            let stderr = String::from_utf8(output.stderr)
-                .map(|output| output.trim().to_string())
-                .wrap_err("Script stderr not valid UTF-8")?;
-
-            Err(Report::msg(stderr)
-                .wrap_err("Script returned non-zero error code")
-                .suggestion("Check the path to your script")
-                .suggestion("Check the script for errors"))
-        }
+        Ok(ModuleWidget {
+            widget: label,
+            popup: None,
+        })
    }
 }
--- a/src/modules/sysinfo.rs
+++ b/src/modules/sysinfo.rs
@@ -1,77 +1,456 @@
-use crate::modules::{Module, ModuleInfo};
+use crate::config::CommonConfig;
+use crate::modules::{Module, ModuleInfo, ModuleUpdateEvent, ModuleWidget, WidgetContext};
 use color_eyre::Result;
 use gtk::prelude::*;
-use gtk::{Label, Orientation};
+use gtk::Label;
 use regex::{Captures, Regex};
 use serde::Deserialize;
 use std::collections::HashMap;
-use sysinfo::{CpuExt, System, SystemExt};
+use std::time::Duration;
+use sysinfo::{ComponentExt, CpuExt, DiskExt, NetworkExt, RefreshKind, System, SystemExt};
 use tokio::spawn;
+use tokio::sync::mpsc;
+use tokio::sync::mpsc::{Receiver, Sender};
 use tokio::time::sleep;

 #[derive(Debug, Deserialize, Clone)]
 pub struct SysInfoModule {
    /// List of formatting strings.
    format: Vec<String>,
+    /// Number of seconds between refresh
+    #[serde(default = "Interval::default")]
+    interval: Interval,
+
+    #[serde(flatten)]
+    pub common: CommonConfig,
+}
+
+#[derive(Debug, Deserialize, Copy, Clone)]
+pub struct Intervals {
+    #[serde(default = "default_interval")]
+    memory: u64,
+    #[serde(default = "default_interval")]
+    cpu: u64,
+    #[serde(default = "default_interval")]
+    temps: u64,
+    #[serde(default = "default_interval")]
+    disks: u64,
+    #[serde(default = "default_interval")]
+    networks: u64,
+    #[serde(default = "default_interval")]
+    system: u64,
+}
+
+#[derive(Debug, Deserialize, Copy, Clone)]
+#[serde(untagged)]
+pub enum Interval {
+    All(u64),
+    Individual(Intervals),
+}
+
+impl Default for Interval {
+    fn default() -> Self {
+        Self::All(default_interval())
+    }
+}
+
+impl Interval {
+    const fn memory(self) -> u64 {
+        match self {
+            Self::All(n) => n,
+            Self::Individual(intervals) => intervals.memory,
+        }
+    }
+
+    const fn cpu(self) -> u64 {
+        match self {
+            Self::All(n) => n,
+            Self::Individual(intervals) => intervals.cpu,
+        }
+    }
+
+    const fn temps(self) -> u64 {
+        match self {
+            Self::All(n) => n,
+            Self::Individual(intervals) => intervals.temps,
+        }
+    }
+
+    const fn disks(self) -> u64 {
+        match self {
+            Self::All(n) => n,
+            Self::Individual(intervals) => intervals.disks,
+        }
+    }
+
+    const fn networks(self) -> u64 {
+        match self {
+            Self::All(n) => n,
+            Self::Individual(intervals) => intervals.networks,
+        }
+    }
+
+    const fn system(self) -> u64 {
+        match self {
+            Self::All(n) => n,
+            Self::Individual(intervals) => intervals.system,
+        }
+    }
+}
+
+const fn default_interval() -> u64 {
+    5
+}
+
+#[derive(Debug)]
+enum RefreshType {
+    Memory,
+    Cpu,
+    Temps,
+    Disks,
+    Network,
+    System,
 }

 impl Module<gtk::Box> for SysInfoModule {
-    fn into_widget(self, _info: &ModuleInfo) -> Result<gtk::Box> {
-        let re = Regex::new(r"\{([\w-]+)}")?;
+    type SendMessage = HashMap<String, String>;
+    type ReceiveMessage = ();

-        let container = gtk::Box::new(Orientation::Horizontal, 10);
+    fn spawn_controller(
+        &self,
+        _info: &ModuleInfo,
+        tx: Sender<ModuleUpdateEvent<Self::SendMessage>>,
+        _rx: Receiver<Self::ReceiveMessage>,
+    ) -> Result<()> {
+        let interval = self.interval;
+
+        let refresh_kind = RefreshKind::everything()
+            .without_processes()
+            .without_users_list();
+
+        let mut sys = System::new_with_specifics(refresh_kind);
+        sys.refresh_components_list();
+        sys.refresh_disks_list();
+        sys.refresh_networks_list();
+
+        let (refresh_tx, mut refresh_rx) = mpsc::channel(16);
+
+        // memory refresh
+        {
+            let tx = refresh_tx.clone();
+            spawn(async move {
+                loop {
+                    tx.send(RefreshType::Memory)
+                        .await
+                        .expect("Failed to send memory refresh");
+                    sleep(Duration::from_secs(interval.memory())).await;
+                }
+            });
+        }
+
+        // cpu refresh
+        {
+            let tx = refresh_tx.clone();
+            spawn(async move {
+                loop {
+                    tx.send(RefreshType::Cpu)
+                        .await
+                        .expect("Failed to send cpu refresh");
+                    sleep(Duration::from_secs(interval.cpu())).await;
+                }
+            });
+        }
+
+        // temp refresh
+        {
+            let tx = refresh_tx.clone();
+            spawn(async move {
+                loop {
+                    tx.send(RefreshType::Temps)
+                        .await
+                        .expect("Failed to send temperature refresh");
+                    sleep(Duration::from_secs(interval.temps())).await;
+                }
+            });
+        }
+
+        // disk refresh
+        {
+            let tx = refresh_tx.clone();
+            spawn(async move {
+                loop {
+                    tx.send(RefreshType::Disks)
+                        .await
+                        .expect("Failed to send disk refresh");
+                    sleep(Duration::from_secs(interval.disks())).await;
+                }
+            });
+        }
+
+        // network refresh
+        {
+            let tx = refresh_tx.clone();
+            spawn(async move {
+                loop {
+                    tx.send(RefreshType::Network)
+                        .await
+                        .expect("Failed to send network refresh");
+                    sleep(Duration::from_secs(interval.networks())).await;
+                }
+            });
+        }
+
+        // system refresh
+        {
+            let tx = refresh_tx;
+            spawn(async move {
+                loop {
+                    tx.send(RefreshType::System)
+                        .await
+                        .expect("Failed to send system refresh");
+                    sleep(Duration::from_secs(interval.system())).await;
+                }
+            });
+        }
+
+        spawn(async move {
+            let mut format_info = HashMap::new();
+
+            while let Some(refresh) = refresh_rx.recv().await {
+                match refresh {
+                    RefreshType::Memory => refresh_memory_tokens(&mut format_info, &mut sys),
+                    RefreshType::Cpu => refresh_cpu_tokens(&mut format_info, &mut sys),
+                    RefreshType::Temps => refresh_temp_tokens(&mut format_info, &mut sys),
+                    RefreshType::Disks => refresh_disk_tokens(&mut format_info, &mut sys),
+                    RefreshType::Network => {
+                        refresh_network_tokens(&mut format_info, &mut sys, interval.networks());
+                    }
+                    RefreshType::System => refresh_system_tokens(&mut format_info, &sys),
+                };
+
+                tx.send(ModuleUpdateEvent::Update(format_info.clone()))
+                    .await
+                    .expect("Failed to send system info map");
+            }
+        });
+
+        Ok(())
+    }
+
+    fn into_widget(
+        self,
+        context: WidgetContext<Self::SendMessage, Self::ReceiveMessage>,
+        info: &ModuleInfo,
+    ) -> Result<ModuleWidget<gtk::Box>> {
+        let re = Regex::new(r"\{([^}]+)}")?;
+
+        let container = gtk::Box::new(info.bar_position.get_orientation(), 10);

        let mut labels = Vec::new();

        for format in &self.format {
-            let label = Label::builder().label(format).name("item").build();
+            let label = Label::builder()
+                .label(format)
+                .use_markup(true)
+                .name("item")
+                .build();
+            label.set_angle(info.bar_position.get_angle());
            container.add(&label);
            labels.push(label);
        }

-        let (tx, rx) = glib::MainContext::channel(glib::PRIORITY_DEFAULT);
-        spawn(async move {
-            let mut sys = System::new_all();
-
-            loop {
-                sys.refresh_all();
-
-                let mut format_info = HashMap::new();
-
-                let actual_used_memory = sys.total_memory() - sys.available_memory();
-                let memory_percent = actual_used_memory as f64 / sys.total_memory() as f64 * 100.0;
-
-                let cpu_percent = sys.global_cpu_info().cpu_usage();
-
-                // TODO: Add remaining format info
-
-                format_info.insert("memory-percent", format!("{:0>2.0}", memory_percent));
-                format_info.insert("cpu-percent", format!("{:0>2.0}", cpu_percent));
-
-                tx.send(format_info)
-                    .expect("Failed to send system info map");
-
-                sleep(tokio::time::Duration::from_secs(1)).await;
-            }
-        });
-
        {
            let formats = self.format;
-            rx.attach(None, move |info| {
+            context.widget_rx.attach(None, move |info| {
                for (format, label) in formats.iter().zip(labels.clone()) {
-                    let format_compiled = re.replace(format, |caps: &Captures| {
+                    let format_compiled = re.replace_all(format, |caps: &Captures| {
                        info.get(&caps[1])
                            .unwrap_or(&caps[0].to_string())
                            .to_string()
                    });

-                    label.set_text(format_compiled.as_ref());
+                    label.set_markup(format_compiled.as_ref());
                }

                Continue(true)
            });
        }

-        Ok(container)
+        Ok(ModuleWidget {
+            widget: container,
+            popup: None,
+        })
    }
 }
+
+fn refresh_memory_tokens(format_info: &mut HashMap<String, String>, sys: &mut System) {
+    sys.refresh_memory();
+
+    let total_memory = sys.total_memory();
+    let available_memory = sys.available_memory();
+
+    let actual_used_memory = total_memory - available_memory;
+    let memory_percent = actual_used_memory as f64 / total_memory as f64 * 100.0;
+
+    format_info.insert(
+        String::from("memory_free"),
+        (bytes_to_gigabytes(available_memory)).to_string(),
+    );
+    format_info.insert(
+        String::from("memory_used"),
+        (bytes_to_gigabytes(actual_used_memory)).to_string(),
+    );
+    format_info.insert(
+        String::from("memory_total"),
+        (bytes_to_gigabytes(total_memory)).to_string(),
+    );
+    format_info.insert(
+        String::from("memory_percent"),
+        format!("{:0>2.0}", memory_percent),
+    );
+
+    let used_swap = sys.used_swap();
+    let total_swap = sys.total_swap();
+
+    format_info.insert(
+        String::from("swap_free"),
+        (bytes_to_gigabytes(sys.free_swap())).to_string(),
+    );
+    format_info.insert(
+        String::from("swap_used"),
+        (bytes_to_gigabytes(used_swap)).to_string(),
+    );
+    format_info.insert(
+        String::from("swap_total"),
+        (bytes_to_gigabytes(total_swap)).to_string(),
+    );
+    format_info.insert(
+        String::from("swap_percent"),
+        format!("{:0>2.0}", used_swap as f64 / total_swap as f64 * 100.0),
+    );
+}
+
+fn refresh_cpu_tokens(format_info: &mut HashMap<String, String>, sys: &mut System) {
+    sys.refresh_cpu();
+
+    let cpu_info = sys.global_cpu_info();
+    let cpu_percent = cpu_info.cpu_usage();
+
+    format_info.insert(
+        String::from("cpu_percent"),
+        format!("{:0>2.0}", cpu_percent),
+    );
+}
+
+fn refresh_temp_tokens(format_info: &mut HashMap<String, String>, sys: &mut System) {
+    sys.refresh_components();
+
+    let components = sys.components();
+    for component in components {
+        let key = component.label().replace(' ', "-");
+        let temp = component.temperature();
+
+        format_info.insert(format!("temp_c:{key}"), format!("{temp:.0}"));
+        format_info.insert(format!("temp_f:{key}"), format!("{:.0}", c_to_f(temp)));
+    }
+}
+
+fn refresh_disk_tokens(format_info: &mut HashMap<String, String>, sys: &mut System) {
+    sys.refresh_disks();
+
+    for disk in sys.disks() {
+        // replace braces to avoid conflict with regex
+        let key = disk
+            .mount_point()
+            .to_str()
+            .map(|s| s.replace(['{', '}'], ""));
+
+        if let Some(key) = key {
+            let total = disk.total_space();
+            let available = disk.available_space();
+            let used = total - available;
+
+            format_info.insert(
+                format!("disk_free:{key}"),
+                bytes_to_gigabytes(available).to_string(),
+            );
+
+            format_info.insert(
+                format!("disk_used:{key}"),
+                bytes_to_gigabytes(used).to_string(),
+            );
+
+            format_info.insert(
+                format!("disk_total:{key}"),
+                bytes_to_gigabytes(total).to_string(),
+            );
+
+            format_info.insert(
+                format!("disk_percent:{key}"),
+                format!("{:0>2.0}", used as f64 / total as f64 * 100.0),
+            );
+        }
+    }
+}
+
+fn refresh_network_tokens(
+    format_info: &mut HashMap<String, String>,
+    sys: &mut System,
+    interval: u64,
+) {
+    sys.refresh_networks();
+
+    for (iface, network) in sys.networks() {
+        format_info.insert(
+            format!("net_down:{iface}"),
+            format!("{:0>2.0}", bytes_to_megabits(network.received()) / interval),
+        );
+
+        format_info.insert(
+            format!("net_up:{iface}"),
+            format!(
+                "{:0>2.0}",
+                bytes_to_megabits(network.transmitted()) / interval
+            ),
+        );
+    }
+}
+
+fn refresh_system_tokens(format_info: &mut HashMap<String, String>, sys: &System) {
+    // no refresh required for these tokens
+
+    let load_average = sys.load_average();
+    format_info.insert(String::from("load_average:1"), load_average.one.to_string());
+
+    format_info.insert(
+        String::from("load_average:5"),
+        load_average.five.to_string(),
+    );
+
+    format_info.insert(
+        String::from("load_average:15"),
+        load_average.fifteen.to_string(),
+    );
+
+    let uptime = Duration::from_secs(sys.uptime()).as_secs();
+    let hours = uptime / 3600;
+    format_info.insert(
+        String::from("uptime"),
+        format!("{:0>2}:{:0>2}", hours, (uptime % 3600) / 60),
+    );
+}
+
+/// Converts celsius to fahrenheit.
+fn c_to_f(c: f32) -> f32 {
+    c * 9.0 / 5.0 + 32.0
+}
+
+const fn bytes_to_gigabytes(b: u64) -> u64 {
+    const BYTES_IN_GIGABYTE: u64 = 1_000_000_000;
+    b / BYTES_IN_GIGABYTE
+}
+
+const fn bytes_to_megabits(b: u64) -> u64 {
+    const BYTES_IN_MEGABIT: u64 = 125_000;
+    b / BYTES_IN_MEGABIT
+}
--- a/src/modules/tray.rs
+++ b/src/modules/tray.rs
@@ -1,24 +1,23 @@
-use crate::modules::{Module, ModuleInfo};
+use crate::await_sync;
+use crate::clients::system_tray::get_tray_event_client;
+use crate::config::CommonConfig;
+use crate::modules::{Module, ModuleInfo, ModuleUpdateEvent, ModuleWidget, WidgetContext};
 use color_eyre::Result;
-use futures_util::StreamExt;
 use gtk::prelude::*;
 use gtk::{IconLookupFlags, IconTheme, Image, Menu, MenuBar, MenuItem, SeparatorMenuItem};
 use serde::Deserialize;
 use std::collections::HashMap;
-use stray::message::menu::{MenuItem as MenuItemInfo, MenuType, TrayMenu};
+use stray::message::menu::{MenuItem as MenuItemInfo, MenuType};
 use stray::message::tray::StatusNotifierItem;
 use stray::message::{NotifierItemCommand, NotifierItemMessage};
-use stray::SystemTray;
 use tokio::spawn;
 use tokio::sync::mpsc;
+use tokio::sync::mpsc::{Receiver, Sender};

 #[derive(Debug, Deserialize, Clone)]
-pub struct TrayModule;
-
-#[derive(Debug)]
-enum TrayUpdate {
-    Update(String, Box<StatusNotifierItem>, Option<TrayMenu>),
-    Remove(String),
+pub struct TrayModule {
+    #[serde(flatten)]
+    pub common: CommonConfig,
 }

 /// Gets a GTK `Image` component
@@ -26,7 +25,7 @@ enum TrayUpdate {
 fn get_icon(item: &StatusNotifierItem) -> Option<Image> {
    item.icon_theme_path.as_ref().and_then(|path| {
        let theme = IconTheme::new();
-        theme.append_search_path(&path);
+        theme.append_search_path(path);

        item.icon_name.as_ref().and_then(|icon_name| {
            let icon_info = theme.lookup_icon(icon_name, 16, IconLookupFlags::empty());
@@ -39,7 +38,7 @@ fn get_icon(item: &StatusNotifierItem) -> Option<Image> {
 /// for the provided submenu array.
 fn get_menu_items(
    menu: &[MenuItemInfo],
-    tx: &mpsc::Sender<NotifierItemCommand>,
+    tx: &Sender<NotifierItemCommand>,
    id: &str,
    path: &str,
 ) -> Vec<MenuItem> {
@@ -90,72 +89,88 @@ fn get_menu_items(
 }

 impl Module<MenuBar> for TrayModule {
-    fn into_widget(self, _info: &ModuleInfo) -> Result<MenuBar> {
-        let container = MenuBar::new();
+    type SendMessage = NotifierItemMessage;
+    type ReceiveMessage = NotifierItemCommand;

-        let (tx, rx) = glib::MainContext::channel(glib::PRIORITY_DEFAULT);
-        let (ui_tx, ui_rx) = mpsc::channel(32);
+    fn spawn_controller(
+        &self,
+        _info: &ModuleInfo,
+        tx: Sender<ModuleUpdateEvent<Self::SendMessage>>,
+        mut rx: Receiver<Self::ReceiveMessage>,
+    ) -> Result<()> {
+        let client = await_sync(async { get_tray_event_client().await });
+        let (tray_tx, mut tray_rx) = client.subscribe();

+        // listen to tray updates
        spawn(async move {
-            // FIXME: Can only spawn one of these at a time - means cannot have tray on multiple bars
-            let mut tray = SystemTray::new(ui_rx).await;
-
-            // listen for tray updates & send message to update UI
-            while let Some(message) = tray.next().await {
-                match message {
-                    NotifierItemMessage::Update {
-                        address: id,
-                        item,
-                        menu,
-                    } => {
-                        tx.send(TrayUpdate::Update(id, Box::new(item), menu))
-                            .expect("Failed to send tray update event");
-                    }
-                    NotifierItemMessage::Remove { address: id } => {
-                        tx.send(TrayUpdate::Remove(id))
-                            .expect("Failed to send tray remove event");
-                    }
-                }
+            while let Ok(message) = tray_rx.recv().await {
+                tx.send(ModuleUpdateEvent::Update(message)).await?;
            }
+
+            Ok::<(), mpsc::error::SendError<ModuleUpdateEvent<Self::SendMessage>>>(())
        });

+        // send tray commands
+        spawn(async move {
+            while let Some(cmd) = rx.recv().await {
+                tray_tx.send(cmd).await?;
+            }
+
+            Ok::<(), mpsc::error::SendError<NotifierItemCommand>>(())
+        });
+
+        Ok(())
+    }
+
+    fn into_widget(
+        self,
+        context: WidgetContext<Self::SendMessage, Self::ReceiveMessage>,
+        _info: &ModuleInfo,
+    ) -> Result<ModuleWidget<MenuBar>> {
+        let container = MenuBar::new();
+
        {
            let container = container.clone();
            let mut widgets = HashMap::new();

            // listen for UI updates
-            rx.attach(None, move |update| {
+            context.widget_rx.attach(None, move |update| {
                match update {
-                    TrayUpdate::Update(id, item, menu) => {
-                        let menu_item = widgets.remove(id.as_str()).unwrap_or_else(|| {
+                    NotifierItemMessage::Update {
+                        item,
+                        address,
+                        menu,
+                    } => {
+                        let menu_item = widgets.remove(address.as_str()).unwrap_or_else(|| {
                            let menu_item = MenuItem::new();
                            menu_item.style_context().add_class("item");
                            if let Some(image) = get_icon(&item) {
-                                image.set_widget_name(id.as_str());
+                                image.set_widget_name(address.as_str());
                                menu_item.add(&image);
                            }
-
                            container.add(&menu_item);
                            menu_item.show_all();
-
                            menu_item
                        });
-
                        if let (Some(menu_opts), Some(menu_path)) = (menu, item.menu) {
                            let submenus = menu_opts.submenus;
                            if !submenus.is_empty() {
                                let menu = Menu::new();
-                                get_menu_items(&submenus, &ui_tx.clone(), &id, &menu_path)
-                                    .iter()
-                                    .for_each(|item| menu.add(item));
+                                get_menu_items(
+                                    &submenus,
+                                    &context.controller_tx.clone(),
+                                    &address,
+                                    &menu_path,
+                                )
+                                .iter()
+                                .for_each(|item| menu.add(item));
                                menu_item.set_submenu(Some(&menu));
                            }
                        }
-
-                        widgets.insert(id, menu_item);
+                        widgets.insert(address, menu_item);
                    }
-                    TrayUpdate::Remove(id) => {
-                        if let Some(widget) = widgets.get(&id) {
+                    NotifierItemMessage::Remove { address } => {
+                        if let Some(widget) = widgets.get(&address) {
                            container.remove(widget);
                        }
                    }
@@ -165,6 +180,9 @@ impl Module<MenuBar> for TrayModule {
            });
        };

-        Ok(container)
+        Ok(ModuleWidget {
+            widget: container,
+            popup: None,
+        })
    }
 }
--- a/src/modules/workspaces.rs
+++ b/src/modules/workspaces.rs
@@ -1,62 +1,83 @@
-use crate::modules::{Module, ModuleInfo};
-use crate::sway::{get_client, Workspace};
+use crate::await_sync;
+use crate::clients::sway::{get_client, get_sub_client};
+use crate::config::CommonConfig;
+use crate::modules::{Module, ModuleInfo, ModuleUpdateEvent, ModuleWidget, WidgetContext};
 use color_eyre::{Report, Result};
 use gtk::prelude::*;
-use gtk::{Button, Orientation};
-use ksway::IpcCommand;
+use gtk::Button;
 use serde::Deserialize;
 use std::collections::HashMap;
+use swayipc_async::{Workspace, WorkspaceChange, WorkspaceEvent};
 use tokio::spawn;
-use tokio::sync::mpsc;
-use tokio::task::spawn_blocking;
-use tracing::{debug, trace};
+use tokio::sync::mpsc::{Receiver, Sender};
+use tracing::trace;

 #[derive(Debug, Deserialize, Clone)]
 pub struct WorkspacesModule {
    /// Map of actual workspace names to custom names.
    name_map: Option<HashMap<String, String>>,

-    /// Whether to display icons for all monitors.
+    /// Whether to display buttons for all monitors.
    #[serde(default = "crate::config::default_false")]
    all_monitors: bool,
+
+    #[serde(flatten)]
+    pub common: CommonConfig,
 }

-impl Workspace {
-    fn as_button(&self, name_map: &HashMap<String, String>, tx: &mpsc::Sender<String>) -> Button {
-        let button = Button::builder()
-            .label(name_map.get(self.name.as_str()).unwrap_or(&self.name))
-            .build();
+#[derive(Clone, Debug)]
+pub enum WorkspaceUpdate {
+    Init(Vec<Workspace>),
+    Update(Box<WorkspaceEvent>),
+}

-        let style_context = button.style_context();
-        style_context.add_class("item");
+/// Creates a button from a workspace
+fn create_button(
+    name: &str,
+    focused: bool,
+    name_map: &HashMap<String, String>,
+    tx: &Sender<String>,
+) -> Button {
+    let button = Button::builder()
+        .label(name_map.get(name).map_or(name, String::as_str))
+        .build();

-        if self.focused {
-            style_context.add_class("focused");
-        }
+    let style_context = button.style_context();
+    style_context.add_class("item");

-        {
-            let tx = tx.clone();
-            let name = self.name.clone();
-            button.connect_clicked(move |_item| {
-                tx.try_send(name.clone())
-                    .expect("Failed to send workspace click event");
-            });
-        }
-
-        button
+    if focused {
+        style_context.add_class("focused");
    }
+
+    {
+        let tx = tx.clone();
+        let name = name.to_string();
+        button.connect_clicked(move |_item| {
+            tx.try_send(name.clone())
+                .expect("Failed to send workspace click event");
+        });
+    }
+
+    button
 }

 impl Module<gtk::Box> for WorkspacesModule {
-    fn into_widget(self, info: &ModuleInfo) -> Result<gtk::Box> {
-        let container = gtk::Box::new(Orientation::Horizontal, 0);
+    type SendMessage = WorkspaceUpdate;
+    type ReceiveMessage = String;

+    fn spawn_controller(
+        &self,
+        info: &ModuleInfo,
+        tx: Sender<ModuleUpdateEvent<Self::SendMessage>>,
+        mut rx: Receiver<Self::ReceiveMessage>,
+    ) -> Result<()> {
        let workspaces = {
            trace!("Getting current workspaces");
-            let sway = get_client();
-            let mut sway = sway.lock().expect("Failed to get lock on Sway IPC client");
-            let raw = sway.ipc(IpcCommand::GetWorkspaces)?;
-            let workspaces = serde_json::from_slice::<Vec<Workspace>>(&raw)?;
+            let workspaces = await_sync(async {
+                let sway = get_client().await;
+                let mut sway = sway.lock().await;
+                sway.get_workspaces().await
+            })?;

            if self.all_monitors {
                workspaces
@@ -69,108 +90,154 @@ impl Module<gtk::Box> for WorkspacesModule {
            }
        };

-        let name_map = self.name_map.unwrap_or_default();
-
-        let mut button_map: HashMap<String, Button> = HashMap::new();
-
-        let (ui_tx, mut ui_rx) = mpsc::channel(32);
-
-        trace!("Creating workspace buttons");
-        for workspace in workspaces {
-            let item = workspace.as_button(&name_map, &ui_tx);
-            container.add(&item);
-            button_map.insert(workspace.name, item);
-        }
-
-        let (tx, rx) = glib::MainContext::channel(glib::PRIORITY_DEFAULT);
-
-        spawn_blocking(move || {
-            trace!("Starting workspace event listener task");
-            let srx = {
-                let sway = get_client();
-                let mut sway = sway.lock().expect("Failed to get lock on Sway IPC client");
+        tx.try_send(ModuleUpdateEvent::Update(WorkspaceUpdate::Init(workspaces)))
+            .expect("Failed to send initial workspace list");

+        // Subscribe & send events
+        spawn(async move {
+            let mut srx = {
+                let sway = get_sub_client();
                sway.subscribe_workspace()
            };

-            while let Ok(payload) = srx.recv() {
-                tx.send(payload).expect("Failed to send workspace event");
+            trace!("Set up Sway workspace subscription");
+
+            while let Ok(payload) = srx.recv().await {
+                tx.send(ModuleUpdateEvent::Update(WorkspaceUpdate::Update(payload)))
+                    .await
+                    .expect("Failed to send workspace update");
            }
        });

-        {
-            trace!("Setting up sway event handler");
-            let menubar = container.clone();
-            let output_name = info.output_name.to_string();
-            rx.attach(None, move |event| {
-                debug!("Received workspace event {:?}", event);
-                match event.change.as_str() {
-                    "focus" => {
-                        let old = event.old.and_then(|old| button_map.get(&old.name));
-                        if let Some(old) = old {
-                            old.style_context().remove_class("focused");
-                        }
-
-                        let new = event.current.and_then(|new| button_map.get(&new.name));
-                        if let Some(new) = new {
-                            new.style_context().add_class("focused");
-                        }
-
-                        trace!("{:?} {:?}", old, new);
-                    }
-                    "init" => {
-                        if let Some(workspace) = event.current {
-                            if self.all_monitors || workspace.output == output_name {
-                                let item = workspace.as_button(&name_map, &ui_tx);
-
-                                item.show();
-                                menubar.add(&item);
-                                button_map.insert(workspace.name, item);
-                            }
-                        }
-                    }
-                    "move" => {
-                        if let Some(workspace) = event.current {
-                            if !self.all_monitors {
-                                if workspace.output == output_name {
-                                    let item = workspace.as_button(&name_map, &ui_tx);
-
-                                    item.show();
-                                    menubar.add(&item);
-                                    button_map.insert(workspace.name, item);
-                                } else if let Some(item) = button_map.get(&workspace.name) {
-                                    menubar.remove(item);
-                                }
-                            }
-                        }
-                    }
-                    "empty" => {
-                        if let Some(workspace) = event.current {
-                            if let Some(item) = button_map.get(&workspace.name) {
-                                menubar.remove(item);
-                            }
-                        }
-                    }
-                    _ => {}
-                }
-
-                Continue(true)
-            });
-        }
-
+        // Change workspace focus
        spawn(async move {
            trace!("Setting up UI event handler");
-            let sway = get_client();
-            while let Some(name) = ui_rx.recv().await {
-                let mut sway = sway
-                    .lock()
-                    .expect("Failed to get write lock on Sway IPC client");
-                sway.run(format!("workspace {}", name))?;
+            let sway = get_client().await;
+            while let Some(name) = rx.recv().await {
+                let mut sway = sway.lock().await;
+                sway.run_command(format!("workspace {}", name)).await?;
            }

            Ok::<(), Report>(())
        });

-        Ok(container)
+        Ok(())
+    }
+
+    fn into_widget(
+        self,
+        context: WidgetContext<Self::SendMessage, Self::ReceiveMessage>,
+        info: &ModuleInfo,
+    ) -> Result<ModuleWidget<gtk::Box>> {
+        let container = gtk::Box::new(info.bar_position.get_orientation(), 0);
+
+        let name_map = self.name_map.unwrap_or_default();
+
+        let mut button_map: HashMap<String, Button> = HashMap::new();
+
+        {
+            let container = container.clone();
+            let output_name = info.output_name.to_string();
+
+            context.widget_rx.attach(None, move |event| {
+                match event {
+                    WorkspaceUpdate::Init(workspaces) => {
+                        trace!("Creating workspace buttons");
+                        for workspace in workspaces {
+                            let item = create_button(
+                                &workspace.name,
+                                workspace.focused,
+                                &name_map,
+                                &context.controller_tx,
+                            );
+                            container.add(&item);
+                            button_map.insert(workspace.name, item);
+                        }
+                        container.show_all();
+                    }
+                    WorkspaceUpdate::Update(event) if event.change == WorkspaceChange::Focus => {
+                        let old = event
+                            .old
+                            .and_then(|old| old.name)
+                            .and_then(|name| button_map.get(&name));
+                        if let Some(old) = old {
+                            old.style_context().remove_class("focused");
+                        }
+
+                        let new = event
+                            .current
+                            .and_then(|old| old.name)
+                            .and_then(|new| button_map.get(&new));
+                        if let Some(new) = new {
+                            new.style_context().add_class("focused");
+                        }
+                    }
+                    WorkspaceUpdate::Update(event) if event.change == WorkspaceChange::Init => {
+                        if let Some(workspace) = event.current {
+                            if self.all_monitors
+                                || workspace.output.unwrap_or_default() == output_name
+                            {
+                                let name = workspace.name.unwrap_or_default();
+                                let item = create_button(
+                                    &name,
+                                    workspace.focused,
+                                    &name_map,
+                                    &context.controller_tx,
+                                );
+
+                                item.show();
+                                container.add(&item);
+
+                                if !name.is_empty() {
+                                    button_map.insert(name, item);
+                                }
+                            }
+                        }
+                    }
+                    WorkspaceUpdate::Update(event) if event.change == WorkspaceChange::Move => {
+                        if let Some(workspace) = event.current {
+                            if !self.all_monitors {
+                                if workspace.output.unwrap_or_default() == output_name {
+                                    let name = workspace.name.unwrap_or_default();
+                                    let item = create_button(
+                                        &name,
+                                        workspace.focused,
+                                        &name_map,
+                                        &context.controller_tx,
+                                    );
+
+                                    item.show();
+                                    container.add(&item);
+
+                                    if !name.is_empty() {
+                                        button_map.insert(name, item);
+                                    }
+                                } else if let Some(item) =
+                                    button_map.get(&workspace.name.unwrap_or_default())
+                                {
+                                    container.remove(item);
+                                }
+                            }
+                        }
+                    }
+                    WorkspaceUpdate::Update(event) if event.change == WorkspaceChange::Empty => {
+                        if let Some(workspace) = event.current {
+                            if let Some(item) = button_map.get(&workspace.name.unwrap_or_default())
+                            {
+                                container.remove(item);
+                            }
+                        }
+                    }
+                    WorkspaceUpdate::Update(_) => {}
+                };
+
+                Continue(true)
+            });
+        }
+
+        Ok(ModuleWidget {
+            widget: container,
+            popup: None,
+        })
    }
 }
--- a/src/popup.rs
+++ b/src/popup.rs
@@ -1,27 +1,31 @@
+use std::collections::HashMap;
+
 use crate::config::BarPosition;
+use crate::modules::ModuleInfo;
 use gtk::gdk::Monitor;
 use gtk::prelude::*;
-use gtk::{Application, ApplicationWindow, Button, Orientation};
+use gtk::{ApplicationWindow, Button, Orientation};
+use tracing::debug;

 #[derive(Debug, Clone)]
 pub struct Popup {
    pub window: ApplicationWindow,
-    pub container: gtk::Box,
+    pub cache: HashMap<usize, gtk::Box>,
    monitor: Monitor,
+    pos: BarPosition,
 }

 impl Popup {
    /// Creates a new popup window.
    /// This includes setting up gtk-layer-shell
    /// and an empty `gtk::Box` container.
-    pub fn new(
-        name: &str,
-        app: &Application,
-        monitor: &Monitor,
-        orientation: Orientation,
-        bar_position: &BarPosition,
-    ) -> Self {
-        let win = ApplicationWindow::builder().application(app).build();
+    pub fn new(module_info: &ModuleInfo) -> Self {
+        let pos = module_info.bar_position;
+        let orientation = pos.get_orientation();
+
+        let win = ApplicationWindow::builder()
+            .application(module_info.app)
+            .build();

        gtk_layer_shell::init_for_window(&win);
        gtk_layer_shell::set_layer(&win, gtk_layer_shell::Layer::Overlay);
@@ -29,57 +33,69 @@ impl Popup {
        gtk_layer_shell::set_margin(
            &win,
            gtk_layer_shell::Edge::Top,
-            if bar_position == &BarPosition::Top {
-                5
-            } else {
-                0
-            },
+            if pos == BarPosition::Top { 5 } else { 0 },
        );
        gtk_layer_shell::set_margin(
            &win,
            gtk_layer_shell::Edge::Bottom,
-            if bar_position == &BarPosition::Bottom {
-                5
-            } else {
-                0
-            },
+            if pos == BarPosition::Bottom { 5 } else { 0 },
+        );
+        gtk_layer_shell::set_margin(
+            &win,
+            gtk_layer_shell::Edge::Left,
+            if pos == BarPosition::Left { 5 } else { 0 },
+        );
+        gtk_layer_shell::set_margin(
+            &win,
+            gtk_layer_shell::Edge::Right,
+            if pos == BarPosition::Right { 5 } else { 0 },
        );
-        gtk_layer_shell::set_margin(&win, gtk_layer_shell::Edge::Left, 0);
-        gtk_layer_shell::set_margin(&win, gtk_layer_shell::Edge::Right, 0);

        gtk_layer_shell::set_anchor(
            &win,
            gtk_layer_shell::Edge::Top,
-            bar_position == &BarPosition::Top,
+            pos == BarPosition::Top || orientation == Orientation::Vertical,
        );
        gtk_layer_shell::set_anchor(
            &win,
            gtk_layer_shell::Edge::Bottom,
-            bar_position == &BarPosition::Bottom,
+            pos == BarPosition::Bottom,
+        );
+        gtk_layer_shell::set_anchor(
+            &win,
+            gtk_layer_shell::Edge::Left,
+            pos == BarPosition::Left || orientation == Orientation::Horizontal,
+        );
+        gtk_layer_shell::set_anchor(
+            &win,
+            gtk_layer_shell::Edge::Right,
+            pos == BarPosition::Right,
        );
-        gtk_layer_shell::set_anchor(&win, gtk_layer_shell::Edge::Left, true);
-        gtk_layer_shell::set_anchor(&win, gtk_layer_shell::Edge::Right, false);

-        let content = gtk::Box::builder()
-            .orientation(orientation)
-            .spacing(0)
-            .hexpand(false)
-            .name(name)
-            .build();
-
-        content.style_context().add_class("popup");
-
-        win.add(&content);
-
-        win.connect_leave_notify_event(|win, ev| {
+        win.connect_leave_notify_event(move |win, ev| {
            const THRESHOLD: f64 = 3.0;

-            let (w, _h) = win.size();
+            let (w, h) = win.size();
            let (x, y) = ev.position();

            // some child widgets trigger this event
            // so check we're actually outside the window
-            if x < THRESHOLD || y < THRESHOLD || x > f64::from(w) - THRESHOLD {
+            let hide = match pos {
+                BarPosition::Top => {
+                    x < THRESHOLD || y > f64::from(h) - THRESHOLD || x > f64::from(w) - THRESHOLD
+                }
+                BarPosition::Bottom => {
+                    x < THRESHOLD || y < THRESHOLD || x > f64::from(w) - THRESHOLD
+                }
+                BarPosition::Left => {
+                    y < THRESHOLD || x > f64::from(w) - THRESHOLD || y > f64::from(h) - THRESHOLD
+                }
+                BarPosition::Right => {
+                    y < THRESHOLD || x < THRESHOLD || y > f64::from(h) - THRESHOLD
+                }
+            };
+
+            if hide {
                win.hide();
            }

@@ -88,15 +104,37 @@ impl Popup {

        Self {
            window: win,
-            container: content,
-            monitor: monitor.clone(),
+            cache: HashMap::new(),
+            monitor: module_info.monitor.clone(),
+            pos,
        }
    }

-    /// Shows the popover
-    pub fn show(&self, button: &Button) {
+    pub fn register_content(&mut self, key: usize, content: gtk::Box) {
+        debug!("Registered popup content for #{}", key);
+        self.cache.insert(key, content);
+    }
+
+    pub fn show_content(&self, key: usize) {
+        self.clear_window();
+
+        if let Some(content) = self.cache.get(&key) {
+            content.style_context().add_class("popup");
+            self.window.add(content);
+        }
+    }
+
+    fn clear_window(&self) {
+        let children = self.window.children();
+        for child in children {
+            self.window.remove(&child);
+        }
+    }
+
+    /// Shows the popup
+    pub fn show(&self, geometry: ButtonGeometry) {
        self.window.show_all();
-        self.set_pos(button);
+        self.set_pos(geometry);
    }

    /// Hides the popover
@@ -104,27 +142,89 @@ impl Popup {
        self.window.hide();
    }

-    /// Sets the popover's X position relative to the left border of the screen
-    fn set_pos(&self, button: &Button) {
-        let widget_width = button.allocation().width();
-        let screen_width = self.monitor.workarea().width();
-        let popup_width = self.window.allocated_width();
+    /// Checks if the popup is currently visible
+    pub fn is_visible(&self) -> bool {
+        self.window.is_visible()
+    }

-        let top_level = button.toplevel().expect("Failed to get top-level widget");
-        let (widget_x, _) = button
-            .translate_coordinates(&top_level, 0, 0)
-            .unwrap_or((0, 0));
+    /// Sets the popup's X/Y position relative to the left or border of the screen
+    /// (depending on orientation).
+    fn set_pos(&self, geometry: ButtonGeometry) {
+        let orientation = self.pos.get_orientation();

-        let widget_center = f64::from(widget_x) + f64::from(widget_width) / 2.0;
+        let mon_workarea = self.monitor.workarea();
+        let screen_size = if orientation == Orientation::Horizontal {
+            mon_workarea.width()
+        } else {
+            mon_workarea.height()
+        };

-        let mut offset = (widget_center - (f64::from(popup_width) / 2.0)).round();
+        let (popup_width, popup_height) = self.window.size();
+        let popup_size = if orientation == Orientation::Horizontal {
+            popup_width
+        } else {
+            popup_height
+        };
+
+        let widget_center = f64::from(geometry.position) + f64::from(geometry.size) / 2.0;
+
+        let bar_offset = (f64::from(screen_size) - f64::from(geometry.bar_size)) / 2.0;
+
+        let mut offset = bar_offset + (widget_center - (f64::from(popup_size) / 2.0)).round();

        if offset < 5.0 {
            offset = 5.0;
-        } else if offset > f64::from(screen_width - popup_width) - 5.0 {
-            offset = f64::from(screen_width - popup_width) - 5.0;
+        } else if offset > f64::from(screen_size - popup_size) - 5.0 {
+            offset = f64::from(screen_size - popup_size) - 5.0;
        }

-        gtk_layer_shell::set_margin(&self.window, gtk_layer_shell::Edge::Left, offset as i32);
+        let edge = if orientation == Orientation::Horizontal {
+            gtk_layer_shell::Edge::Left
+        } else {
+            gtk_layer_shell::Edge::Top
+        };
+
+        gtk_layer_shell::set_margin(&self.window, edge, offset as i32);
+    }
+
+    /// Gets the absolute X position of the button
+    /// and its width / height (depending on orientation).
+    pub fn button_pos(button: &Button, orientation: Orientation) -> ButtonGeometry {
+        let button_size = if orientation == Orientation::Horizontal {
+            button.allocation().width()
+        } else {
+            button.allocation().height()
+        };
+
+        let top_level = button.toplevel().expect("Failed to get top-level widget");
+
+        let bar_size = if orientation == Orientation::Horizontal {
+            top_level.allocation().width()
+        } else {
+            top_level.allocation().height()
+        };
+
+        let (button_x, button_y) = button
+            .translate_coordinates(&top_level, 0, 0)
+            .unwrap_or((0, 0));
+
+        let button_pos = if orientation == Orientation::Horizontal {
+            button_x
+        } else {
+            button_y
+        };
+
+        ButtonGeometry {
+            position: button_pos,
+            size: button_size,
+            bar_size,
+        }
    }
 }
+
+#[derive(Debug, Copy, Clone)]
+pub struct ButtonGeometry {
+    position: i32,
+    size: i32,
+    bar_size: i32,
+}
--- a/src/script.rs
+++ b/src/script.rs
@@ -0,0 +1,354 @@
+use color_eyre::eyre::WrapErr;
+use color_eyre::{Report, Result};
+use serde::Deserialize;
+use std::fmt::{Display, Formatter};
+use std::process::Stdio;
+use tokio::io::{AsyncBufReadExt, BufReader};
+use tokio::process::Command;
+use tokio::sync::mpsc;
+use tokio::time::sleep;
+use tokio::{select, spawn};
+use tracing::{error, warn};
+
+#[derive(Debug, Deserialize, Clone)]
+#[serde(untagged)]
+pub enum ScriptInput {
+    String(String),
+    Struct(Script),
+}
+
+#[derive(Debug, Deserialize, Clone, Copy, Eq, PartialEq)]
+#[serde(rename_all = "snake_case")]
+pub enum ScriptMode {
+    Poll,
+    Watch,
+}
+
+#[derive(Debug, Clone)]
+pub enum OutputStream {
+    Stdout(String),
+    Stderr(String),
+}
+
+impl From<&str> for ScriptMode {
+    fn from(str: &str) -> Self {
+        match str {
+            "poll" | "p" => Self::Poll,
+            "watch" | "w" => Self::Watch,
+            _ => {
+                warn!("Invalid script mode: '{str}', falling back to polling");
+                ScriptMode::Poll
+            }
+        }
+    }
+}
+
+impl Default for ScriptMode {
+    fn default() -> Self {
+        Self::Poll
+    }
+}
+
+impl Display for ScriptMode {
+    fn fmt(&self, f: &mut Formatter<'_>) -> std::fmt::Result {
+        write!(
+            f,
+            "{}",
+            match self {
+                ScriptMode::Poll => "poll",
+                ScriptMode::Watch => "watch",
+            }
+        )
+    }
+}
+
+impl ScriptMode {
+    fn try_parse(str: &str) -> Result<Self> {
+        match str {
+            "poll" | "p" => Ok(Self::Poll),
+            "watch" | "w" => Ok(Self::Watch),
+            _ => Err(Report::msg(format!("Invalid script mode: {str}"))),
+        }
+    }
+}
+
+#[derive(Debug, Deserialize, Clone)]
+pub struct Script {
+    #[serde(default = "ScriptMode::default")]
+    pub(crate) mode: ScriptMode,
+    pub cmd: String,
+    #[serde(default = "default_interval")]
+    pub(crate) interval: u64,
+}
+
+const fn default_interval() -> u64 {
+    5000
+}
+
+impl Default for Script {
+    fn default() -> Self {
+        Self {
+            mode: ScriptMode::default(),
+            interval: default_interval(),
+            cmd: String::new(),
+        }
+    }
+}
+
+impl From<ScriptInput> for Script {
+    fn from(input: ScriptInput) -> Self {
+        match input {
+            ScriptInput::String(string) => Self::from(string.as_str()),
+            ScriptInput::Struct(script) => script,
+        }
+    }
+}
+
+#[derive(Debug)]
+enum ScriptInputToken {
+    Mode(ScriptMode),
+    Interval(u64),
+    Cmd(String),
+    Colon,
+}
+
+impl From<&str> for Script {
+    fn from(str: &str) -> Self {
+        let mut script = Self::default();
+        let mut tokens = vec![];
+
+        let mut chars = str.chars().collect::<Vec<_>>();
+        while !chars.is_empty() {
+            let char = chars[0];
+
+            let (token, skip) = match char {
+                ':' => (ScriptInputToken::Colon, 1),
+                // interval
+                '0'..='9' => {
+                    let interval_str = chars
+                        .iter()
+                        .take_while(|c| c.is_ascii_digit())
+                        .collect::<String>();
+                    (
+                        ScriptInputToken::Interval(
+                            interval_str.parse::<u64>().expect("Invalid interval"),
+                        ),
+                        interval_str.len(),
+                    )
+                }
+                // watching or polling
+                'w' | 'p' => {
+                    let mode_str = chars.iter().take_while(|&c| c != &':').collect::<String>();
+                    let len = mode_str.len();
+
+                    let token = ScriptMode::try_parse(&mode_str)
+                        .map_or(ScriptInputToken::Cmd(mode_str), |mode| {
+                            ScriptInputToken::Mode(mode)
+                        });
+
+                    (token, len)
+                }
+                _ => {
+                    let cmd_str = chars.iter().take_while(|_| true).collect::<String>();
+                    let len = cmd_str.len();
+                    (ScriptInputToken::Cmd(cmd_str), len)
+                }
+            };
+
+            tokens.push(token);
+            chars.drain(..skip);
+        }
+
+        for token in tokens {
+            match token {
+                ScriptInputToken::Mode(mode) => script.mode = mode,
+                ScriptInputToken::Interval(interval) => script.interval = interval,
+                ScriptInputToken::Cmd(cmd) => script.cmd = cmd,
+                ScriptInputToken::Colon => {}
+            }
+        }
+
+        script
+    }
+}
+
+impl Script {
+    pub fn new_polling(input: ScriptInput) -> Self {
+        let mut script = Self::from(input);
+        script.mode = ScriptMode::Poll;
+        script
+    }
+
+    pub async fn run<F>(&self, callback: F)
+    where
+        F: Fn((OutputStream, bool)),
+    {
+        loop {
+            match self.mode {
+                ScriptMode::Poll => match self.get_output().await {
+                    Ok(output) => callback(output),
+                    Err(err) => error!("{err:?}"),
+                },
+                ScriptMode::Watch => match self.spawn().await {
+                    Ok(mut rx) => {
+                        while let Some(msg) = rx.recv().await {
+                            callback((msg, true));
+                        }
+                    }
+                    Err(err) => error!("{err:?}"),
+                },
+            };
+
+            sleep(tokio::time::Duration::from_millis(self.interval)).await;
+        }
+    }
+
+    /// Attempts to execute a given command,
+    /// waiting for it to finish.
+    /// If the command returns status 0,
+    /// the `stdout` is returned.
+    /// Otherwise, an `Err` variant
+    /// containing the `stderr` is returned.
+    pub async fn get_output(&self) -> Result<(OutputStream, bool)> {
+        let output = Command::new("sh")
+            .args(["-c", &self.cmd])
+            .output()
+            .await
+            .wrap_err("Failed to get script output")?;
+
+        if output.status.success() {
+            let stdout = String::from_utf8(output.stdout)
+                .map(|output| output.trim().to_string())
+                .wrap_err("Script stdout not valid UTF-8")?;
+
+            Ok((OutputStream::Stdout(stdout), true))
+        } else {
+            let stderr = String::from_utf8(output.stderr)
+                .map(|output| output.trim().to_string())
+                .wrap_err("Script stderr not valid UTF-8")?;
+
+            Ok((OutputStream::Stderr(stderr), false))
+        }
+    }
+
+    pub async fn spawn(&self) -> Result<mpsc::Receiver<OutputStream>> {
+        let mut handle = Command::new("sh")
+            .args(["-c", &self.cmd])
+            .stdout(Stdio::piped())
+            .stderr(Stdio::piped())
+            .stdin(Stdio::null())
+            .spawn()?;
+
+        let mut stdout_lines = BufReader::new(
+            handle
+                .stdout
+                .take()
+                .expect("Failed to take script handle stdout"),
+        )
+        .lines();
+
+        let mut stderr_lines = BufReader::new(
+            handle
+                .stderr
+                .take()
+                .expect("Failed to take script handle stderr"),
+        )
+        .lines();
+
+        let (tx, rx) = mpsc::channel(32);
+
+        spawn(async move {
+            loop {
+                select! {
+                    _ = handle.wait() => break,
+                    Ok(Some(line)) = stdout_lines.next_line() => {
+                        tx.send(OutputStream::Stdout(line)).await.expect("Failed to send stdout");
+                    }
+                    Ok(Some(line)) = stderr_lines.next_line() => {
+                        tx.send(OutputStream::Stderr(line)).await.expect("Failed to send stderr");
+                    }
+                }
+            }
+        });
+
+        Ok(rx)
+    }
+}
+
+#[cfg(test)]
+mod tests {
+    use super::*;
+
+    #[test]
+    fn test_parse_basic() {
+        let cmd = "echo 'hello'";
+        let script = Script::from(cmd);
+
+        assert_eq!(script.cmd, cmd);
+        assert_eq!(script.interval, default_interval());
+        assert_eq!(script.mode, ScriptMode::default());
+    }
+
+    #[test]
+    fn test_parse_full() {
+        let cmd = "echo 'hello'";
+        let mode = ScriptMode::Watch;
+        let interval = 300;
+
+        let full_cmd = format!("{mode}:{interval}:{cmd}");
+        let script = Script::from(full_cmd.as_str());
+
+        assert_eq!(script.cmd, cmd);
+        assert_eq!(script.mode, mode);
+        assert_eq!(script.interval, interval);
+    }
+
+    #[test]
+    fn test_parse_interval_and_cmd() {
+        let cmd = "echo 'hello'";
+        let interval = 300;
+
+        let full_cmd = format!("{interval}:{cmd}");
+        let script = Script::from(full_cmd.as_str());
+
+        assert_eq!(script.cmd, cmd);
+        assert_eq!(script.interval, interval);
+        assert_eq!(script.mode, ScriptMode::default());
+    }
+
+    #[test]
+    fn test_parse_mode_and_cmd() {
+        let cmd = "echo 'hello'";
+        let mode = ScriptMode::Watch;
+
+        let full_cmd = format!("{mode}:{cmd}");
+        let script = Script::from(full_cmd.as_str());
+
+        assert_eq!(script.cmd, cmd);
+        assert_eq!(script.interval, default_interval());
+        assert_eq!(script.mode, mode);
+    }
+
+    #[test]
+    fn test_parse_cmd_with_colon() {
+        let cmd = "uptime | awk '{print \"Uptime: \" $1}'";
+        let script = Script::from(cmd);
+
+        assert_eq!(script.cmd, cmd);
+        assert_eq!(script.interval, default_interval());
+        assert_eq!(script.mode, ScriptMode::default());
+    }
+
+    #[test]
+    fn test_no_cmd() {
+        let mode = ScriptMode::Watch;
+        let interval = 300;
+
+        let full_cmd = format!("{mode}:{interval}");
+        let script = Script::from(full_cmd.as_str());
+
+        assert_eq!(script.cmd, ""); // TODO: Probably better handle this case
+        assert_eq!(script.interval, interval);
+        assert_eq!(script.mode, mode);
+    }
+}
--- a/src/style.rs
+++ b/src/style.rs
@@ -2,10 +2,13 @@ use color_eyre::{Help, Report};
 use glib::Continue;
 use gtk::prelude::CssProviderExt;
 use gtk::{gdk, gio, CssProvider, StyleContext};
-use notify::{Event, RecursiveMode, Result, Watcher};
+use notify::event::{DataChange, ModifyKind};
+use notify::{recommended_watcher, Event, EventKind, RecursiveMode, Result, Watcher};
 use std::path::PathBuf;
+use std::time::Duration;
 use tokio::spawn;
-use tracing::{error, info};
+use tokio::time::sleep;
+use tracing::{debug, error, info};

 /// Attempts to load CSS file at the given path
 /// and attach if to the current GTK application.
@@ -15,13 +18,14 @@ use tracing::{error, info};
 pub fn load_css(style_path: PathBuf) {
    let provider = CssProvider::new();

-    if let Err(err) = provider.load_from_file(&gio::File::for_path(&style_path)) {
-        error!("{:?}", Report::new(err)
+    match provider.load_from_file(&gio::File::for_path(&style_path)) {
+        Ok(()) => debug!("Loaded css from '{}'", style_path.display()),
+        Err(err) => error!("{:?}", Report::new(err)
                    .wrap_err("Failed to load CSS")
                    .suggestion("Check the CSS file for errors")
                    .suggestion("GTK CSS uses a subset of the full CSS spec and many properties are not available. Ensure you are not using any unsupported property.")
-                );
-    }
+                )
+    };

    let screen = gdk::Screen::default().expect("Failed to get default GTK screen");
    StyleContext::add_provider_for_screen(&screen, &provider, 800);
@@ -29,24 +33,27 @@ pub fn load_css(style_path: PathBuf) {
    let (tx, rx) = glib::MainContext::channel(glib::PRIORITY_DEFAULT);

    spawn(async move {
-        match notify::recommended_watcher(move |res: Result<Event>| match res {
-            Ok(event) => {
+        let mut watcher = recommended_watcher(move |res: Result<Event>| match res {
+            Ok(event) if event.kind == EventKind::Modify(ModifyKind::Data(DataChange::Any)) => {
+                debug!("{event:?}");
                if let Some(path) = event.paths.first() {
                    tx.send(path.clone())
                        .expect("Failed to send style changed message");
                }
            }
            Err(e) => error!("Error occurred when watching stylesheet: {:?}", e),
-        }) {
-            Ok(mut watcher) => {
-                watcher
-                    .watch(&style_path, RecursiveMode::NonRecursive)
-                    .expect("Unexpected error when attempting to watch CSS");
-            }
-            Err(err) => error!(
-                "{:?}",
-                Report::new(err).wrap_err("Failed to start CSS watcher")
-            ),
+            _ => {}
+        })
+        .expect("Failed to create CSS file watcher");
+
+        watcher
+            .watch(&style_path, RecursiveMode::NonRecursive)
+            .expect("Failed to start CSS file watcher");
+        debug!("Installed CSS file watcher on '{}'", style_path.display());
+
+        // avoid watcher from dropping
+        loop {
+            sleep(Duration::from_secs(1)).await;
        }
    });

--- a/src/sway/mod.rs
+++ b/src/sway/mod.rs
@@ -1,224 +0,0 @@
-use color_eyre::{Report, Result};
-use crossbeam_channel::Receiver;
-use ksway::{Error, IpcCommand, IpcEvent};
-use lazy_static::lazy_static;
-use serde::Deserialize;
-use std::sync::{Arc, Mutex};
-use tokio::spawn;
-use tracing::{debug, info, trace};
-
-pub mod node;
-
-#[derive(Deserialize, Debug, Clone)]
-pub struct WorkspaceEvent {
-    pub change: String,
-    pub old: Option<Workspace>,
-    pub current: Option<Workspace>,
-}
-
-#[derive(Deserialize, Debug, Clone)]
-pub struct Workspace {
-    pub name: String,
-    pub focused: bool,
-    // pub num: i32,
-    pub output: String,
-}
-
-#[derive(Debug, Deserialize, Clone)]
-pub struct WindowEvent {
-    pub change: String,
-    pub container: SwayNode,
-}
-
-#[derive(Debug, Deserialize, Clone)]
-pub struct SwayNode {
-    #[serde(rename = "type")]
-    pub node_type: String,
-    pub id: i32,
-    pub name: Option<String>,
-    pub app_id: Option<String>,
-    pub focused: bool,
-    pub urgent: bool,
-    pub nodes: Vec<SwayNode>,
-    pub floating_nodes: Vec<SwayNode>,
-    pub shell: Option<String>,
-    pub window_properties: Option<WindowProperties>,
-}
-
-#[derive(Debug, Deserialize, Clone)]
-pub struct WindowProperties {
-    pub class: Option<String>,
-}
-
-#[derive(Deserialize)]
-pub struct SwayOutput {
-    pub name: String,
-}
-
-type Broadcaster<T> = Arc<Mutex<UnboundedBroadcast<T>>>;
-
-pub struct SwayClient {
-    client: ksway::Client,
-
-    workspace_bc: Broadcaster<WorkspaceEvent>,
-    window_bc: Broadcaster<WindowEvent>,
-}
-
-impl SwayClient {
-    fn connect() -> Result<Self> {
-        let client = match ksway::Client::connect() {
-            Ok(client) => Ok(client),
-            Err(err) => Err(get_client_error(err)),
-        }?;
-        info!("Sway IPC client connected");
-
-        let workspace_bc = Arc::new(Mutex::new(UnboundedBroadcast::new()));
-        let window_bc = Arc::new(Mutex::new(UnboundedBroadcast::new()));
-
-        let workspace_bc2 = workspace_bc.clone();
-        let window_bc2 = window_bc.clone();
-        spawn(async move {
-            let mut sub_client = match ksway::Client::connect() {
-                Ok(client) => Ok(client),
-                Err(err) => Err(get_client_error(err)),
-            }
-            .expect("Failed to connect to Sway IPC server");
-            info!("Sway IPC subscription client connected");
-
-            let event_types = vec![IpcEvent::Window, IpcEvent::Workspace];
-            let rx = match sub_client.subscribe(event_types) {
-                Ok(res) => Ok(res),
-                Err(err) => Err(get_client_error(err)),
-            }
-            .expect("Failed to subscribe to Sway IPC server");
-
-            loop {
-                while let Ok((ev_type, payload)) = rx.try_recv() {
-                    debug!("Received sway event {:?}", ev_type);
-                    match ev_type {
-                        IpcEvent::Workspace => {
-                            let json = serde_json::from_slice::<WorkspaceEvent>(&payload).expect(
-                                "Received invalid workspace event payload from Sway IPC server",
-                            );
-                            workspace_bc
-                                .lock()
-                                .expect("Failed to get lock on workspace event bus")
-                                .send(json)
-                                .expect("Failed to broadcast workspace event");
-                        }
-                        IpcEvent::Window => {
-                            let json = serde_json::from_slice::<WindowEvent>(&payload).expect(
-                                "Received invalid window event payload from Sway IPC server",
-                            );
-                            window_bc
-                                .lock()
-                                .expect("Failed to get lock on window event bus")
-                                .send(json)
-                                .expect("Failed to broadcast window event");
-                        }
-                        _ => {}
-                    }
-                }
-                match sub_client.poll() {
-                    Ok(()) => Ok(()),
-                    Err(err) => Err(get_client_error(err)),
-                }
-                .expect("Failed to poll Sway IPC client");
-            }
-        });
-
-        Ok(Self {
-            client,
-            workspace_bc: workspace_bc2,
-            window_bc: window_bc2,
-        })
-    }
-
-    pub fn ipc(&mut self, command: IpcCommand) -> Result<Vec<u8>> {
-        debug!("Sending command: {:?}", command);
-        match self.client.ipc(command) {
-            Ok(res) => Ok(res),
-            Err(err) => Err(get_client_error(err)),
-        }
-    }
-
-    pub(crate) fn run(&mut self, cmd: String) -> Result<Vec<u8>> {
-        debug!("Sending command: {}", cmd);
-        match self.client.run(cmd) {
-            Ok(res) => Ok(res),
-            Err(err) => Err(get_client_error(err)),
-        }
-    }
-
-    pub fn subscribe_workspace(&mut self) -> Receiver<WorkspaceEvent> {
-        trace!("Adding new workspace subscriber");
-        self.workspace_bc
-            .lock()
-            .expect("Failed to get lock on workspace event bus")
-            .subscribe()
-    }
-
-    pub fn subscribe_window(&mut self) -> Receiver<WindowEvent> {
-        trace!("Adding new window subscriber");
-        self.window_bc
-            .lock()
-            .expect("Failed to get lock on window event bus")
-            .subscribe()
-    }
-}
-
-/// Gets an error report from a `ksway` error enum variant
-pub fn get_client_error(error: Error) -> Report {
-    match error {
-        Error::SockPathNotFound => Report::msg("Sway socket path not found"),
-        Error::SubscriptionError => Report::msg("Sway IPC subscription error"),
-        Error::AlreadySubscribed => Report::msg("Already subscribed to Sway IPC server"),
-        Error::Io(err) => Report::new(err),
-    }
-}
-
-lazy_static! {
-    static ref CLIENT: Arc<Mutex<SwayClient>> = {
-        let client = SwayClient::connect();
-        match client {
-            Ok(client) => Arc::new(Mutex::new(client)),
-            Err(err) => panic!("{:?}", err),
-        }
-    };
-}
-
-pub fn get_client() -> Arc<Mutex<SwayClient>> {
-    Arc::clone(&CLIENT)
-}
-
-/// Crossbeam channel wrapper
-/// which sends messages to all receivers.
-pub struct UnboundedBroadcast<T> {
-    channels: Vec<crossbeam_channel::Sender<T>>,
-}
-
-impl<T: 'static + Clone + Send + Sync> UnboundedBroadcast<T> {
-    /// Creates a new broadcaster.
-    pub const fn new() -> Self {
-        Self { channels: vec![] }
-    }
-
-    /// Creates a new sender/receiver pair.
-    /// The sender is stored locally and the receiver is returned.
-    pub fn subscribe(&mut self) -> Receiver<T> {
-        let (tx, rx) = crossbeam_channel::unbounded();
-
-        self.channels.push(tx);
-
-        rx
-    }
-
-    /// Attempts to send a messsge to all receivers.
-    pub fn send(&self, message: T) -> Result<(), crossbeam_channel::SendError<T>> {
-        for c in &self.channels {
-            c.send(message.clone())?;
-        }
-
-        Ok(())
-    }
-}
--- a/src/sway/node.rs
+++ b/src/sway/node.rs
@@ -1,57 +0,0 @@
-use crate::sway::{SwayClient, SwayNode};
-use color_eyre::Result;
-use ksway::IpcCommand;
-
-impl SwayNode {
-    /// Gets either the `app_id` or `class`
-    /// depending on whether this is a native Wayland
-    /// or xwayland application.
-    pub fn get_id(&self) -> &str {
-        self.app_id.as_ref().map_or_else(
-            || {
-                self.window_properties
-                    .as_ref()
-                    .expect("Cannot find node window properties")
-                    .class
-                    .as_ref()
-                    .expect("Cannot find node name")
-            },
-            |app_id| app_id,
-        )
-    }
-
-    /// Checks whether this application
-    /// is running under xwayland.
-    pub fn is_xwayland(&self) -> bool {
-        self.shell == Some(String::from("xwayland"))
-    }
-}
-
-/// Recursively checks the provided node for any child application nodes.
-/// Returns a list of any found application nodes.
-fn check_node(node: SwayNode, window_nodes: &mut Vec<SwayNode>) {
-    if node.name.is_some() && (node.node_type == "con" || node.node_type == "floating_con") {
-        window_nodes.push(node);
-    } else {
-        node.nodes.into_iter().for_each(|node| {
-            check_node(node, window_nodes);
-        });
-
-        node.floating_nodes.into_iter().for_each(|node| {
-            check_node(node, window_nodes);
-        });
-    }
-}
-
-impl SwayClient {
-    /// Gets a flat vector of all currently open windows.
-    pub fn get_open_windows(&mut self) -> Result<Vec<SwayNode>> {
-        let root_node = self.ipc(IpcCommand::GetTree)?;
-        let root_node = serde_json::from_slice(&root_node)?;
-
-        let mut window_nodes = vec![];
-        check_node(root_node, &mut window_nodes);
-
-        Ok(window_nodes)
-    }
-}
Author	SHA1	Message	Date
Jake Stanger	c1e1743b5e	chore(release): v0.8.0	2022-11-30 22:58:31 +00:00
Jake Stanger	37458642df	ci(build): reverse order of fmt/clippy/build	2022-11-30 22:56:44 +00:00
Jake Stanger	862c46c7ec	style: run rustfmt d'oh	2022-11-30 22:49:49 +00:00
Jake Stanger	afedf0214d	docs: add link to new custom power menu example	2022-11-30 22:42:31 +00:00
Jake Stanger	64f54040ef	refactor: move dynamic_label.rs to dynamic_string.rs and fix failing test	2022-11-30 22:40:53 +00:00
Jake Stanger	d20972cb32	feat: dynamic tooltips Resolves #36	2022-11-30 22:27:56 +00:00
Jake Stanger	1320639d4e	docs: add custom power menu example	2022-11-30 22:09:46 +00:00
Jake Stanger	907a565f3d	test(dynamic label): do not run if cannot initialise gtk	2022-11-28 22:46:32 +00:00
Jake Stanger	ec69649a04	docs: update example configs	2022-11-28 22:43:12 +00:00
Jake Stanger	c4cdf4be8b	docs: update example configs	2022-11-28 22:30:32 +00:00
Jake Stanger	00f973c3a4	style: run rustfmt	2022-11-28 22:30:32 +00:00
Jake Stanger	5d153a02fc	feat(custom): ability to embed scripts in labels for dynamic content Fully resolves #34.	2022-11-28 22:30:31 +00:00
Jake Stanger	e274ba39cd	refactor(custom): rename `exec` to `on_click` for consistency BREAKING CHANGE: This changes the option on buttons in the `custom` module. Any uses of the module must be updated to use the new custom widget attribute name.	2022-11-28 22:26:14 +00:00
Jake Stanger	8c75bc46ac	refactor(script): rename `path` to `cmd` for consistency BREAKING CHANGE: This changes the option in the `script` module. Any uses of the module must be updated to use the new option name.	2022-11-28 22:25:14 +00:00
Jake Stanger	df77020c52	refactor(sys_info): use snake_case for module tokens for consistency BREAKING CHANGE: This renames the module from `sys-info` to `sys_info`, and almost every formatting token from `kebab-case` to `snake_case`. Any use of this module will need to be updated.	2022-11-28 22:23:33 +00:00
Jake Stanger	0fb5fa8c2a	refactor: use latest `libcorn` with serde support This should speed Corn config loading up a bit :)	2022-11-28 22:23:11 +00:00
Jake Stanger	cf87bb4e8d	ci(build): run cargo tests	2022-11-28 22:21:47 +00:00
Jake Stanger	badfcc0c2d	Merge pull request #38 from JakeStanger/feat/common-options feat: common module options (`show_if`, `on_click`, `tooltip`)	2022-11-28 22:20:40 +00:00
Jake Stanger	c9e66d4664	feat: common module options (`show_if`, `on_click`, `tooltip`) The first three of many options that are common to all modules. Resolves #36. Resolves partially #34.	2022-11-28 22:09:18 +00:00
Yavor Kolev	a3f90adaf1	feat: add nix flake support * Add nix flake * Fix readme syntax issue * Format nix flake * ci(build): add nix flake support * ci(build): fix workflow_dispatch casing * ci(build): fix nix flake lock update job * ci: add nix flake lock update timer job old method didn't work * improve example and add cachix info Co-authored-by: Jake Stanger <mail@jstanger.dev>	2022-11-26 21:29:16 +00:00
Jake Stanger	47420d83bf	Merge pull request #35 from JakeStanger/feat/script-watch feat(script): new watch mode	2022-11-07 21:26:38 +00:00
Jake Stanger	4662f60ac5	refactor: move various clients to own folder	2022-11-06 23:38:51 +00:00
Jake Stanger	94693c92e3	ci(sync wiki): overhaul with bash script	2022-11-06 23:25:11 +00:00
Jake Stanger	8c774100f1	docs(script): add information on new mode options	2022-11-06 23:04:24 +00:00
Jake Stanger	b4db0226cd	Merge branch 'master' into feat/script-watch	2022-11-06 22:55:16 +00:00
Jake Stanger	ff17ec1996	refactor: various changes based on rust 1.65 clippy	2022-11-06 22:53:48 +00:00
Jake Stanger	c48029664d	docs(script): improve doc comment	2022-11-06 22:53:29 +00:00
Jake Stanger	58d55db660	docs: migrate wiki into main repo	2022-11-06 22:52:21 +00:00
Jake Stanger	73158c2fce	feat(script): new watch mode Resolves #30	2022-11-06 17:40:01 +00:00
JakeStanger	1c032ae8e3	docs: update CHANGELOG.md for v0.7.0 [skip ci]	2022-11-05 17:34:48 +00:00
Jake Stanger	3b04642148	chore(release): v0.7.0	2022-11-05 17:33:36 +00:00
Jake Stanger	0a331f3138	docs(readme): remove warning about outdated cargo package	2022-11-05 17:33:02 +00:00
Jake Stanger	bc625b929b	refactor: clippy & fmt	2022-11-05 17:32:42 +00:00
Jake Stanger	ad77dc4e4c	feat: improved logging & error handling	2022-11-05 17:32:29 +00:00
Jake Stanger	3a83bd31ab	fix: able to insert duplicate keys into collection This replaces the custom `Collection` implementation with `IndexMap` from the crate of the same name. Fixes #28.	2022-11-05 17:32:01 +00:00
Jake Stanger	5ebc84c7b9	refactor(logging): consts for default log levels	2022-11-05 17:29:17 +00:00
Jake Stanger	51d1cd4a16	build: update deps	2022-11-01 22:56:47 +00:00
Jake Stanger	b7792a415e	feat: env var to set custom css location Set `IRONBAR_CSS` to load CSS from that path instead of regular path.	2022-11-01 13:25:46 +00:00
Jake Stanger	9f82ba58cd	chore: cleanup println	2022-10-23 17:18:49 +01:00
Jake Stanger	a93700e8fd	Merge pull request #27 from JakeStanger/feat/custom-widget feat: new custom module	2022-10-23 17:11:17 +01:00
Jake Stanger	2a3fe33446	build: remove no longer required patch, reduce build times	2022-10-23 17:01:35 +01:00
Jake Stanger	3750124d8c	feat: new custom module Allows basic modules to be created from a config object, including popup content.	2022-10-23 17:01:35 +01:00
Jake Stanger	e693c1c166	fix(mpd): volume slider causing mpd server errors	2022-10-16 22:23:40 +01:00
Jake Stanger	cbd0c49e25	fix: css watcher not working	2022-10-16 22:21:51 +01:00
Jake Stanger	e23e691bc6	build: use latest release version of `stray`	2022-10-16 16:44:51 +01:00
Jake Stanger	be0f4c6366	chore: run fmt	2022-10-16 16:44:32 +01:00
Jake Stanger	493df6bb49	feat(mpd): add volume slider to popup	2022-10-16 16:00:18 +01:00
Jake Stanger	b4ac1c9850	Merge pull request #26 from JakeStanger/feat/sysinfo-tokens Add loads more tokens & interval options to `sysinfo`, optimise info refreshing	2022-10-16 14:04:11 +01:00
Jake Stanger	27f6abad67	chore: format and fix clippy warnings	2022-10-16 13:54:48 +01:00
Jake Stanger	ec1d59677b	feat(logging): `IRONBAR_LOG` and `IRONBAR_FILE_LOG` env vars	2022-10-16 13:42:59 +01:00
Jake Stanger	70e1b526a9	fix(logging): file log not capturing panics	2022-10-16 13:42:35 +01:00
Jake Stanger	3c43c20c6a	fix: weird behaviour when config does not exist	2022-10-16 12:58:11 +01:00
Jake Stanger	b66bd788b2	fix: logging for creating bar incorrect still	2022-10-16 12:57:37 +01:00
Jake Stanger	f17ae7a415	fix(script): not parsing pango markup	2022-10-16 12:56:39 +01:00
Jake Stanger	a06c4bccca	docs(examples): add full system info config	2022-10-16 01:03:36 +01:00
Jake Stanger	e4e72d8008	style(sys-info): fix clippy warnings & run fmt	2022-10-16 01:03:20 +01:00
Jake Stanger	9e6dbbd131	fix(sys-info): tokens not replaced if more than one in string	2022-10-16 01:00:43 +01:00
Jake Stanger	91c57edc73	feat(sys-info): pango markup support	2022-10-16 01:00:14 +01:00
Jake Stanger	dec402edd9	feat(sys-info): config options for refresh intervals	2022-10-16 00:59:28 +01:00
Jake Stanger	fad90fdad6	feat(sys-info): add loads more formatting tokens	2022-10-16 00:58:47 +01:00
Jake Stanger	35ce3b4d45	chore: use cargo patch block	2022-10-16 00:56:47 +01:00
Jake Stanger	27d04795af	docs(readme): add warning about crate being outdated	2022-10-15 18:51:45 +01:00
JakeStanger	9d9c275313	docs: update CHANGELOG.md for v0.6.0 [skip ci]	2022-10-15 17:27:37 +00:00
Jake Stanger	0669504519	chore(release): v0.6.0	2022-10-15 18:26:51 +01:00
Jake Stanger	eb5170ff6a	style: run fmt	2022-10-15 18:08:56 +01:00
Jake Stanger	b7b64886e3	fix: sometimes panicking on startup	2022-10-15 18:01:09 +01:00
Jake Stanger	75339f07ed	fix: vertical bars ignoring height config option	2022-10-15 16:35:31 +01:00
Jake Stanger	06cfad62e2	feat: more positioning options (#23 ) * feat: more positioning options Can now display the bar on the left/right, and avoid anchoring to edges to centre the bar. BREAKING CHANGE: The `left` and `right` config options have been renamed to `start` and `end`	2022-10-15 16:27:25 +01:00
Jake Stanger	1b853bcb71	refactor: fix clippy warning	2022-10-15 16:19:21 +01:00
Jake Stanger	bd5bdf5af5	fix: logging for creating bar incorrect	2022-10-15 15:36:23 +01:00
Jake Stanger	8536ad719a	fix(mpd): incorrectly checking for unix sockets	2022-10-15 00:17:40 +01:00
Jake Stanger	006c242f49	style: run fmt	2022-10-15 00:09:38 +01:00
Jake Stanger	2cd59ef5ff	build: fix compilation errors caused by package update	2022-10-15 00:07:10 +01:00
Jake Stanger	f411b7c451	chore: update lockfile	2022-10-14 23:53:13 +01:00
Jake Stanger	1dd0a9e52f	feat(launcher): add popup css selectors	2022-10-14 23:49:11 +01:00
Jake Stanger	5523e9af46	fix(popup): often opening in wrong place Fixes #16.	2022-10-14 23:48:28 +01:00
Jake Stanger	9e31107251	chore: update lockfile	2022-10-14 23:46:56 +01:00
Jake Stanger	668fe4a308	Merge pull request #24 from JakeStanger/feat/wayland-protocols Implement Wayland protocol support	2022-10-14 22:24:57 +01:00
Jake Stanger	994d0f580b	docs(readme): update references to sway	2022-10-14 22:14:04 +01:00
Jake Stanger	5ce50b0987	refactor: tidy and format	2022-10-10 21:59:44 +01:00
Jake Stanger	b1c66b9117	feat: wlroots-agnostic support for `launcher` module	2022-10-10 20:15:24 +01:00
Jake Stanger	bb4fe7f7f5	docs(readme): credit smithay client toolkit Could not have got the Wayland stuff working without.	2022-10-04 23:26:26 +01:00
Jake Stanger	324f00cdf9	feat: wlroots-agnostic support for `focused` module	2022-10-04 23:26:07 +01:00
Jake Stanger	b188bc7146	feat: initial support for running outside sway Progress is being tracked in #18. Currently the workspaces, focused and launcher modules are not supported.	2022-09-27 20:24:16 +01:00
Jake Stanger	d22d954e83	ci: alter changelog categories	2022-09-25 22:50:17 +01:00
Jake Stanger	45e44d7913	chore(intellij): update run configs	2022-09-25 22:50:05 +01:00
Jake Stanger	b352181b3d	docs: update json example	2022-09-25 22:49:54 +01:00
Jake Stanger	720ba7bfb0	Major module refactor (#19 ) * refactor: major module restructuring Modules now implement a "controller", which allows for separation of logic from UI code and enforces a tighter structure around how modules should be written. The introduction of this change required major refactoring or even rewriting of all modules. This also better integrates the popup into modules, making it easier for data to be passed around without fetching the same thing twice The refactor also improves some client code, switching from `ksway` to the much more stable `swayipc-async`. Partial multi-monitor for the tray module has been added. BREAKING CHANGE: The `mpd` module config has changed, moving the icons to their own object.	2022-09-25 22:49:00 +01:00
JakeStanger	daafa0943e	docs: update CHANGELOG.md for v0.5.2 [skip ci]	2022-09-07 21:49:04 +00:00